`, where Drop-in will be included on your page or the selector for the empty element. e.g. `#dropin-container`.\n * @param {string} options.selector Deprecated: Now an alias for `options.container`.\n * @param {string} [options.locale=`en_US`] Use this option to change the language, links, and terminology used throughout Drop-in. Supported locales include:\n * `ar_EG`,\n * `cs_CZ`,\n * `da_DK`,\n * `de_DE`,\n * `el_GR`,\n * `en_AU`,\n * `en_GB`,\n * `en_IN`,\n * `en_US`,\n * `es_ES`,\n * `es_XC`,\n * `fi_FI`,\n * `fr_CA`,\n * `fr_FR`,\n * `fr_XC`,\n * `he_IL`,\n * `hu_HU`,\n * `id_ID`,\n * `it_IT`,\n * `ja_JP`,\n * `ko_KR`,\n * `nl_NL`,\n * `no_NO`,\n * `pl_PL`,\n * `pt_BR`,\n * `pt_PT`,\n * `ru_RU`,\n * `sk_SK`,\n * `sv_SE`,\n * `th_TH`,\n * `zh_CN`,\n * `zh_HK`,\n * `zh_TW`,\n * `zh_XC`.\n *\n * @param {object} [options.translations] To use your own translations, pass an object with the strings you wish to replace. This object must use the same structure as the object used internally for supported translations, which can be found [here](https://github.com/braintree/braintree-web-drop-in/blob/main/src/translations/en_US.js). Any strings that are not included will be those from the provided `locale` or `en_US` if no `locale` is provided. See below for an example of creating Drop-in with custom translations.\n * @param {array} [options.paymentOptionPriority] Use this option to indicate the order in which enabled payment options should appear when multiple payment options are enabled. By default, payment options will appear in this order: `['card', 'paypal', 'paypalCredit', 'venmo', 'applePay', 'googlePay']`. Payment options omitted from this array will not be offered to the customer.\n *\n * @param {(boolean|object)} [options.card] The configuration options for cards. See [`cardCreateOptions`](#~cardCreateOptions) for all `card` options. If this option is omitted, cards will still appear as a payment option. To remove cards, pass `false` for the value.\n * @param {object} [options.paypal] The configuration options for PayPal. To include a PayPal option in your Drop-in integration, include the `paypal` parameter and [enable PayPal in the Braintree Control Panel](https://developers.braintreepayments.com/guides/paypal/testing-go-live/#go-live). To test in Sandbox, you will need to [link a PayPal sandbox test account to your Braintree sandbox account](https://developers.braintreepayments.com/guides/paypal/testing-go-live/#linked-paypal-testing).\n *\n * Some of the PayPal configuration options are listed [here](#~paypalCreateOptions), but for a full list see the [PayPal Checkout client reference options](http://braintree.github.io/braintree-web/3.78.2/PayPalCheckout.html#createPayment).\n *\n * PayPal is not [supported in Internet Explorer versions lower than 11](https://developer.paypal.com/docs/checkout/reference/faq/#which-browsers-does-paypal-checkout-support).\n *\n * @param {object} [options.paypalCredit] The configuration options for PayPal Credit. To include a PayPal Credit option in your Drop-in integration, include the `paypalCredit` parameter and [enable PayPal in the Braintree Control Panel](https://developers.braintreepayments.com/guides/paypal/testing-go-live/#go-live).\n *\n * Some of the PayPal Credit configuration options are listed [here](#~paypalCreateOptions), but for a full list see the [PayPal Checkout client reference options](http://braintree.github.io/braintree-web/3.78.2/PayPalCheckout.html#createPayment). For more information on PayPal Credit, see the [Braintree Developer Docs](https://developers.braintreepayments.com/guides/paypal/paypal-credit/javascript/v3).\n *\n * PayPal Credit is not [supported in Internet Explorer versions lower than 11](https://developer.paypal.com/docs/checkout/reference/faq/#which-browsers-does-paypal-checkout-support).\n *\n * @param {(object|boolean)} [options.venmo] The configuration options for Pay with Venmo. To include a Venmo option in your Drop-in integration, include the `venmo` parameter and [follow the documentation for setting up Venmo in the Braintree control panel](https://articles.braintreepayments.com/guides/payment-methods/venmo#setup). If a user's browser does not support Venmo, the Venmo option will not be rendered.\n *\n * See [`venmoCreateOptions`](#~venmoCreateOptions) for `venmo` options.\n *\n * @param {object} [options.applePay] The configuration options for Apple Pay. To include an Apple Pay option in your Drop-in integration, include the `applePay` parameter and [enable Apple Pay in the Braintree Control Panel](https://developers.braintreepayments.com/guides/apple-pay/configuration/javascript/v3). If a user's browser does not support Apple Pay, the Apple Pay option will not be rendered. See [Apple's documentation](https://support.apple.com/en-us/HT201469) for browser and device support.\n *\n * See [`applePayCreateOptions`](#~applePayCreateOptions) for `applePay` options.\n *\n * @param {object} [options.googlePay] The configuration options for Google Pay. To include a Google Pay option in your Drop-in integration, include the `googlePay` parameter and [enable Google Pay in the Braintree Control Panel](https://developers.braintreepayments.com/guides/google-pay/configuration/javascript/v3). If a user's browser does not support Google Pay, the Google Pay option will not be rendered. See [Google's documentation](https://developers.google.com/pay/api/web/test-and-deploy) for browser and device support.\n *\n * See [`googlePayCreateOptions`](#~googlePayCreateOptions) for `googlePay` options.\n *\n * @param {object|boolean} [options.dataCollector] If `true` is passed, Drop-in will be configured to collect data for use with Advanced Fraud Protection. If collecting data via Kount, pass a [`dataCollectorOptions` object](#~dataCollectorOptions) with `kount: true` instead. If Data Collector is configured and fails to load, Drop-in creation will fail.\n *\n * @param {(boolean|object)} [options.threeDSecure] When `true` is passed, the 3D Secure module will be created with a default configuration. See [`threeDSecureOptions`](#~threeDSecureOptions) for additional create options. If 3D Secure is configured and fails to load, Drop-in creation will fail.\n *\n * @param {boolean} [options.vaultManager=false] Whether or not to allow a customer to delete saved payment methods when used with a [client token with a customer id](https://developers.braintreepayments.com/reference/request/client-token/generate/#customer_id). *Note:* Deleting a payment method from Drop-in will permanently delete the payment method, so this option is not recommended for merchants using Braintree's recurring billing system. This feature is not supported in Internet Explorer 9.\n *\n * @param {boolean} [options.preselectVaultedPaymentMethod=true] Whether or not to initialize Drop-in with a vaulted payment method pre-selected. Only applicable when using a [client token with a customer id](https://developers.braintreepayments.com/reference/request/client-token/generate/#customer_id) and a customer with saved payment methods.\n *\n * @param {boolean} [options.showDefaultPaymentMethodFirst=true] When `true` or left out, the customer's default payment method will be displayed first in the list of vaulted payment methods. When `false`, the Braintree API will determine which payment method to display first, typically the latest payment method added to the customer. Only applicable when using a [client token with a customer id](https://developers.braintreepayments.com/reference/request/client-token/generate/#customer_id) and a customer with saved payment methods.\n *\n * @param {function} [callback] The second argument, `data`, is the {@link Dropin} instance. Returns a promise if no callback is provided.\n * @returns {(void|Promise)} Returns a promise if no callback is provided.\n * @example\n *
A full example of accepting credit cards with callback API\n * \n * \n * \n *
\n *
Checkout\n * \n * \n *
\n *
\n *\n * \n *\n * \n * \n * \n * @example\n *
A full example of accepting credit cards with promise API\n * \n * \n * \n *
\n *
Checkout\n * \n * \n *
\n *
\n *\n * \n *\n * \n * \n * \n * @example\n *
Setting up a Drop-in instance to accept credit cards, PayPal, PayPal Credit, Venmo, and Apple Pay\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * applePay: {\n * displayName: 'Merchant Name',\n * paymentRequest: {\n * label: 'Localized Name',\n * total: '10.00'\n * }\n * },\n * paypal: {\n * flow: 'checkout',\n * amount: '10.00',\n * currency: 'USD'\n * },\n * paypalCredit: {\n * flow: 'checkout',\n * amount: '10.00',\n * currency: 'USD'\n * },\n * venmo: true\n * }, function (err, dropinInstance) {\n * // Set up a handler to request a payment method and\n * // submit the payment method nonce to your server\n * });\n * @example\n *
Setting up a Drop-in instance to accept Venmo with restricted browser support\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * venmo: {\n * allowNewBrowserTab: false\n * }\n * }, function (err, dropinInstance) {\n * // Set up a handler to request a payment method and\n * // submit the payment method nonce to your server\n * });\n *\n * @example\n *
Submitting the payment method nonce to the server using a form\n * \n * \n * \n *
\n *
Checkout\n * \n * \n *
\n *\n * \n *\n * \n * \n * \n *\n * @example\n *
Use your own translations\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * translations: {\n * payingWith: 'You are paying with {{paymentSource}}',\n * chooseAnotherWayToPay: 'My custom chooseAnotherWayToPay string',\n * // Any other custom translation strings\n * }\n * }, callback);\n *\n * @example\n *
Customizing Drop-in with card form overrides\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * card: {\n * overrides: {\n * fields: {\n * number: {\n * placeholder: '1111 1111 1111 1111' // Update the number field placeholder\n * },\n * postalCode: {\n * minlength: 5 // Set the minimum length of the postal code field\n * },\n * cvv: null // Remove the CVV field from your form\n * },\n * styles: {\n * input: {\n * 'font-size': '18px' // Change the font size for all inputs\n * },\n * ':focus': {\n * color: 'red' // Change the focus color to red for all inputs\n * }\n * }\n * }\n * }\n * }, callback);\n *\n * @example\n *
Mask Card Inputs\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * card: {\n * overrides: {\n * fields: {\n * number: {\n * maskInput: {\n * showLastFour: true\n * }\n * },\n * cvv: {\n * maskInput: true\n * }\n * }\n * }\n * }\n * }, callback);\n *\n * @example\n *
Including a cardholder name field\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * card: {\n * cardholderName: true\n * }\n * }, callback);\n *\n * @example\n *
Including a required cardholder name field\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * card: {\n * cardholderName: {\n * required: true\n * }\n * }\n * }, callback);\n *\n * @example\n *
Enabling 3D Secure\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * threeDSecure: true\n * }, function (err, dropinInstance) {\n * // setup payment button\n * btn.addEventListener('click', function (e) {\n * e.preventDefault();\n *\n * dropinInstance.requestPaymentMethod(|\n * threeDSecure: {\n * amount: '100.00',\n * billingAddress: {\n * givenName: 'Jill', // ASCII-printable characters required, else will throw a validation error\n * surname: 'Doe', // ASCII-printable characters required, else will throw a validation error\n * phoneNumber: '8101234567',\n * streetAddress: '555 Smith St.',\n * extendedAddress: '#5',\n * locality: 'Oakland',\n * region: 'CA',\n * postalCode: '12345',\n * countryCodeAlpha2: 'US'\n * },\n * // additional 3ds params\n * }\n * }, function (err, payload) {\n * // inspect payload.liablityShifted\n * // send payload.nonce to server\n * });\n * });\n * });\n *\n * @example\n *
Enabled Vault Manager\n * braintree.dropin.create({\n * authorization: 'CLIENT_AUTHORIZATION',\n * container: '#dropin-container',\n * vaultManager: true\n * }, callback);\n */\n\nfunction create(options) {\n if (!options.authorization) {\n return Promise.reject(new DropinError('options.authorization is required.'));\n }\n\n return client.create({\n authorization: options.authorization\n }).catch(function (err) {\n return Promise.reject(new DropinError({\n message: 'There was an error creating Drop-in.',\n braintreeWebError: err\n }));\n }).then(function (clientInstance) {\n clientInstance = setAnalyticsIntegration(clientInstance);\n\n if (clientInstance.getConfiguration().authorizationType === 'TOKENIZATION_KEY') {\n analytics.sendEvent(clientInstance, 'started.tokenization-key');\n } else {\n analytics.sendEvent(clientInstance, 'started.client-token');\n }\n\n return new Promise(function (resolve, reject) {\n new Dropin({\n merchantConfiguration: options,\n client: clientInstance\n })._initialize(function (err, instance) {\n if (err) {\n reject(err);\n\n return;\n }\n\n resolve(instance);\n });\n });\n });\n}\n\nfunction setAnalyticsIntegration(clientInstance) {\n var configuration = clientInstance.getConfiguration();\n\n configuration.analyticsMetadata.integration = constants.INTEGRATION;\n configuration.analyticsMetadata.integrationType = constants.INTEGRATION;\n configuration.analyticsMetadata.dropinVersion = VERSION;\n\n clientInstance.getConfiguration = function () {\n return configuration;\n };\n\n return clientInstance;\n}\n\n// we check for document's existence to support server side rendering\ncreateFromScriptTag(create, typeof document !== 'undefined' && document.querySelector('script[data-braintree-dropin-authorization]'));\n\nmodule.exports = {\n create: wrapPromise(create),\n /**\n * @description The current version of Drop-in, i.e. `1.30.1`.\n * @type {string}\n */\n VERSION: VERSION\n};\n\n},{\"./constants\":191,\"./dropin\":193,\"./lib/analytics\":196,\"./lib/create-from-script-tag\":199,\"./lib/dropin-error\":201,\"./lib/promise\":208,\"@braintree/wrap-promise\":50,\"braintree-web/client\":59}],195:[function(require,module,exports){\n'use strict';\n\nfunction addSelectionEventHandler(element, func) {\n element.addEventListener('click', func);\n element.addEventListener('keyup', function (event) {\n if (event.keyCode === 13) {\n func();\n }\n });\n}\n\nmodule.exports = addSelectionEventHandler;\n\n},{}],196:[function(require,module,exports){\n'use strict';\n\nvar atob = require('./polyfill').atob;\nvar constants = require('../constants');\nvar braintreeClientVersion = require('braintree-web/client').VERSION;\n\nfunction _millisToSeconds(millis) {\n return Math.floor(millis / 1000);\n}\n\nfunction sendAnalyticsEvent(client, kind, callback) {\n var configuration = client.getConfiguration();\n var analyticsRequest = client._request;\n var timestamp = _millisToSeconds(Date.now());\n var url = configuration.gatewayConfiguration.analytics.url;\n var data = {\n analytics: [{\n kind: constants.ANALYTICS_PREFIX + kind,\n timestamp: timestamp\n }],\n _meta: configuration.analyticsMetadata,\n braintreeLibraryVersion: braintreeClientVersion\n };\n\n if (configuration.authorizationType === 'TOKENIZATION_KEY') {\n data.tokenizationKey = configuration.authorization;\n } else {\n data.authorizationFingerprint = JSON.parse(atob(configuration.authorization)).authorizationFingerprint;\n }\n\n analyticsRequest({\n url: url,\n method: 'post',\n data: data,\n timeout: constants.ANALYTICS_REQUEST_TIMEOUT_MS\n }, callback);\n}\n\nmodule.exports = {\n sendEvent: sendAnalyticsEvent\n};\n\n},{\"../constants\":191,\"./polyfill\":207,\"braintree-web/client\":59}],197:[function(require,module,exports){\narguments[4][95][0].apply(exports,arguments)\n},{\"dup\":95}],198:[function(require,module,exports){\n'use strict';\n\nvar isIe9 = require('@braintree/browser-detection/is-ie9');\nvar isIe10 = require('@braintree/browser-detection/is-ie10');\n\nmodule.exports = {\n isIe9: isIe9,\n isIe10: isIe10\n};\n\n},{\"@braintree/browser-detection/is-ie10\":32,\"@braintree/browser-detection/is-ie9\":33}],199:[function(require,module,exports){\n'use strict';\n\nvar analytics = require('./analytics');\nvar find = require('./find-parent-form');\nvar uuid = require('@braintree/uuid');\nvar DropinError = require('./dropin-error');\nvar kebabCaseToCamelCase = require('./kebab-case-to-camel-case');\nvar WHITELISTED_DATA_ATTRIBUTES = [\n 'locale',\n 'payment-option-priority',\n\n 'data-collector.kount',\n 'data-collector.paypal',\n\n // camelcase version was accidentally used initially.\n // we add the kebab case version to match the docs, but\n // we retain the camelcase version for backwards compatibility\n 'card.cardholderName',\n 'card.cardholderName.required',\n 'card.cardholder-name',\n 'card.cardholder-name.required',\n\n 'paypal.amount',\n 'paypal.currency',\n 'paypal.flow',\n 'paypal.landing-page-type',\n\n 'paypal-credit.amount',\n 'paypal-credit.currency',\n 'paypal-credit.flow',\n 'paypal-credit.landing-page-type'\n];\n\nfunction injectHiddenInput(name, value, form) {\n var input = form.querySelector('[name=\"' + name + '\"]');\n\n if (!input) {\n input = document.createElement('input');\n input.type = 'hidden';\n input.name = name;\n form.appendChild(input);\n }\n\n input.value = value;\n}\n\nfunction addCompositeKeyValuePairToObject(obj, key, value) {\n var decomposedKeys = key.split('.');\n var topLevelKey = kebabCaseToCamelCase(decomposedKeys[0]);\n\n if (decomposedKeys.length === 1) {\n obj[topLevelKey] = deserialize(value);\n } else {\n obj[topLevelKey] = obj[topLevelKey] || {};\n addCompositeKeyValuePairToObject(obj[topLevelKey], decomposedKeys.slice(1).join('.'), value);\n }\n}\n\nfunction deserialize(value) {\n try {\n return JSON.parse(value);\n } catch (e) {\n return value;\n }\n}\n\nfunction createFromScriptTag(createFunction, scriptTag) {\n var authorization, container, createOptions, form;\n\n if (!scriptTag) {\n return;\n }\n\n authorization = scriptTag.getAttribute('data-braintree-dropin-authorization');\n\n if (!authorization) {\n throw new DropinError('Authorization not found in data-braintree-dropin-authorization attribute');\n }\n\n container = document.createElement('div');\n container.id = 'braintree-dropin-' + uuid();\n\n form = find.findParentForm(scriptTag);\n\n if (!form) {\n throw new DropinError('No form found for script tag integration.');\n }\n\n form.addEventListener('submit', function (event) {\n event.preventDefault();\n });\n\n scriptTag.parentNode.insertBefore(container, scriptTag);\n\n createOptions = {\n authorization: authorization,\n container: container\n };\n\n WHITELISTED_DATA_ATTRIBUTES.forEach(function (compositeKey) {\n var value = scriptTag.getAttribute('data-' + compositeKey);\n\n if (value == null) {\n return;\n }\n\n addCompositeKeyValuePairToObject(createOptions, compositeKey, value);\n });\n\n createFunction(createOptions).then(function (instance) {\n analytics.sendEvent(instance._client, 'integration-type.script-tag');\n form.addEventListener('submit', function () {\n instance.requestPaymentMethod(function (requestPaymentError, payload) {\n if (requestPaymentError) {\n return;\n }\n\n injectHiddenInput('payment_method_nonce', payload.nonce, form);\n\n if (payload.deviceData) {\n injectHiddenInput('device_data', payload.deviceData, form);\n }\n\n form.submit();\n });\n });\n });\n}\n\nmodule.exports = createFromScriptTag;\n\n},{\"./analytics\":196,\"./dropin-error\":201,\"./find-parent-form\":202,\"./kebab-case-to-camel-case\":206,\"@braintree/uuid\":46}],200:[function(require,module,exports){\n(function (global){(function (){\n'use strict';\n\nvar constants = require('../constants');\nvar analytics = require('./analytics');\nvar assets = require('@braintree/asset-loader');\nvar Promise = require('./promise');\n\nfunction DataCollector(config) {\n this._config = config;\n}\n\nDataCollector.prototype.initialize = function () {\n var self = this;\n\n return Promise.resolve().then(function () {\n var braintreeWebVersion;\n\n if (global.braintree && global.braintree.dataCollector) {\n return Promise.resolve();\n }\n\n braintreeWebVersion = self._config.client.getVersion();\n\n return assets.loadScript({\n src: 'https://js.braintreegateway.com/web/' + braintreeWebVersion + '/js/data-collector.min.js',\n id: constants.DATA_COLLECTOR_SCRIPT_ID\n });\n }).then(function () {\n return global.braintree.dataCollector.create(self._config);\n }).then(function (instance) {\n self._instance = instance;\n }).catch(function (err) {\n analytics.sendEvent(self._config.client, 'data-collector.setup-failed');\n // log the Data Collector setup error\n // but do not prevent Drop-in from loading\n self.log(err);\n });\n};\n\nDataCollector.prototype.log = function (message) {\n console.log(message); // eslint-disable-line no-console\n};\n\nDataCollector.prototype.getDeviceData = function () {\n if (!this._instance) {\n return '';\n }\n\n return this._instance.deviceData;\n};\n\nDataCollector.prototype.teardown = function () {\n if (!this._instance) {\n return Promise.resolve();\n }\n\n return this._instance.teardown();\n};\n\nmodule.exports = DataCollector;\n\n}).call(this)}).call(this,typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : {})\n},{\"../constants\":191,\"./analytics\":196,\"./promise\":208,\"@braintree/asset-loader\":1}],201:[function(require,module,exports){\n'use strict';\n\nfunction isBraintreeWebError(err) {\n return err.name === 'BraintreeError';\n}\n\nfunction DropinError(err) {\n this.name = 'DropinError';\n\n if (typeof err === 'string') {\n this.message = err;\n } else {\n this.message = err.message;\n }\n\n if (isBraintreeWebError(err)) {\n this._braintreeWebError = err;\n } else {\n this._braintreeWebError = err.braintreeWebError;\n }\n}\n\nDropinError.prototype = Object.create(Error.prototype);\nDropinError.prototype.constructor = DropinError;\n\nmodule.exports = DropinError;\n\n},{}],202:[function(require,module,exports){\n'use strict';\n\nfunction findParentForm(element) {\n var parentNode = element.parentNode;\n\n if (!parentNode || parentNode.nodeName === 'FORM') {\n return parentNode;\n }\n\n return findParentForm(parentNode);\n}\n\nmodule.exports = {\n findParentForm: findParentForm\n};\n\n},{}],203:[function(require,module,exports){\n'use strict';\n\nvar atob = require('./polyfill').atob;\n\nmodule.exports = function (client) {\n var authorizationFingerprint;\n var configuration = client.getConfiguration();\n\n if (configuration.authorizationType !== 'TOKENIZATION_KEY') {\n authorizationFingerprint = JSON.parse(atob(configuration.authorization)).authorizationFingerprint;\n\n return !authorizationFingerprint || authorizationFingerprint.indexOf('customer_id=') === -1;\n }\n\n return true;\n};\n\n},{\"./polyfill\":207}],204:[function(require,module,exports){\n(function (global){(function (){\n'use strict';\n\nfunction isHTTPS() {\n return global.location.protocol === 'https:';\n}\n\nmodule.exports = {\n isHTTPS: isHTTPS\n};\n\n}).call(this)}).call(this,typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : {})\n},{}],205:[function(require,module,exports){\n(function (global){(function (){\n'use strict';\n\nmodule.exports = function (win) {\n win = win || global;\n\n return Boolean(win.document.characterSet && win.document.characterSet.toLowerCase() === 'utf-8');\n};\n\n}).call(this)}).call(this,typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : {})\n},{}],206:[function(require,module,exports){\n'use strict';\n\nfunction kebabCaseToCamelCase(kebab) {\n var parts = kebab.split('-');\n var first = parts.shift();\n var capitalizedParts = parts.map(function (part) {\n return part.charAt(0).toUpperCase() + part.substring(1);\n });\n\n return [first].concat(capitalizedParts).join('');\n}\n\nmodule.exports = kebabCaseToCamelCase;\n\n},{}],207:[function(require,module,exports){\n(function (global){(function (){\n'use strict';\n/* eslint-disable no-mixed-operators */\n\nvar atobNormalized = typeof global.atob === 'function' ? global.atob : atob;\n\nfunction atob(base64String) {\n var a, b, c, b1, b2, b3, b4, i;\n var base64Matcher = new RegExp('^(?:[A-Za-z0-9+/]{4})*(?:[A-Za-z0-9+/]{2}==|[A-Za-z0-9+/]{3}=|[A-Za-z0-9+/]{4})([=]{1,2})?$');\n var characters = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n var result = '';\n\n if (!base64Matcher.test(base64String)) {\n throw new Error('Non base64 encoded input passed to window.atob polyfill');\n }\n\n i = 0;\n do {\n b1 = characters.indexOf(base64String.charAt(i++));\n b2 = characters.indexOf(base64String.charAt(i++));\n b3 = characters.indexOf(base64String.charAt(i++));\n b4 = characters.indexOf(base64String.charAt(i++));\n\n a = (b1 & 0x3F) << 2 | b2 >> 4 & 0x3;\n b = (b2 & 0xF) << 4 | b3 >> 2 & 0xF;\n c = (b3 & 0x3) << 6 | b4 & 0x3F;\n\n result += String.fromCharCode(a) + (b ? String.fromCharCode(b) : '') + (c ? String.fromCharCode(c) : '');\n } while (i < base64String.length);\n\n return result;\n}\n\nmodule.exports = {\n atob: function (base64String) {\n return atobNormalized.call(global, base64String);\n },\n _atob: atob\n};\n\n}).call(this)}).call(this,typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : {})\n},{}],208:[function(require,module,exports){\n(function (global){(function (){\n'use strict';\n\nvar Promise = global.Promise || require('promise-polyfill');\n\nmodule.exports = Promise;\n\n}).call(this)}).call(this,typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : {})\n},{\"promise-polyfill\":186}],209:[function(require,module,exports){\n'use strict';\n\nmodule.exports = function (string) {\n if (typeof string !== 'string') {\n return '';\n }\n\n return string\n .replace(//g, '>');\n};\n\n},{}],210:[function(require,module,exports){\n'use strict';\n\nmodule.exports = function () {\n var el = document.createElement('div');\n var prop = 'flex-basis: 1px';\n var prefixes = [\n '-webkit-',\n '-moz-',\n '-ms-',\n '-o-',\n ''\n ];\n\n prefixes.forEach(function (prefix) {\n el.style.cssText += prefix + prop;\n });\n\n return Boolean(el.style.length);\n};\n\n},{}],211:[function(require,module,exports){\n'use strict';\n\nvar assign = require('./assign').assign;\nvar threeDSecure = require('braintree-web/three-d-secure');\n\nvar DEFAULT_ACS_WINDOW_SIZE = '03';\nvar PASSTHROUGH_EVENTS = [\n 'customer-canceled',\n 'authentication-modal-render',\n 'authentication-modal-close'\n];\n\nfunction ThreeDSecure(client, model) {\n this._client = client;\n this._model = model;\n this._config = assign({}, model.merchantConfiguration.threeDSecure);\n}\n\nThreeDSecure.prototype.initialize = function () {\n var self = this;\n var options = {\n client: this._client,\n version: 2\n };\n\n if (this._config.cardinalSDKConfig) {\n options.cardinalSDKConfig = this._config.cardinalSDKConfig;\n }\n\n return threeDSecure.create(options).then(function (instance) {\n self._instance = instance;\n\n PASSTHROUGH_EVENTS.forEach(function (eventName) {\n self._instance.on(eventName, function (event) {\n self._model._emit('3ds:' + eventName, event);\n });\n });\n });\n};\n\nThreeDSecure.prototype.verify = function (payload, merchantProvidedData) {\n var verifyOptions = assign({\n amount: this._config.amount\n }, merchantProvidedData, {\n nonce: payload.nonce,\n bin: payload.details.bin,\n // TODO in the future, we will allow\n // merchants to pass in a custom\n // onLookupComplete hook\n onLookupComplete: function (data, next) {\n next();\n }\n });\n\n verifyOptions.additionalInformation = verifyOptions.additionalInformation || {};\n verifyOptions.additionalInformation.acsWindowSize = verifyOptions.additionalInformation.acsWindowSize || DEFAULT_ACS_WINDOW_SIZE;\n\n return this._instance.verifyCard(verifyOptions);\n};\n\nThreeDSecure.prototype.updateConfiguration = function (key, value) {\n this._config[key] = value;\n};\n\nThreeDSecure.prototype.teardown = function () {\n return this._instance.teardown();\n};\n\nmodule.exports = ThreeDSecure;\n\n},{\"./assign\":197,\"braintree-web/three-d-secure\":147}],212:[function(require,module,exports){\n'use strict';\n\nvar browserDetection = require('./browser-detection');\n\nfunction isHidden(element) {\n if (!element) { // no parentNode, so nothing containing the element is hidden\n return false;\n }\n\n if (element.style.display === 'none') {\n return true;\n }\n\n return isHidden(element.parentNode);\n}\n\nfunction onTransitionEnd(element, propertyName, callback) {\n if (browserDetection.isIe9() || isHidden(element)) {\n callback();\n\n return;\n }\n\n function transitionEventListener(event) {\n if (event.propertyName === propertyName) {\n element.removeEventListener('transitionend', transitionEventListener);\n callback();\n }\n }\n\n element.addEventListener('transitionend', transitionEventListener);\n}\n\nmodule.exports = {\n onTransitionEnd: onTransitionEnd\n};\n\n},{\"./browser-detection\":198}],213:[function(require,module,exports){\n'use strict';\n\nvar Promise = require('./promise');\n\nfunction delay(time) {\n time = time || 0;\n\n return new Promise(function (resolve) {\n window.setTimeout(resolve, time);\n });\n}\n\nmodule.exports = {\n delay: delay\n};\n\n},{\"./promise\":208}],214:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"الدفع باستخدام {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"اختر طريقة دفع أخرى\",\n \"chooseAWayToPay\": \"اختر طريقة الدفع\",\n \"otherWaysToPay\": \"طرق أخرى للدفع\",\n \"edit\": \"تحرير\",\n \"doneEditing\": \"تم\",\n \"editPaymentMethods\": \"تحرير طرق الدفع\",\n \"CreditCardDeleteConfirmationMessage\": \"هل تريد حذف البطاقة ({{secondaryIdentifier}}) التي تنتهي بالرقم {{identifier}}؟\",\n \"PayPalAccountDeleteConfirmationMessage\": \"هل تريد حذف حساب {{identifier}} على PayPal؟\",\n \"VenmoAccountDeleteConfirmationMessage\": \"هل تريد فعلاً حذف حساب Venmo الذي يحمل اسم المستخدم {{identifier}}؟\",\n \"genericDeleteConfirmationMessage\": \"هل تريد فعلاً حذف طريقة الدفع هذه؟\",\n \"deleteCancelButton\": \"إلغاء\",\n \"deleteConfirmationButton\": \"حذف\",\n \"fieldEmptyForCvv\": \"يرجى إدخال رمز حماية البطاقة.\",\n \"fieldEmptyForExpirationDate\": \"يرجى إدخال تاريخ انتهاء الصلاحية.\",\n \"fieldEmptyForCardholderName\": \"يرجى إدخال اسم صاحب البطاقة.\",\n \"fieldTooLongForCardholderName\": \"يجب أن يقل اسم صاحب البطاقة عن 256 حرفاً.\",\n \"fieldEmptyForNumber\": \"يرجى إدخال رقم.\",\n \"fieldEmptyForPostalCode\": \"يرجى إدخال الرمز البريدي.\",\n \"fieldInvalidForCardholderName\": \"اسم حامل البطاقة غير صحيح.\",\n \"fieldInvalidForCvv\": \"رمز الحماية هذا غير صحيح.\",\n \"fieldInvalidForExpirationDate\": \"تاريخ انتهاء الصلاحية هذا غير صحيح.\",\n \"fieldInvalidForNumber\": \"رقم هذه البطاقة غير صحيح.\",\n \"fieldInvalidForPostalCode\": \"الرمز البريدي هذا غير صحيح.\",\n \"genericError\": \"وقع خطأ ما من جانبنا.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"هذه البطاقة الائتمانية موجودة حالياً كطريقة دفع محفوظة.\",\n \"hostedFieldsFailedTokenizationError\": \"يرجى مراجعة بياناتك وإعادة المحاولة.\",\n \"hostedFieldsFieldsInvalidError\": \"يرجى مراجعة بياناتك وإعادة المحاولة.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"خطأ في الشبكة. يرجى إعادة المحاولة.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"فشلت مصادقة بطاقة الائتمان. يرجى مراجعة بياناتك وإعادة المحاولة.\",\n \"paypalButtonMustBeUsed\": \"استخدم زر PayPal لاستئناف الدفع.\",\n \"paypalAccountTokenizationFailedError\": \"وقع خطأ أثناء إضافة حساب PayPal. يرجى إعادة المحاولة.\",\n \"paypalFlowFailedError\": \"وقع خطأ أثناء الاتصال بـ PayPal. يرجى إعادة المحاولة.\",\n \"paypalTokenizationRequestActiveError\": \"تفويض الدفع عبر PayPal قيد التنفيذ.\",\n \"venmoCanceledError\": \"وقع خطأ ما. تأكد أن أحدث إصدار من تطبيق Venmo مثبت في جهازك وأن متصفحك يدعم التبديل إلى Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"فشل حذف طريقة الدفع. أعد المحاولة.\",\n \"venmoAppFailedError\": \"تطبيق Venmo غير موجود في جهازك.\",\n \"unsupportedCardTypeError\": \"نوع هذه البطاقة غير مدعوم. يرجى استخدام بطاقة أخرى.\",\n \"applePayTokenizationError\": \"وقع خطأ في الشبكة أثناء معالجة الدفع عبر Apple Pay. يرجى إعادة المحاولة.\",\n \"applePayActiveCardError\": \"إضافة بطاقة مدعومة إلى محفظة Apple Pay.\",\n \"cardholderNameLabel\": \"اسم صاحب البطاقة\",\n \"cardNumberLabel\": \"رقم البطاقة\",\n \"cvvLabel\": \"رمز حماية البطاقة\",\n \"cvvThreeDigitLabelSubheading\": \"(3 أرقام)\",\n \"cvvFourDigitLabelSubheading\": \"(4 أرقام)\",\n \"cardholderNamePlaceholder\": \"اسم صاحب البطاقة\",\n \"expirationDateLabel\": \"تاريخ انتهاء الصلاحية\",\n \"expirationDateLabelSubheading\": \"(MM/YY)\",\n \"expirationDatePlaceholder\": \"MM/YY\",\n \"postalCodeLabel\": \"الرمز البريدي\",\n \"saveCardLabel\": \"حفظ البطاقة\",\n \"payWithCard\": \"الدفع باستخدام بطاقة\",\n \"endingIn\": \"التي تنتهي بالرقم {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"بطاقة\",\n \"PayPal\": \"Paypal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],215:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Způsob platby: {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Vybrat jiný způsob platby\",\n \"chooseAWayToPay\": \"Vybrat způsob platby\",\n \"otherWaysToPay\": \"Jiné způsoby platby\",\n \"edit\": \"Upravit\",\n \"doneEditing\": \"Hotovo\",\n \"editPaymentMethods\": \"Upravit způsoby platby\",\n \"CreditCardDeleteConfirmationMessage\": \"Chcete kartu {{secondaryIdentifier}} s koncovým číslem {{identifier}} odstranit?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Chcete účet {{identifier}} ve službě PayPal odstranit?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Opravdu chcete účet Venmo s uživatelským jménem {{identifier}} odstranit?\",\n \"genericDeleteConfirmationMessage\": \"Opravdu chcete tento způsob platby odstranit?\",\n \"deleteCancelButton\": \"Zrušit\",\n \"deleteConfirmationButton\": \"Odstranit\",\n \"fieldEmptyForCvv\": \"Vyplňte kód CVV.\",\n \"fieldEmptyForExpirationDate\": \"Vyplňte datum vypršení platnosti.\",\n \"fieldEmptyForCardholderName\": \"Vyplňte jméno držitele karty.\",\n \"fieldTooLongForCardholderName\": \"Jméno držitele karty musí obsahovat méně než 256 znaků.\",\n \"fieldEmptyForNumber\": \"Vyplňte číslo.\",\n \"fieldEmptyForPostalCode\": \"Vyplňte PSČ.\",\n \"fieldInvalidForCardholderName\": \"Toto jméno držitele karty není platné.\",\n \"fieldInvalidForCvv\": \"Tento bezpečnostní kód není platný.\",\n \"fieldInvalidForExpirationDate\": \"Toto datum vypršení platnosti není platné.\",\n \"fieldInvalidForNumber\": \"Toto číslo karty není platné.\",\n \"fieldInvalidForPostalCode\": \"Toto PSČ není platné.\",\n \"genericError\": \"Došlo k chybě na naší straně.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Tato kreditní karta je již jako způsob platby uložena.\",\n \"hostedFieldsFailedTokenizationError\": \"Zkontrolujte zadané údaje a zkuste to znovu.\",\n \"hostedFieldsFieldsInvalidError\": \"Zkontrolujte zadané údaje a zkuste to znovu.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Došlo k chybě sítě. Zkuste to znovu.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Ověření kreditní karty se nezdařilo. Zkontrolujte zadané údaje a zkuste to znovu.\",\n \"paypalButtonMustBeUsed\": \"Chcete-li přejít k platbě, použijte tlačítko PayPal.\",\n \"paypalAccountTokenizationFailedError\": \"Při přidávání účtu PayPal došlo k chybě. Zkuste to znovu.\",\n \"paypalFlowFailedError\": \"Při připojování ke službě PayPal došlo k chybě. Zkuste to znovu.\",\n \"paypalTokenizationRequestActiveError\": \"Autorizace platby přes PayPal již probíhá.\",\n \"venmoCanceledError\": \"Došlo k chybě. Zkontrolujte, zda máte v zařízení nainstalovanou nejnovější verzi aplikace Venmo a zda prohlížeč přechod na aplikaci Venmo podporuje.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Způsob platby se nepodařilo odstranit. Zkuste to znovu.\",\n \"venmoAppFailedError\": \"Aplikaci Venmo se ve vašem zařízení nepodařilo najít.\",\n \"unsupportedCardTypeError\": \"Tento typ karty není podporován. Vyzkoušejte jinou kartu.\",\n \"applePayTokenizationError\": \"Při zpracování platby přes Apple Pay došlo k chybě sítě. Zkuste to znovu.\",\n \"applePayActiveCardError\": \"Přidejte si podporovanou kartu do peněženky Apple Pay.\",\n \"cardholderNameLabel\": \"Jméno držitele karty\",\n \"cardNumberLabel\": \"Číslo karty\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 číslice)\",\n \"cvvFourDigitLabelSubheading\": \"(4 číslice)\",\n \"cardholderNamePlaceholder\": \"Jméno držitele karty\",\n \"expirationDateLabel\": \"Datum vypršení platnosti\",\n \"expirationDateLabelSubheading\": \"(MM/RR)\",\n \"expirationDatePlaceholder\": \"MM/RR\",\n \"postalCodeLabel\": \"PSČ\",\n \"saveCardLabel\": \"Uložit kartu\",\n \"payWithCard\": \"Zaplatit kartou\",\n \"endingIn\": \"Koncové číslo: {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Karta\",\n \"PayPal\": \"Společnost PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],216:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Betaler med {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Vælg en anden betalingsmetode\",\n \"chooseAWayToPay\": \"Vælg, hvordan du vil betale\",\n \"otherWaysToPay\": \"Andre betalingsmetoder\",\n \"edit\": \"Rediger\",\n \"doneEditing\": \"Udført\",\n \"editPaymentMethods\": \"Rediger betalingsmetoder\",\n \"CreditCardDeleteConfirmationMessage\": \"Vil du slette {{secondaryIdentifier}}-kortet, der slutter på {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Vil du slette PayPal-kontoen {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Er du sikker på, at du vil slette Venmo-kontoen med brugernavnet {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Er du sikker på, at du vil slette denne betalingsmetode?\",\n \"deleteCancelButton\": \"Annuller\",\n \"deleteConfirmationButton\": \"Slet\",\n \"fieldEmptyForCvv\": \"Du skal angive kontrolcifrene.\",\n \"fieldEmptyForExpirationDate\": \"Du skal angive udløbsdatoen.\",\n \"fieldEmptyForCardholderName\": \"Du skal angive kortindehaverens navn.\",\n \"fieldTooLongForCardholderName\": \"Kortejerens navn skal være mindre end 256 tegn.\",\n \"fieldEmptyForNumber\": \"Du skal angive et nummer.\",\n \"fieldEmptyForPostalCode\": \"Du skal angive et postnummer.\",\n \"fieldInvalidForCardholderName\": \"Kortindehaverens navn er ugyldigt.\",\n \"fieldInvalidForCvv\": \"Sikkerhedskoden er ugyldig.\",\n \"fieldInvalidForExpirationDate\": \"Udløbsdatoen er ugyldig.\",\n \"fieldInvalidForNumber\": \"Kortnummeret er ugyldigt.\",\n \"fieldInvalidForPostalCode\": \"Postnummeret er ugyldigt.\",\n \"genericError\": \"Der opstod en fejl.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Dette betalingskort er allerede en gemt betalingsmetode.\",\n \"hostedFieldsFailedTokenizationError\": \"Tjek oplysningerne, og prøv igen.\",\n \"hostedFieldsFieldsInvalidError\": \"Tjek oplysningerne, og prøv igen.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Netværksfejl. Prøv igen.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Betalingskortet blev ikke bekræftet. Tjek oplysningerne, og prøv igen.\",\n \"paypalButtonMustBeUsed\": \"Brug PayPal-knappen for at fortsætte med din betaling.\",\n \"paypalAccountTokenizationFailedError\": \"PayPal-kontoen blev ikke tilføjet. Prøv igen.\",\n \"paypalFlowFailedError\": \"Der kunne ikke oprettes forbindelse til PayPal. Prøv igen.\",\n \"paypalTokenizationRequestActiveError\": \"PayPal-betalingen er i gang med at blive autoriseret.\",\n \"venmoCanceledError\": \"Der opstod en fejl. Sørg for, at du har den seneste version af Venmo-appen installeret på din enhed, og at din browser understøtter skift til Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Vi kunne ikke slette betalingsmetoden. Prøv igen.\",\n \"venmoAppFailedError\": \"Venmo-appen blev ikke fundet på din enhed.\",\n \"unsupportedCardTypeError\": \"Korttypen understøttes ikke. Prøv et andet kort.\",\n \"applePayTokenizationError\": \"Der opstod en netværksfejl under behandlingen af betalingen med Apple Pay. Prøv igen.\",\n \"applePayActiveCardError\": \"Knyt et understøttet kort til din Apple Pay-e-pung.\",\n \"cardholderNameLabel\": \"Kortindehaverens navn\",\n \"cardNumberLabel\": \"Kortnummer\",\n \"cvvLabel\": \"Kontrolcifre\",\n \"cvvThreeDigitLabelSubheading\": \"(3 cifre)\",\n \"cvvFourDigitLabelSubheading\": \"(4 cifre)\",\n \"cardholderNamePlaceholder\": \"Kortindehaverens navn\",\n \"expirationDateLabel\": \"Udløbsdato\",\n \"expirationDateLabelSubheading\": \"(MM/ÅÅ)\",\n \"expirationDatePlaceholder\": \"MM/ÅÅ\",\n \"postalCodeLabel\": \"Postnummer\",\n \"saveCardLabel\": \"Gem kort\",\n \"payWithCard\": \"Betal med kort\",\n \"endingIn\": \"Der slutter på {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Kort\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],217:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Zahlen mit {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Andere Zahlungsmethode wählen\",\n \"chooseAWayToPay\": \"Wie möchten Sie bezahlen?\",\n \"otherWaysToPay\": \"Andere Zahlungsmethoden\",\n \"edit\": \"Bearbeiten\",\n \"doneEditing\": \"Fertig\",\n \"editPaymentMethods\": \"Zahlungsquellen bearbeiten\",\n \"CreditCardDeleteConfirmationMessage\": \"{{secondaryIdentifier}} Karte mit den Endziffern {{identifier}} löschen?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"PayPal-Konto {{identifier}} löschen?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Wollen Sie das Venmo-Konto mit dem Benutzernamen {{identifier}} wirklich löschen?\",\n \"genericDeleteConfirmationMessage\": \"Wollen Sie diese Zahlungsquelle wirklich löschen?\",\n \"deleteCancelButton\": \"Abbrechen\",\n \"deleteConfirmationButton\": \"Löschen\",\n \"fieldEmptyForCvv\": \"Geben Sie die Kartenprüfnummer ein.\",\n \"fieldEmptyForExpirationDate\": \"Geben Sie das Ablaufdatum ein.\",\n \"fieldEmptyForCardholderName\": \"Geben Sie den Namen des Karteninhabers ein.\",\n \"fieldTooLongForCardholderName\": \"Der Name des Karteninhabers darf 255 Zeichen nicht übersteigen.\",\n \"fieldEmptyForNumber\": \"Geben Sie die Nummer ein.\",\n \"fieldEmptyForPostalCode\": \"Geben Sie die PLZ ein.\",\n \"fieldInvalidForCardholderName\": \"Der Name des Karteninhabers ist nicht gültig.\",\n \"fieldInvalidForCvv\": \"Die Kartenprüfnummer ist ungültig.\",\n \"fieldInvalidForExpirationDate\": \"Das Ablaufdatum ist ungültig.\",\n \"fieldInvalidForNumber\": \"Die Kreditkartennummer ist ungültig.\",\n \"fieldInvalidForPostalCode\": \"Die PLZ ist ungültig.\",\n \"genericError\": \"Bei uns ist ein Problem aufgetreten.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Diese Kreditkarte ist bereits als gespeicherte Zahlungsmethode vorhanden.\",\n \"hostedFieldsFailedTokenizationError\": \"Überprüfen Sie Ihre Eingabe und versuchen Sie es erneut.\",\n \"hostedFieldsFieldsInvalidError\": \"Überprüfen Sie Ihre Eingabe und versuchen Sie es erneut.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Netzwerkfehler. Versuchen Sie es erneut.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Überprüfung der Karte fehlgeschlagen. Überprüfen Sie Ihre Eingabe und versuchen Sie es erneut.\",\n \"paypalButtonMustBeUsed\": \"Verwenden Sie den PayPal-Button, um mit der Zahlung fortfahren.\",\n \"paypalAccountTokenizationFailedError\": \"Beim Hinzufügen des PayPal-Kontos ist ein Problem aufgetreten. Versuchen Sie es erneut.\",\n \"paypalFlowFailedError\": \"Beim Verbinden mit PayPal ist ein Problem aufgetreten. Versuchen Sie es erneut.\",\n \"paypalTokenizationRequestActiveError\": \"Die PayPal-Zahlung wird bereits autorisiert.\",\n \"venmoCanceledError\": \"Etwas ist schief gelaufen. Vergewissern Sie sich, dass Sie die neueste Version der Venmo-App auf Ihrem Gerät installiert haben und Ihr Browser den Wechsel zu Venmo unterstützt.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Die Zahlungsquelle konnte nicht gelöscht werden. Versuchen Sie es erneut.\",\n \"venmoAppFailedError\": \"Die Venmo-App wurde auf Ihrem Gerät nicht gefunden.\",\n \"unsupportedCardTypeError\": \"Dieser Kreditkartentyp wird nicht unterstützt. Versuchen Sie es mit einer anderen Karte.\",\n \"applePayTokenizationError\": \"Netzwerkfehler bei der Zahlungsabwicklung mit Apple Pay. Versuchen Sie es erneut.\",\n \"applePayActiveCardError\": \"Fügen Sie der Apple-Pay-Börse eine unterstützte Kreditkarte hinzu.\",\n \"cardholderNameLabel\": \"Name des Karteninhabers\",\n \"cardNumberLabel\": \"Kartennummer\",\n \"cvvLabel\": \"Prüfnr.\",\n \"cvvThreeDigitLabelSubheading\": \"(3-stellig)\",\n \"cvvFourDigitLabelSubheading\": \"(4-stellig)\",\n \"cardholderNamePlaceholder\": \"Name des Karteninhabers\",\n \"expirationDateLabel\": \"Gültig bis\",\n \"expirationDateLabelSubheading\": \"(MM/JJ)\",\n \"expirationDatePlaceholder\": \"MM/JJ\",\n \"postalCodeLabel\": \"PLZ\",\n \"saveCardLabel\": \"Karte speichern\",\n \"payWithCard\": \"Mit Kreditkarte zahlen\",\n \"endingIn\": \"Mit den Endziffern {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Kreditkarte\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],218:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Πληρωμή μέσω {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Επιλέξτε έναν άλλον τρόπο πληρωμής\",\n \"chooseAWayToPay\": \"Επιλογή τρόπου πληρωμής\",\n \"otherWaysToPay\": \"Άλλοι τρόποι πληρωμής\",\n \"edit\": \"Επεξεργασία\",\n \"doneEditing\": \"Τέλος\",\n \"editPaymentMethods\": \"Επεξεργασία μεθόδων πληρωμής\",\n \"CreditCardDeleteConfirmationMessage\": \"Διαγραφή κάρτας {{secondaryIdentifier}} που λήγει σε {{identifier}};\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Διαγραφή λογαριασμού PayPal {{identifier}};\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Θέλετε σίγουρα να διαγράψετε τον λογαριασμό Venmo με το όνομα χρήστη {{identifier}};\",\n \"genericDeleteConfirmationMessage\": \"Θέλετε σίγουρα να διαγράψετε αυτήν τη μέθοδο πληρωμής;\",\n \"deleteCancelButton\": \"Ακύρωση\",\n \"deleteConfirmationButton\": \"Διαγραφή\",\n \"fieldEmptyForCvv\": \"Συμπληρώστε έναν CVV.\",\n \"fieldEmptyForExpirationDate\": \"Συμπληρώστε ημερομηνία λήξης.\",\n \"fieldEmptyForCardholderName\": \"Συμπληρώστε το όνομα ενός κατόχου κάρτας.\",\n \"fieldTooLongForCardholderName\": \"Το όνομα του κατόχου της κάρτας πρέπει να περιέχει λιγότερους από 256 χαρακτήρες.\",\n \"fieldEmptyForNumber\": \"Συμπληρώστε έναν αριθμό.\",\n \"fieldEmptyForPostalCode\": \"Συμπληρώστε έναν ταχυδρομικό κώδικα.\",\n \"fieldInvalidForCardholderName\": \"Αυτό το όνομα κατόχου κάρτας δεν είναι έγκυρο.\",\n \"fieldInvalidForCvv\": \"Αυτός ο κωδικός ασφαλείας δεν είναι έγκυρος.\",\n \"fieldInvalidForExpirationDate\": \"Αυτή η ημερομηνία λήξης δεν είναι έγκυρη.\",\n \"fieldInvalidForNumber\": \"Αυτός ο αριθμός κάρτας δεν είναι έγκυρος.\",\n \"fieldInvalidForPostalCode\": \"Αυτός ο ταχυδρομικός κώδικας δεν είναι έγκυρος.\",\n \"genericError\": \"Προέκυψε ένα πρόβλημα στο σύστημά μας.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Αυτή η πιστωτική κάρτα υπάρχει ήδη ως αποθηκευμένη μέθοδος πληρωμής.\",\n \"hostedFieldsFailedTokenizationError\": \"Ελέγξτε τα στοιχεία σας και δοκιμάστε ξανά.\",\n \"hostedFieldsFieldsInvalidError\": \"Ελέγξτε τα στοιχεία σας και δοκιμάστε ξανά.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Σφάλμα δικτύου. Δοκιμάστε ξανά.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Η επαλήθευση της πιστωτικής κάρτας απέτυχε. Ελέγξτε τα στοιχεία σας και δοκιμάστε ξανά.\",\n \"paypalButtonMustBeUsed\": \"Χρησιμοποιήστε το κουμπί PayPal για να συνεχίσετε με την πληρωμή.\",\n \"paypalAccountTokenizationFailedError\": \"Προέκυψε κάποιο πρόβλημα με την προσθήκη του λογαριασμού PayPal. Δοκιμάστε ξανά.\",\n \"paypalFlowFailedError\": \"Προέκυψε κάποιο πρόβλημα με τη σύνδεση στην PayPal. Δοκιμάστε ξανά.\",\n \"paypalTokenizationRequestActiveError\": \"Η εξουσιοδότηση πληρωμής PayPal βρίσκεται ήδη σε εξέλιξη.\",\n \"venmoCanceledError\": \"Προέκυψε πρόβλημα. Βεβαιωθείτε ότι έχετε την πιο πρόσφατη έκδοση της εφαρμογής Venmo εγκατεστημένη στη συσκευή σας και ότι το πρόγραμμα περιήγησής σας υποστηρίζει τη μετάβαση στη Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Η διαγραφή της μεθόδου πληρωμής είναι αδύνατη, δοκιμάστε ξανά.\",\n \"venmoAppFailedError\": \"Η εφαρμογή Venmo δεν βρέθηκε στη συσκευή σας.\",\n \"unsupportedCardTypeError\": \"Αυτός ο τύπος κάρτας δεν υποστηρίζεται. Δοκιμάστε άλλη κάρτα.\",\n \"applePayTokenizationError\": \"Προέκυψε σφάλμα δικτύου κατά την επεξεργασία της πληρωμής μέσω Apple Pay. Δοκιμάστε ξανά.\",\n \"applePayActiveCardError\": \"Προσθέστε μια υποστηριζόμενη κάρτα στο πορτοφόλι Apple Pay.\",\n \"cardholderNameLabel\": \"Όνομα κατόχου κάρτας\",\n \"cardNumberLabel\": \"Αριθμός κάρτας\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 ψηφία)\",\n \"cvvFourDigitLabelSubheading\": \"(4 ψηφία)\",\n \"cardholderNamePlaceholder\": \"Όνομα κατόχου κάρτας\",\n \"expirationDateLabel\": \"Ημερομηνία λήξης\",\n \"expirationDateLabelSubheading\": \"(ΜΜ/ΕΕ)\",\n \"expirationDatePlaceholder\": \"MM/ΕΕ\",\n \"postalCodeLabel\": \"Ταχυδρομικός κώδικας\",\n \"saveCardLabel\": \"Αποθήκευση κάρτας\",\n \"payWithCard\": \"Πληρωμή με κάρτα\",\n \"endingIn\": \"που λήγει σε {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Κάρτα\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],219:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Paying with {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Choose another way to pay\",\n \"chooseAWayToPay\": \"Choose a way to pay\",\n \"otherWaysToPay\": \"Other ways to pay\",\n \"edit\": \"Edit\",\n \"doneEditing\": \"Done\",\n \"editPaymentMethods\": \"Edit payment methods\",\n \"CreditCardDeleteConfirmationMessage\": \"Delete {{secondaryIdentifier}} card ending in {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Delete PayPal account {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Are you sure you want to delete the Venmo account with username {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Are you sure you want to delete this payment method?\",\n \"deleteCancelButton\": \"Cancel\",\n \"deleteConfirmationButton\": \"Delete\",\n \"fieldEmptyForCvv\": \"Please fill out a CVV.\",\n \"fieldEmptyForExpirationDate\": \"Please fill out an expiry date.\",\n \"fieldEmptyForCardholderName\": \"Please fill out a cardholder name.\",\n \"fieldTooLongForCardholderName\": \"Cardholder name must be less than 256 characters.\",\n \"fieldEmptyForNumber\": \"Please fill out a number.\",\n \"fieldEmptyForPostalCode\": \"Please fill out a postcode.\",\n \"fieldInvalidForCardholderName\": \"This cardholder name isn't valid.\",\n \"fieldInvalidForCvv\": \"This security code is not valid.\",\n \"fieldInvalidForExpirationDate\": \"This expiry date is not valid.\",\n \"fieldInvalidForNumber\": \"This card number is not valid.\",\n \"fieldInvalidForPostalCode\": \"This postcode is not valid.\",\n \"genericError\": \"Something went wrong on our end.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"This credit card already exists as a saved payment method.\",\n \"hostedFieldsFailedTokenizationError\": \"Check your entries and try again.\",\n \"hostedFieldsFieldsInvalidError\": \"Check your entries and try again.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Network error. Please try again.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Credit card verification failed. Check your entries and try again.\",\n \"paypalButtonMustBeUsed\": \"Use the PayPal button to continue with your payment.\",\n \"paypalAccountTokenizationFailedError\": \"Something went wrong while adding the PayPal account. Please try again.\",\n \"paypalFlowFailedError\": \"Something went wrong while connecting to PayPal. Please try again.\",\n \"paypalTokenizationRequestActiveError\": \"PayPal payment authorisation is already in progress.\",\n \"venmoCanceledError\": \"We're sorry, something seems to have gone wrong. Please ensure you have the most recent version of the Venmo app installed on your device and your browser supports switching to Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"We're sorry. We couldn't delete that payment method. Please try again.\",\n \"venmoAppFailedError\": \"The Venmo app wasn't found on your device.\",\n \"unsupportedCardTypeError\": \"This card type is not supported. Please try another card.\",\n \"applePayTokenizationError\": \"A network error occurred while processing the Apple Pay payment. Please try again.\",\n \"applePayActiveCardError\": \"Link a supported card to your Apple Pay Wallet.\",\n \"cardholderNameLabel\": \"Cardholder Name\",\n \"cardNumberLabel\": \"Card Number\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 digits)\",\n \"cvvFourDigitLabelSubheading\": \"(4 digits)\",\n \"cardholderNamePlaceholder\": \"Cardholder Name\",\n \"expirationDateLabel\": \"Expiry date\",\n \"expirationDateLabelSubheading\": \"(MM/YY)\",\n \"expirationDatePlaceholder\": \"MM/YY\",\n \"postalCodeLabel\": \"Postcode\",\n \"saveCardLabel\": \"Save card\",\n \"payWithCard\": \"Pay with credit or debit card\",\n \"endingIn\": \"Ending in {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Card\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],220:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Paying with {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Choose another way to pay\",\n \"chooseAWayToPay\": \"Choose a way to pay\",\n \"otherWaysToPay\": \"Other ways to pay\",\n \"edit\": \"Edit\",\n \"doneEditing\": \"Done\",\n \"editPaymentMethods\": \"Edit funding sources\",\n \"CreditCardDeleteConfirmationMessage\": \"Delete {{secondaryIdentifier}} card ending in {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Delete PayPal account {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Are you sure you want to delete the Venmo account with username {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Are you sure you want to delete this funding source?\",\n \"deleteCancelButton\": \"Cancel\",\n \"deleteConfirmationButton\": \"Delete\",\n \"fieldEmptyForCvv\": \"Please fill in a CSC.\",\n \"fieldEmptyForExpirationDate\": \"Please fill in an expiry date.\",\n \"fieldEmptyForCardholderName\": \"Please fill in a cardholder name.\",\n \"fieldTooLongForCardholderName\": \"Cardholder name must be less than 256 characters.\",\n \"fieldEmptyForNumber\": \"Please fill in a number.\",\n \"fieldEmptyForPostalCode\": \"Please fill in a postcode.\",\n \"fieldInvalidForCardholderName\": \"This cardholder name isn't valid.\",\n \"fieldInvalidForCvv\": \"This security code is not valid.\",\n \"fieldInvalidForExpirationDate\": \"This expiry date is not valid.\",\n \"fieldInvalidForNumber\": \"This card number is not valid.\",\n \"fieldInvalidForPostalCode\": \"This postcode is not valid.\",\n \"genericError\": \"Something went wrong on our end.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"This credit card has already been added to your account as a funding source.\",\n \"hostedFieldsFailedTokenizationError\": \"Please check your information and try again.\",\n \"hostedFieldsFieldsInvalidError\": \"Please check your information and try again.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Network error. Please try again.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Credit card verification failed. Please check your information and try again.\",\n \"paypalButtonMustBeUsed\": \"Use the PayPal button to continue with your payment.\",\n \"paypalAccountTokenizationFailedError\": \"Something went wrong while adding the PayPal account. Please try again.\",\n \"paypalFlowFailedError\": \"Something went wrong while connecting to PayPal. Please try again.\",\n \"paypalTokenizationRequestActiveError\": \"PayPal payment authorisation is already in progress.\",\n \"venmoCanceledError\": \"We're sorry, something seems to have gone wrong. Make sure you have the most recent version of the Venmo app installed on your device and your browser supports the switch to Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Unable to delete funding source, try again.\",\n \"venmoAppFailedError\": \"The Venmo app isn't on your device.\",\n \"unsupportedCardTypeError\": \"This card type is not supported. Please try another card.\",\n \"applePayTokenizationError\": \"A network error occurred while processing the Apple Pay payment. Please try again.\",\n \"applePayActiveCardError\": \"Add a supported card to your Apple Pay wallet.\",\n \"cardholderNameLabel\": \"Cardholder name\",\n \"cardNumberLabel\": \"Card number\",\n \"cvvLabel\": \"CSC\",\n \"cvvThreeDigitLabelSubheading\": \"(3 digits)\",\n \"cvvFourDigitLabelSubheading\": \"(4 digits)\",\n \"cardholderNamePlaceholder\": \"Cardholder name\",\n \"expirationDateLabel\": \"Expiry date\",\n \"expirationDateLabelSubheading\": \"(MM/YY)\",\n \"expirationDatePlaceholder\": \"MM/YY\",\n \"postalCodeLabel\": \"Postcode\",\n \"saveCardLabel\": \"Save card\",\n \"payWithCard\": \"Pay with card\",\n \"endingIn\": \"Ending in {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Card\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],221:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Paying with {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Choose another way to pay\",\n \"chooseAWayToPay\": \"Choose a way to pay\",\n \"otherWaysToPay\": \"Other ways to pay\",\n \"edit\": \"Edit\",\n \"doneEditing\": \"Done\",\n \"editPaymentMethods\": \"Edit payment methods\",\n \"CreditCardDeleteConfirmationMessage\": \"Delete {{secondaryIdentifier}} card ending in {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Delete PayPal account {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Are you sure you want to delete the Venmo account with username {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Are you sure you want to delete this payment method?\",\n \"deleteCancelButton\": \"Cancel\",\n \"deleteConfirmationButton\": \"Delete\",\n \"fieldEmptyForCvv\": \"Please enter a CVV.\",\n \"fieldEmptyForExpirationDate\": \"Please enter an expiry date.\",\n \"fieldEmptyForCardholderName\": \"Please enter a cardholder name.\",\n \"fieldTooLongForCardholderName\": \"Cardholder name must have less than 256 characters.\",\n \"fieldEmptyForNumber\": \"Please enter a number.\",\n \"fieldEmptyForPostalCode\": \"Please enter a PIN code.\",\n \"fieldInvalidForCardholderName\": \"This cardholder name isn't valid.\",\n \"fieldInvalidForCvv\": \"This security code isn't valid.\",\n \"fieldInvalidForExpirationDate\": \"This expiration date isn't valid.\",\n \"fieldInvalidForNumber\": \"This card number isn't valid.\",\n \"fieldInvalidForPostalCode\": \"This PIN code isn't valid.\",\n \"genericError\": \"We're sorry, something seems to have gone wrong.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"This credit card already exists as a saved payment method.\",\n \"hostedFieldsFailedTokenizationError\": \"Please check your information and try again.\",\n \"hostedFieldsFieldsInvalidError\": \"Please check your information and try again.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Network error. Please try again.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Credit card verification failed. Please check your information and try again.\",\n \"paypalButtonMustBeUsed\": \"Use the PayPal button to continue with your payment.\",\n \"paypalAccountTokenizationFailedError\": \"Something went wrong adding the PayPal account. Please try again.\",\n \"paypalFlowFailedError\": \"Something went wrong connecting to PayPal. Please try again.\",\n \"paypalTokenizationRequestActiveError\": \"PayPal payment authorisation is already in progress.\",\n \"venmoCanceledError\": \"We're sorry, something seems to have gone wrong. Please ensure you have the most recent version of the Venmo app installed on your device and your browser supports switching to Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Unable to delete payment method. Please try again.\",\n \"venmoAppFailedError\": \"The Venmo app couldn't be found on your device.\",\n \"unsupportedCardTypeError\": \"This card type isn't supported. Please try another card.\",\n \"applePayTokenizationError\": \"A network error occurred while processing the Apple Pay payment. Please try again.\",\n \"applePayActiveCardError\": \"Add a supported card to your Apple Pay wallet.\",\n \"cardholderNameLabel\": \"Cardholder name\",\n \"cardNumberLabel\": \"Card number\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 digits)\",\n \"cvvFourDigitLabelSubheading\": \"(4 digits)\",\n \"cardholderNamePlaceholder\": \"Cardholder name\",\n \"expirationDateLabel\": \"Expiry date\",\n \"expirationDateLabelSubheading\": \"(MM/YY)\",\n \"expirationDatePlaceholder\": \"MM/YY\",\n \"postalCodeLabel\": \"PIN code\",\n \"saveCardLabel\": \"Save card\",\n \"payWithCard\": \"Pay with card\",\n \"endingIn\": \"Ending in {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Card\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],222:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n payingWith: 'Paying with {{paymentSource}}',\n chooseAnotherWayToPay: 'Choose another way to pay',\n chooseAWayToPay: 'Choose a way to pay',\n otherWaysToPay: 'Other ways to pay',\n edit: 'Edit',\n doneEditing: 'Done',\n editPaymentMethods: 'Edit payment methods',\n CreditCardDeleteConfirmationMessage: 'Delete {{secondaryIdentifier}} card ending in {{identifier}}?',\n PayPalAccountDeleteConfirmationMessage: 'Delete PayPal account {{identifier}}?',\n VenmoAccountDeleteConfirmationMessage: 'Are you sure you want to delete Venmo account with username {{identifier}}?',\n genericDeleteConfirmationMessage: 'Are you sure you want to delete this payment method?',\n deleteCancelButton: 'Cancel',\n deleteConfirmationButton: 'Delete',\n // Errors\n fieldEmptyForCvv: 'Please fill out a CVV.',\n fieldEmptyForExpirationDate: 'Please fill out an expiration date.',\n fieldEmptyForCardholderName: 'Please fill out a cardholder name.',\n fieldEmptyForNumber: 'Please fill out a card number.',\n fieldEmptyForPostalCode: 'Please fill out a postal code.',\n fieldInvalidForCardholderName: 'This cardholder name is not valid.',\n fieldInvalidForCvv: 'This security code is not valid.',\n fieldInvalidForExpirationDate: 'This expiration date is not valid.',\n fieldInvalidForNumber: 'This card number is not valid.',\n fieldInvalidForPostalCode: 'This postal code is not valid.',\n fieldTooLongForCardholderName: 'Cardholder name must be less than 256 characters.',\n genericError: 'Something went wrong on our end.',\n hostedFieldsTokenizationFailOnDuplicateError: 'This credit card already exists as a saved payment method.',\n hostedFieldsFailedTokenizationError: 'Please check your information and try again.',\n hostedFieldsTokenizationCvvVerificationFailedError: 'Credit card verification failed. Please check your information and try again.',\n hostedFieldsTokenizationNetworkErrorError: 'Network error. Please try again.',\n hostedFieldsFieldsInvalidError: 'Please check your information and try again.',\n paypalButtonMustBeUsed: 'Use the PayPal button to continue with your payment.',\n paypalAccountTokenizationFailedError: 'Something went wrong adding the PayPal account. Please try again.',\n paypalFlowFailedError: 'Something went wrong connecting to PayPal. Please try again.',\n paypalTokenizationRequestActiveError: 'PayPal payment authorization is already in progress.',\n applePayTokenizationError: 'A network error occurred while processing the Apple Pay payment. Please try again.',\n applePayActiveCardError: 'Add a supported card to your Apple Pay wallet.',\n vaultManagerPaymentMethodDeletionError: 'Unable to delete payment method, try again.',\n venmoCanceledError: 'Something went wrong. Ensure you have the most recent version of the Venmo app installed on your device and your browser supports switching to Venmo.',\n venmoAppFailedError: 'The Venmo app could not be found on your device.',\n unsupportedCardTypeError: 'This card type is not supported. Please try another card.',\n // Card form\n cardholderNameLabel: 'Cardholder Name',\n cardNumberLabel: 'Card Number',\n cvvLabel: 'CVV',\n cvvThreeDigitLabelSubheading: '(3 digits)',\n cvvFourDigitLabelSubheading: '(4 digits)',\n expirationDateLabel: 'Expiration Date',\n expirationDateLabelSubheading: '(MM/YY)',\n cardholderNamePlaceholder: 'Cardholder Name',\n expirationDatePlaceholder: 'MM/YY',\n postalCodeLabel: 'Postal Code',\n saveCardLabel: 'Save card',\n payWithCard: 'Pay with card',\n // Payment Method descriptions\n endingIn: 'Ending in {{lastFourCardDigits}}',\n Card: 'Card',\n PayPal: 'PayPal',\n 'PayPal Credit': 'PayPal Credit',\n 'Apple Pay': 'Apple Pay',\n 'Google Pay': 'Google Pay',\n 'Venmo': 'Venmo',\n 'American Express': 'American Express',\n Discover: 'Discover',\n 'Diners Club': 'Diners Club',\n MasterCard: 'Mastercard',\n Visa: 'Visa',\n JCB: 'JCB',\n Maestro: 'Maestro',\n UnionPay: 'UnionPay'\n};\n\n},{}],223:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Pago con {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Selecciona otra forma de pago.\",\n \"chooseAWayToPay\": \"Selecciona una forma de pago.\",\n \"otherWaysToPay\": \"Otras formas de pago\",\n \"edit\": \"Modificar\",\n \"doneEditing\": \"Hecho\",\n \"editPaymentMethods\": \"Editar formas de pago\",\n \"CreditCardDeleteConfirmationMessage\": \"¿Quieres eliminar la tarjeta {{secondaryIdentifier}} que termina en {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"¿Quieres eliminar la cuenta PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"¿Seguro de que deseas eliminar la cuenta de Venmo con nombre de usuario {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"¿Seguro que deseas eliminar esta forma de pago?\",\n \"deleteCancelButton\": \"Cancelar\",\n \"deleteConfirmationButton\": \"Eliminar\",\n \"fieldEmptyForCvv\": \"Escribe el código CVV.\",\n \"fieldEmptyForExpirationDate\": \"Escribe la fecha de vencimiento.\",\n \"fieldEmptyForCardholderName\": \"Escribe el nombre de un titular de la tarjeta.\",\n \"fieldTooLongForCardholderName\": \"El nombre del titular de la tarjeta debe tener menos de 256 caracteres.\",\n \"fieldEmptyForNumber\": \"Escribe un número.\",\n \"fieldEmptyForPostalCode\": \"Escribe el código postal.\",\n \"fieldInvalidForCardholderName\": \"El nombre del titular de la tarjeta no es válido.\",\n \"fieldInvalidForCvv\": \"Este código de seguridad no es válido.\",\n \"fieldInvalidForExpirationDate\": \"Esta fecha de vencimiento no es válida.\",\n \"fieldInvalidForNumber\": \"Este número de tarjeta no es válido.\",\n \"fieldInvalidForPostalCode\": \"Este código postal no es válido.\",\n \"genericError\": \"Hemos tenido algún problema.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Esta tarjeta de crédito ya existe como forma de pago guardada.\",\n \"hostedFieldsFailedTokenizationError\": \"Comprueba la información e inténtalo de nuevo.\",\n \"hostedFieldsFieldsInvalidError\": \"Comprueba la información e inténtalo de nuevo.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Error de red. Inténtalo de nuevo.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Error de verificación de la tarjeta de crédito. Comprueba la información e inténtalo de nuevo.\",\n \"paypalButtonMustBeUsed\": \"Utiliza el botón de PayPal para continuar con el pago.\",\n \"paypalAccountTokenizationFailedError\": \"Se ha producido un error al vincular la cuenta PayPal. Inténtalo de nuevo.\",\n \"paypalFlowFailedError\": \"Se ha producido un error al conectarse a PayPal. Inténtalo de nuevo.\",\n \"paypalTokenizationRequestActiveError\": \"Ya hay una autorización de pago de PayPal en curso.\",\n \"venmoCanceledError\": \"Ha habido un problema. Asegúrate de que tienes la versión más reciente de la aplicación de Venmo instalada en tu dispositivo y de que tu navegador es compatible con cambiar a Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"No se ha podido eliminar la forma de pago. Inténtalo de nuevo.\",\n \"venmoAppFailedError\": \"No se ha encontrado la aplicación de Venmo en tu dispositivo.\",\n \"unsupportedCardTypeError\": \"No se admite este tipo de tarjeta. Prueba con otra tarjeta.\",\n \"applePayTokenizationError\": \"Se ha producido un error de red al procesar el pago con Apple Pay. Inténtalo de nuevo.\",\n \"applePayActiveCardError\": \"Añade una tarjeta admitida a tu Wallet de Apple Pay.\",\n \"cardholderNameLabel\": \"Nombre del titular de la tarjeta\",\n \"cardNumberLabel\": \"Número de tarjeta\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 dígitos)\",\n \"cvvFourDigitLabelSubheading\": \"(4 dígitos)\",\n \"cardholderNamePlaceholder\": \"Nombre del titular de la tarjeta\",\n \"expirationDateLabel\": \"Fecha de vencimiento\",\n \"expirationDateLabelSubheading\": \"(MM/AA)\",\n \"expirationDatePlaceholder\": \"MM/AA\",\n \"postalCodeLabel\": \"Código postal\",\n \"saveCardLabel\": \"Guardar tarjeta\",\n \"payWithCard\": \"Pagar con tarjeta\",\n \"endingIn\": \"Terminada en {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Tarjeta\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],224:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Pagando con {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Elija otra forma de pago\",\n \"chooseAWayToPay\": \"Elija una forma de pago\",\n \"otherWaysToPay\": \"Otras formas de pago\",\n \"edit\": \"Editar\",\n \"doneEditing\": \"Listo\",\n \"editPaymentMethods\": \"Editar formas de pago\",\n \"CreditCardDeleteConfirmationMessage\": \"¿Desea eliminar la tarjeta {{secondaryIdentifier}} con terminación en {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"¿Desea eliminar la cuenta de PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"¿Seguro que desea eliminar la cuenta de Venmo con el nombre de usuario {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"¿Seguro que desea eliminar esta forma de pago?\",\n \"deleteCancelButton\": \"Cancelar\",\n \"deleteConfirmationButton\": \"Eliminar\",\n \"fieldEmptyForCvv\": \"Ingrese un CVV.\",\n \"fieldEmptyForExpirationDate\": \"Complete una fecha de vencimiento.\",\n \"fieldEmptyForCardholderName\": \"Ingrese el nombre del titular de la tarjeta.\",\n \"fieldTooLongForCardholderName\": \"El nombre del titular de la tarjeta debe tener menos de 256 caracteres.\",\n \"fieldEmptyForNumber\": \"Ingrese un número.\",\n \"fieldEmptyForPostalCode\": \"Ingrese un código postal.\",\n \"fieldInvalidForCardholderName\": \"El nombre del titular de la tarjeta no es válido.\",\n \"fieldInvalidForCvv\": \"Este código de seguridad no es válido.\",\n \"fieldInvalidForExpirationDate\": \"Esta fecha de vencimiento no es válida.\",\n \"fieldInvalidForNumber\": \"Este número de tarjeta no es válido.\",\n \"fieldInvalidForPostalCode\": \"Este código postal no es válido.\",\n \"genericError\": \"Se ha producido un error.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Esta tarjeta de crédito ya existe como forma de pago guardada.\",\n \"hostedFieldsFailedTokenizationError\": \"Verifique su información e inténtelo de nuevo.\",\n \"hostedFieldsFieldsInvalidError\": \"Verifique su información e inténtelo de nuevo.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Error de red. Inténtelo de nuevo.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"La verificación de la tarjeta de crédito falló. Revise su información e inténtelo de nuevo.\",\n \"paypalButtonMustBeUsed\": \"Utilice el botón de PayPal para continuar con su pago.\",\n \"paypalAccountTokenizationFailedError\": \"Se ha producido un error al agregar la cuenta de PayPal. Inténtelo de nuevo.\",\n \"paypalFlowFailedError\": \"Se ha producido un error al conectar con PayPal. Inténtelo de nuevo.\",\n \"paypalTokenizationRequestActiveError\": \"La autorización de pago de PayPal ya está en curso.\",\n \"venmoCanceledError\": \"Se ha producido un error. Asegúrese de que tiene la versión más reciente de la aplicación de Venmo instalada en su dispositivo y que su navegador admita el sitio web Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"No se pudo eliminar la forma de pago, inténtelo de nuevo.\",\n \"venmoAppFailedError\": \"No se pudo encontrar la aplicación de Venmo en su dispositivo.\",\n \"unsupportedCardTypeError\": \"Este tipo de tarjeta no es compatible. Inténtelo con otra tarjeta.\",\n \"applePayTokenizationError\": \"Se ha producido un error de red al procesar el pago de Apple Pay. Inténtelo de nuevo.\",\n \"applePayActiveCardError\": \"Agregue una tarjeta compatible a su cartera de Apple Pay.\",\n \"cardholderNameLabel\": \"Nombre del titular de la tarjeta\",\n \"cardNumberLabel\": \"Número de tarjeta\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 dígitos)\",\n \"cvvFourDigitLabelSubheading\": \"(4 dígitos)\",\n \"cardholderNamePlaceholder\": \"Nombre del titular de la tarjeta\",\n \"expirationDateLabel\": \"Fecha de vencimiento\",\n \"expirationDateLabelSubheading\": \"(MM/AA)\",\n \"expirationDatePlaceholder\": \"MM/AA\",\n \"postalCodeLabel\": \"Código postal\",\n \"saveCardLabel\": \"Guardar tarjeta\",\n \"payWithCard\": \"Pagar con tarjeta\",\n \"endingIn\": \"Con terminación en {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Tarjeta\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],225:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Maksutapa: {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Valitse toinen maksutapa\",\n \"chooseAWayToPay\": \"Valitse maksutapa\",\n \"otherWaysToPay\": \"Muut maksutavat\",\n \"edit\": \"Muokkaa\",\n \"doneEditing\": \"Valmis\",\n \"editPaymentMethods\": \"Muokkaa maksutapoja\",\n \"CreditCardDeleteConfirmationMessage\": \"Haluatko poistaa {{secondaryIdentifier}}-kortin, jonka numero päättyy {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Haluatko poistaa PayPal-tilin {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Haluatko varmasti poistaa Venmo-tilin, jonka käyttäjätunnus on {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Haluatko varmasti poistaa tämän maksutavan?\",\n \"deleteCancelButton\": \"Peruuta\",\n \"deleteConfirmationButton\": \"Poista\",\n \"fieldEmptyForCvv\": \"Täytä CVV.\",\n \"fieldEmptyForExpirationDate\": \"Täytä voimassaolon päättymispäivämäärä.\",\n \"fieldEmptyForCardholderName\": \"Täytä kortinhaltijan nimi.\",\n \"fieldTooLongForCardholderName\": \"Kortin haltijan nimen on oltava alle 256 merkkiä.\",\n \"fieldEmptyForNumber\": \"Täytä numero.\",\n \"fieldEmptyForPostalCode\": \"Täytä postinumero.\",\n \"fieldInvalidForCardholderName\": \"Kortinhaltijan nimi ei ole kelvollinen.\",\n \"fieldInvalidForCvv\": \"Tämä turvakoodi ei ole kelvollinen.\",\n \"fieldInvalidForExpirationDate\": \"Tämä päättymispäivämäärä ei ole kelvollinen.\",\n \"fieldInvalidForNumber\": \"Tämä kortin numero ei ole kelvollinen.\",\n \"fieldInvalidForPostalCode\": \"Tämä postinumero ei ole kelvollinen.\",\n \"genericError\": \"Jokin meni pieleen meidän päässämme.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Tämä luottokortti on jo tallennettu maksutavaksi.\",\n \"hostedFieldsFailedTokenizationError\": \"Tarkista tiedot ja yritä uudelleen.\",\n \"hostedFieldsFieldsInvalidError\": \"Tarkista tiedot ja yritä uudelleen.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Verkkovirhe. Yritä uudelleen.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Luottokortin varmennus epäonnistui. Tarkista tiedot ja yritä uudelleen.\",\n \"paypalButtonMustBeUsed\": \"Jatka maksua PayPal-painikkeen avulla.\",\n \"paypalAccountTokenizationFailedError\": \"Jotain meni pieleen PayPal-tiliä lisätessä. Yritä uudelleen.\",\n \"paypalFlowFailedError\": \"Jotain meni pieleen muodostettaessa yhteyttä PayPaliin. Yritä uudelleen.\",\n \"paypalTokenizationRequestActiveError\": \"PayPal-maksun valtuutus on jo meneillään.\",\n \"venmoCanceledError\": \"Jokin meni pieleen. Varmista, että laitteeseesi on asennettu Venmo-sovelluksen viimeisin versio, ja että selain tukee vaihtamista Venmoon.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Maksutavan poistaminen ei onnistu, yritä uudelleen.\",\n \"venmoAppFailedError\": \"Venmo-sovellusta ei löytynyt laitteesta.\",\n \"unsupportedCardTypeError\": \"Tätä korttityyppiä ei tueta. Kokeile toista korttia.\",\n \"applePayTokenizationError\": \"Tapahtui verkkovirhe Apple Pay -maksun käsittelyssä. Yritä uudelleen.\",\n \"applePayActiveCardError\": \"Lisää tuettu kortti Apple Pay -lompakkoon.\",\n \"cardholderNameLabel\": \"Kortinhaltijan nimi\",\n \"cardNumberLabel\": \"Kortin numero\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(kolme numeroa)\",\n \"cvvFourDigitLabelSubheading\": \"(neljä numeroa)\",\n \"cardholderNamePlaceholder\": \"Kortinhaltijan nimi\",\n \"expirationDateLabel\": \"Päättymispäivämäärä\",\n \"expirationDateLabelSubheading\": \"(KK/VV)\",\n \"expirationDatePlaceholder\": \"KK/VV\",\n \"postalCodeLabel\": \"Postinumero\",\n \"saveCardLabel\": \"Tallenna kortti\",\n \"payWithCard\": \"Maksa kortilla\",\n \"endingIn\": \"Päättyy {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Kortti\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],226:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Payer avec {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Choisir un autre mode de paiement\",\n \"chooseAWayToPay\": \"Choisir le mode de paiement\",\n \"otherWaysToPay\": \"Autres modes de paiement\",\n \"edit\": \"Modifier\",\n \"doneEditing\": \"Terminé\",\n \"editPaymentMethods\": \"Modifier les modes de paiement\",\n \"CreditCardDeleteConfirmationMessage\": \"Supprimer la carte {{secondaryIdentifier}} se terminant par {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Supprimer le compte PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Souhaitez-vous vraiment supprimer le compte Venmo avec le nom d’utilisateur {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Voulez-vous vraiment supprimer ce mode de paiement?\",\n \"deleteCancelButton\": \"Annuler\",\n \"deleteConfirmationButton\": \"Supprimer\",\n \"fieldEmptyForCvv\": \"Veuillez saisir un cryptogramme visuel.\",\n \"fieldEmptyForExpirationDate\": \"Veuillez saisir une date d'expiration.\",\n \"fieldEmptyForCardholderName\": \"Veuillez saisir un nom de titulaire de la carte.\",\n \"fieldTooLongForCardholderName\": \"Le nom du titulaire de la carte doit contenir moins de 256 caractères.\",\n \"fieldEmptyForNumber\": \"Veuillez saisir un numéro.\",\n \"fieldEmptyForPostalCode\": \"Veuillez saisir un code postal.\",\n \"fieldInvalidForCardholderName\": \"Le nom de ce titulaire de la carte n'est pas valide.\",\n \"fieldInvalidForCvv\": \"Ce cryptogramme visuel n'est pas valide.\",\n \"fieldInvalidForExpirationDate\": \"Cette date d'expiration n'est pas valide.\",\n \"fieldInvalidForNumber\": \"Ce numéro de carte n'est pas valide.\",\n \"fieldInvalidForPostalCode\": \"Ce code postal n'est pas valide.\",\n \"genericError\": \"Une erreur s'est produite de notre côté.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Cette carte de crédit existe déjà comme mode de paiement enregistré.\",\n \"hostedFieldsFailedTokenizationError\": \"Vérifiez vos informations, puis réessayez.\",\n \"hostedFieldsFieldsInvalidError\": \"Vérifiez vos informations, puis réessayez.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Erreur réseau. Veuillez réessayer.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"La vérification de la carte de crédit a échoué. Vérifiez vos informations, puis réessayez.\",\n \"paypalButtonMustBeUsed\": \"Utilisez le bouton PayPal pour poursuivre votre paiement.\",\n \"paypalAccountTokenizationFailedError\": \"Une erreur s'est produite lors de l'enregistrement du compte PayPal. Veuillez réessayer.\",\n \"paypalFlowFailedError\": \"Une erreur s'est produite au cours de la connexion à PayPal. Veuillez réessayer.\",\n \"paypalTokenizationRequestActiveError\": \"L'autorisation de paiement PayPal est déjà en cours.\",\n \"venmoCanceledError\": \"Une erreur s'est produite. Assurez-vous que la version la plus récente de l'application Venmo est installée sur votre appareil et que votre navigateur prend Venmo en charge.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Impossible de supprimer le mode de paiement, essayez de nouveau.\",\n \"venmoAppFailedError\": \"L'application Venmo est introuvable sur votre appareil.\",\n \"unsupportedCardTypeError\": \"Ce type de carte n'est pas pris en charge. Veuillez essayer une autre carte.\",\n \"applePayTokenizationError\": \"Une erreur de réseau s'est produite lors du traitement du paiement avec Apple Pay. Veuillez réessayer.\",\n \"applePayActiveCardError\": \"Ajoutez une carte prise en charge à Apple Pay.\",\n \"cardholderNameLabel\": \"Nom du titulaire de la carte\",\n \"cardNumberLabel\": \"Numéro de carte\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 chiffres)\",\n \"cvvFourDigitLabelSubheading\": \"(4 chiffres)\",\n \"cardholderNamePlaceholder\": \"Nom du titulaire de la carte\",\n \"expirationDateLabel\": \"Date d'expiration\",\n \"expirationDateLabelSubheading\": \"(MM/AA)\",\n \"expirationDatePlaceholder\": \"MM/AA\",\n \"postalCodeLabel\": \"Code postal\",\n \"saveCardLabel\": \"Enregistrer la carte\",\n \"payWithCard\": \"Payer par carte\",\n \"endingIn\": \"Se terminant par {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Carte\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],227:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Payer avec {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Choisissez une autre façon de payer.\",\n \"chooseAWayToPay\": \"Choisissez comment payer.\",\n \"otherWaysToPay\": \"Autres façons de payer\",\n \"edit\": \"Modifier\",\n \"doneEditing\": \"Terminé\",\n \"editPaymentMethods\": \"Modifier les sources d'approvisionnement\",\n \"CreditCardDeleteConfirmationMessage\": \"Supprimer la carte {{secondaryIdentifier}} se terminant par {{identifier}} ?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Supprimer le compte PayPal {{identifier}} ?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Êtes-vous sûr de vouloir supprimer le compte Venmo avec le nom d'utilisateur {{identifier}} ?\",\n \"genericDeleteConfirmationMessage\": \"Êtes-vous sûr de vouloir supprimer cette source d'approvisionnement ?\",\n \"deleteCancelButton\": \"Annuler\",\n \"deleteConfirmationButton\": \"Supprimer\",\n \"fieldEmptyForCvv\": \"Entrez un cryptogramme visuel.\",\n \"fieldEmptyForExpirationDate\": \"Entrez une date d'expiration.\",\n \"fieldEmptyForCardholderName\": \"Entrez un nom du titulaire de la carte.\",\n \"fieldTooLongForCardholderName\": \"Le nom du titulaire de la carte doit contenir moins de 256 caractères.\",\n \"fieldEmptyForNumber\": \"Entrez un numéro.\",\n \"fieldEmptyForPostalCode\": \"Entrez un code postal.\",\n \"fieldInvalidForCardholderName\": \"Le nom de ce titulaire de la carte est incorrect.\",\n \"fieldInvalidForCvv\": \"Ce cryptogramme visuel n'est pas valide.\",\n \"fieldInvalidForExpirationDate\": \"Cette date d'expiration n'est pas valide.\",\n \"fieldInvalidForNumber\": \"Ce numéro de carte n'est pas valide.\",\n \"fieldInvalidForPostalCode\": \"Ce code postal n'est pas valide.\",\n \"genericError\": \"Une erreur est survenue.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Cette carte bancaire existe déjà comme mode de paiement enregistré.\",\n \"hostedFieldsFailedTokenizationError\": \"Vérifiez vos informations et réessayez.\",\n \"hostedFieldsFieldsInvalidError\": \"Vérifiez vos informations et réessayez.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Erreur réseau. Réessayez.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Échec de vérification de la carte bancaire. Vérifiez vos informations et réessayez.\",\n \"paypalButtonMustBeUsed\": \"Utilisez le bouton PayPal pour poursuivre votre paiement.\",\n \"paypalAccountTokenizationFailedError\": \"Une erreur est survenue lors de l'ajout du compte PayPal. Réessayez.\",\n \"paypalFlowFailedError\": \"Une erreur est survenue lors de la connexion à PayPal. Réessayez.\",\n \"paypalTokenizationRequestActiveError\": \"L'autorisation de paiement PayPal est déjà en cours.\",\n \"venmoCanceledError\": \"Une erreur est survenue. Vérifiez que vous disposez de la dernière version de l'application Venmo sur votre appareil et que votre navigateur prend en charge la redirection vers Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Impossible de supprimer la source d'approvisionnement. Réessayez.\",\n \"venmoAppFailedError\": \"L'application Venmo est introuvable sur votre appareil.\",\n \"unsupportedCardTypeError\": \"Ce type de carte n'est pas pris en charge. Essayez une autre carte.\",\n \"applePayTokenizationError\": \"Une erreur réseau s'est produite lors du traitement du paiement Apple Pay. Réessayez.\",\n \"applePayActiveCardError\": \"Enregistrez une carte prise en charge sur Apple Pay.\",\n \"cardholderNameLabel\": \"Nom du titulaire de la carte\",\n \"cardNumberLabel\": \"Nº de carte\",\n \"cvvLabel\": \"Cryptogramme visuel\",\n \"cvvThreeDigitLabelSubheading\": \"(3 chiffres)\",\n \"cvvFourDigitLabelSubheading\": \"(4 chiffres)\",\n \"cardholderNamePlaceholder\": \"Nom du titulaire de la carte\",\n \"expirationDateLabel\": \"Date d'expiration\",\n \"expirationDateLabelSubheading\": \"(MM/AA)\",\n \"expirationDatePlaceholder\": \"MM/AA\",\n \"postalCodeLabel\": \"Code postal\",\n \"saveCardLabel\": \"Enregistrer une carte\",\n \"payWithCard\": \"Payer par carte\",\n \"endingIn\": \"Se terminant par {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Carte\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],228:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Payer avec {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Choisir un autre mode de paiement\",\n \"chooseAWayToPay\": \"Choisir un mode de paiement\",\n \"otherWaysToPay\": \"Autres modes de paiement\",\n \"edit\": \"Modifier\",\n \"doneEditing\": \"Terminé\",\n \"editPaymentMethods\": \"Modifier les modes de paiement\",\n \"CreditCardDeleteConfirmationMessage\": \"Supprimer la carte {{secondaryIdentifier}} se terminant par {{identifier}} ?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Supprimer le compte PayPal {{identifier}} ?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Souhaitez-vous vraiment supprimer le compte Venmo associé au nom d'utilisateur {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Souhaitez-vous vraiment supprimer ce mode de paiement ?\",\n \"deleteCancelButton\": \"Annuler\",\n \"deleteConfirmationButton\": \"Supprimer\",\n \"fieldEmptyForCvv\": \"Saisissez un cryptogramme visuel.\",\n \"fieldEmptyForExpirationDate\": \"Indiquez une date d'expiration.\",\n \"fieldEmptyForCardholderName\": \"Saisissez le nom du titulaire de la carte.\",\n \"fieldTooLongForCardholderName\": \"Le nom du titulaire de la carte doit comporter moins de 256 caractères.\",\n \"fieldEmptyForNumber\": \"Indiquez un numéro.\",\n \"fieldEmptyForPostalCode\": \"Indiquez un code postal.\",\n \"fieldInvalidForCardholderName\": \"Le nom de ce titulaire de la carte est incorrect.\",\n \"fieldInvalidForCvv\": \"Ce cryptogramme visuel n'est pas valide.\",\n \"fieldInvalidForExpirationDate\": \"Cette date d'expiration n'est pas valide.\",\n \"fieldInvalidForNumber\": \"Ce numéro de carte n'est pas valide.\",\n \"fieldInvalidForPostalCode\": \"Ce code postal n'est pas valide.\",\n \"genericError\": \"Une erreur est survenue.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Cette carte bancaire existe déjà en tant que mode de paiement enregistré.\",\n \"hostedFieldsFailedTokenizationError\": \"Vérifiez les informations et réessayez.\",\n \"hostedFieldsFieldsInvalidError\": \"Vérifiez les informations et réessayez.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Erreur réseau. Réessayez.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Échec de la vérification de carte bancaire. Vérifiez les informations et réessayez.\",\n \"paypalButtonMustBeUsed\": \"Utilisez le bouton PayPal pour poursuivre le paiement.\",\n \"paypalAccountTokenizationFailedError\": \"Un problème est survenu lors de l'ajout du compte PayPal. Réessayez.\",\n \"paypalFlowFailedError\": \"Une erreur est survenue lors de la connexion à PayPal. Réessayez.\",\n \"paypalTokenizationRequestActiveError\": \"L'autorisation de paiement PayPal est déjà en cours.\",\n \"venmoCanceledError\": \"Une erreur est survenue. Vérifiez que la dernière version de l'application Venmo est installée sur votre appareil et que votre navigateur prend en charge la redirection vers Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Impossible de supprimer le mode de paiement, réessayez.\",\n \"venmoAppFailedError\": \"Nous n'avons pas trouvé l'application Venmo sur votre appareil.\",\n \"unsupportedCardTypeError\": \"Ce type de carte n'est pas pris en charge. Essayez une autre carte.\",\n \"applePayTokenizationError\": \"Une erreur réseau s'est produite lors du traitement du paiement Apple Pay. Réessayez.\",\n \"applePayActiveCardError\": \"Ajoutez une carte prise en charge à votre portefeuille Apple Pay.\",\n \"cardholderNameLabel\": \"Nom du titulaire de la carte\",\n \"cardNumberLabel\": \"Numéro de carte\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 chiffres)\",\n \"cvvFourDigitLabelSubheading\": \"(4 chiffres)\",\n \"cardholderNamePlaceholder\": \"Nom du titulaire de la carte\",\n \"expirationDateLabel\": \"Date d'expiration\",\n \"expirationDateLabelSubheading\": \"(MM/AA)\",\n \"expirationDatePlaceholder\": \"MM/AA\",\n \"postalCodeLabel\": \"Code postal\",\n \"saveCardLabel\": \"Enregistrer la carte\",\n \"payWithCard\": \"Payer avec la carte\",\n \"endingIn\": \"Se terminant par {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Carte\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],229:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"שליחת תשלום באמצעות {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"עליך לבחור שיטת תשלום אחרת\",\n \"chooseAWayToPay\": \"עליך לבחור שיטת תשלום\",\n \"otherWaysToPay\": \"שיטות תשלום אחרות\",\n \"edit\": \"עריכה\",\n \"doneEditing\": \"סיום\",\n \"editPaymentMethods\": \"עריכת שיטות תשלום\",\n \"CreditCardDeleteConfirmationMessage\": \"ברצונך למחוק את כרטיס ה-{{secondaryIdentifier}} שמסתיים בספרות {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"ברצונך למחוק את חשבון ה-PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"האם אתה בטוח שברצונך למחוק את חשבון Venmo הרשום תחת שם המשתמש {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"האם אתה בטוח שברצונך למחוק שיטת תשלום זו?\",\n \"deleteCancelButton\": \"ביטול\",\n \"deleteConfirmationButton\": \"מחיקה\",\n \"fieldEmptyForCvv\": \"עליך למלא את מספר האבטחה של כרטיס האשראי.\",\n \"fieldEmptyForExpirationDate\": \"עליך למלא את תאריך פקיעת התוקף.\",\n \"fieldEmptyForCardholderName\": \"עליך למלא את שם בעל הכרטיס.\",\n \"fieldTooLongForCardholderName\": \"שם בעל הכרטיס יכול להכיל 256 תווים לכל היותר.\",\n \"fieldEmptyForNumber\": \"עליך למלא את המספר.\",\n \"fieldEmptyForPostalCode\": \"עליך למלא את המיקוד.\",\n \"fieldInvalidForCardholderName\": \"שם בעל הכרטיס אינו חוקי.\",\n \"fieldInvalidForCvv\": \"קוד אבטחה זה אינו חוקי.\",\n \"fieldInvalidForExpirationDate\": \"תאריך פקיעת התוקף הזה אינו חוקי.\",\n \"fieldInvalidForNumber\": \"מספר כרטיס האשראי הזה אינו חוקי.\",\n \"fieldInvalidForPostalCode\": \"מיקוד זה אינו חוקי.\",\n \"genericError\": \"נראה שמשהו השתבש בצד שלנו.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"כרטיס אשראי זה כבר שמור כשיטת תשלום.\",\n \"hostedFieldsFailedTokenizationError\": \"עליך לבדוק את הפרטים שלך ולנסות שוב.\",\n \"hostedFieldsFieldsInvalidError\": \"עליך לבדוק את הפרטים שלך ולנסות שוב.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"שגיאת רשת. יש לנסות שוב.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"אימות כרטיס האשראי נכשל. עליך לבדוק את הפרטים שלך ולנסות שוב.\",\n \"paypalButtonMustBeUsed\": \"להשתמש בלחצן PayPal כדי להמשיך בביצוע התשלום שלך.\",\n \"paypalAccountTokenizationFailedError\": \"משהו השתבש בו בעת הוספת חשבון PayPal. יש לנסות שוב.\",\n \"paypalFlowFailedError\": \"משהו השתבש בהתחברות ל-PayPal. יש לנסות שוב.\",\n \"paypalTokenizationRequestActiveError\": \"אישור התשלום של PayPal כבר מתבצע.\",\n \"venmoCanceledError\": \"נראה שמשהו השתבש. עליך לוודא שהגרסה העדכנית ביותר של אפליקציית Venmo מותקנת במכשיר שלך, ושהדפדפן שלך תומך במעבר ל-Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"לא הצלחנו למחוק את שיטת התשלום, עליך לנסות שוב.\",\n \"venmoAppFailedError\": \"לא מצאנו למצוא את אפליקציית Venmo במכשיר שלך.\",\n \"unsupportedCardTypeError\": \"סוג כרטיס זה אינו נתמך. עליך לנסות כרטיס אחר.\",\n \"applePayTokenizationError\": \"אירעה שגיאת רשת בעת עיבוד תשלום התשלומים של Apple Pay. יש לנסות שוב.\",\n \"applePayActiveCardError\": \"הוספת כרטיס נתמך לארנק Apple Pay שלך.\",\n \"cardholderNameLabel\": \"שם בעל הכרטיס\",\n \"cardNumberLabel\": \"מספר הכרטיס\",\n \"cvvLabel\": \"קוד האבטחה (CVV)\",\n \"cvvThreeDigitLabelSubheading\": \"(3 ספרות)\",\n \"cvvFourDigitLabelSubheading\": \"(ארבע ספרות)\",\n \"cardholderNamePlaceholder\": \"שם בעל הכרטיס\",\n \"expirationDateLabel\": \"תאריך פקיעת תוקף\",\n \"expirationDateLabelSubheading\": \"(MM/YY)\",\n \"expirationDatePlaceholder\": \"MM/YY\",\n \"postalCodeLabel\": \"מיקוד\",\n \"saveCardLabel\": \"שמירת הכרטיס\",\n \"payWithCard\": \"תשלום באמצעות כרטיס אשראי\",\n \"endingIn\": \"המסתיים בספרות {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"כרטיס\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],230:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Fizetve ezzel {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Válasszon másik fizetési módot\",\n \"chooseAWayToPay\": \"Válasszon fizetési módot\",\n \"otherWaysToPay\": \"Egyéb fizetési módok\",\n \"edit\": \"Szerkesztés\",\n \"doneEditing\": \"Kész\",\n \"editPaymentMethods\": \"Fizetési módok szerkesztése\",\n \"CreditCardDeleteConfirmationMessage\": \"Törli a(z) {{identifier}}-re végződő {{secondaryIdentifier}} kártyát?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Törli a(z) {{identifier}} PayPal-számlát?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Biztosan törli a(z) {{identifier}} felhasználónévhez tartozó Venmo-számlát?\",\n \"genericDeleteConfirmationMessage\": \"Biztosan törli ezt a fizetési módot?\",\n \"deleteCancelButton\": \"Mégse\",\n \"deleteConfirmationButton\": \"Törés\",\n \"fieldEmptyForCvv\": \"Adja meg a CVV-t.\",\n \"fieldEmptyForExpirationDate\": \"Töltse ki a lejárati dátumot.\",\n \"fieldEmptyForCardholderName\": \"Töltse ki a kártyatulajdonos nevét.\",\n \"fieldTooLongForCardholderName\": \"A kártyatulajdonos neve nem lehet hosszabb mint 256 karakter.\",\n \"fieldEmptyForNumber\": \"Töltse ki a számot.\",\n \"fieldEmptyForPostalCode\": \"Töltse ki az irányítószámot.\",\n \"fieldInvalidForCardholderName\": \"Ez a kártyabirtokos neve nem érvényes.\",\n \"fieldInvalidForCvv\": \"Ez a biztonsági kód nem érvényes.\",\n \"fieldInvalidForExpirationDate\": \"Ez a lejárati dátum nem érvényes.\",\n \"fieldInvalidForNumber\": \"Ez a kártyaszám nem érvényes.\",\n \"fieldInvalidForPostalCode\": \"Ez az irányítószám nem érvényes.\",\n \"genericError\": \"Hiba történt a mi oldalunkon.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Ez a hitelkártya már szerepel mentett fizetési módként.\",\n \"hostedFieldsFailedTokenizationError\": \"Ellenőrizze adatait, majd próbálja újra.\",\n \"hostedFieldsFieldsInvalidError\": \"Ellenőrizze adatait, majd próbálja újra.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Hálózati hiba. Próbálja újra.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"A hitelkártya hitelesítése sikertelen. Ellenőrizze adatait, majd próbálja újra.\",\n \"paypalButtonMustBeUsed\": \"A fizetés folytatásához használja a PayPal-gombot.\",\n \"paypalAccountTokenizationFailedError\": \"Hiba történt a PayPal-számla hozzáadása közben. Próbálja újra.\",\n \"paypalFlowFailedError\": \"Hiba történt a PayPalhoz való kapcsolódás közben. Próbálja újra.\",\n \"paypalTokenizationRequestActiveError\": \"A PayPal-fizetés engedélyezése már folyamatban van.\",\n \"venmoCanceledError\": \"Hiba történt. Ellenőrizze, hogy eszközére a Venmo-alkalmazás legfrissebb verziója van-e telepítve, és hogy a böngészője támogatja-e a Venmo-ra történő átváltást.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Nem sikerült törölni a fizetési módot, próbálja újra.\",\n \"venmoAppFailedError\": \"A Venmo-alkalmazást nem találja a rendszer az eszközön.\",\n \"unsupportedCardTypeError\": \"Ez a kártyatípus nem támogatott. Próbáljon meg másik kártyát.\",\n \"applePayTokenizationError\": \"Hálózati hiba történt az Apple Pay-kifizetés közben. Próbálja újra.\",\n \"applePayActiveCardError\": \"Adjon egy támogatott kártyáját az Apple Pay pénztárcához.\",\n \"cardholderNameLabel\": \"Kártyatulajdonos neve\",\n \"cardNumberLabel\": \"Kártyaszám\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 számjegy)\",\n \"cvvFourDigitLabelSubheading\": \"(4 számjegy)\",\n \"cardholderNamePlaceholder\": \"Kártyatulajdonos neve\",\n \"expirationDateLabel\": \"Lejárati dátum\",\n \"expirationDateLabelSubheading\": \"(HH/ÉÉ)\",\n \"expirationDatePlaceholder\": \"HH/ÉÉ\",\n \"postalCodeLabel\": \"Irányítószám\",\n \"saveCardLabel\": \"Kártya mentése\",\n \"payWithCard\": \"Fizetés kártyával\",\n \"endingIn\": \"{{lastFourCardDigits}} végű\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"-kártya\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],231:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Membayar dengan {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Pilih metode pembayaran lain\",\n \"chooseAWayToPay\": \"Pilih metode pembayaran\",\n \"otherWaysToPay\": \"Metode pembayaran lain\",\n \"edit\": \"Edit\",\n \"doneEditing\": \"Selesai\",\n \"editPaymentMethods\": \"Edit metode pembayaran\",\n \"CreditCardDeleteConfirmationMessage\": \"Hapus kartu {{secondaryIdentifier}} yang berakhiran {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Hapus {{identifier}} rekening PayPal?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Yakin akan menghapus rekening Venmo dengan nama pengguna {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Yakin akan menghapus metode pembayaran ini?\",\n \"deleteCancelButton\": \"Batalkan\",\n \"deleteConfirmationButton\": \"Hapus\",\n \"fieldEmptyForCvv\": \"Masukkan CVV.\",\n \"fieldEmptyForExpirationDate\": \"Masukkan tanggal akhir berlaku.\",\n \"fieldEmptyForCardholderName\": \"Masukkan nama pemegang kartu.\",\n \"fieldTooLongForCardholderName\": \"Nama pemegang kartu harus kurang dari 256 karakter.\",\n \"fieldEmptyForNumber\": \"Masukkan nomor.\",\n \"fieldEmptyForPostalCode\": \"Masukkan kode pos.\",\n \"fieldInvalidForCardholderName\": \"Nama pemilik kartu ini tidak valid.\",\n \"fieldInvalidForCvv\": \"Kode keamanan ini tidak valid.\",\n \"fieldInvalidForExpirationDate\": \"Tanggal akhir berlaku ini tidak valid.\",\n \"fieldInvalidForNumber\": \"Nomor kartu ini tidak valid.\",\n \"fieldInvalidForPostalCode\": \"Kode pos ini tidak valid.\",\n \"genericError\": \"Ada yang salah pada sistem kami.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Kartu kredit ini sudah dimasukkan sebagai metode pembayaran tersimpan.\",\n \"hostedFieldsFailedTokenizationError\": \"Periksa informasi Anda dan coba lagi.\",\n \"hostedFieldsFieldsInvalidError\": \"Periksa informasi Anda dan coba lagi.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Masalah jaringan. Coba lagi.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Verifikasi kartu kredit gagal. Periksa informasi Anda dan coba lagi.\",\n \"paypalButtonMustBeUsed\": \"Gunakan tombol PayPal untuk melanjutkan pembayaran Anda.\",\n \"paypalAccountTokenizationFailedError\": \"Terjadi kesalahan saat menambahkan rekening PayPal. Coba lagi.\",\n \"paypalFlowFailedError\": \"Terjadi kesalahan saat menyambung ke PayPal. Coba lagi.\",\n \"paypalTokenizationRequestActiveError\": \"Otorisasi pembayaran PayPal sedang diproses.\",\n \"venmoCanceledError\": \"Terdapat kesalahan. Pastikan Anda telah menginstal aplikasi Venmo versi terbaru pada perangkat dan peramban Anda mendukung untuk beralih ke Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Tidak dapat menghapus metode pembayaran, coba lagi.\",\n \"venmoAppFailedError\": \"Aplikasi Venmo tidak dapat ditemukan pada perangkat Anda.\",\n \"unsupportedCardTypeError\": \"Jenis kartu ini tidak didukung. Coba kartu lainnya.\",\n \"applePayTokenizationError\": \"Terjadi kesalahan jaringan sewaktu memproses pembayaran melalui Apple Pay. Coba lagi.\",\n \"applePayActiveCardError\": \"Tambahkan kartu yang didukung ke wallet Apple Pay.\",\n \"cardholderNameLabel\": \"Nama Pemegang Kartu\",\n \"cardNumberLabel\": \"Nomor Kartu\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 angka)\",\n \"cvvFourDigitLabelSubheading\": \"(4 angka)\",\n \"cardholderNamePlaceholder\": \"Nama Pemegang Kartu\",\n \"expirationDateLabel\": \"Tanggal Kedaluwarsa\",\n \"expirationDateLabelSubheading\": \"(BB/TT)\",\n \"expirationDatePlaceholder\": \"BB/TT\",\n \"postalCodeLabel\": \"Kode Pos\",\n \"saveCardLabel\": \"Simpan kartu\",\n \"payWithCard\": \"Bayar dengan kartu\",\n \"endingIn\": \"Berakhiran {{lastTwoCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Kartu\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],232:[function(require,module,exports){\n/* eslint-disable camelcase */\n'use strict';\n\nvar assign = require('../lib/assign').assign;\n\nvar fiveCharacterLocales = {\n ar_EG: require('./ar_EG'),\n cs_CZ: require('./cs_CZ'),\n da_DK: require('./da_DK'),\n de_DE: require('./de_DE'),\n el_GR: require('./el_GR'),\n en_AU: require('./en_AU'),\n en_GB: require('./en_GB'),\n en_IN: require('./en_IN'),\n en_US: require('./en_US'),\n es_ES: require('./es_ES'),\n es_XC: require('./es_XC'),\n fi_FI: require('./fi_FI'),\n fr_CA: require('./fr_CA'),\n fr_FR: require('./fr_FR'),\n fr_XC: require('./fr_XC'),\n he_IL: require('./he_IL'),\n hu_HU: require('./hu_HU'),\n id_ID: require('./id_ID'),\n it_IT: require('./it_IT'),\n ja_JP: require('./ja_JP'),\n ko_KR: require('./ko_KR'),\n nl_NL: require('./nl_NL'),\n no_NO: require('./no_NO'),\n pl_PL: require('./pl_PL'),\n pt_BR: require('./pt_BR'),\n pt_PT: require('./pt_PT'),\n ru_RU: require('./ru_RU'),\n sk_SK: require('./sk_SK'),\n sv_SE: require('./sv_SE'),\n th_TH: require('./th_TH'),\n zh_CN: require('./zh_CN'),\n zh_HK: require('./zh_HK'),\n zh_TW: require('./zh_TW'),\n zh_XC: require('./zh_XC')\n};\n\nvar twoCharacterLocaleAliases = {\n ar: fiveCharacterLocales.ar_EG,\n cs: fiveCharacterLocales.cs_CZ,\n da: fiveCharacterLocales.da_DK,\n de: fiveCharacterLocales.de_DE,\n el: fiveCharacterLocales.el_GR,\n en: fiveCharacterLocales.en_US,\n es: fiveCharacterLocales.es_ES,\n fi: fiveCharacterLocales.fi_FI,\n fr: fiveCharacterLocales.fr_FR,\n id: fiveCharacterLocales.id_ID,\n it: fiveCharacterLocales.it_IT,\n hu: fiveCharacterLocales.hu_HU,\n ja: fiveCharacterLocales.ja_JP,\n ko: fiveCharacterLocales.ko_KR,\n nl: fiveCharacterLocales.nl_NL,\n no: fiveCharacterLocales.no_NO,\n pl: fiveCharacterLocales.pl_PL,\n pt: fiveCharacterLocales.pt_PT,\n ru: fiveCharacterLocales.ru_RU,\n sk: fiveCharacterLocales.sk_SK,\n sv: fiveCharacterLocales.sv_SE,\n th: fiveCharacterLocales.th_TH,\n zh: fiveCharacterLocales.zh_CN\n};\n\nmodule.exports = {\n twoCharacterLocaleAliases: twoCharacterLocaleAliases,\n fiveCharacterLocales: fiveCharacterLocales,\n translations: assign({}, twoCharacterLocaleAliases, fiveCharacterLocales)\n};\n/* eslint-enable camelcase */\n\n},{\"../lib/assign\":197,\"./ar_EG\":214,\"./cs_CZ\":215,\"./da_DK\":216,\"./de_DE\":217,\"./el_GR\":218,\"./en_AU\":219,\"./en_GB\":220,\"./en_IN\":221,\"./en_US\":222,\"./es_ES\":223,\"./es_XC\":224,\"./fi_FI\":225,\"./fr_CA\":226,\"./fr_FR\":227,\"./fr_XC\":228,\"./he_IL\":229,\"./hu_HU\":230,\"./id_ID\":231,\"./it_IT\":233,\"./ja_JP\":234,\"./ko_KR\":235,\"./nl_NL\":236,\"./no_NO\":237,\"./pl_PL\":238,\"./pt_BR\":239,\"./pt_PT\":240,\"./ru_RU\":241,\"./sk_SK\":242,\"./sv_SE\":243,\"./th_TH\":244,\"./zh_CN\":245,\"./zh_HK\":246,\"./zh_TW\":247,\"./zh_XC\":248}],233:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Pagamento con {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Scegli di pagare in un altro modo\",\n \"chooseAWayToPay\": \"Scegli come pagare\",\n \"otherWaysToPay\": \"Altri modi di pagare\",\n \"edit\": \"Modifica\",\n \"doneEditing\": \"Fine\",\n \"editPaymentMethods\": \"Modifica i metodi di pagamento\",\n \"CreditCardDeleteConfirmationMessage\": \"Eliminare la carta {{secondaryIdentifier}} le cui ultime cifre sono {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Eliminare il conto PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Vuoi eliminare il conto Venmo con nome utente {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Vuoi eliminare questo metodo di pagamento?\",\n \"deleteCancelButton\": \"Annulla\",\n \"deleteConfirmationButton\": \"Rimuovi\",\n \"fieldEmptyForCvv\": \"Immetti il codice di sicurezza (CVV).\",\n \"fieldEmptyForExpirationDate\": \"Immetti la data di scadenza.\",\n \"fieldEmptyForCardholderName\": \"Immetti il nome del titolare della carta.\",\n \"fieldTooLongForCardholderName\": \"Il nome del titolare della carta deve avere meno di 256 caratteri.\",\n \"fieldEmptyForNumber\": \"Immetti il numero di carta.\",\n \"fieldEmptyForPostalCode\": \"Immetti il CAP.\",\n \"fieldInvalidForCardholderName\": \"Il nome del titolare non è valido.\",\n \"fieldInvalidForCvv\": \"Il codice di sicurezza non è valido.\",\n \"fieldInvalidForExpirationDate\": \"La data di scadenza non è valida.\",\n \"fieldInvalidForNumber\": \"Il numero di carta non è valido.\",\n \"fieldInvalidForPostalCode\": \"Il CAP non è valido.\",\n \"genericError\": \"Si è verificato un errore nei nostri sistemi.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Questa carta di credito è già registrata come metodo di pagamento salvato.\",\n \"hostedFieldsFailedTokenizationError\": \"Controlla e riprova.\",\n \"hostedFieldsFieldsInvalidError\": \"Controlla e riprova.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Errore di rete. Riprova.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"La verifica della carta di credito non è andata a buon fine. Controlla i dati e riprova.\",\n \"paypalButtonMustBeUsed\": \"Usa il pulsante PayPal per procedere al pagamento.\",\n \"paypalAccountTokenizationFailedError\": \"Si è verificato un errore nel collegamento del conto PayPal. Riprova.\",\n \"paypalFlowFailedError\": \"Si è verificato un errore di connessione a PayPal. Riprova.\",\n \"paypalTokenizationRequestActiveError\": \"L'autorizzazione di pagamento PayPal è già in corso.\",\n \"venmoCanceledError\": \"Si è verificato un errore. Assicurati di avere la versione più recente dell'app Venmo installata sul tuo dispositivo e che il browser supporti l'uso di Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Impossibile eliminare il metodo di pagamento; riprova.\",\n \"venmoAppFailedError\": \"Impossibile trovare l'app Venmo sul dispositivo in uso.\",\n \"unsupportedCardTypeError\": \"Questo tipo di carta non è supportato. Prova con un'altra carta.\",\n \"applePayTokenizationError\": \"Si è verificato un errore di rete durante l'elaborazione del pagamento con Apple Pay. Riprova.\",\n \"applePayActiveCardError\": \"Collega una carta supportata al tuo Apple Pay Wallet.\",\n \"cardholderNameLabel\": \"Titolare della carta\",\n \"cardNumberLabel\": \"Numero di carta\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 cifre)\",\n \"cvvFourDigitLabelSubheading\": \"(4 cifre)\",\n \"cardholderNamePlaceholder\": \"Titolare della carta\",\n \"expirationDateLabel\": \"Data di scadenza\",\n \"expirationDateLabelSubheading\": \"(MM/AA)\",\n \"expirationDatePlaceholder\": \"MM/AA\",\n \"postalCodeLabel\": \"CAP\",\n \"saveCardLabel\": \"Salva carta\",\n \"payWithCard\": \"Paga con una carta\",\n \"endingIn\": \"Le cui ultime cifre sono {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Carta\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],234:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"{{paymentSource}}で支払う\",\n \"chooseAnotherWayToPay\": \"別の支払方法を選択する\",\n \"chooseAWayToPay\": \"支払方法を選択する\",\n \"otherWaysToPay\": \"その他の支払方法\",\n \"edit\": \"編集\",\n \"doneEditing\": \"完了\",\n \"editPaymentMethods\": \"支払方法の編集\",\n \"CreditCardDeleteConfirmationMessage\": \"末尾が{{identifier}}の{{secondaryIdentifier}}カードを削除しますか?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"PayPalアカウント{{identifier}}を削除しますか?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"ユーザー名{{identifier}}のVenmoアカウントを削除してよろしいですか?\",\n \"genericDeleteConfirmationMessage\": \"この支払い方法を削除してよろしいですか?\",\n \"deleteCancelButton\": \"キャンセル\",\n \"deleteConfirmationButton\": \"削除\",\n \"fieldEmptyForCvv\": \"セキュリティコードを入力してください。\",\n \"fieldEmptyForExpirationDate\": \"有効期限を入力してください。\",\n \"fieldEmptyForCardholderName\": \"カード保有者の名前を入力してください。\",\n \"fieldTooLongForCardholderName\": \"カード保有者の名前は256文字未満にしてください。\",\n \"fieldEmptyForNumber\": \"番号を入力してください。\",\n \"fieldEmptyForPostalCode\": \"郵便番号を入力してください。\",\n \"fieldInvalidForCardholderName\": \"このカード保有者の名前は無効です。\",\n \"fieldInvalidForCvv\": \"このセキュリティコードは無効です。\",\n \"fieldInvalidForExpirationDate\": \"この有効期限は無効です。\",\n \"fieldInvalidForNumber\": \"このカード番号は無効です。\",\n \"fieldInvalidForPostalCode\": \"この郵便番号は無効です。\",\n \"genericError\": \"弊社側で問題が発生しました。\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"このクレジットカードは、保存済みの支払方法としてすでに登録されています。\",\n \"hostedFieldsFailedTokenizationError\": \"情報を確認してもう一度お試しください。\",\n \"hostedFieldsFieldsInvalidError\": \"情報を確認してもう一度お試しください。\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"ネットワークエラーです。もう一度お試しください。\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"クレジットカードの認証に失敗しました。情報を確認してもう一度お試しください。\",\n \"paypalButtonMustBeUsed\": \"お客さまの支払いを続行するには、PayPalボタンを使用します。\",\n \"paypalAccountTokenizationFailedError\": \"PayPalアカウントの追加で問題が発生しました。もう一度お試しください。\",\n \"paypalFlowFailedError\": \"PayPalへの接続に問題が発生しました。もう一度お試しください。\",\n \"paypalTokenizationRequestActiveError\": \"PayPal支払いの承認はすでに処理中です。\",\n \"venmoCanceledError\": \"問題が発生しました。お客さまの端末にインストールされているVenmoアプリが最新のバージョンであること、お使いのブラウザがVenmoへの切り替えをサポートしていることを確認してください。\",\n \"vaultManagerPaymentMethodDeletionError\": \"支払方法を削除できません。もう一度お試しください。\",\n \"venmoAppFailedError\": \"お客さまの端末でVenmoアプリが見つかりませんでした。\",\n \"unsupportedCardTypeError\": \"このカードタイプはサポートされていません。別のカードをご使用ください。\",\n \"applePayTokenizationError\": \"Apple Payの支払いを処理する際にネットワークエラーが発生しました。もう一度お試しください。\",\n \"applePayActiveCardError\": \"Apple Payウォレットに対応しているカードを追加してください。\",\n \"cardholderNameLabel\": \"カード保有者の名前\",\n \"cardNumberLabel\": \"カード番号\",\n \"cvvLabel\": \"セキュリティコード\",\n \"cvvThreeDigitLabelSubheading\": \"(3桁)\",\n \"cvvFourDigitLabelSubheading\": \"(4桁)\",\n \"cardholderNamePlaceholder\": \"カード保有者の名前\",\n \"expirationDateLabel\": \"有効期限\",\n \"expirationDateLabelSubheading\": \"(MM/YY)\",\n \"expirationDatePlaceholder\": \"MM/YY\",\n \"postalCodeLabel\": \"郵便番号\",\n \"saveCardLabel\": \"カードを保存\",\n \"payWithCard\": \"カードで支払う\",\n \"endingIn\": \"末尾が{{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"カード\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"銀聯(UnionPay)\"\n};\n\n},{}],235:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"{{paymentSource}}(으)로 결제\",\n \"chooseAnotherWayToPay\": \"다른 결제수단 선택\",\n \"chooseAWayToPay\": \"결제수단 선택\",\n \"otherWaysToPay\": \"다른 방법으로 결제\",\n \"edit\": \"편집\",\n \"doneEditing\": \"완료\",\n \"editPaymentMethods\": \"결제수단 편집\",\n \"CreditCardDeleteConfirmationMessage\": \"끝번호가 {{identifier}}인 {{secondaryIdentifier}} 카드를 삭제하시겠어요?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"PayPal 계정 {{identifier}}을(를) 삭제하시겠어요?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"사용자 이름이 {{identifier}}인 Venmo 계정을 삭제하시겠어요?\",\n \"genericDeleteConfirmationMessage\": \"이 결제수단을 삭제하시겠어요?\",\n \"deleteCancelButton\": \"취소\",\n \"deleteConfirmationButton\": \"삭제\",\n \"fieldEmptyForCvv\": \"CVV를 입력하세요.\",\n \"fieldEmptyForExpirationDate\": \"만료일을 입력하세요.\",\n \"fieldEmptyForCardholderName\": \"카드 소유자 이름을 입력하세요.\",\n \"fieldTooLongForCardholderName\": \"카드 소유자 이름은 256자 미만이어야 합니다.\",\n \"fieldEmptyForNumber\": \"번호를 입력하세요.\",\n \"fieldEmptyForPostalCode\": \"우편번호를 입력하세요.\",\n \"fieldInvalidForCardholderName\": \"이 카드 소유자 이름은 유효하지 않습니다.\",\n \"fieldInvalidForCvv\": \"이 보안 코드가 올바르지 않습니다.\",\n \"fieldInvalidForExpirationDate\": \"이 만료일이 올바르지 않습니다.\",\n \"fieldInvalidForNumber\": \"이 카드 번호가 올바르지 않습니다.\",\n \"fieldInvalidForPostalCode\": \"이 우편번호가 올바르지 않습니다.\",\n \"genericError\": \"저희 쪽에 문제가 발생했습니다.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"저장된 결제수단에 이미 이 신용카드가 존재합니다.\",\n \"hostedFieldsFailedTokenizationError\": \"정보를 확인하고 다시 시도해 주세요.\",\n \"hostedFieldsFieldsInvalidError\": \"정보를 확인하고 다시 시도해 주세요.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"네트워크 오류가 발생했습니다. 다시 시도해 주세요.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"신용카드 인증에 실패했습니다. 정보를 확인하고 다시 시도해 주세요.\",\n \"paypalButtonMustBeUsed\": \"결제를 계속하려면 PayPal 버튼을 사용하세요.\",\n \"paypalAccountTokenizationFailedError\": \"PayPal 계정을 추가하는 동안 문제가 발생했습니다. 다시 시도해 주세요.\",\n \"paypalFlowFailedError\": \"PayPal 계정을 연결하는 동안 문제가 발생했습니다. 다시 시도해 주세요.\",\n \"paypalTokenizationRequestActiveError\": \"PayPal 결제 승인이 이미 진행 중입니다.\",\n \"venmoCanceledError\": \"오류가 발생했습니다. 기기에 최신 버전의 Venmo 앱이 설치되어 있으며 브라우저가 Venmo로 전환 기능을 지원하는지 확인하세요.\",\n \"vaultManagerPaymentMethodDeletionError\": \"결제수단을 삭제할 수 없습니다. 다시 시도해 주세요.\",\n \"venmoAppFailedError\": \"기기에서 Venmo 앱을 찾을 수 없습니다.\",\n \"unsupportedCardTypeError\": \"이 카드 형식은 지원되지 않습니다. 다른 카드로 시도해 주세요.\",\n \"applePayTokenizationError\": \"Apple Pay 결제를 처리하는 동안 네트워크 오류가 발생했습니다. 다시 시도해 주세요.\",\n \"applePayActiveCardError\": \"Apple Pay 전자지갑에 지원되는 카드를 추가하세요.\",\n \"cardholderNameLabel\": \"카드 소유자 이름\",\n \"cardNumberLabel\": \"카드 번호\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3자리)\",\n \"cvvFourDigitLabelSubheading\": \"(4자리)\",\n \"cardholderNamePlaceholder\": \"카드 소유자 이름\",\n \"expirationDateLabel\": \"만료일\",\n \"expirationDateLabelSubheading\": \"(MM/YY)\",\n \"expirationDatePlaceholder\": \"MM/YY\",\n \"postalCodeLabel\": \"우편번호\",\n \"saveCardLabel\": \"카드 저장\",\n \"payWithCard\": \"카드로 결제\",\n \"endingIn\": \"끝번호: {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"카드\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],236:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Betalen met {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Kies een andere betaalmethode\",\n \"chooseAWayToPay\": \"Kies een betaalwijze\",\n \"otherWaysToPay\": \"Andere manieren om te betalen\",\n \"edit\": \"Bewerk\",\n \"doneEditing\": \"Klaar\",\n \"editPaymentMethods\": \"Betaalmethoden aanpassen\",\n \"CreditCardDeleteConfirmationMessage\": \"{{secondaryIdentifier}}-kaart eindigend op {{identifier}} verwijderen?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"PayPal-rekening {{identifier}} verwijderen?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Weet u zeker dat u Venmo-rekening met gebruikersnaam {{identifier}} wilt verwijderen?\",\n \"genericDeleteConfirmationMessage\": \"Weet u zeker dat u deze betaalmethode wilt verwijderen?\",\n \"deleteCancelButton\": \"Annuleren\",\n \"deleteConfirmationButton\": \"Verwijderen\",\n \"fieldEmptyForCvv\": \"Vul een CSC in.\",\n \"fieldEmptyForExpirationDate\": \"Vul een vervaldatum in.\",\n \"fieldEmptyForCardholderName\": \"Vul een naam voor de kaarthouder in.\",\n \"fieldTooLongForCardholderName\": \"De naam van de kaarthouder moet korter zijn dan 256 tekens.\",\n \"fieldEmptyForNumber\": \"Vul een nummer in.\",\n \"fieldEmptyForPostalCode\": \"Vul een postcode in.\",\n \"fieldInvalidForCardholderName\": \"Naam kaarthouder is ongeldig.\",\n \"fieldInvalidForCvv\": \"Deze CSC is ongeldig.\",\n \"fieldInvalidForExpirationDate\": \"Deze vervaldatum is ongeldig.\",\n \"fieldInvalidForNumber\": \"Dit creditcardnummer is ongeldig.\",\n \"fieldInvalidForPostalCode\": \"Deze postcode is ongeldig.\",\n \"genericError\": \"Er is iets fout gegaan.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Deze creditcard staat al geregistreerd als een opgeslagen betaalmethode.\",\n \"hostedFieldsFailedTokenizationError\": \"Controleer uw gegevens en probeer het opnieuw.\",\n \"hostedFieldsFieldsInvalidError\": \"Controleer uw gegevens en probeer het opnieuw.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Netwerkfout. Probeer het opnieuw.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"De controle van de creditcard is mislukt. Controleer uw gegevens en probeer het opnieuw.\",\n \"paypalButtonMustBeUsed\": \"Gebruik de PayPal-knop om door te gaan met uw betaling.\",\n \"paypalAccountTokenizationFailedError\": \"Er is iets misgegaan bij het toevoegen van de PayPal-rekening. Probeer het opnieuw.\",\n \"paypalFlowFailedError\": \"Er is iets misgegaan bij de verbinding met PayPal. Probeer het opnieuw.\",\n \"paypalTokenizationRequestActiveError\": \"De autorisatie van de PayPal-betaling is al in behandeling.\",\n \"venmoCanceledError\": \"Er ging iets fout. Controleer of de meest recente versie van de Venmo-app op je apparaat is geïnstalleerd en dat je browser overschakelen naar Venmo ondersteunt.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Kan de betaalmethode niet verwijderen, probeer het opnieuw.\",\n \"venmoAppFailedError\": \"De Venmo-app is niet aangetroffen op je apparaat.\",\n \"unsupportedCardTypeError\": \"Dit type creditcard wordt niet ondersteund. Gebruik een andere creditcard.\",\n \"applePayTokenizationError\": \"Er is een netwerkfout opgetreden bij het verwerken van de Apple Pay-betaling. Probeer het opnieuw.\",\n \"applePayActiveCardError\": \"Voeg een ondersteunde creditcard toe aan je Apple Pay-wallet.\",\n \"cardholderNameLabel\": \"Naam kaarthouder\",\n \"cardNumberLabel\": \"Creditcardnummer\",\n \"cvvLabel\": \"CSC\",\n \"cvvThreeDigitLabelSubheading\": \"(3 cijfers)\",\n \"cvvFourDigitLabelSubheading\": \"(4 cijfers)\",\n \"cardholderNamePlaceholder\": \"Naam kaarthouder\",\n \"expirationDateLabel\": \"Vervaldatum\",\n \"expirationDateLabelSubheading\": \"(MM/JJ)\",\n \"expirationDatePlaceholder\": \"MM/JJ\",\n \"postalCodeLabel\": \"Postcode\",\n \"saveCardLabel\": \"Creditcard opslaan\",\n \"payWithCard\": \"Betalen met creditcard\",\n \"endingIn\": \"Eindigend op {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Creditcard\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],237:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Betaling med {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Velg en annen måte å betale på\",\n \"chooseAWayToPay\": \"Velg betalingsmåte\",\n \"otherWaysToPay\": \"Andre måter å betale på\",\n \"edit\": \"Rediger\",\n \"doneEditing\": \"Fullført\",\n \"editPaymentMethods\": \"Endre betalingsmetodene dine\",\n \"CreditCardDeleteConfirmationMessage\": \"Vil du slette {{secondaryIdentifier}}-kortet som slutter på {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Vil du slette PayPal-kontoen {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Er du sikker på at du vil slette Venmo-kontoen med brukernavnet {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Er du sikker på at du vil slette denne betalingsmetoden?\",\n \"deleteCancelButton\": \"Avbryt\",\n \"deleteConfirmationButton\": \"Slett\",\n \"fieldEmptyForCvv\": \"Oppgi en kortsikkerhetskode (CVV).\",\n \"fieldEmptyForExpirationDate\": \"Oppgi en utløpsdato.\",\n \"fieldEmptyForCardholderName\": \"Oppgi et navn for kortinnehaveren.\",\n \"fieldTooLongForCardholderName\": \"Makslengden for kortinnehaverens navn er 256 tegn.\",\n \"fieldEmptyForNumber\": \"Oppgi et nummer.\",\n \"fieldEmptyForPostalCode\": \"Oppgi et postnummer.\",\n \"fieldInvalidForCardholderName\": \"Denne kortinnehaverens navn er ikke gyldig.\",\n \"fieldInvalidForCvv\": \"Denne sikkerhetskoden er ikke gyldig.\",\n \"fieldInvalidForExpirationDate\": \"Denne utløpsdatoen er ikke gyldig.\",\n \"fieldInvalidForNumber\": \"Dette kortnummeret er ikke gyldig.\",\n \"fieldInvalidForPostalCode\": \"Dette postnummeret er ikke gyldig.\",\n \"genericError\": \"Noe gikk galt hos oss.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Dette betalingskortet eksisterer allerede som en lagret betalingsmetode.\",\n \"hostedFieldsFailedTokenizationError\": \"Kontroller informasjonen og prøv på nytt.\",\n \"hostedFieldsFieldsInvalidError\": \"Kontroller informasjonen og prøv på nytt.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Nettverksfeil. Prøv på nytt.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Bekreftelsen av betalingskortet mislyktes. Kontroller informasjonen og prøv på nytt.\",\n \"paypalButtonMustBeUsed\": \"Bruk PayPal-knappen for å fortsette med betalingen.\",\n \"paypalAccountTokenizationFailedError\": \"Noe gikk galt da PayPal-kontoen ble lagt til. Prøv på nytt.\",\n \"paypalFlowFailedError\": \"Det oppsto et problem med tilkoblingen til PayPal. Prøv på nytt.\",\n \"paypalTokenizationRequestActiveError\": \"Godkjenning av PayPal-betalingen pågår allerede\",\n \"venmoCanceledError\": \"Noe gikk galt. Kontroller at du har installert den nyeste versjonen av Venmo-appen på enheten og at nettleseren din støtter bytte til Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Kunne ikke slette betalingsmetoden. Prøv på nytt.\",\n \"venmoAppFailedError\": \"Finner ikke Venmo-appen på enheten.\",\n \"unsupportedCardTypeError\": \"Denne korttypen støttes ikke. Prøv med et annet kort.\",\n \"applePayTokenizationError\": \"Det oppsto en nettverksfeil under behandlingen av Apple Pay-betalingen. Prøv på nytt.\",\n \"applePayActiveCardError\": \"Legg til et kort som støttes i Apple Pay-lommeboken din.\",\n \"cardholderNameLabel\": \"Kortinnehaverens navn\",\n \"cardNumberLabel\": \"Kortnummer\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 siffer)\",\n \"cvvFourDigitLabelSubheading\": \"(4 siffer)\",\n \"cardholderNamePlaceholder\": \"Kortinnehaverens navn\",\n \"expirationDateLabel\": \"Utløpsdato\",\n \"expirationDateLabelSubheading\": \"(MM/ÅÅ)\",\n \"expirationDatePlaceholder\": \"MM/ÅÅ\",\n \"postalCodeLabel\": \"Postnummer\",\n \"saveCardLabel\": \"Lagre kort\",\n \"payWithCard\": \"Betal med kort\",\n \"endingIn\": \"Slutter på {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Kort\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],238:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Źródło finansowania płatności: {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Wybierz inne źródło finansowania płatności\",\n \"chooseAWayToPay\": \"Wybierz źródło finansowania płatności\",\n \"otherWaysToPay\": \"Inne źródła finansowania płatności\",\n \"edit\": \"Edytuj\",\n \"doneEditing\": \"Gotowe\",\n \"editPaymentMethods\": \"Edytuj źródła finansowania płatności\",\n \"CreditCardDeleteConfirmationMessage\": \"Usunąć kartę {{secondaryIdentifier}} o numerze zakończonym cyframi {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Usunąć konto PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Czy na pewno chcesz usunąć konto Venmo z nazwą użytkownika {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Czy na pewno chcesz usunąć to źródło finansowania płatności?\",\n \"deleteCancelButton\": \"Anuluj\",\n \"deleteConfirmationButton\": \"Usuń\",\n \"fieldEmptyForCvv\": \"Podaj kod bezpieczeństwa.\",\n \"fieldEmptyForExpirationDate\": \"Podaj datę ważności.\",\n \"fieldEmptyForCardholderName\": \"Podaj imię i nazwisko posiadacza karty.\",\n \"fieldTooLongForCardholderName\": \"Imię i nazwisko posiadacza karty musi mieć mniej niż 256 znaków.\",\n \"fieldEmptyForNumber\": \"Podaj numer.\",\n \"fieldEmptyForPostalCode\": \"Podaj kod pocztowy.\",\n \"fieldInvalidForCardholderName\": \"To imię i nazwisko posiadacza karty jest nieprawidłowe.\",\n \"fieldInvalidForCvv\": \"Podany kod bezpieczeństwa jest nieprawidłowy.\",\n \"fieldInvalidForExpirationDate\": \"Podana data ważności jest nieprawidłowa.\",\n \"fieldInvalidForNumber\": \"Podany numer karty jest nieprawidłowy.\",\n \"fieldInvalidForPostalCode\": \"Podany kod pocztowy jest nieprawidłowy.\",\n \"genericError\": \"Wystąpił błąd po naszej stronie.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Ta karta kredytowa jest już zapisana jako źródło finansowania płatności.\",\n \"hostedFieldsFailedTokenizationError\": \"Sprawdź swoje informacje i spróbuj ponownie.\",\n \"hostedFieldsFieldsInvalidError\": \"Sprawdź swoje informacje i spróbuj ponownie.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Błąd sieci. Spróbuj ponownie.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Weryfikacja karty kredytowej nie powiodła się. Sprawdź swoje informacje i spróbuj ponownie.\",\n \"paypalButtonMustBeUsed\": \"Użyj przycisku PayPal, aby kontynuować płatność.\",\n \"paypalAccountTokenizationFailedError\": \"Coś poszło nie tak podczas dodawania konta PayPal. Spróbuj ponownie.\",\n \"paypalFlowFailedError\": \"Coś poszło nie tak podczas łączenia z systemem PayPal. Spróbuj ponownie.\",\n \"paypalTokenizationRequestActiveError\": \"Autoryzacja płatności PayPal jest już w trakcie realizacji.\",\n \"venmoCanceledError\": \"Wystąpił problem. Upewnij się, czy na swoim urządzeniu masz zainstalowaną najnowszą wersję aplikacji Venmo i Twoja przeglądarka ją obsługuje.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Nie można usunąć źródła finansowania płatności. Spróbuj ponownie.\",\n \"venmoAppFailedError\": \"Nie można odnaleźć aplikacji Venmo na urządzeniu.\",\n \"unsupportedCardTypeError\": \"Ten typ karty nie jest obsługiwany. Spróbuj użyć innej karty.\",\n \"applePayTokenizationError\": \"Wystąpił błąd sieci podczas przetwarzania płatności Apple Pay. Spróbuj ponownie.\",\n \"applePayActiveCardError\": \"Dodaj obsługiwaną kartę do portfela Apple Pay.\",\n \"cardholderNameLabel\": \"Imię i nazwisko posiadacza karty\",\n \"cardNumberLabel\": \"Numer karty\",\n \"cvvLabel\": \"Kod CVC\",\n \"cvvThreeDigitLabelSubheading\": \"(3 cyfry)\",\n \"cvvFourDigitLabelSubheading\": \"(4 cyfry)\",\n \"cardholderNamePlaceholder\": \"Imię i nazwisko posiadacza karty\",\n \"expirationDateLabel\": \"Data ważności\",\n \"expirationDateLabelSubheading\": \"(MM/RR)\",\n \"expirationDatePlaceholder\": \"MM/RR\",\n \"postalCodeLabel\": \"Kod pocztowy\",\n \"saveCardLabel\": \"Zapisz kartę\",\n \"payWithCard\": \"Zapłać kartą\",\n \"endingIn\": \"O numerze zakończonym cyframi {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Karta\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],239:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Pagando com {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Escolher outro meio de pagamento\",\n \"chooseAWayToPay\": \"Escolher um meio de pagamento\",\n \"otherWaysToPay\": \"Outro meio de pagamento\",\n \"edit\": \"Editar\",\n \"doneEditing\": \"Concluído\",\n \"editPaymentMethods\": \"Editar meios de pagamento\",\n \"CreditCardDeleteConfirmationMessage\": \"Excluir cartão com {{secondaryIdentifier}} com final {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Excluir conta do PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Tem certeza de que deseja excluir a conta do Venmo com o nome de usuário {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Tem certeza de que deseja excluir este meio de pagamento?\",\n \"deleteCancelButton\": \"Cancelar\",\n \"deleteConfirmationButton\": \"Excluir\",\n \"fieldEmptyForCvv\": \"Informe o Código de Segurança.\",\n \"fieldEmptyForExpirationDate\": \"Informe a data de vencimento.\",\n \"fieldEmptyForCardholderName\": \"Informe o nome do titular do cartão.\",\n \"fieldTooLongForCardholderName\": \"O nome do titular do cartão deve ter menos de 256 caracteres.\",\n \"fieldEmptyForNumber\": \"Informe um número.\",\n \"fieldEmptyForPostalCode\": \"Informe um CEP.\",\n \"fieldInvalidForCardholderName\": \"O nome do titular do cartão é inválido.\",\n \"fieldInvalidForCvv\": \"Este código de segurança não é válido.\",\n \"fieldInvalidForExpirationDate\": \"Esta data de vencimento não é válida.\",\n \"fieldInvalidForNumber\": \"O número do cartão não é válido.\",\n \"fieldInvalidForPostalCode\": \"Este CEP não é válido.\",\n \"genericError\": \"Ocorreu um erro.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Este cartão de crédito já está salvo em seus meios de pagamento.\",\n \"hostedFieldsFailedTokenizationError\": \"Verifique as informações e tente novamente.\",\n \"hostedFieldsFieldsInvalidError\": \"Verifique as informações e tente novamente.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Erro de rede. Tente novamente.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Falha ao verificar o cartão de crédito. Verifique as informações e tente novamente.\",\n \"paypalButtonMustBeUsed\": \"Use o botão do PayPal para prosseguir com o seu pagamento.\",\n \"paypalAccountTokenizationFailedError\": \"Ocorreu um erro ao adicionar a conta do PayPal. Tente novamente.\",\n \"paypalFlowFailedError\": \"Ocorreu um erro de conexão com o PayPal. Tente novamente.\",\n \"paypalTokenizationRequestActiveError\": \"A autorização de pagamento do PayPal já está em andamento.\",\n \"venmoCanceledError\": \"Ocorreu um erro. Certifique-se de ter a versão mais recente do aplicativo Venmo instalado no seu dispositivo e que o seu navegador suporte a mudança para o Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Não é possível excluir o meio de pagamento, tente novamente.\",\n \"venmoAppFailedError\": \"Não foi possível encontrar o aplicativo Venmo no seu dispositivo.\",\n \"unsupportedCardTypeError\": \"Este tipo de cartão não é aceito. Experimente outro cartão.\",\n \"applePayTokenizationError\": \"Ocorreu um erro de rede ao processar o pagamento com Apple Pay. Tente novamente.\",\n \"applePayActiveCardError\": \"Adicione cartão suportado à sua carteira do Apple Pay.\",\n \"cardholderNameLabel\": \"Nome do titular do cartão\",\n \"cardNumberLabel\": \"Número do cartão\",\n \"cvvLabel\": \"CSC\",\n \"cvvThreeDigitLabelSubheading\": \"(3 dígitos)\",\n \"cvvFourDigitLabelSubheading\": \"(4 dígitos)\",\n \"cardholderNamePlaceholder\": \"Nome do titular do cartão\",\n \"expirationDateLabel\": \"Data de vencimento\",\n \"expirationDateLabelSubheading\": \"(MM/AA)\",\n \"expirationDatePlaceholder\": \"MM/AA\",\n \"postalCodeLabel\": \"CEP\",\n \"saveCardLabel\": \"Salvar cartão\",\n \"payWithCard\": \"Pague com seu cartão\",\n \"endingIn\": \"Com final {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Cartão\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],240:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Pagar com {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Escolher outra forma de pagamento\",\n \"chooseAWayToPay\": \"Escolha um meio de pagamento\",\n \"otherWaysToPay\": \"Outras formas de pagamento\",\n \"edit\": \"Editar\",\n \"doneEditing\": \"Concluído\",\n \"editPaymentMethods\": \"Editar meios de pagamento\",\n \"CreditCardDeleteConfirmationMessage\": \"Eliminar o cartão {{secondaryIdentifier}} terminado em {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Eliminar {{identifier}} da conta PayPal?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Tem a certeza de que pretende eliminar a conta Venmo com o nome de utilizador {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Tem certeza de que pretende eliminar este meio de pagamento?\",\n \"deleteCancelButton\": \"Cancelar\",\n \"deleteConfirmationButton\": \"Eliminar\",\n \"fieldEmptyForCvv\": \"Introduza o código CVV.\",\n \"fieldEmptyForExpirationDate\": \"Introduza a data de validade.\",\n \"fieldEmptyForCardholderName\": \"Introduza um nome do titular do cartão.\",\n \"fieldTooLongForCardholderName\": \"O nome do titular do cartão tem de ter menos de 256 carateres.\",\n \"fieldEmptyForNumber\": \"Introduza um número.\",\n \"fieldEmptyForPostalCode\": \"Introduza o código postal.\",\n \"fieldInvalidForCardholderName\": \"Este nome do titular do cartão não é válido.\",\n \"fieldInvalidForCvv\": \"Este código de segurança não é válido.\",\n \"fieldInvalidForExpirationDate\": \"Esta data de validade não é correta.\",\n \"fieldInvalidForNumber\": \"Este número de cartão não é válido.\",\n \"fieldInvalidForPostalCode\": \"Este código postal não é válido.\",\n \"genericError\": \"Tudo indica que houve um problema.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Este cartão de crédito já está registado como um meio de pagamento guardado.\",\n \"hostedFieldsFailedTokenizationError\": \"Verifique os dados e tente novamente.\",\n \"hostedFieldsFieldsInvalidError\": \"Verifique os dados e tente novamente.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Erro de rede. Tente novamente.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"A verificação do cartão de crédito falhou. Verifique os dados e tente novamente.\",\n \"paypalButtonMustBeUsed\": \"Use o botão PayPal para continuar com o seu pagamento.\",\n \"paypalAccountTokenizationFailedError\": \"Ocorreu um erro ao associar a conta PayPal. Tente novamente.\",\n \"paypalFlowFailedError\": \"Ocorreu um erro na ligação com PayPal. Tente novamente.\",\n \"paypalTokenizationRequestActiveError\": \"Já há uma autorização de pagamento PayPal em curso.\",\n \"venmoCanceledError\": \"Ocorreu um erro. Certifique-se de que tem a versão mais recente da aplicação Venmo instalada no seu dispositivo e que o navegador suporta a mudança para o Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Não é possível eliminar o meio de pagamento, tente novamente.\",\n \"venmoAppFailedError\": \"Não foi possível encontrar a aplicação Venmo no dispositivo.\",\n \"unsupportedCardTypeError\": \"Este tipo de cartão não é suportado. Tente usar outro cartão.\",\n \"applePayTokenizationError\": \"Ocorreu um erro de rede ao processar o pagamento com Apple Pay. Tente novamente.\",\n \"applePayActiveCardError\": \"Adicione um cartão suportado à sua carteira Apple Pay.\",\n \"cardholderNameLabel\": \"Nome do titular do cartão\",\n \"cardNumberLabel\": \"Número do cartão\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 dígitos)\",\n \"cvvFourDigitLabelSubheading\": \"(4 dígitos)\",\n \"cardholderNamePlaceholder\": \"Nome do titular do cartão\",\n \"expirationDateLabel\": \"Data de validade\",\n \"expirationDateLabelSubheading\": \"(MM/AA)\",\n \"expirationDatePlaceholder\": \"MM/AA\",\n \"postalCodeLabel\": \"Código postal\",\n \"saveCardLabel\": \"Guardar cartão\",\n \"payWithCard\": \"Pagar com cartão\",\n \"endingIn\": \"Terminado em {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Cartão\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],241:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Способы оплаты: {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Выберите другой способ оплаты\",\n \"chooseAWayToPay\": \"Выберите способ оплаты\",\n \"otherWaysToPay\": \"Другие способы оплаты\",\n \"edit\": \"Редактировать\",\n \"doneEditing\": \"Готово\",\n \"editPaymentMethods\": \"Редактировать способы оплаты\",\n \"CreditCardDeleteConfirmationMessage\": \"Удалить карту {{secondaryIdentifier}}, оканчивающуюся на {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Удалить счет PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Вы действительно хотите удалить счет Venmo с именем пользователя {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Вы действительно хотите удалить этот способ оплаты?\",\n \"deleteCancelButton\": \"Отмена\",\n \"deleteConfirmationButton\": \"Удалить\",\n \"fieldEmptyForCvv\": \"Укажите код безопасности.\",\n \"fieldEmptyForExpirationDate\": \"Укажите дату окончания срока действия.\",\n \"fieldEmptyForCardholderName\": \"Введите имя и фамилию владельца карты.\",\n \"fieldTooLongForCardholderName\": \"Имя владельца карты должно содержать не более 256 символов.\",\n \"fieldEmptyForNumber\": \"Введите номер.\",\n \"fieldEmptyForPostalCode\": \"Укажите почтовый индекс.\",\n \"fieldInvalidForCardholderName\": \"Недопустимое имя владельца карты.\",\n \"fieldInvalidForCvv\": \"Этот код безопасности недействителен.\",\n \"fieldInvalidForExpirationDate\": \"Эта дата окончания срока действия недействительна.\",\n \"fieldInvalidForNumber\": \"Этот номер карты недействителен.\",\n \"fieldInvalidForPostalCode\": \"Этот почтовый индекс недействителен.\",\n \"genericError\": \"Возникла проблема с нашей стороны.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Эта кредитная карта уже указана как сохраненный источник средств.\",\n \"hostedFieldsFailedTokenizationError\": \"Проверьте правильность ввода данных и повторите попытку.\",\n \"hostedFieldsFieldsInvalidError\": \"Проверьте правильность ввода данных и повторите попытку.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Ошибка сети. Повторите попытку.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Проверка банковской карты не выполнена. Проверьте правильность ввода данных и повторите попытку.\",\n \"paypalButtonMustBeUsed\": \"Используйте кнопку PayPal, чтобы продолжить совершение оплаты.\",\n \"paypalAccountTokenizationFailedError\": \"Что-то пошло не так — не удалось добавить учетную запись PayPal. Повторите попытку.\",\n \"paypalFlowFailedError\": \"Что-то пошло не так — не удалось подключиться к системе PayPal. Повторите попытку.\",\n \"paypalTokenizationRequestActiveError\": \"Выполняется авторизация платежа PayPal.\",\n \"venmoCanceledError\": \"Возникла ошибка. Просим вас убедиться, что у вас установлена новейшая версия приложения Venmo и ваш браузер поддерживает переключение к Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Не удалось удалить способ оплаты. Повторите попытку.\",\n \"venmoAppFailedError\": \"Приложение Venmo не обнаружено на вашем устройстве.\",\n \"unsupportedCardTypeError\": \"Этот тип карты не поддерживается. Попробуйте воспользоваться другой картой.\",\n \"applePayTokenizationError\": \"При обработке платежа через Apple Pay возникла сетевая ошибка. Повторите попытку.\",\n \"applePayActiveCardError\": \"Добавьте поддерживаемую карту к своему счету Apple Pay.\",\n \"cardholderNameLabel\": \"Имя и фамилия владельца\",\n \"cardNumberLabel\": \"Номер карты\",\n \"cvvLabel\": \"Код безопасности\",\n \"cvvThreeDigitLabelSubheading\": \"(3 цифры)\",\n \"cvvFourDigitLabelSubheading\": \"(4 цифры)\",\n \"cardholderNamePlaceholder\": \"Имя и фамилия владельца\",\n \"expirationDateLabel\": \"Срок действия\",\n \"expirationDateLabelSubheading\": \"(ММ/ГГ)\",\n \"expirationDatePlaceholder\": \"ММ/ГГ\",\n \"postalCodeLabel\": \"Индекс\",\n \"saveCardLabel\": \"Сохранить карту\",\n \"payWithCard\": \"Оплатить картой\",\n \"endingIn\": \"Последние четыре цифры номера карты: {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Карта\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],242:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Spôsob úhrady: {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Vyberte iný spôsob platby\",\n \"chooseAWayToPay\": \"Vyberte spôsob platby\",\n \"otherWaysToPay\": \"Iné spôsoby platby\",\n \"edit\": \"Upraviť\",\n \"doneEditing\": \"Hotovo\",\n \"editPaymentMethods\": \"Upraviť spôsoby platby\",\n \"CreditCardDeleteConfirmationMessage\": \"Odstrániť kartu {{secondaryIdentifier}} končiacu na {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Odstrániť účet PayPal {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Naozaj chcete odstrániť účet Venmo s menom používateľa {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Ste si istí, že chcete tento spôsob platby odstrániť?\",\n \"deleteCancelButton\": \"Zrušiť\",\n \"deleteConfirmationButton\": \"Odstrániť\",\n \"fieldEmptyForCvv\": \"Zadajte číslo CVV.\",\n \"fieldEmptyForExpirationDate\": \"Zadajte dátum skončenia platnosti.\",\n \"fieldEmptyForCardholderName\": \"Zadajte meno majiteľa karty.\",\n \"fieldTooLongForCardholderName\": \"Meno majiteľa karty musí obsahovať menej ako 256 znakov.\",\n \"fieldEmptyForNumber\": \"Zadajte číslo.\",\n \"fieldEmptyForPostalCode\": \"Zadajte PSČ.\",\n \"fieldInvalidForCardholderName\": \"Toto meno majiteľa karty je neplatné.\",\n \"fieldInvalidForCvv\": \"Tento bezpečnostný kód je neplatný.\",\n \"fieldInvalidForExpirationDate\": \"Tento dátum skončenia platnosti je neplatný.\",\n \"fieldInvalidForNumber\": \"Toto číslo karty je neplatné.\",\n \"fieldInvalidForPostalCode\": \"Toto PSČ je neplatné.\",\n \"genericError\": \"Vyskytla sa chyba na našej strane.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Táto kreditná karta už existuje ako uložená metóda platby.\",\n \"hostedFieldsFailedTokenizationError\": \"Skontrolujte údaje a skúste to znova.\",\n \"hostedFieldsFieldsInvalidError\": \"Skontrolujte údaje a skúste to znova.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Chyba v sieti. Skúste to znova.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Overenie kreditnej karty nebolo úspešné. Skontrolujte údaje a skúste to znova.\",\n \"paypalButtonMustBeUsed\": \"Ak chcete pokračovať v platbe, použite tlačidlo PayPal.\",\n \"paypalAccountTokenizationFailedError\": \"Vyskytla sa chyba pri pridávaní účtu PayPal. Skúste to znova.\",\n \"paypalFlowFailedError\": \"Vyskytla sa chyba pri pripájaní do účtu PayPal. Skúste to znova.\",\n \"paypalTokenizationRequestActiveError\": \"Autorizácia platby PayPal už prebieha.\",\n \"venmoCanceledError\": \"Vyskytla sa chyba. Skontrolujte, či máte v zariadení nainštalovanú najnovšiu verziu aplikácie Venmo a či prehliadač podporuje prechod na aplikáciu Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Nebolo možné odstrániť spôsob platby, skúste to znova.\",\n \"venmoAppFailedError\": \"Aplikáciu Venmo sa vo vašom zariadení nepodarilo nájsť.\",\n \"unsupportedCardTypeError\": \"Tento typ karty nie je podporovaný. Skúste inú kartu.\",\n \"applePayTokenizationError\": \"Počas spracúvania platby cez Apple Pay došlo k chybe siete. Skúste to znova.\",\n \"applePayActiveCardError\": \"Pridajte si podporovanú kartu do peňaženky Apple Pay.\",\n \"cardholderNameLabel\": \"Meno majiteľa karty\",\n \"cardNumberLabel\": \"Číslo karty\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 číslice)\",\n \"cvvFourDigitLabelSubheading\": \"(4 číslice)\",\n \"cardholderNamePlaceholder\": \"Meno majiteľa karty\",\n \"expirationDateLabel\": \"Dátum skončenia platnosti\",\n \"expirationDateLabelSubheading\": \"(MM/RR)\",\n \"expirationDatePlaceholder\": \"MM/RR\",\n \"postalCodeLabel\": \"PSČ\",\n \"saveCardLabel\": \"Uložiť kartu\",\n \"payWithCard\": \"Zaplatiť kartou\",\n \"endingIn\": \"S posledným štvorčíslím {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Karta\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],243:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"Betalas med {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"Välj ett annat sätt att betala\",\n \"chooseAWayToPay\": \"Välj hur du vill betala\",\n \"otherWaysToPay\": \"Andra sätt att betala\",\n \"edit\": \"Ändra\",\n \"doneEditing\": \"Klart\",\n \"editPaymentMethods\": \"Redigera betalningsmetoder\",\n \"CreditCardDeleteConfirmationMessage\": \"Ta bort {{secondaryIdentifier}}-kort som slutar på {{identifier}}?\",\n \"PayPalAccountDeleteConfirmationMessage\": \"Ta bort PayPal-konto {{identifier}}?\",\n \"VenmoAccountDeleteConfirmationMessage\": \"Är du säker på att du vill ta bort Venmo-konto med användarnamn {{identifier}}?\",\n \"genericDeleteConfirmationMessage\": \"Är du säker på att du vill ta bort den här betalningsmetoden?\",\n \"deleteCancelButton\": \"Avbryt\",\n \"deleteConfirmationButton\": \"Ta bort\",\n \"fieldEmptyForCvv\": \"Fyll i en CVV-kod.\",\n \"fieldEmptyForExpirationDate\": \"Fyll i ett utgångsdatum.\",\n \"fieldEmptyForCardholderName\": \"Fyll i kortinnehavarens namn.\",\n \"fieldTooLongForCardholderName\": \"Kortinnehavarens namn måste vara kortare än 256 tecken.\",\n \"fieldEmptyForNumber\": \"Fyll i ett nummer.\",\n \"fieldEmptyForPostalCode\": \"Fyll i ett postnummer.\",\n \"fieldInvalidForCardholderName\": \"Namnet på kortinnehavaren är ogiltigt.\",\n \"fieldInvalidForCvv\": \"Den här säkerhetskoden är inte giltig.\",\n \"fieldInvalidForExpirationDate\": \"Det här utgångsdatumet är inte giltigt.\",\n \"fieldInvalidForNumber\": \"Det här kortnumret är inte giltigt.\",\n \"fieldInvalidForPostalCode\": \"Det här postnumret är inte giltigt.\",\n \"genericError\": \"Ett fel uppstod.\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"Det här betalkortet finns redan som en sparad betalningsmetod.\",\n \"hostedFieldsFailedTokenizationError\": \"Kontrollera uppgifterna och försök igen.\",\n \"hostedFieldsFieldsInvalidError\": \"Kontrollera uppgifterna och försök igen.\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"Nätverksfel. Försök igen.\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"Verifieringen av betalkort misslyckades. Kontrollera uppgifterna och försök igen.\",\n \"paypalButtonMustBeUsed\": \"Använd PayPal-knappen för att fortsätta med din betalning.\",\n \"paypalAccountTokenizationFailedError\": \"Ett fel uppstod när PayPal-kontot skulle läggas till. Försök igen.\",\n \"paypalFlowFailedError\": \"Ett fel uppstod när anslutningen till PayPal skulle upprättas. Försök igen.\",\n \"paypalTokenizationRequestActiveError\": \"Betalningsgodkännandet för PayPal behandlas redan.\",\n \"venmoCanceledError\": \"Något gick fel. Se till att du har den senaste versionen av Venmo-appen installerad på din enhet och att webbläsaren stöder att gå över till Venmo.\",\n \"vaultManagerPaymentMethodDeletionError\": \"Det gick inte att ta bort betalningsmetoden. Försök igen.\",\n \"venmoAppFailedError\": \"Venmo-appen kunde inte hittas på din enhet.\",\n \"unsupportedCardTypeError\": \"Den här korttypen stöds inte. Pröva med ett annat kort.\",\n \"applePayTokenizationError\": \"Ett nätverksfel inträffade när Apple Pay-betalningen skulle behandlas. Försök igen.\",\n \"applePayActiveCardError\": \"Lägg till ett kort som stöds i Apple Pay-e-plånboken.\",\n \"cardholderNameLabel\": \"Kortinnehavarens namn\",\n \"cardNumberLabel\": \"Kortnummer\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 siffror)\",\n \"cvvFourDigitLabelSubheading\": \"(4 siffror)\",\n \"cardholderNamePlaceholder\": \"Kortinnehavarens namn\",\n \"expirationDateLabel\": \"Utgångsdatum\",\n \"expirationDateLabelSubheading\": \"(MM/ÅÅ)\",\n \"expirationDatePlaceholder\": \"MM/ÅÅ\",\n \"postalCodeLabel\": \"Postnummer\",\n \"saveCardLabel\": \"Spara kort\",\n \"payWithCard\": \"Betala med kort\",\n \"endingIn\": \"Slutar på {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"Kort\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],244:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"การชำระเงินด้วย {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"เลือกวิธีอื่นเพื่อชำระเงิน\",\n \"chooseAWayToPay\": \"เลือกวิธีชำระเงิน\",\n \"otherWaysToPay\": \"วิธีอื่นๆ ในการชำระเงิน\",\n \"edit\": \"แก้ไข\",\n \"doneEditing\": \"เสร็จแล้ว\",\n \"editPaymentMethods\": \"แก้ไขวิธีการชำระเงิน\",\n \"CreditCardDeleteConfirmationMessage\": \"ลบบัตร {{secondaryIdentifier }} ที่ลงท้ายด้วย {{identifier}} หรือไม่\",\n \"PayPalAccountDeleteConfirmationMessage\": \"ลบ {{identifier}} บัญชี PayPal หรือไม่\",\n \"VenmoAccountDeleteConfirmationMessage\": \"คุณมั่นใจว่าต้องการลบบัญชี Venmo ที่มีชื่อผู้ใช้ {{identifier}} หรือไม่\",\n \"genericDeleteConfirmationMessage\": \"คุณมั่นใจว่าต้องการลบวิธีการชำระเงินนี้หรือไม่\",\n \"deleteCancelButton\": \"ยกเลิก\",\n \"deleteConfirmationButton\": \"ลบ\",\n \"fieldEmptyForCvv\": \"โปรดกรอก CVV (รหัสการตรวจสอบยืนยันบัตร)\",\n \"fieldEmptyForExpirationDate\": \"โปรดกรอกวันที่หมดอายุ\",\n \"fieldEmptyForCardholderName\": \"โปรดกรอกชื่อเจ้าของบัตร\",\n \"fieldTooLongForCardholderName\": \"ชื่อผู้ถือบัตรจะต้องไม่เกิน 256 อักขระ\",\n \"fieldEmptyForNumber\": \"โปรดกรอกหมายเลข\",\n \"fieldEmptyForPostalCode\": \"โปรดกรอกรหัสไปรษณีย์\",\n \"fieldInvalidForCardholderName\": \"ชื่อผู้ถือบัตรนี้ไม่ถูกต้องชื่อผู้ถือบัตรนี้ไม่ถูกต้อง\",\n \"fieldInvalidForCvv\": \"รหัสความปลอดภัยนี้ไม่ถูกต้อง\",\n \"fieldInvalidForExpirationDate\": \"วันที่หมดอายุนี้ไม่ถูกต้อง\",\n \"fieldInvalidForNumber\": \"หมายเลขบัตรนี้ไม่ถูกต้อง\",\n \"fieldInvalidForPostalCode\": \"รหัสไปรษณีย์นี้ไม่ถูกต้อง\",\n \"genericError\": \"เกิดข้อผิดพลาดขึ้นในระบบของเรา\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"บัตรเครดิตนี้ถูกบันทึกไว้เป็นวิธีการชำระเงิน\",\n \"hostedFieldsFailedTokenizationError\": \"โปรดตรวจสอบข้อมูลของคุณ แล้วลองใหม่อีกครั้ง\",\n \"hostedFieldsFieldsInvalidError\": \"โปรดตรวจสอบข้อมูลของคุณ แล้วลองใหม่อีกครั้ง\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"ข้อผิดพลาดด้านเครือข่าย โปรดลองอีกครั้ง\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"การตรวจสอบยืนยันบัตรเครดิตล้มเหลว โปรดตรวจสอบข้อมูลของคุณ แล้วลองใหม่อีกครั้ง\",\n \"paypalButtonMustBeUsed\": \"ใช้ปุ่ม PayPal เพื่อดำเนินการชำระเงินต่อ\",\n \"paypalAccountTokenizationFailedError\": \"เกิดข้อผิดพลาดในการเพิ่มบัญชี PayPal โปรดลองอีกครั้ง\",\n \"paypalFlowFailedError\": \"เกิดข้อผิดพลาดในการเชื่อมต่อกับ PayPal โปรดลองอีกครั้ง\",\n \"paypalTokenizationRequestActiveError\": \"การอนุญาตการชำระเงินของ PayPal อยู่ในระหว่างดำเนินการ\",\n \"venmoCanceledError\": \"เกิดข้อผิดพลาดบางประการ ตรวจสอบว่าคุณมีแอป Venmo เวอร์ชันล่าสุดติดตั้งในอุปกรณ์ของคุณ และมีเบราเซอร์ที่รองรับ Venmo\",\n \"vaultManagerPaymentMethodDeletionError\": \"ไม่สามารถลบวิธีการชำระเงินได้ ลองอีกครั้ง\",\n \"venmoAppFailedError\": \"ไม่พบแอป Venmo บนอุปกรณ์ของคุณ\",\n \"unsupportedCardTypeError\": \"ไม่รองรับบัตรประเภทนี้ โปรดลองใช้บัตรใบอื่น\",\n \"applePayTokenizationError\": \"เกิดข้อผิดพลาดด้านเครือข่ายขึ้นขณะดำเนินการชำระเงินด้วย Apple Pay โปรดลองอีกครั้ง\",\n \"applePayActiveCardError\": \"เพิ่มบัตรที่รองรับในกระเป๋าสตางค์ Apple Pay ของคุณ\",\n \"cardholderNameLabel\": \"ชื่อเจ้าของบัตร\",\n \"cardNumberLabel\": \"หมายเลขบัตร\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"(3 หลัก)\",\n \"cvvFourDigitLabelSubheading\": \"(4 หลัก)\",\n \"cardholderNamePlaceholder\": \"ชื่อเจ้าของบัตร\",\n \"expirationDateLabel\": \"วันหมดอายุ\",\n \"expirationDateLabelSubheading\": \"(ดด/ปป)\",\n \"expirationDatePlaceholder\": \"ดด/ปป\",\n \"postalCodeLabel\": \"รหัสไปรษณีย์\",\n \"saveCardLabel\": \"บันทึกบัตร\",\n \"payWithCard\": \"ชำระเงินด้วยบัตร\",\n \"endingIn\": \"ลงท้ายด้วย {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"บัตร\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],245:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"正在使用{{paymentSource}}付款\",\n \"chooseAnotherWayToPay\": \"选择其他付款方式\",\n \"chooseAWayToPay\": \"选择付款方式\",\n \"otherWaysToPay\": \"其他付款方式\",\n \"edit\": \"编辑\",\n \"doneEditing\": \"完成\",\n \"editPaymentMethods\": \"编辑付款方式\",\n \"CreditCardDeleteConfirmationMessage\": \"删除尾号为{{identifier}}的{{secondaryIdentifier}}卡？\",\n \"PayPalAccountDeleteConfirmationMessage\": \"删除PayPal账户{{identifier}}？\",\n \"VenmoAccountDeleteConfirmationMessage\": \"确定要删除用户名为{{identifier}}的Venmo账户吗？\",\n \"genericDeleteConfirmationMessage\": \"确定要删除该付款方式吗？\",\n \"deleteCancelButton\": \"取消\",\n \"deleteConfirmationButton\": \"删除\",\n \"fieldEmptyForCvv\": \"请填写CVV。\",\n \"fieldEmptyForExpirationDate\": \"请填写有效期限。\",\n \"fieldEmptyForCardholderName\": \"请填写持卡人的姓名。\",\n \"fieldTooLongForCardholderName\": \"持卡人姓名必须少于256个字符。\",\n \"fieldEmptyForNumber\": \"请填写一个号码。\",\n \"fieldEmptyForPostalCode\": \"请填写邮政编码。\",\n \"fieldInvalidForCardholderName\": \"此持卡人姓名无效。\",\n \"fieldInvalidForCvv\": \"此安全代码无效。\",\n \"fieldInvalidForExpirationDate\": \"此有效期限无效。\",\n \"fieldInvalidForNumber\": \"此卡号无效。\",\n \"fieldInvalidForPostalCode\": \"此邮政编码无效。\",\n \"genericError\": \"我们遇到了一些问题\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"此信用卡已作为保存后的付款方式存在。\",\n \"hostedFieldsFailedTokenizationError\": \"请检查您的信息，然后重试。\",\n \"hostedFieldsFieldsInvalidError\": \"请检查您的信息，然后重试。\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"网络错误。请重试。\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"信用卡验证失败。请检查您的信息，然后重试。\",\n \"paypalButtonMustBeUsed\": \"使用PayPal按钮继续进行付款。\",\n \"paypalAccountTokenizationFailedError\": \"添加PayPal账户时出错。请重试。\",\n \"paypalFlowFailedError\": \"连接到PayPal时出错。请重试。\",\n \"paypalTokenizationRequestActiveError\": \"PayPal付款授权已在进行中。\",\n \"venmoCanceledError\": \"我们遇到了问题。请确保您的设备上已安装最新版本的Venmo应用，并且您的浏览器支持切换到Venmo。\",\n \"vaultManagerPaymentMethodDeletionError\": \"无法删除付款方式，请重试。\",\n \"venmoAppFailedError\": \"在您的设备上找不到Venmo应用。\",\n \"unsupportedCardTypeError\": \"不支持该卡类型。请尝试其他卡。\",\n \"applePayTokenizationError\": \"处理Apple Pay付款时出现网络错误。请重试。\",\n \"applePayActiveCardError\": \"请添加受支持的卡到您的Apple Pay钱包。\",\n \"cardholderNameLabel\": \"持卡人姓名\",\n \"cardNumberLabel\": \"卡号\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"（3位数）\",\n \"cvvFourDigitLabelSubheading\": \"（4位数）\",\n \"cardholderNamePlaceholder\": \"持卡人姓名\",\n \"expirationDateLabel\": \"有效期限\",\n \"expirationDateLabelSubheading\": \"（MM/YY）\",\n \"expirationDatePlaceholder\": \"MM/YY\",\n \"postalCodeLabel\": \"邮政编码\",\n \"saveCardLabel\": \"保存卡\",\n \"payWithCard\": \"用卡付款\",\n \"endingIn\": \"尾号为{{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"卡\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"银联\"\n};\n\n},{}],246:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"付款方式為 {{paymentSource}}\",\n \"chooseAnotherWayToPay\": \"選擇其他付款方式\",\n \"chooseAWayToPay\": \"選擇付款方式\",\n \"otherWaysToPay\": \"其他付款方式\",\n \"edit\": \"編輯\",\n \"doneEditing\": \"完成\",\n \"editPaymentMethods\": \"編輯付款方式\",\n \"CreditCardDeleteConfirmationMessage\": \"要刪除末碼為 {{identifier}} 的 {{secondaryIdentifier}} 卡嗎？\",\n \"PayPalAccountDeleteConfirmationMessage\": \"要刪除 PayPal 帳戶 {{identifier}} 嗎？\",\n \"VenmoAccountDeleteConfirmationMessage\": \"確定要刪除使用者名稱為 {{identifier}} 的 Venmo 帳戶嗎？\",\n \"genericDeleteConfirmationMessage\": \"確定要刪除此付款方式嗎？\",\n \"deleteCancelButton\": \"取消\",\n \"deleteConfirmationButton\": \"刪除\",\n \"fieldEmptyForCvv\": \"請填寫信用卡認證碼。\",\n \"fieldEmptyForExpirationDate\": \"請填寫到期日。\",\n \"fieldEmptyForCardholderName\": \"請填寫持卡人的名字。\",\n \"fieldTooLongForCardholderName\": \"持卡人姓名必須少於 256 個字元。\",\n \"fieldEmptyForNumber\": \"請填寫號碼。\",\n \"fieldEmptyForPostalCode\": \"請填寫郵遞區號。\",\n \"fieldInvalidForCardholderName\": \"持卡人姓名無效。\",\n \"fieldInvalidForCvv\": \"此安全代碼無效。\",\n \"fieldInvalidForExpirationDate\": \"此到期日無效。\",\n \"fieldInvalidForNumber\": \"此卡號無效。\",\n \"fieldInvalidForPostalCode\": \"此郵遞區號無效。\",\n \"genericError\": \"系統發生錯誤。\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"此信用卡已存在，為已儲存的付款方式。\",\n \"hostedFieldsFailedTokenizationError\": \"請檢查你的資料並再試一次。\",\n \"hostedFieldsFieldsInvalidError\": \"請檢查你的資料並再試一次。\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"網絡錯誤。再試一次。\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"信用卡認證失敗。請檢查你的資料並再試一次。\",\n \"paypalButtonMustBeUsed\": \"使用 PayPal 按鈕以繼續付款。\",\n \"paypalAccountTokenizationFailedError\": \"加入 PayPal 帳戶時發生錯誤。再試一次。\",\n \"paypalFlowFailedError\": \"連接 PayPal 時發生錯誤。再試一次。\",\n \"paypalTokenizationRequestActiveError\": \"PayPal 付款授權已在處理中。\",\n \"venmoCanceledError\": \"系統發生錯誤，請確保你已在裝置上安裝最新版本的 Venmo 應用程式，而且你的瀏覽器支援切換至 Venmo。\",\n \"vaultManagerPaymentMethodDeletionError\": \"無法刪除付款方式，請再試一次。\",\n \"venmoAppFailedError\": \"在你的裝置上找不到 Venmo 應用程式。\",\n \"unsupportedCardTypeError\": \"不可使用此信用卡類型。請改用其他信用卡。\",\n \"applePayTokenizationError\": \"處理 Apple Pay 付款時發生網絡錯誤。再試一次。\",\n \"applePayActiveCardError\": \"在 Apple Pay 錢包中加入支援的信用卡。\",\n \"cardholderNameLabel\": \"持卡人名字\",\n \"cardNumberLabel\": \"卡號\",\n \"cvvLabel\": \"信用卡認證碼\",\n \"cvvThreeDigitLabelSubheading\": \"（3 位數）\",\n \"cvvFourDigitLabelSubheading\": \"（4 位數）\",\n \"cardholderNamePlaceholder\": \"持卡人名字\",\n \"expirationDateLabel\": \"到期日\",\n \"expirationDateLabelSubheading\": \"(MM/YY)\",\n \"expirationDatePlaceholder\": \"月 / 年\",\n \"postalCodeLabel\": \"郵遞區號\",\n \"saveCardLabel\": \"儲存信用卡\",\n \"payWithCard\": \"使用信用卡付款\",\n \"endingIn\": \"末碼為 {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"信用卡\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],247:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"以 {{paymentSource}} 付款\",\n \"chooseAnotherWayToPay\": \"選擇付款的以其他方式付款\",\n \"chooseAWayToPay\": \"選擇付款方式\",\n \"otherWaysToPay\": \"其他付款方式\",\n \"edit\": \"編輯\",\n \"doneEditing\": \"完成\",\n \"editPaymentMethods\": \"編輯付款方式\",\n \"CreditCardDeleteConfirmationMessage\": \"確定要刪除末碼為 {{identifier}} 的 {{secondaryIdentifier}} 卡片嗎？\",\n \"PayPalAccountDeleteConfirmationMessage\": \"確定要刪除 {{identifier}} PayPal 帳戶嗎？\",\n \"VenmoAccountDeleteConfirmationMessage\": \"確定要刪除用戶名稱為 {{identifier}} 的 Venmo 帳戶嗎？\",\n \"genericDeleteConfirmationMessage\": \"確定要刪除此付款方式？\",\n \"deleteCancelButton\": \"取消\",\n \"deleteConfirmationButton\": \"刪除\",\n \"fieldEmptyForCvv\": \"請填妥信用卡驗證碼。\",\n \"fieldEmptyForExpirationDate\": \"請填妥到期日。\",\n \"fieldEmptyForCardholderName\": \"請填妥持卡人姓名。\",\n \"fieldTooLongForCardholderName\": \"持卡人姓名不能超過 256 個字元。\",\n \"fieldEmptyForNumber\": \"請填妥號碼。\",\n \"fieldEmptyForPostalCode\": \"請填寫郵遞區號。\",\n \"fieldInvalidForCardholderName\": \"此持卡人姓名無效。\",\n \"fieldInvalidForCvv\": \"這組安全代碼無效。\",\n \"fieldInvalidForExpirationDate\": \"此到期日無效。\",\n \"fieldInvalidForNumber\": \"此卡號無效。\",\n \"fieldInvalidForPostalCode\": \"此郵遞區號無效。\",\n \"genericError\": \"我們的系統發生問題。\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"此信用卡已存在，為已儲存的付款方式。\",\n \"hostedFieldsFailedTokenizationError\": \"請檢查你的資料並重試。\",\n \"hostedFieldsFieldsInvalidError\": \"請檢查你的資料並重試。\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"網路錯誤。請重試。\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"信用卡認證失敗。請檢查你的資料並重試。\",\n \"paypalButtonMustBeUsed\": \"使用 PayPal 按鈕以繼續付款。\",\n \"paypalAccountTokenizationFailedError\": \"新增 PayPal 帳戶時，系統發生錯誤。請重試。\",\n \"paypalFlowFailedError\": \"連結至 PayPal 時，系統發生錯誤。請重試。\",\n \"paypalTokenizationRequestActiveError\": \"PayPal 支付款項的授權已在處理中。\",\n \"venmoCanceledError\": \"系統發生錯誤。確認你的裝置上裝有最新版本的 Venmo 應用程式，而且瀏覽器支援切換至 Venmo。\",\n \"vaultManagerPaymentMethodDeletionError\": \"無法刪除付款方式，請再試一次。\",\n \"venmoAppFailedError\": \"你的裝置上找不到 Venmo 應用程式。\",\n \"unsupportedCardTypeError\": \"不支援此卡片類型。請改用其他卡片。\",\n \"applePayTokenizationError\": \"在處理 Apple Pay 付款時發生網路錯誤。請重試。\",\n \"applePayActiveCardError\": \"新增支援的卡片至你的 Apple Pay 錢包。\",\n \"cardholderNameLabel\": \"持卡人姓名\",\n \"cardNumberLabel\": \"卡號\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"（3 位數）\",\n \"cvvFourDigitLabelSubheading\": \"（4 位數）\",\n \"cardholderNamePlaceholder\": \"持卡人姓名\",\n \"expirationDateLabel\": \"到期日\",\n \"expirationDateLabelSubheading\": \"（月 / 年）\",\n \"expirationDatePlaceholder\": \"月 / 年\",\n \"postalCodeLabel\": \"郵遞區號\",\n \"saveCardLabel\": \"儲存卡片\",\n \"payWithCard\": \"使用信用卡 / 扣帳卡付款\",\n \"endingIn\": \"末碼為 {{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"信用卡或扣帳卡\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal 信貸\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"美國運通 (American Express)\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"大來國際 (Diners Club)\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"UnionPay\"\n};\n\n},{}],248:[function(require,module,exports){\n'use strict';\n\nmodule.exports = {\n \"payingWith\": \"使用{{paymentSource}}付款\",\n \"chooseAnotherWayToPay\": \"选择其它付款方式\",\n \"chooseAWayToPay\": \"选择付款方式\",\n \"otherWaysToPay\": \"其它付款方式\",\n \"edit\": \"编辑\",\n \"doneEditing\": \"完成\",\n \"editPaymentMethods\": \"编辑付款方式\",\n \"CreditCardDeleteConfirmationMessage\": \"删除尾号为{{identifier}}的{{secondaryIdentifier}}卡？\",\n \"PayPalAccountDeleteConfirmationMessage\": \"删除PayPal账户{{identifier}}？\",\n \"VenmoAccountDeleteConfirmationMessage\": \"确定要删除用户名为{{identifier}}的Venmo账户吗？\",\n \"genericDeleteConfirmationMessage\": \"确定要删除此付款方式吗？\",\n \"deleteCancelButton\": \"取消\",\n \"deleteConfirmationButton\": \"删除\",\n \"fieldEmptyForCvv\": \"请填写 CVV。\",\n \"fieldEmptyForExpirationDate\": \"请填写有效期限。\",\n \"fieldEmptyForCardholderName\": \"请填写持卡人姓名。\",\n \"fieldTooLongForCardholderName\": \"持卡人姓名必须少于256个字符。\",\n \"fieldEmptyForNumber\": \"请填写号码。\",\n \"fieldEmptyForPostalCode\": \"请填写邮政编码。\",\n \"fieldInvalidForCardholderName\": \"此持卡人姓名无效。\",\n \"fieldInvalidForCvv\": \"此验证码无效。\",\n \"fieldInvalidForExpirationDate\": \"此有效期限无效。\",\n \"fieldInvalidForNumber\": \"此卡号无效。\",\n \"fieldInvalidForPostalCode\": \"此邮政编码无效。\",\n \"genericError\": \"我们遇到了一些问题。\",\n \"hostedFieldsTokenizationFailOnDuplicateError\": \"此信用卡已存在于已保存的付款方式中。\",\n \"hostedFieldsFailedTokenizationError\": \"请检查您的信息，然后重试。\",\n \"hostedFieldsFieldsInvalidError\": \"请检查您的信息，然后重试。\",\n \"hostedFieldsTokenizationNetworkErrorError\": \"网络错误。请重试。\",\n \"hostedFieldsTokenizationCvvVerificationFailedError\": \"信用卡认证失败。请检查您的信息，然后重试。\",\n \"paypalButtonMustBeUsed\": \"使用PayPal按钮以便继续进行您的付款。\",\n \"paypalAccountTokenizationFailedError\": \"添加PayPal账户时遇到了问题。请重试。\",\n \"paypalFlowFailedError\": \"连接到PayPal时遇到了问题。请重试。\",\n \"paypalTokenizationRequestActiveError\": \"PayPal付款授权正在处理中。\",\n \"venmoCanceledError\": \"我们遇到了一些问题。请确保您的设备上安装了最新版本的Venmo应用，并且您的浏览器支持切换到Venmo。\",\n \"vaultManagerPaymentMethodDeletionError\": \"无法删除付款方式，请重试。\",\n \"venmoAppFailedError\": \"未能在您的设备上找到Venmo应用。\",\n \"unsupportedCardTypeError\": \"不支持此类型的卡。请尝试其它卡。\",\n \"applePayTokenizationError\": \"处理Apple Pay付款时出现了网络错误。请重试。\",\n \"applePayActiveCardError\": \"在您的Apple Pay钱包中添加一张受支持的卡。\",\n \"cardholderNameLabel\": \"持卡人姓名\",\n \"cardNumberLabel\": \"卡号\",\n \"cvvLabel\": \"CVV\",\n \"cvvThreeDigitLabelSubheading\": \"（3位数）\",\n \"cvvFourDigitLabelSubheading\": \"（4位数）\",\n \"cardholderNamePlaceholder\": \"持卡人姓名\",\n \"expirationDateLabel\": \"有效期限\",\n \"expirationDateLabelSubheading\": \"（月/年）\",\n \"expirationDatePlaceholder\": \"月/年\",\n \"postalCodeLabel\": \"邮政编码\",\n \"saveCardLabel\": \"保存卡\",\n \"payWithCard\": \"使用卡付款\",\n \"endingIn\": \"尾号为{{lastFourCardDigits}}\",\n \"Apple Pay\": \"Apple Pay\",\n \"Venmo\": \"Venmo\",\n \"Card\": \"卡\",\n \"PayPal\": \"PayPal\",\n \"PayPal Credit\": \"PayPal Credit\",\n \"Google Pay\": \"Google Pay\",\n \"American Express\": \"American Express\",\n \"Discover\": \"Discover\",\n \"Diners Club\": \"Diners Club\",\n \"MasterCard\": \"Mastercard\",\n \"Visa\": \"Visa\",\n \"JCB\": \"JCB\",\n \"Maestro\": \"Maestro\",\n \"UnionPay\": \"银联\"\n};\n\n},{}],249:[function(require,module,exports){\n'use strict';\n\nvar assign = require('../lib/assign').assign;\nvar classList = require('@braintree/class-list');\nvar DropinError = require('../lib/dropin-error');\nvar errors = require('../constants').errors;\nvar Promise = require('../lib/promise');\n\nfunction BaseView(options) {\n options = options || {};\n\n assign(this, options);\n}\n\nBaseView.prototype.getElementById = function (id) {\n if (!this.element) { return null; }\n\n return this.element.querySelector('[data-braintree-id=\"' + id + '\"]');\n};\n\nBaseView.prototype.requestPaymentMethod = function () {\n return Promise.reject(new DropinError(errors.NO_PAYMENT_METHOD_ERROR));\n};\n\nBaseView.prototype.getPaymentMethod = function () {\n return this.activeMethodView && this.activeMethodView.paymentMethod;\n};\n\nBaseView.prototype.onSelection = function () {};\n\nBaseView.prototype.teardown = function () {\n return Promise.resolve();\n};\n\nBaseView.prototype.preventUserAction = function () {\n if (this.element) {\n classList.add(this.element, 'braintree-sheet--loading');\n }\n\n this.model.preventUserAction();\n};\n\nBaseView.prototype.allowUserAction = function () {\n if (this.element) {\n classList.remove(this.element, 'braintree-sheet--loading');\n }\n\n this.model.allowUserAction();\n};\n\nmodule.exports = BaseView;\n\n},{\"../constants\":191,\"../lib/assign\":197,\"../lib/dropin-error\":201,\"../lib/promise\":208,\"@braintree/class-list\":39}],250:[function(require,module,exports){\n'use strict';\n\nvar BaseView = require('./base-view');\nvar addSelectionEventHandler = require('../lib/add-selection-event-handler');\nvar paymentMethodTypes = require('../constants').paymentMethodTypes;\n\nfunction DeleteConfirmationView() {\n BaseView.apply(this, arguments);\n\n this._initialize();\n}\n\nDeleteConfirmationView.prototype = Object.create(BaseView.prototype);\nDeleteConfirmationView.prototype.constructor = DeleteConfirmationView;\nDeleteConfirmationView.ID = DeleteConfirmationView.prototype.ID = 'delete-confirmation';\n\nDeleteConfirmationView.prototype._initialize = function () {\n this._yesButton = this.getElementById('delete-confirmation__yes');\n this._noButton = this.getElementById('delete-confirmation__no');\n this._messageBox = this.getElementById('delete-confirmation__message');\n\n addSelectionEventHandler(this._yesButton, function () {\n this.model.deleteVaultedPaymentMethod();\n }.bind(this));\n addSelectionEventHandler(this._noButton, function () {\n this.model.cancelDeleteVaultedPaymentMethod();\n }.bind(this));\n};\n\nDeleteConfirmationView.prototype.applyPaymentMethod = function (paymentMethod) {\n var identifier, secondaryIdentifier;\n var messageText = this.strings[paymentMethod.type + 'DeleteConfirmationMessage'];\n\n if (messageText) {\n switch (paymentMethod.type) {\n case paymentMethodTypes.card:\n identifier = paymentMethod.details.lastFour;\n secondaryIdentifier = paymentMethod.details.cardType;\n secondaryIdentifier = this.strings[secondaryIdentifier] || secondaryIdentifier;\n break;\n case paymentMethodTypes.paypal:\n identifier = paymentMethod.details.email;\n break;\n case paymentMethodTypes.venmo:\n identifier = paymentMethod.details.username;\n break;\n default:\n break;\n }\n\n messageText = messageText.replace('{{identifier}}', identifier);\n if (secondaryIdentifier) {\n messageText = messageText.replace('{{secondaryIdentifier}}', secondaryIdentifier);\n }\n } else {\n messageText = this.strings.genericDeleteConfirmationMessage;\n }\n this._messageBox.innerText = messageText;\n};\n\nDeleteConfirmationView.prototype.onSelection = function () {\n window.requestAnimationFrame(function () {\n this._yesButton.focus();\n }.bind(this));\n};\n\nmodule.exports = DeleteConfirmationView;\n\n},{\"../constants\":191,\"../lib/add-selection-event-handler\":195,\"./base-view\":249}],251:[function(require,module,exports){\n'use strict';\n\nvar analytics = require('../lib/analytics');\nvar analyticsKinds = require('../constants').analyticsKinds;\nvar BaseView = require('./base-view');\nvar classList = require('@braintree/class-list');\nvar sheetViews = require('./payment-sheet-views');\nvar PaymentMethodsView = require('./payment-methods-view');\nvar PaymentOptionsView = require('./payment-options-view');\nvar DeleteConfirmationView = require('./delete-confirmation-view');\nvar addSelectionEventHandler = require('../lib/add-selection-event-handler');\nvar Promise = require('../lib/promise');\nvar wait = require('../lib/wait');\nvar supportsFlexbox = require('../lib/supports-flexbox');\n\nvar CHANGE_ACTIVE_PAYMENT_METHOD_TIMEOUT = require('../constants').CHANGE_ACTIVE_PAYMENT_METHOD_TIMEOUT;\nvar DEVELOPER_MISCONFIGURATION_MESSAGE = require('../constants').errors.DEVELOPER_MISCONFIGURATION_MESSAGE;\n\nfunction MainView() {\n BaseView.apply(this, arguments);\n\n this.dependenciesInitializing = 0;\n\n this._initialize();\n}\n\nMainView.prototype = Object.create(BaseView.prototype);\nMainView.prototype.constructor = MainView;\n\nMainView.prototype._initialize = function () {\n var paymentOptionsView;\n\n this._hasMultiplePaymentOptions = this.model.supportedPaymentOptions.length > 1;\n\n this._views = {};\n\n this.sheetContainer = this.getElementById('sheet-container');\n this.sheetErrorText = this.getElementById('sheet-error-text');\n\n this.toggle = this.getElementById('toggle');\n this.disableWrapper = this.getElementById('disable-wrapper');\n this.lowerContainer = this.getElementById('lower-container');\n\n this.loadingContainer = this.getElementById('loading-container');\n this.dropinContainer = this.element.querySelector('.braintree-dropin');\n\n this.supportsFlexbox = supportsFlexbox();\n\n this.model.on('asyncDependenciesReady', this.hideLoadingIndicator.bind(this));\n\n this.model.on('errorOccurred', this.showSheetError.bind(this));\n this.model.on('errorCleared', this.hideSheetError.bind(this));\n this.model.on('preventUserAction', this.preventUserAction.bind(this));\n this.model.on('allowUserAction', this.allowUserAction.bind(this));\n\n this.paymentSheetViewIDs = Object.keys(sheetViews).reduce(function (ids, sheetViewKey) {\n var PaymentSheetView, paymentSheetView;\n\n if (this.model.supportedPaymentOptions.indexOf(sheetViewKey) !== -1) {\n PaymentSheetView = sheetViews[sheetViewKey];\n\n paymentSheetView = new PaymentSheetView({\n element: this.getElementById(PaymentSheetView.ID),\n mainView: this,\n model: this.model,\n client: this.client,\n strings: this.strings\n });\n paymentSheetView.initialize();\n\n this.addView(paymentSheetView);\n ids.push(paymentSheetView.ID);\n }\n\n return ids;\n }.bind(this), []);\n\n this.paymentMethodsViews = new PaymentMethodsView({\n element: this.element,\n model: this.model,\n client: this.client,\n strings: this.strings\n });\n this.addView(this.paymentMethodsViews);\n\n this.deleteConfirmationView = new DeleteConfirmationView({\n element: this.getElementById('delete-confirmation'),\n model: this.model,\n strings: this.strings\n });\n this.addView(this.deleteConfirmationView);\n\n addSelectionEventHandler(this.toggle, this.toggleAdditionalOptions.bind(this));\n\n this.model.on('changeActivePaymentMethod', function () {\n wait.delay(CHANGE_ACTIVE_PAYMENT_METHOD_TIMEOUT).then(function () {\n this.setPrimaryView(PaymentMethodsView.ID);\n }.bind(this));\n }.bind(this));\n\n this.model.on('changeActiveView', this._onChangeActiveView.bind(this));\n\n this.model.on('removeActivePaymentMethod', function () {\n var activePaymentView = this.getView(this.model.getActivePaymentViewId());\n\n if (activePaymentView && typeof activePaymentView.removeActivePaymentMethod === 'function') {\n activePaymentView.removeActivePaymentMethod();\n }\n }.bind(this));\n\n this.model.on('enableEditMode', this.enableEditMode.bind(this));\n\n this.model.on('disableEditMode', this.disableEditMode.bind(this));\n\n this.model.on('confirmPaymentMethodDeletion', this.openConfirmPaymentMethodDeletionDialog.bind(this));\n this.model.on('cancelVaultedPaymentMethodDeletion', this.cancelVaultedPaymentMethodDeletion.bind(this));\n this.model.on('startVaultedPaymentMethodDeletion', this.startVaultedPaymentMethodDeletion.bind(this));\n this.model.on('finishVaultedPaymentMethodDeletion', this.finishVaultedPaymentMethodDeletion.bind(this));\n\n if (this._hasMultiplePaymentOptions) {\n paymentOptionsView = new PaymentOptionsView({\n client: this.client,\n element: this.getElementById(PaymentOptionsView.ID),\n mainView: this,\n model: this.model,\n strings: this.strings\n });\n\n this.addView(paymentOptionsView);\n }\n\n this._sendToDefaultView();\n};\n\nMainView.prototype._onChangeActiveView = function (data) {\n var id = data.newViewId;\n var activePaymentView = this.getView(id);\n\n if (id === PaymentMethodsView.ID) {\n classList.add(this.paymentMethodsViews.container, 'braintree-methods--active');\n classList.remove(this.sheetContainer, 'braintree-sheet--active');\n } else {\n wait.delay(0).then(function () {\n classList.add(this.sheetContainer, 'braintree-sheet--active');\n }.bind(this));\n classList.remove(this.paymentMethodsViews.container, 'braintree-methods--active');\n if (!this.getView(id).getPaymentMethod()) {\n this.model.setPaymentMethodRequestable({\n isRequestable: false\n });\n }\n }\n\n activePaymentView.onSelection();\n};\n\nMainView.prototype.addView = function (view) {\n this._views[view.ID] = view;\n};\n\nMainView.prototype.getView = function (id) {\n return this._views[id];\n};\n\nMainView.prototype.setPrimaryView = function (id, secondaryViewId) {\n var paymentMethod;\n\n wait.delay(0).then(function () {\n this.element.className = prefixShowClass(id);\n if (secondaryViewId) {\n classList.add(this.element, prefixShowClass(secondaryViewId));\n }\n }.bind(this));\n\n this.primaryView = this.getView(id);\n this.model.changeActiveView(id);\n\n if (this.paymentSheetViewIDs.indexOf(id) !== -1) {\n if (this.model.getPaymentMethods().length > 0 || this.getView(PaymentOptionsView.ID)) {\n this.showToggle();\n } else {\n this.hideToggle();\n }\n } else if (id === PaymentMethodsView.ID) {\n this.showToggle();\n // Move options below the upper-container\n this.getElementById('lower-container').appendChild(this.getElementById('options'));\n } else if (id === PaymentOptionsView.ID) {\n this.hideToggle();\n }\n\n if (!this.supportsFlexbox) {\n this.element.setAttribute('data-braintree-no-flexbox', true);\n }\n\n paymentMethod = this.primaryView.getPaymentMethod();\n\n this.model.setPaymentMethodRequestable({\n isRequestable: Boolean(paymentMethod && !this.model.isInEditMode()),\n type: paymentMethod && paymentMethod.type,\n selectedPaymentMethod: paymentMethod\n });\n\n this.model.clearError();\n};\n\nMainView.prototype.requestPaymentMethod = function () {\n var activePaymentView = this.getView(this.model.getActivePaymentViewId());\n\n return activePaymentView.requestPaymentMethod().then(function (payload) {\n analytics.sendEvent(this.client, 'request-payment-method.' + analyticsKinds[payload.type]);\n\n return payload;\n }.bind(this)).catch(function (err) {\n analytics.sendEvent(this.client, 'request-payment-method.error');\n\n return Promise.reject(err);\n }.bind(this));\n};\n\nMainView.prototype.hideLoadingIndicator = function () {\n classList.remove(this.dropinContainer, 'braintree-loading');\n classList.add(this.dropinContainer, 'braintree-loaded');\n classList.add(this.loadingContainer, 'braintree-hidden');\n};\n\nMainView.prototype.showLoadingIndicator = function () {\n classList.add(this.dropinContainer, 'braintree-loading');\n classList.remove(this.dropinContainer, 'braintree-loaded');\n classList.remove(this.loadingContainer, 'braintree-hidden');\n};\n\nMainView.prototype.toggleAdditionalOptions = function () {\n var sheetViewID;\n var isPaymentSheetView = this.paymentSheetViewIDs.indexOf(this.primaryView.ID) !== -1;\n\n this.hideToggle();\n\n if (!this._hasMultiplePaymentOptions) {\n sheetViewID = this.paymentSheetViewIDs[0];\n\n classList.add(this.element, prefixShowClass(sheetViewID));\n this.model.changeActiveView(sheetViewID);\n } else if (isPaymentSheetView) {\n if (this.model.getPaymentMethods().length === 0) {\n this.setPrimaryView(PaymentOptionsView.ID);\n } else {\n this.setPrimaryView(PaymentMethodsView.ID, PaymentOptionsView.ID);\n this.hideToggle();\n }\n } else {\n classList.add(this.element, prefixShowClass(PaymentOptionsView.ID));\n }\n};\n\nMainView.prototype.showToggle = function () {\n if (this.model.isInEditMode()) {\n return;\n }\n classList.remove(this.toggle, 'braintree-hidden');\n classList.add(this.lowerContainer, 'braintree-hidden');\n};\n\nMainView.prototype.hideToggle = function () {\n classList.add(this.toggle, 'braintree-hidden');\n classList.remove(this.lowerContainer, 'braintree-hidden');\n};\n\nMainView.prototype.showSheetError = function (error) {\n var errorMessage;\n var genericErrorMessage = this.strings.genericError;\n\n if (this.strings.hasOwnProperty(error)) {\n errorMessage = this.strings[error];\n } else if (error && typeof error.code === 'string') {\n errorMessage = this.strings[snakeCaseToCamelCase(error.code) + 'Error'] || genericErrorMessage;\n } else if (error === 'developerError') {\n errorMessage = DEVELOPER_MISCONFIGURATION_MESSAGE;\n } else {\n errorMessage = genericErrorMessage;\n }\n\n classList.add(this.dropinContainer, 'braintree-sheet--has-error');\n this.sheetErrorText.innerHTML = errorMessage;\n};\n\nMainView.prototype.hideSheetError = function () {\n classList.remove(this.dropinContainer, 'braintree-sheet--has-error');\n};\n\nMainView.prototype.getOptionsElements = function () {\n return this._views.options.elements;\n};\n\nMainView.prototype.preventUserAction = function () {\n classList.remove(this.disableWrapper, 'braintree-hidden');\n};\n\nMainView.prototype.allowUserAction = function () {\n classList.add(this.disableWrapper, 'braintree-hidden');\n};\n\nMainView.prototype.teardown = function () {\n var error;\n var viewNames = Object.keys(this._views);\n var teardownPromises = viewNames.map(function (view) {\n return this._views[view].teardown().catch(function (err) {\n error = err;\n });\n }.bind(this));\n\n return Promise.all(teardownPromises).then(function () {\n if (error) {\n return Promise.reject(error);\n }\n\n return Promise.resolve();\n });\n};\n\nMainView.prototype.enableEditMode = function () {\n this.setPrimaryView(this.paymentMethodsViews.ID);\n this.paymentMethodsViews.enableEditMode();\n this.hideToggle();\n\n this.model.setPaymentMethodRequestable({\n isRequestable: false\n });\n};\n\nMainView.prototype.disableEditMode = function () {\n var paymentMethod;\n\n this.hideSheetError();\n this.paymentMethodsViews.disableEditMode();\n this.showToggle();\n\n paymentMethod = this.primaryView.getPaymentMethod();\n\n this.model.setPaymentMethodRequestable({\n isRequestable: Boolean(paymentMethod),\n type: paymentMethod && paymentMethod.type,\n selectedPaymentMethod: paymentMethod\n });\n};\n\nMainView.prototype.openConfirmPaymentMethodDeletionDialog = function (paymentMethod) {\n this.deleteConfirmationView.applyPaymentMethod(paymentMethod);\n this.setPrimaryView(this.deleteConfirmationView.ID);\n};\n\nMainView.prototype.cancelVaultedPaymentMethodDeletion = function () {\n this.setPrimaryView(this.paymentMethodsViews.ID);\n};\n\nMainView.prototype.startVaultedPaymentMethodDeletion = function () {\n this.element.className = '';\n this.showLoadingIndicator();\n};\n\nMainView.prototype.finishVaultedPaymentMethodDeletion = function (error) {\n var self = this;\n\n this.paymentMethodsViews.refreshPaymentMethods();\n\n if (error && this.model.getPaymentMethods().length > 0) {\n this.model.enableEditMode();\n this.showSheetError('vaultManagerPaymentMethodDeletionError');\n } else {\n this._sendToDefaultView();\n }\n\n return new Promise(function (resolve) {\n wait.delay(500).then(function () {\n // allow all the views to reset before hiding the loading indicator\n self.hideLoadingIndicator();\n resolve();\n });\n });\n};\n\nMainView.prototype._sendToDefaultView = function () {\n var paymentMethods = this.model.getPaymentMethods();\n var preselectVaultedPaymentMethod = this.model.merchantConfiguration.preselectVaultedPaymentMethod !== false;\n\n if (paymentMethods.length > 0) {\n if (preselectVaultedPaymentMethod) {\n analytics.sendEvent(this.client, 'vaulted-card.preselect');\n\n this.model.changeActivePaymentMethod(paymentMethods[0]);\n } else {\n this.setPrimaryView(this.paymentMethodsViews.ID);\n }\n } else if (this._hasMultiplePaymentOptions) {\n this.setPrimaryView(PaymentOptionsView.ID);\n } else {\n this.setPrimaryView(this.paymentSheetViewIDs[0]);\n }\n};\nfunction snakeCaseToCamelCase(s) {\n return s.toLowerCase().replace(/(\\_\\w)/g, function (m) {\n return m[1].toUpperCase();\n });\n}\n\nfunction prefixShowClass(classname) {\n return 'braintree-show-' + classname;\n}\n\nmodule.exports = MainView;\n\n},{\"../constants\":191,\"../lib/add-selection-event-handler\":195,\"../lib/analytics\":196,\"../lib/promise\":208,\"../lib/supports-flexbox\":210,\"../lib/wait\":213,\"./base-view\":249,\"./delete-confirmation-view\":250,\"./payment-methods-view\":253,\"./payment-options-view\":254,\"./payment-sheet-views\":259,\"@braintree/class-list\":39}],252:[function(require,module,exports){\n'use strict';\n\nvar analytics = require('../lib/analytics');\nvar BaseView = require('./base-view');\nvar classList = require('@braintree/class-list');\nvar constants = require('../constants');\n\nvar addSelectionEventHandler = require('../lib/add-selection-event-handler');\n\nvar paymentMethodHTML = \"
\\n\\n
\\n \\n
\\n\\n
\\n\\n
\\n\";\n\nfunction PaymentMethodView() {\n BaseView.apply(this, arguments);\n\n this._initialize();\n}\n\nPaymentMethodView.prototype = Object.create(BaseView.prototype);\nPaymentMethodView.prototype.constructor = PaymentMethodView;\n\nPaymentMethodView.prototype._initialize = function () {\n var endingInText;\n var html = paymentMethodHTML;\n var paymentMethodCardTypes = constants.paymentMethodCardTypes;\n var paymentMethodTypes = constants.paymentMethodTypes;\n\n this.element = document.createElement('div');\n this.element.className = 'braintree-method';\n this.element.setAttribute('tabindex', '0');\n this.element.setAttribute('role', 'button');\n\n addSelectionEventHandler(this.element, function () {\n if (this.model.isInEditMode()) {\n this._selectDelete();\n } else {\n this._choosePaymentMethod();\n }\n }.bind(this));\n\n switch (this.paymentMethod.type) {\n case paymentMethodTypes.applePay:\n html = html.replace(/@ICON/g, 'logoApplePay')\n .replace(/@CLASSNAME/g, '')\n .replace(/@TITLE/g, this.strings['Apple Pay'])\n .replace(/@SUBTITLE/g, '');\n break;\n case paymentMethodTypes.card:\n endingInText = this.strings.endingIn.replace('{{lastFourCardDigits}}', this.paymentMethod.details.lastFour);\n html = html.replace(/@ICON/g, 'icon-' + paymentMethodCardTypes[this.paymentMethod.details.cardType])\n .replace(/@CLASSNAME/g, ' braintree-icon--bordered')\n .replace(/@TITLE/g, endingInText)\n .replace(/@SUBTITLE/g, this.strings[this.paymentMethod.details.cardType]);\n break;\n case paymentMethodTypes.googlePay:\n html = html.replace(/@ICON/g, 'logoGooglePay')\n .replace(/@CLASSNAME/g, '')\n .replace(/@TITLE/g, this.strings['Google Pay'])\n .replace(/@SUBTITLE/g, '');\n break;\n case paymentMethodTypes.paypal:\n html = html.replace(/@ICON/g, 'logoPayPal')\n .replace(/@CLASSNAME/g, '')\n .replace(/@TITLE/g, this.paymentMethod.details.email)\n .replace(/@SUBTITLE/g, this.strings.PayPal);\n break;\n case paymentMethodTypes.venmo:\n html = html.replace(/@ICON/g, 'logoVenmo')\n .replace(/@CLASSNAME/g, '')\n .replace(/@TITLE/g, this.paymentMethod.details.username)\n .replace(/@SUBTITLE/g, this.strings.Venmo);\n break;\n default:\n break;\n }\n\n this.element.innerHTML = html;\n this.checkMark = this.element.querySelector('.braintree-method__check-container');\n};\n\nPaymentMethodView.prototype.setActive = function (isActive) {\n // setTimeout required to animate addition of new payment methods\n setTimeout(function () {\n classList.toggle(this.element, 'braintree-method--active', isActive);\n }.bind(this), 0);\n};\n\nPaymentMethodView.prototype.enableEditMode = function () {\n classList.add(this.checkMark, 'braintree-hidden');\n if (this.paymentMethod.hasSubscription) {\n classList.add(this.element, 'braintree-method--disabled');\n }\n};\n\nPaymentMethodView.prototype.disableEditMode = function () {\n classList.remove(this.checkMark, 'braintree-hidden');\n classList.remove(this.element, 'braintree-method--disabled');\n};\n\nPaymentMethodView.prototype.teardown = function () {\n if (this.element.parentNode) {\n this.element.parentNode.removeChild(this.element);\n }\n};\n\nPaymentMethodView.prototype._choosePaymentMethod = function () {\n if (this.paymentMethod.vaulted) {\n analytics.sendEvent(this.client, 'vaulted-' + constants.analyticsKinds[this.paymentMethod.type] + '.select');\n }\n\n this.model.changeActivePaymentMethod(this.paymentMethod);\n};\n\nPaymentMethodView.prototype._selectDelete = function () {\n this.model.confirmPaymentMethodDeletion(this.paymentMethod);\n};\n\nmodule.exports = PaymentMethodView;\n\n},{\"../constants\":191,\"../lib/add-selection-event-handler\":195,\"../lib/analytics\":196,\"./base-view\":249,\"@braintree/class-list\":39}],253:[function(require,module,exports){\n'use strict';\n\nvar BaseView = require('./base-view');\nvar PaymentMethodView = require('./payment-method-view');\nvar DropinError = require('../lib/dropin-error');\nvar classList = require('@braintree/class-list');\nvar errors = require('../constants').errors;\nvar Promise = require('../lib/promise');\nvar addSelectionEventHandler = require('../lib/add-selection-event-handler');\n\nvar PAYMENT_METHOD_TYPE_TO_TRANSLATION_STRING = {\n CreditCard: 'Card',\n PayPalAccount: 'PayPal',\n ApplePayCard: 'Apple Pay',\n AndroidPayCard: 'Google Pay',\n VenmoAccount: 'Venmo'\n};\n\nfunction PaymentMethodsView() {\n BaseView.apply(this, arguments);\n\n this._initialize();\n}\n\nPaymentMethodsView.prototype = Object.create(BaseView.prototype);\nPaymentMethodsView.prototype.constructor = PaymentMethodsView;\nPaymentMethodsView.ID = PaymentMethodsView.prototype.ID = 'methods';\n\nPaymentMethodsView.prototype._initialize = function () {\n this.views = [];\n this.container = this.getElementById('methods-container');\n this._headingLabel = this.getElementById('methods-label');\n this._editButton = this.getElementById('methods-edit');\n\n this.model.on('addPaymentMethod', this._addPaymentMethod.bind(this));\n this.model.on('changeActivePaymentMethod', this._changeActivePaymentMethodView.bind(this));\n this.model.on('refreshPaymentMethods', this.refreshPaymentMethods.bind(this));\n\n this.refreshPaymentMethods();\n\n if (this.model.merchantConfiguration.vaultManager) {\n this.model.on('removePaymentMethod', this._removePaymentMethod.bind(this));\n\n addSelectionEventHandler(this._editButton, function () {\n if (this.model.isInEditMode()) {\n this.model.disableEditMode();\n } else {\n this.model.enableEditMode();\n }\n }.bind(this));\n\n classList.remove(this._editButton, 'braintree-hidden');\n }\n};\n\nPaymentMethodsView.prototype.removeActivePaymentMethod = function () {\n if (!this.activeMethodView) {\n return;\n }\n this.activeMethodView.setActive(false);\n this.activeMethodView = null;\n classList.add(this._headingLabel, 'braintree-no-payment-method-selected');\n};\n\nPaymentMethodsView.prototype._getPaymentMethodString = function () {\n var stringKey, paymentMethodTypeString;\n\n if (!this.activeMethodView) {\n return '';\n }\n\n stringKey = PAYMENT_METHOD_TYPE_TO_TRANSLATION_STRING[this.activeMethodView.paymentMethod.type];\n paymentMethodTypeString = this.strings[stringKey];\n\n return this.strings.payingWith.replace('{{paymentSource}}', paymentMethodTypeString);\n};\n\nPaymentMethodsView.prototype.enableEditMode = function () {\n classList.add(this.container, 'braintree-methods--edit');\n\n this._editButton.innerHTML = this.strings.deleteCancelButton;\n this._headingLabel.innerHTML = this.strings.editPaymentMethods;\n\n this.views.forEach(function (view) {\n view.enableEditMode();\n });\n};\n\nPaymentMethodsView.prototype.disableEditMode = function () {\n classList.remove(this.container, 'braintree-methods--edit');\n\n this._editButton.innerHTML = this.strings.edit;\n this._headingLabel.innerHTML = this._getPaymentMethodString();\n\n this.views.forEach(function (view) {\n view.disableEditMode();\n });\n};\n\nPaymentMethodsView.prototype._addPaymentMethod = function (paymentMethod) {\n var paymentMethodView = new PaymentMethodView({\n model: this.model,\n paymentMethod: paymentMethod,\n client: this.client,\n strings: this.strings\n });\n\n if (this.model.isGuestCheckout && this.container.firstChild) {\n this.views[0].teardown();\n this.views.pop();\n }\n\n if (this.container.firstChild) {\n this.container.insertBefore(paymentMethodView.element, this.container.firstChild);\n } else {\n this.container.appendChild(paymentMethodView.element);\n }\n\n this.views.push(paymentMethodView);\n};\n\nPaymentMethodsView.prototype._removePaymentMethod = function (paymentMethod) {\n var i;\n\n for (i = 0; i < this.views.length; i++) {\n if (this.views[i].paymentMethod === paymentMethod) {\n this.views[i].teardown();\n this._headingLabel.innerHTML = ' ';\n this.views.splice(i, 1);\n break;\n }\n }\n};\n\nPaymentMethodsView.prototype._changeActivePaymentMethodView = function (paymentMethod) {\n var i;\n var previousActiveMethodView = this.activeMethodView;\n\n for (i = 0; i < this.views.length; i++) {\n if (this.views[i].paymentMethod === paymentMethod) {\n this.activeMethodView = this.views[i];\n this._headingLabel.innerHTML = this._getPaymentMethodString();\n break;\n }\n }\n\n if (previousActiveMethodView) {\n previousActiveMethodView.setActive(false);\n }\n this.activeMethodView.setActive(true);\n classList.remove(this._headingLabel, 'braintree-no-payment-method-selected');\n};\n\nPaymentMethodsView.prototype.requestPaymentMethod = function () {\n if (!this.activeMethodView || this.model.isInEditMode()) {\n return Promise.reject(new DropinError(errors.NO_PAYMENT_METHOD_ERROR));\n }\n\n return Promise.resolve(this.activeMethodView.paymentMethod);\n};\n\nPaymentMethodsView.prototype.refreshPaymentMethods = function () {\n var i;\n var paymentMethods = this.model.getPaymentMethods();\n\n this.views.forEach(function (view) {\n view.teardown();\n });\n\n this.views = [];\n\n for (i = paymentMethods.length - 1; i >= 0; i--) {\n this._addPaymentMethod(paymentMethods[i]);\n }\n};\n\nmodule.exports = PaymentMethodsView;\n\n},{\"../constants\":191,\"../lib/add-selection-event-handler\":195,\"../lib/dropin-error\":201,\"../lib/promise\":208,\"./base-view\":249,\"./payment-method-view\":252,\"@braintree/class-list\":39}],254:[function(require,module,exports){\n'use strict';\n\nvar analytics = require('../lib/analytics');\nvar addSelectionEventHandler = require('../lib/add-selection-event-handler');\nvar BaseView = require('./base-view');\n\nvar paymentOptionIDs = require('../constants').paymentOptionIDs;\n\nvar paymentMethodOptionHTML = \"
\\n \\n
\\n\\n
\\n\";\n\nfunction PaymentOptionsView() {\n BaseView.apply(this, arguments);\n\n this._initialize();\n}\n\nPaymentOptionsView.prototype = Object.create(BaseView.prototype);\nPaymentOptionsView.prototype.constructor = PaymentOptionsView;\nPaymentOptionsView.ID = PaymentOptionsView.prototype.ID = 'options';\n\nPaymentOptionsView.prototype._initialize = function () {\n this.container = this.getElementById('payment-options-container');\n this.elements = {};\n\n this.model.supportedPaymentOptions.forEach(function (paymentOptionID) {\n this._addPaymentOption(paymentOptionID);\n }.bind(this));\n};\n\nPaymentOptionsView.prototype._addPaymentOption = function (paymentOptionID) {\n var paymentSource;\n var div = document.createElement('div');\n var html = paymentMethodOptionHTML;\n var clickHandler = function clickHandler() {\n this.mainView.setPrimaryView(paymentOptionID);\n this.model.selectPaymentOption(paymentOptionID);\n analytics.sendEvent(this.client, 'selected.' + paymentOptionIDs[paymentOptionID]);\n }.bind(this);\n\n div.className = 'braintree-option braintree-option__' + paymentOptionID;\n div.setAttribute('tabindex', '0');\n\n switch (paymentOptionID) {\n case paymentOptionIDs.applePay:\n paymentSource = this.strings['Apple Pay'];\n html = html.replace(/@ICON/g, 'logoApplePay');\n break;\n case paymentOptionIDs.card:\n paymentSource = this.strings.Card;\n html = html.replace(/@ICON/g, 'iconCardFront');\n html = html.replace(/@CLASSNAME/g, 'braintree-icon--bordered');\n break;\n case paymentOptionIDs.googlePay:\n paymentSource = this.strings['Google Pay'];\n html = html.replace(/@ICON/g, 'logoGooglePay');\n break;\n case paymentOptionIDs.paypal:\n paymentSource = this.strings.PayPal;\n html = html.replace(/@ICON/g, 'logoPayPal');\n break;\n case paymentOptionIDs.paypalCredit:\n paymentSource = this.strings['PayPal Credit'];\n html = html.replace(/@ICON/g, 'logoPayPalCredit');\n break;\n case paymentOptionIDs.venmo:\n paymentSource = this.strings.Venmo;\n html = html.replace(/@ICON/g, 'logoVenmo');\n break;\n default:\n break;\n }\n\n html = html.replace(/@OPTION_LABEL/g, this._generateOptionLabel(paymentSource));\n html = html.replace(/@OPTION_TITLE/g, paymentSource);\n html = html.replace(/@CLASSNAME/g, '');\n\n div.innerHTML = html;\n\n addSelectionEventHandler(div, clickHandler);\n\n this.container.appendChild(div);\n this.elements[paymentOptionID] = {\n div: div,\n clickHandler: clickHandler\n };\n};\n\nPaymentOptionsView.prototype._generateOptionLabel = function (paymentSourceString) {\n return this.strings.payingWith.replace('{{paymentSource}}', paymentSourceString);\n};\n\nmodule.exports = PaymentOptionsView;\n\n},{\"../constants\":191,\"../lib/add-selection-event-handler\":195,\"../lib/analytics\":196,\"./base-view\":249}],255:[function(require,module,exports){\n(function (global){(function (){\n'use strict';\n\nvar assign = require('../../lib/assign').assign;\nvar BaseView = require('../base-view');\nvar btApplePay = require('braintree-web/apple-pay');\nvar DropinError = require('../../lib/dropin-error');\nvar isHTTPS = require('../../lib/is-https');\nvar Promise = require('../../lib/promise');\nvar paymentOptionIDs = require('../../constants').paymentOptionIDs;\n\nvar DEFAULT_APPLE_PAY_SESSION_VERSION = 2;\n\nfunction ApplePayView() {\n BaseView.apply(this, arguments);\n}\n\nApplePayView.prototype = Object.create(BaseView.prototype);\nApplePayView.prototype.constructor = ApplePayView;\nApplePayView.ID = ApplePayView.prototype.ID = paymentOptionIDs.applePay;\n\nApplePayView.prototype.initialize = function () {\n var self = this;\n\n self.applePayConfiguration = assign({}, self.model.merchantConfiguration.applePay);\n self.applePaySessionVersion = self.applePayConfiguration.applePaySessionVersion || DEFAULT_APPLE_PAY_SESSION_VERSION;\n\n delete self.applePayConfiguration.applePaySessionVersion;\n\n return btApplePay.create({client: this.client}).then(function (applePayInstance) {\n self.buttonDiv = self.getElementById('apple-pay-button');\n\n self.applePayInstance = applePayInstance;\n\n self.buttonDiv.onclick = self._showPaymentSheet.bind(self);\n self.buttonDiv.style['-apple-pay-button-style'] = self.model.merchantConfiguration.applePay.buttonStyle || 'black';\n\n self.model.asyncDependencyReady(ApplePayView.ID);\n }).catch(function (err) {\n self.model.asyncDependencyFailed({\n view: self.ID,\n error: new DropinError(err)\n });\n });\n};\n\nApplePayView.prototype._showPaymentSheet = function () {\n var self = this;\n var request, session;\n\n if (this._sessionInProgress) {\n return false;\n }\n\n this._sessionInProgress = true;\n\n request = this.applePayInstance.createPaymentRequest(this.applePayConfiguration.paymentRequest);\n session = new global.ApplePaySession(self.applePaySessionVersion, request);\n\n session.onvalidatemerchant = function (event) {\n self.applePayInstance.performValidation({\n validationURL: event.validationURL,\n displayName: self.applePayConfiguration.displayName\n }).then(function (validationData) {\n session.completeMerchantValidation(validationData);\n }).catch(function (validationErr) {\n self.model.reportError(validationErr);\n self._sessionInProgress = false;\n session.abort();\n });\n };\n\n session.onpaymentauthorized = function (event) {\n self.applePayInstance.tokenize({\n token: event.payment.token\n }).then(function (payload) {\n self._sessionInProgress = false;\n session.completePayment(global.ApplePaySession.STATUS_SUCCESS);\n payload.rawPaymentData = event.payment;\n self.model.addPaymentMethod(payload);\n }).catch(function (tokenizeErr) {\n self.model.reportError(tokenizeErr);\n self._sessionInProgress = false;\n session.completePayment(global.ApplePaySession.STATUS_FAILURE);\n });\n };\n\n session.begin();\n\n return false;\n};\n\nApplePayView.prototype.updateConfiguration = function (key, value) {\n this.applePayConfiguration[key] = value;\n};\n\nApplePayView.isEnabled = function (options) {\n var gatewayConfiguration = options.client.getConfiguration().gatewayConfiguration;\n var applePayEnabled = gatewayConfiguration.applePayWeb && Boolean(options.merchantConfiguration.applePay);\n var applePaySessionVersion = options.merchantConfiguration.applePay && options.merchantConfiguration.applePay.applePaySessionVersion;\n var applePayBrowserSupported;\n\n applePaySessionVersion = applePaySessionVersion || DEFAULT_APPLE_PAY_SESSION_VERSION;\n\n if (!applePayEnabled) {\n return Promise.resolve(false);\n }\n\n applePayBrowserSupported = global.ApplePaySession && isHTTPS.isHTTPS();\n\n if (!applePayBrowserSupported) {\n return Promise.resolve(false);\n }\n\n if (!global.ApplePaySession.supportsVersion(applePaySessionVersion)) {\n return Promise.resolve(false);\n }\n\n return Promise.resolve(Boolean(global.ApplePaySession.canMakePayments()));\n};\n\nmodule.exports = ApplePayView;\n\n}).call(this)}).call(this,typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : {})\n},{\"../../constants\":191,\"../../lib/assign\":197,\"../../lib/dropin-error\":201,\"../../lib/is-https\":204,\"../../lib/promise\":208,\"../base-view\":249,\"braintree-web/apple-pay\":53}],256:[function(require,module,exports){\n(function (global){(function (){\n'use strict';\n\nvar analytics = require('../../lib/analytics');\nvar assign = require('../../lib/assign').assign;\nvar browserDetection = require('../../lib/browser-detection');\nvar BaseView = require('../base-view');\nvar btPaypal = require('braintree-web/paypal-checkout');\nvar DropinError = require('../../lib/dropin-error');\nvar constants = require('../../constants');\nvar assets = require('@braintree/asset-loader');\nvar translations = require('../../translations').fiveCharacterLocales;\nvar Promise = require('../../lib/promise');\n\nvar ASYNC_DEPENDENCY_TIMEOUT = 30000;\nvar READ_ONLY_CONFIGURATION_OPTIONS = ['offerCredit', 'locale'];\nvar DEFAULT_CHECKOUTJS_LOG_LEVEL = 'warn';\n\nvar paypalScriptLoadInProgressPromise;\n\nfunction BasePayPalView() {\n BaseView.apply(this, arguments);\n}\n\nBasePayPalView.prototype = Object.create(BaseView.prototype);\n\nBasePayPalView.prototype.initialize = function () {\n var asyncDependencyTimeoutHandler;\n var isCredit = Boolean(this._isPayPalCredit);\n var setupComplete = false;\n var self = this;\n var paypalType = isCredit ? 'paypalCredit' : 'paypal';\n var paypalConfiguration = this.model.merchantConfiguration[paypalType];\n var dropinWrapperId = '#braintree--dropin__' + this.model.componentID;\n\n this.paypalConfiguration = assign({}, paypalConfiguration);\n\n asyncDependencyTimeoutHandler = setTimeout(function () {\n self.model.asyncDependencyFailed({\n view: self.ID,\n error: new DropinError('There was an error connecting to PayPal.')\n });\n }, ASYNC_DEPENDENCY_TIMEOUT);\n\n return btPaypal.create({client: this.client}).then(function (paypalInstance) {\n var checkoutJSConfiguration;\n var buttonSelector = '[data-braintree-id=\"paypal-button\"]';\n var environment = self.client.getConfiguration().gatewayConfiguration.environment === 'production' ? 'production' : 'sandbox';\n var locale = self.model.merchantConfiguration.locale;\n\n self.paypalInstance = paypalInstance;\n\n self.paypalConfiguration.offerCredit = Boolean(isCredit);\n checkoutJSConfiguration = {\n env: environment,\n style: self.paypalConfiguration.buttonStyle || {},\n commit: self.paypalConfiguration.commit,\n payment: function () {\n return paypalInstance.createPayment(self.paypalConfiguration).catch(reportError);\n },\n onAuthorize: function (data) {\n // NEXT_MAJOR_VERSION change out this vaultPayPal property\n // to something more generic, such as vaultOnTokenization so\n // all the vault objects can have the same shape (instead\n // of being specific to PayPal accounts here)\n var shouldNotVault = self.paypalConfiguration.vault && self.paypalConfiguration.vault.vaultPayPal === false;\n\n if (shouldNotVault) {\n data.vault = false;\n }\n\n return paypalInstance.tokenizePayment(data).then(function (tokenizePayload) {\n if (!shouldNotVault && self.paypalConfiguration.flow === 'vault' && !self.model.isGuestCheckout) {\n tokenizePayload.vaulted = true;\n }\n self.model.addPaymentMethod(tokenizePayload);\n }).catch(reportError);\n },\n onError: reportError\n };\n\n if (locale && locale in translations) {\n self.paypalConfiguration.locale = locale;\n checkoutJSConfiguration.locale = locale;\n }\n checkoutJSConfiguration.funding = {\n disallowed: []\n };\n\n Object.keys(global.paypal.FUNDING).forEach(function (key) {\n if (key === 'PAYPAL' || key === 'CREDIT') {\n return;\n }\n checkoutJSConfiguration.funding.disallowed.push(global.paypal.FUNDING[key]);\n });\n\n if (isCredit) {\n buttonSelector = '[data-braintree-id=\"paypal-credit-button\"]';\n checkoutJSConfiguration.style.label = 'credit';\n } else {\n checkoutJSConfiguration.funding.disallowed.push(global.paypal.FUNDING.CREDIT);\n }\n\n buttonSelector = dropinWrapperId + ' ' + buttonSelector;\n\n return global.paypal.Button.render(checkoutJSConfiguration, buttonSelector).then(function () {\n self.model.asyncDependencyReady(paypalType);\n setupComplete = true;\n clearTimeout(asyncDependencyTimeoutHandler);\n });\n }).catch(reportError);\n\n function reportError(err) {\n if (setupComplete) {\n self.model.reportError(err);\n } else {\n self.model.asyncDependencyFailed({\n view: self.ID,\n error: err\n });\n clearTimeout(asyncDependencyTimeoutHandler);\n }\n }\n};\n\nBasePayPalView.prototype.requestPaymentMethod = function () {\n this.model.reportError('paypalButtonMustBeUsed');\n\n return BaseView.prototype.requestPaymentMethod.call(this);\n};\n\nBasePayPalView.prototype.updateConfiguration = function (key, value) {\n if (READ_ONLY_CONFIGURATION_OPTIONS.indexOf(key) === -1) {\n this.paypalConfiguration[key] = value;\n }\n};\n\nBasePayPalView.isEnabled = function (options) {\n var gatewayConfiguration = options.client.getConfiguration().gatewayConfiguration;\n var merchantPayPalConfig = options.merchantConfiguration.paypal || options.merchantConfiguration.paypalCredit;\n\n if (!gatewayConfiguration.paypalEnabled) {\n return Promise.resolve(false);\n }\n\n if (browserDetection.isIe9() || browserDetection.isIe10()) {\n analytics.sendEvent(options.client, options.viewID + '.checkout.js-browser-not-supported');\n\n return Promise.resolve(false);\n }\n\n if (global.paypal && global.paypal.Button) {\n return Promise.resolve(true);\n }\n\n if (paypalScriptLoadInProgressPromise) {\n return paypalScriptLoadInProgressPromise;\n }\n\n paypalScriptLoadInProgressPromise = assets.loadScript({\n src: constants.CHECKOUT_JS_SOURCE,\n id: constants.PAYPAL_CHECKOUT_SCRIPT_ID,\n dataAttributes: {\n 'log-level': merchantPayPalConfig.logLevel || DEFAULT_CHECKOUTJS_LOG_LEVEL\n }\n }).then(function () {\n return Promise.resolve(true);\n }).catch(function () {\n return Promise.resolve(false);\n }).then(function (result) {\n paypalScriptLoadInProgressPromise = null;\n\n return Promise.resolve(result);\n });\n\n return paypalScriptLoadInProgressPromise;\n};\n\nmodule.exports = BasePayPalView;\n\n}).call(this)}).call(this,typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : {})\n},{\"../../constants\":191,\"../../lib/analytics\":196,\"../../lib/assign\":197,\"../../lib/browser-detection\":198,\"../../lib/dropin-error\":201,\"../../lib/promise\":208,\"../../translations\":232,\"../base-view\":249,\"@braintree/asset-loader\":1,\"braintree-web/paypal-checkout\":136}],257:[function(require,module,exports){\n'use strict';\n\nvar assign = require('../../lib/assign').assign;\n\nvar BaseView = require('../base-view');\nvar classList = require('@braintree/class-list');\nvar constants = require('../../constants');\nvar DropinError = require('../../lib/dropin-error');\nvar hostedFields = require('braintree-web/hosted-fields');\nvar isUtf8 = require('../../lib/is-utf-8');\nvar transitionHelper = require('../../lib/transition-helper');\nvar Promise = require('../../lib/promise');\n\nvar cardIconHTML = \"
\\n \\n
\\n
\\n \\n
\\n
\\n \\n
\\n
\\n \\n
\\n
\\n \\n
\\n\\n
\\n \\n
\\n
\\n \\n
\\n
\\n \\n
\\n\";\n\nvar PASSTHROUGH_EVENTS = [\n 'empty',\n // TODO should intercept this event and call tokenize\n 'inputSubmitRequest',\n 'binAvailable'\n];\n\nfunction CardView() {\n BaseView.apply(this, arguments);\n}\n\nCardView.prototype = Object.create(BaseView.prototype);\nCardView.prototype.constructor = CardView;\nCardView.ID = CardView.prototype.ID = constants.paymentOptionIDs.card;\n\nCardView.prototype.initialize = function () {\n var cvvFieldGroup, postalCodeFieldGroup, hfOptions;\n var cardholderNameGroup = this.getElementById('cardholder-name-field-group');\n var cardIcons = this.getElementById('card-view-icons');\n\n this.merchantConfiguration = this.model.merchantConfiguration.card || {};\n this.merchantConfiguration.vault = this.merchantConfiguration.vault || {};\n this.hasCardholderName = Boolean(this.merchantConfiguration.cardholderName);\n this.cardholderNameRequired = this.hasCardholderName && this.merchantConfiguration.cardholderName.required === true;\n hfOptions = this._generateHostedFieldsOptions();\n\n cardIcons.innerHTML = cardIconHTML;\n this._hideUnsupportedCardIcons();\n\n this.hasCVV = hfOptions.fields.cvv;\n this.saveCardInput = this.getElementById('save-card-input');\n this.cardNumberIcon = this.getElementById('card-number-icon');\n this.cardNumberIconSvg = this.getElementById('card-number-icon-svg');\n this.cvvIcon = this.getElementById('cvv-icon');\n this.cvvIconSvg = this.getElementById('cvv-icon-svg');\n this.cvvLabelDescriptor = this.getElementById('cvv-label-descriptor');\n this.fieldErrors = {};\n\n if (!this.hasCardholderName) {\n cardholderNameGroup.parentNode.removeChild(cardholderNameGroup);\n }\n\n if (!this.hasCVV) {\n cvvFieldGroup = this.getElementById('cvv-field-group');\n cvvFieldGroup.parentNode.removeChild(cvvFieldGroup);\n }\n\n if (!hfOptions.fields.postalCode) {\n postalCodeFieldGroup = this.getElementById('postal-code-field-group');\n postalCodeFieldGroup.parentNode.removeChild(postalCodeFieldGroup);\n }\n\n if (!this.model.isGuestCheckout && this.merchantConfiguration.vault.allowVaultCardOverride === true) {\n classList.remove(this.getElementById('save-card-field-group'), 'braintree-hidden');\n }\n\n // NEXT_MAJOR_VERSION change out this vaultCard property\n // to something more generic, such as vaultOnTokenization so\n // all the vault objects can have the same shape (instead\n // of being specific to cards here)\n if (this.merchantConfiguration.vault.vaultCard === false) {\n this.saveCardInput.checked = false;\n }\n\n return hostedFields.create(hfOptions).then(function (hostedFieldsInstance) {\n this.hostedFieldsInstance = hostedFieldsInstance;\n this.hostedFieldsInstance.on('blur', this._onBlurEvent.bind(this));\n this.hostedFieldsInstance.on('cardTypeChange', this._onCardTypeChangeEvent.bind(this));\n this.hostedFieldsInstance.on('focus', this._onFocusEvent.bind(this));\n this.hostedFieldsInstance.on('notEmpty', this._onNotEmptyEvent.bind(this));\n this.hostedFieldsInstance.on('validityChange', this._onValidityChangeEvent.bind(this));\n\n PASSTHROUGH_EVENTS.forEach(function (eventName) {\n this.hostedFieldsInstance.on(eventName, function (event) {\n this.model._emit('card:' + eventName, event);\n }.bind(this));\n }.bind(this));\n\n this.model.asyncDependencyReady(CardView.ID);\n }.bind(this)).catch(function (err) {\n this.model.asyncDependencyFailed({\n view: this.ID,\n error: err\n });\n }.bind(this));\n};\n\nCardView.prototype._sendRequestableEvent = function () {\n if (!this._isTokenizing) {\n this.model.setPaymentMethodRequestable({\n isRequestable: this._validateForm(),\n type: constants.paymentMethodTypes.card\n });\n }\n};\n\nCardView.prototype._generateHostedFieldsOptions = function () {\n var challenges = this.client.getConfiguration().gatewayConfiguration.challenges;\n var hasCVVChallenge = challenges.indexOf('cvv') !== -1;\n var hasPostalCodeChallenge = challenges.indexOf('postal_code') !== -1;\n var overrides = this.merchantConfiguration.overrides;\n var options = {\n client: this.client,\n fields: {\n cardholderName: {\n container: this._getFieldContainer('cardholder-name'),\n placeholder: this.strings.cardholderNamePlaceholder\n },\n number: {\n container: this._getFieldContainer('number'),\n placeholder: generateCardNumberPlaceholder()\n },\n expirationDate: {\n container: this._getFieldContainer('expiration'),\n placeholder: this.strings.expirationDatePlaceholder\n },\n cvv: {\n container: this._getFieldContainer('cvv'),\n placeholder: addBullets(3)\n },\n postalCode: {\n container: this._getFieldContainer('postal-code')\n }\n },\n styles: {\n input: {\n 'font-size': '16px',\n 'font-family': '-apple-system, BlinkMacSystemFont, \"Segoe UI\", \"Roboto\", \"Oxygen\", \"Ubuntu\", \"Cantarell\", \"Fira Sans\", \"Droid Sans\", \"Helvetica Neue\", sans-serif',\n color: '#000'\n },\n ':focus': {\n color: 'black'\n },\n '::-webkit-input-placeholder': {\n color: '#6a6a6a'\n },\n ':-moz-placeholder': {\n color: '#6a6a6a'\n },\n '::-moz-placeholder': {\n color: '#6a6a6a'\n },\n ':-ms-input-placeholder ': {\n color: '#6a6a6a'\n },\n 'input::-ms-clear': {\n color: 'transparent'\n }\n }\n };\n\n if (!this.hasCardholderName) {\n delete options.fields.cardholderName;\n }\n\n if (!hasCVVChallenge) {\n delete options.fields.cvv;\n }\n\n if (!hasPostalCodeChallenge) {\n delete options.fields.postalCode;\n }\n\n if (!overrides) { return options; }\n\n if (overrides.fields) {\n if (overrides.fields.cvv && typeof overrides.fields.cvv.placeholder !== 'undefined') {\n this._hasCustomCVVPlaceholder = true;\n }\n\n Object.keys(overrides.fields).forEach(function (field) {\n if ((field === 'cvv' || field === 'postalCode') && overrides.fields[field] === null) {\n delete options.fields[field];\n\n return;\n }\n\n if (!options.fields[field]) {\n return;\n }\n\n assign(options.fields[field], overrides.fields[field], {\n selector: options.fields[field].selector\n });\n });\n }\n\n if (overrides.styles) {\n Object.keys(overrides.styles).forEach(function (style) {\n if (overrides.styles[style] === null) {\n delete options.styles[style];\n\n return;\n } else if (typeof overrides.styles[style] === 'string') {\n // it's a class name, and should override the configured styles entirely\n options.styles[style] = overrides.styles[style];\n\n return;\n }\n\n normalizeStyles(overrides.styles[style]);\n options.styles[style] = options.styles[style] || {};\n\n assign(options.styles[style], overrides.styles[style]);\n });\n }\n\n return options;\n};\n\nCardView.prototype._validateForm = function (showFieldErrors) {\n var card, cardType, cardTypeSupported, state;\n var isValid = true;\n var supportedCardTypes = this.client.getConfiguration().gatewayConfiguration.creditCards.supportedCardTypes;\n\n if (!this.hostedFieldsInstance) {\n return false;\n }\n\n state = this.hostedFieldsInstance.getState();\n\n Object.keys(state.fields).forEach(function (key) {\n var field = state.fields[key];\n\n if (!showFieldErrors && !isValid) {\n // return early if form is already invalid\n // and we don't need to display all field errors\n return;\n }\n\n if (field.isEmpty) {\n if (!this.cardholderNameRequired && key === 'cardholderName') {\n isValid = true;\n } else {\n isValid = false;\n\n if (showFieldErrors) {\n this.showFieldError(key, this.strings['fieldEmptyFor' + capitalize(key)]);\n }\n }\n } else if (!field.isValid) {\n isValid = false;\n\n if (showFieldErrors) {\n this.showFieldError(key, this.strings['fieldInvalidFor' + capitalize(key)]);\n }\n }\n }.bind(this));\n\n if (state.fields.number.isValid) {\n card = state.cards[0];\n cardType = card && constants.configurationCardTypes[card.type];\n cardTypeSupported = cardType && supportedCardTypes.indexOf(cardType) !== -1;\n\n if (!cardTypeSupported) {\n isValid = false;\n\n if (showFieldErrors) {\n this.showFieldError('number', this.strings.unsupportedCardTypeError);\n }\n }\n }\n\n return isValid;\n};\n\nCardView.prototype.getPaymentMethod = function () { // eslint-disable-line consistent-return\n var formIsValid = this._validateForm();\n\n if (formIsValid) {\n return {\n type: constants.paymentMethodTypes.card\n };\n }\n};\n\nCardView.prototype.tokenize = function () {\n var transitionCallback;\n var self = this;\n var state = self.hostedFieldsInstance.getState();\n var tokenizeOptions = {\n vault: this._shouldVault()\n };\n\n this.model.clearError();\n\n if (!this._validateForm(true)) {\n self.model.reportError('hostedFieldsFieldsInvalidError');\n self.allowUserAction();\n\n return Promise.reject(new DropinError(constants.errors.NO_PAYMENT_METHOD_ERROR));\n }\n\n if (!this.cardholderNameRequired && state.fields.cardholderName && state.fields.cardholderName.isEmpty) {\n tokenizeOptions.fieldsToTokenize = Object.keys(state.fields).filter(function (field) {\n return field !== 'cardholderName';\n });\n }\n\n self._isTokenizing = true;\n\n return self.hostedFieldsInstance.tokenize(tokenizeOptions).then(function (payload) {\n var retainCardFields = self.merchantConfiguration.clearFieldsAfterTokenization === false;\n\n if (!retainCardFields) {\n Object.keys(state.fields).forEach(function (field) {\n self.hostedFieldsInstance.clear(field);\n });\n }\n\n if (self._shouldVault()) {\n payload.vaulted = true;\n }\n\n return new Promise(function (resolve) {\n transitionCallback = function () {\n // Wait for braintree-sheet--tokenized class to be added in IE 9\n // before attempting to remove it\n setTimeout(function () {\n self.model.addPaymentMethod(payload);\n resolve(payload);\n classList.remove(self.element, 'braintree-sheet--tokenized');\n }, 0);\n };\n\n transitionHelper.onTransitionEnd(self.element, 'max-height', transitionCallback);\n\n setTimeout(function () {\n self.allowUserAction();\n self._isTokenizing = false;\n }, constants.CHANGE_ACTIVE_PAYMENT_METHOD_TIMEOUT);\n\n classList.add(self.element, 'braintree-sheet--tokenized');\n });\n }).catch(function (err) {\n self._isTokenizing = false;\n // this is a little magical, but if the code property exists\n // in the translations with the word Error appended to the end,\n // then reportError will automatically print that translation.\n // See https://github.com/braintree/braintree-web-drop-in/blob/6ecba73f2f16e8b7ae2119702ac162a1a985908e/src/views/main-view.js#L255-L256\n self.model.reportError(err);\n self.allowUserAction();\n\n return Promise.reject(new DropinError({\n message: constants.errors.NO_PAYMENT_METHOD_ERROR,\n braintreeWebError: err\n }));\n });\n};\n\nCardView.prototype.showFieldError = function (field, errorMessage) {\n var fieldError;\n var fieldGroup = this.getElementById(camelCaseToKebabCase(field) + '-field-group');\n var input = fieldGroup.querySelector('input');\n\n if (!this.fieldErrors.hasOwnProperty(field)) {\n this.fieldErrors[field] = this.getElementById(camelCaseToKebabCase(field) + '-field-error');\n }\n\n classList.add(fieldGroup, 'braintree-form__field-group--has-error');\n\n fieldError = this.fieldErrors[field];\n fieldError.innerHTML = errorMessage;\n\n if (input) {\n input.setAttribute('aria-invalid', true);\n } else {\n this.hostedFieldsInstance.setAttribute({\n field: field,\n attribute: 'aria-invalid',\n value: true\n });\n this.hostedFieldsInstance.setMessage({\n field: field,\n message: errorMessage\n });\n }\n};\n\nCardView.prototype.hideFieldError = function (field) {\n var fieldGroup = this.getElementById(camelCaseToKebabCase(field) + '-field-group');\n var input = fieldGroup.querySelector('input');\n\n if (!this.fieldErrors.hasOwnProperty(field)) {\n this.fieldErrors[field] = this.getElementById(camelCaseToKebabCase(field) + '-field-error');\n }\n\n classList.remove(fieldGroup, 'braintree-form__field-group--has-error');\n\n if (input) {\n input.removeAttribute('aria-invalid');\n } else {\n this.hostedFieldsInstance.removeAttribute({\n field: field,\n attribute: 'aria-invalid'\n });\n this.hostedFieldsInstance.setMessage({\n field: field,\n message: ''\n });\n }\n};\n\nCardView.prototype.teardown = function () {\n return this.hostedFieldsInstance.teardown();\n};\n\nCardView.prototype._shouldVault = function () {\n return !this.model.isGuestCheckout && this.saveCardInput.checked;\n};\n\nCardView.prototype._getFieldContainer = function (field) {\n // we committed to not changing the data-braintree-id fields\n // so we need to convert this field to the id used in the HTML\n if (field === 'expiration') {\n field = 'expiration-date';\n }\n\n return this.getElementById(field + '-field-group').querySelector('.braintree-form__hosted-field');\n};\n\nCardView.prototype._onBlurEvent = function (event) {\n var field = event.fields[event.emittedBy];\n var fieldGroup = this.getElementById(camelCaseToKebabCase(event.emittedBy) + '-field-group');\n\n classList.remove(fieldGroup, 'braintree-form__field-group--is-focused');\n\n if (this._shouldApplyFieldEmptyError(event.emittedBy, field)) {\n this.showFieldError(event.emittedBy, this.strings['fieldEmptyFor' + capitalize(event.emittedBy)]);\n } else if (!field.isEmpty && !field.isValid) {\n this.showFieldError(event.emittedBy, this.strings['fieldInvalidFor' + capitalize(event.emittedBy)]);\n } else if (event.emittedBy === 'number' && !this._isCardTypeSupported(event.cards[0].type)) {\n this.showFieldError('number', this.strings.unsupportedCardTypeError);\n }\n\n this.model._emit('card:blur', event);\n\n setTimeout(function () {\n // when focusing on a field by clicking the label,\n // we need to wait a bit for the iframe to be\n // focused properly before applying validations\n if (this._shouldApplyFieldEmptyError(event.emittedBy, field)) {\n this.showFieldError(event.emittedBy, this.strings['fieldEmptyFor' + capitalize(event.emittedBy)]);\n }\n }.bind(this), 150);\n};\n\nCardView.prototype._onCardTypeChangeEvent = function (event) {\n var cardType;\n var cardNumberHrefLink = '#iconCardFront';\n var cvvHrefLink = '#iconCVVBack';\n var cvvDescriptor = this.strings.cvvThreeDigitLabelSubheading;\n var cvvPlaceholder = addBullets(3);\n var numberFieldGroup = this.getElementById('number-field-group');\n\n if (event.cards.length === 1) {\n cardType = event.cards[0].type;\n cardNumberHrefLink = '#icon-' + cardType;\n if (cardType === 'american-express') {\n cvvHrefLink = '#iconCVVFront';\n cvvDescriptor = this.strings.cvvFourDigitLabelSubheading;\n cvvPlaceholder = addBullets(4);\n }\n // Keep icon visible when field is not focused\n classList.add(numberFieldGroup, 'braintree-form__field-group--card-type-known');\n } else {\n classList.remove(numberFieldGroup, 'braintree-form__field-group--card-type-known');\n }\n\n this.cardNumberIconSvg.setAttribute('xlink:href', cardNumberHrefLink);\n\n if (this.hasCVV) {\n this.cvvIconSvg.setAttribute('xlink:href', cvvHrefLink);\n this.cvvLabelDescriptor.innerHTML = cvvDescriptor;\n\n if (!this._hasCustomCVVPlaceholder) {\n this.hostedFieldsInstance.setAttribute({\n field: 'cvv',\n attribute: 'placeholder',\n value: cvvPlaceholder\n });\n }\n }\n\n this.model._emit('card:cardTypeChange', event);\n};\n\nCardView.prototype._onFocusEvent = function (event) {\n var fieldGroup = this.getElementById(camelCaseToKebabCase(event.emittedBy) + '-field-group');\n\n classList.add(fieldGroup, 'braintree-form__field-group--is-focused');\n\n this.model._emit('card:focus', event);\n};\n\nCardView.prototype._onNotEmptyEvent = function (event) {\n this.hideFieldError(event.emittedBy);\n\n this.model._emit('card:notEmpty', event);\n};\n\nCardView.prototype._onValidityChangeEvent = function (event) {\n var isValid;\n var field = event.fields[event.emittedBy];\n\n if (event.emittedBy === 'number' && event.cards[0]) {\n isValid = field.isValid && this._isCardTypeSupported(event.cards[0].type);\n } else {\n isValid = field.isValid;\n }\n\n classList.toggle(field.container, 'braintree-form__field--valid', isValid);\n\n if (field.isPotentiallyValid) {\n this.hideFieldError(event.emittedBy);\n }\n\n this._sendRequestableEvent();\n\n this.model._emit('card:validityChange', event);\n};\n\nCardView.prototype.requestPaymentMethod = function () {\n this.preventUserAction();\n\n return this.tokenize();\n};\n\nCardView.prototype.onSelection = function () {\n if (!this.hostedFieldsInstance) {\n return;\n }\n\n setTimeout(function () {\n if (this.hasCardholderName) {\n this.hostedFieldsInstance.focus('cardholderName');\n } else {\n this.hostedFieldsInstance.focus('number');\n }\n }.bind(this), 50);\n};\n\nCardView.prototype._hideUnsupportedCardIcons = function () {\n var supportedCardTypes = this.client.getConfiguration().gatewayConfiguration.creditCards.supportedCardTypes;\n\n Object.keys(constants.configurationCardTypes).forEach(function (paymentMethodCardType) {\n var cardIcon;\n var configurationCardType = constants.configurationCardTypes[paymentMethodCardType];\n\n if (supportedCardTypes.indexOf(configurationCardType) === -1) {\n cardIcon = this.getElementById(paymentMethodCardType + '-card-icon');\n classList.add(cardIcon, 'braintree-hidden');\n }\n }.bind(this));\n};\n\nCardView.prototype._isCardTypeSupported = function (cardType) {\n var configurationCardType = constants.configurationCardTypes[cardType];\n var supportedCardTypes = this.client.getConfiguration().gatewayConfiguration.creditCards.supportedCardTypes;\n\n return supportedCardTypes.indexOf(configurationCardType) !== -1;\n};\n\nCardView.isEnabled = function (options) {\n var gatewayConfiguration = options.client.getConfiguration().gatewayConfiguration;\n var disabledByMerchant = options.merchantConfiguration.card === false;\n\n return Promise.resolve(!disabledByMerchant && gatewayConfiguration.creditCards.supportedCardTypes.length > 0);\n};\n\nCardView.prototype._shouldApplyFieldEmptyError = function (fieldId, field) {\n if (!field.isEmpty) {\n return false;\n }\n\n if (fieldId === 'cardholderName' && !this.cardholderNameRequired) {\n return false;\n }\n\n return isCardViewElement();\n};\n\nfunction isCardViewElement() {\n var activeId = document.activeElement && document.activeElement.id;\n var isHostedFieldsElement = document.activeElement instanceof HTMLIFrameElement && activeId.indexOf('braintree-hosted-field') !== -1;\n\n return isHostedFieldsElement;\n}\n\nfunction camelCaseToKebabCase(string) {\n return string.replace(/([a-z])([A-Z])/g, '$1-$2').toLowerCase();\n}\n\nfunction capitalize(string) {\n return string[0].toUpperCase() + string.substr(1);\n}\n\nfunction normalizeStyles(styles) {\n Object.keys(styles).forEach(function (style) {\n var transformedKeyName = camelCaseToKebabCase(style);\n\n styles[transformedKeyName] = styles[style];\n });\n}\n\nfunction addBullets(number) {\n var bulletCharacter = isUtf8() ? '•' : '*';\n\n return Array(number + 1).join(bulletCharacter);\n}\n\nfunction generateCardNumberPlaceholder() {\n var four = addBullets(4);\n\n return [four, four, four, four].join(' ');\n}\n\nmodule.exports = CardView;\n\n},{\"../../constants\":191,\"../../lib/assign\":197,\"../../lib/dropin-error\":201,\"../../lib/is-utf-8\":205,\"../../lib/promise\":208,\"../../lib/transition-helper\":212,\"../base-view\":249,\"@braintree/class-list\":39,\"braintree-web/hosted-fields\":85}],258:[function(require,module,exports){\n(function (global){(function (){\n'use strict';\n\nvar assign = require('../../lib/assign').assign;\nvar BaseView = require('../base-view');\nvar btGooglePay = require('braintree-web/google-payment');\nvar DropinError = require('../../lib/dropin-error');\nvar constants = require('../../constants');\nvar assets = require('@braintree/asset-loader');\nvar Promise = require('../../lib/promise');\nvar analytics = require('../../lib/analytics');\n\nfunction GooglePayView() {\n BaseView.apply(this, arguments);\n}\n\nGooglePayView.prototype = Object.create(BaseView.prototype);\nGooglePayView.prototype.constructor = GooglePayView;\nGooglePayView.ID = GooglePayView.prototype.ID = constants.paymentOptionIDs.googlePay;\n\nGooglePayView.prototype.initialize = function () {\n var self = this;\n var buttonOptions, googlePayVersion, merchantId;\n\n self.googlePayConfiguration = assign({}, self.model.merchantConfiguration.googlePay);\n googlePayVersion = self.googlePayConfiguration.googlePayVersion;\n merchantId = self.googlePayConfiguration.merchantId;\n\n buttonOptions = assign({\n buttonType: 'short'\n }, self.googlePayConfiguration.button, {\n onClick: function (event) {\n event.preventDefault();\n\n self.preventUserAction();\n\n self.tokenize().then(function () {\n self.allowUserAction();\n });\n }\n });\n\n delete self.googlePayConfiguration.googlePayVersion;\n delete self.googlePayConfiguration.merchantId;\n delete self.googlePayConfiguration.button;\n\n return btGooglePay.create({\n client: self.client,\n googlePayVersion: googlePayVersion,\n googleMerchantId: merchantId\n }).then(function (googlePayInstance) {\n self.googlePayInstance = googlePayInstance;\n self.paymentsClient = createPaymentsClient(self.client);\n }).then(function () {\n var buttonContainer = self.getElementById('google-pay-button');\n\n buttonContainer.appendChild(self.paymentsClient.createButton(buttonOptions));\n\n self.model.asyncDependencyReady(GooglePayView.ID);\n }).catch(function (err) {\n self.model.asyncDependencyFailed({\n view: self.ID,\n error: new DropinError(err)\n });\n });\n};\n\nGooglePayView.prototype.tokenize = function () {\n var self = this;\n var paymentDataRequest = self.googlePayInstance.createPaymentDataRequest(self.googlePayConfiguration);\n var rawPaymentData;\n\n return self.paymentsClient.loadPaymentData(paymentDataRequest).then(function (paymentData) {\n rawPaymentData = paymentData;\n\n return self.googlePayInstance.parseResponse(paymentData);\n }).then(function (tokenizePayload) {\n tokenizePayload.rawPaymentData = rawPaymentData;\n self.model.addPaymentMethod(tokenizePayload);\n }).catch(function (err) {\n var reportedError = err;\n\n if (err.statusCode === 'DEVELOPER_ERROR') {\n console.error(err); // eslint-disable-line no-console\n reportedError = 'developerError';\n } else if (err.statusCode === 'CANCELED') {\n analytics.sendEvent(self.client, 'googlepay.loadPaymentData.canceled');\n\n return;\n } else if (err.statusCode) {\n analytics.sendEvent(self.client, 'googlepay.loadPaymentData.failed');\n }\n\n self.model.reportError(reportedError);\n });\n};\n\nGooglePayView.prototype.updateConfiguration = function (key, value) {\n this.googlePayConfiguration[key] = value;\n};\n\nGooglePayView.isEnabled = function (options) {\n var gatewayConfiguration = options.client.getConfiguration().gatewayConfiguration;\n\n if (!(gatewayConfiguration.androidPay && Boolean(options.merchantConfiguration.googlePay))) {\n return Promise.resolve(false);\n }\n\n return Promise.resolve().then(function () {\n if (!(global.google && global.google.payments && global.google.payments.api && global.google.payments.api.PaymentsClient)) {\n return assets.loadScript({\n id: constants.GOOGLE_PAYMENT_SCRIPT_ID,\n src: constants.GOOGLE_PAYMENT_SOURCE\n });\n }\n\n return Promise.resolve();\n }).then(function () {\n var paymentsClient = createPaymentsClient(options.client);\n\n return paymentsClient.isReadyToPay({\n allowedPaymentMethods: ['CARD', 'TOKENIZED_CARD']\n });\n }).then(function (response) {\n return Boolean(response.result);\n });\n};\n\nfunction createPaymentsClient(client) {\n return new global.google.payments.api.PaymentsClient({\n environment: client.getConfiguration().gatewayConfiguration.environment === 'production' ? 'PRODUCTION' : 'TEST'\n });\n}\n\nmodule.exports = GooglePayView;\n\n}).call(this)}).call(this,typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : {})\n},{\"../../constants\":191,\"../../lib/analytics\":196,\"../../lib/assign\":197,\"../../lib/dropin-error\":201,\"../../lib/promise\":208,\"../base-view\":249,\"@braintree/asset-loader\":1,\"braintree-web/google-payment\":78}],259:[function(require,module,exports){\n'use strict';\n\nvar paymentOptionIDs = require('../../constants').paymentOptionIDs;\n\nvar result = {};\n\nresult[paymentOptionIDs.applePay] = require('./apple-pay-view');\nresult[paymentOptionIDs.card] = require('./card-view');\nresult[paymentOptionIDs.googlePay] = require('./google-pay-view');\nresult[paymentOptionIDs.paypal] = require('./paypal-view');\nresult[paymentOptionIDs.paypalCredit] = require('./paypal-credit-view');\nresult[paymentOptionIDs.venmo] = require('./venmo-view');\n\nmodule.exports = result;\n\n},{\"../../constants\":191,\"./apple-pay-view\":255,\"./card-view\":257,\"./google-pay-view\":258,\"./paypal-credit-view\":260,\"./paypal-view\":261,\"./venmo-view\":262}],260:[function(require,module,exports){\n'use strict';\n\nvar assign = require('../../lib/assign').assign;\nvar Promise = require('../../lib/promise');\nvar paymentOptionIDs = require('../../constants').paymentOptionIDs;\nvar BasePayPalView = require('./base-paypal-view');\n\nfunction PayPalCreditView() {\n BasePayPalView.apply(this, arguments);\n\n this._isPayPalCredit = true;\n}\n\nPayPalCreditView.prototype = Object.create(BasePayPalView.prototype);\nPayPalCreditView.prototype.constructor = PayPalCreditView;\nPayPalCreditView.ID = PayPalCreditView.prototype.ID = paymentOptionIDs.paypalCredit;\n\nPayPalCreditView.isEnabled = function (options) {\n if (!options.merchantConfiguration.paypalCredit) {\n return Promise.resolve(false);\n }\n\n return BasePayPalView.isEnabled(assign({\n viewID: PayPalCreditView.ID\n }, options));\n};\nmodule.exports = PayPalCreditView;\n\n},{\"../../constants\":191,\"../../lib/assign\":197,\"../../lib/promise\":208,\"./base-paypal-view\":256}],261:[function(require,module,exports){\n'use strict';\n\nvar assign = require('../../lib/assign').assign;\nvar Promise = require('../../lib/promise');\nvar paymentOptionIDs = require('../../constants').paymentOptionIDs;\nvar BasePayPalView = require('./base-paypal-view');\n\nfunction PayPalView() {\n BasePayPalView.apply(this, arguments);\n}\n\nPayPalView.prototype = Object.create(BasePayPalView.prototype);\nPayPalView.prototype.constructor = PayPalView;\nPayPalView.ID = PayPalView.prototype.ID = paymentOptionIDs.paypal;\n\nPayPalView.isEnabled = function (options) {\n if (!options.merchantConfiguration.paypal) {\n return Promise.resolve(false);\n }\n\n return BasePayPalView.isEnabled(assign({\n viewID: PayPalView.ID\n }, options));\n};\n\nmodule.exports = PayPalView;\n\n},{\"../../constants\":191,\"../../lib/assign\":197,\"../../lib/promise\":208,\"./base-paypal-view\":256}],262:[function(require,module,exports){\n'use strict';\n\nvar assign = require('../../lib/assign').assign;\nvar BaseView = require('../base-view');\nvar btVenmo = require('braintree-web/venmo');\nvar DropinError = require('../../lib/dropin-error');\nvar Promise = require('../../lib/promise');\nvar paymentOptionIDs = require('../../constants').paymentOptionIDs;\n\nfunction VenmoView() {\n BaseView.apply(this, arguments);\n}\n\nVenmoView.prototype = Object.create(BaseView.prototype);\nVenmoView.prototype.constructor = VenmoView;\nVenmoView.ID = VenmoView.prototype.ID = paymentOptionIDs.venmo;\n\nVenmoView.prototype.initialize = function () {\n var self = this;\n var venmoConfiguration = assign({}, self.model.merchantConfiguration.venmo, {client: this.client});\n\n return btVenmo.create(venmoConfiguration).then(function (venmoInstance) {\n self.venmoInstance = venmoInstance;\n\n if (!self.venmoInstance.hasTokenizationResult()) {\n return Promise.resolve();\n }\n\n return self.venmoInstance.tokenize().then(function (payload) {\n self.model.reportAppSwitchPayload(payload);\n }).catch(function (err) {\n if (self._isIgnorableError(err)) {\n return;\n }\n self.model.reportAppSwitchError(paymentOptionIDs.venmo, err);\n });\n }).then(function () {\n var button = self.getElementById('venmo-button');\n\n button.addEventListener('click', function (event) {\n event.preventDefault();\n\n self.preventUserAction();\n\n return self.venmoInstance.tokenize().then(function (payload) {\n self.model.addPaymentMethod(payload);\n }).catch(function (tokenizeErr) {\n if (self._isIgnorableError(tokenizeErr)) {\n return;\n }\n\n self.model.reportError(tokenizeErr);\n }).then(function () {\n self.allowUserAction();\n });\n });\n\n self.model.asyncDependencyReady(VenmoView.ID);\n }).catch(function (err) {\n self.model.asyncDependencyFailed({\n view: self.ID,\n error: new DropinError(err)\n });\n });\n};\n\nVenmoView.prototype._isIgnorableError = function (error) {\n // customer cancels the flow in the app\n // we don't emit an error because the customer\n // initiated that action\n return error.code === 'VENMO_APP_CANCELED' || error.code === 'VENMO_DESKTOP_CANCELED';\n};\n\nVenmoView.isEnabled = function (options) {\n var gatewayConfiguration = options.client.getConfiguration().gatewayConfiguration;\n var venmoEnabled = gatewayConfiguration.payWithVenmo && Boolean(options.merchantConfiguration.venmo);\n\n if (!venmoEnabled) {\n return Promise.resolve(false);\n }\n\n return Promise.resolve(btVenmo.isBrowserSupported(options.merchantConfiguration.venmo));\n};\n\nmodule.exports = VenmoView;\n\n},{\"../../constants\":191,\"../../lib/assign\":197,\"../../lib/dropin-error\":201,\"../../lib/promise\":208,\"../base-view\":249,\"braintree-web/venmo\":157}]},{},[194])(194)\n});\n",";(function(root) {\n\n function isValidEmail(v) {\n if (!v) return false;\n var re = /^(([^<>()[\\]\\\\.,;:\\s@\\\"]+(\\.[^<>()[\\]\\\\.,;:\\s@\\\"]+)*)|(\\\".+\\\"))@((\\[[0-9]{1,3}\\.[0-9]{1,3}\\.[0-9]{1,3}\\.[0-9]{1,3}\\])|(([a-zA-Z\\-0-9]+\\.)+[a-zA-Z]{2,}))$/;\n return re.test(v);\n }\n\n if (typeof exports !== 'undefined') {\n if (typeof module !== 'undefined' && module.exports) {\n exports = module.exports = isValidEmail;\n }\n exports.isValidEmail = isValidEmail;\n } else if (typeof define === 'function' && define.amd) {\n define([], function() {\n return isValidEmail;\n });\n } else {\n root.isValidEmail = isValidEmail;\n }\n\n})(this);\n","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\n// https://stackoverflow.com/a/46971044/970769\nvar ParseError = function ParseError(code) {\n _classCallCheck(this, ParseError);\n\n this.name = this.constructor.name;\n this.message = code;\n this.stack = new Error(code).stack;\n};\n\nexport { ParseError as default };\nParseError.prototype = Object.create(Error.prototype);\nParseError.prototype.constructor = ParseError;\n","function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; var ownKeys = Object.keys(source); if (typeof Object.getOwnPropertySymbols === 'function') { ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) { return Object.getOwnPropertyDescriptor(source, sym).enumerable; })); } ownKeys.forEach(function (key) { _defineProperty(target, key, source[key]); }); } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nimport Metadata from './metadata';\nimport isPossibleNumber from './isPossibleNumber_';\nimport isValidNumber from './validate_';\nimport isValidNumberForRegion from './isValidNumberForRegion_';\nimport getNumberType from './helpers/getNumberType';\nimport formatNumber from './format_';\nvar USE_NON_GEOGRAPHIC_COUNTRY_CODE = false;\n\nvar PhoneNumber =\n/*#__PURE__*/\nfunction () {\n function PhoneNumber(countryCallingCode, nationalNumber, metadata) {\n _classCallCheck(this, PhoneNumber);\n\n if (!countryCallingCode) {\n throw new TypeError('`country` or `countryCallingCode` not passed');\n }\n\n if (!nationalNumber) {\n throw new TypeError('`nationalNumber` not passed');\n }\n\n if (!metadata) {\n throw new TypeError('`metadata` not passed');\n }\n\n var _metadata = new Metadata(metadata); // If country code is passed then derive `countryCallingCode` from it.\n // Also store the country code as `.country`.\n\n\n if (isCountryCode(countryCallingCode)) {\n this.country = countryCallingCode;\n\n _metadata.country(countryCallingCode);\n\n countryCallingCode = _metadata.countryCallingCode();\n } else {\n /* istanbul ignore if */\n if (USE_NON_GEOGRAPHIC_COUNTRY_CODE) {\n if (_metadata.isNonGeographicCallingCode(countryCallingCode)) {\n this.country = '001';\n }\n }\n }\n\n this.countryCallingCode = countryCallingCode;\n this.nationalNumber = nationalNumber;\n this.number = '+' + this.countryCallingCode + this.nationalNumber;\n this.metadata = metadata;\n }\n\n _createClass(PhoneNumber, [{\n key: \"isPossible\",\n value: function isPossible() {\n return isPossibleNumber(this, {\n v2: true\n }, this.metadata);\n }\n }, {\n key: \"isValid\",\n value: function isValid() {\n return isValidNumber(this, {\n v2: true\n }, this.metadata);\n }\n }, {\n key: \"isNonGeographic\",\n value: function isNonGeographic() {\n var metadata = new Metadata(this.metadata);\n return metadata.isNonGeographicCallingCode(this.countryCallingCode);\n }\n }, {\n key: \"isEqual\",\n value: function isEqual(phoneNumber) {\n return this.number === phoneNumber.number && this.ext === phoneNumber.ext;\n } // // Is just an alias for `this.isValid() && this.country === country`.\n // // https://github.com/googlei18n/libphonenumber/blob/master/FAQ.md#when-should-i-use-isvalidnumberforregion\n // isValidForRegion(country) {\n // \treturn isValidNumberForRegion(this, country, { v2: true }, this.metadata)\n // }\n\n }, {\n key: \"getType\",\n value: function getType() {\n return getNumberType(this, {\n v2: true\n }, this.metadata);\n }\n }, {\n key: \"format\",\n value: function format(_format, options) {\n return formatNumber(this, _format, options ? _objectSpread({}, options, {\n v2: true\n }) : {\n v2: true\n }, this.metadata);\n }\n }, {\n key: \"formatNational\",\n value: function formatNational(options) {\n return this.format('NATIONAL', options);\n }\n }, {\n key: \"formatInternational\",\n value: function formatInternational(options) {\n return this.format('INTERNATIONAL', options);\n }\n }, {\n key: \"getURI\",\n value: function getURI(options) {\n return this.format('RFC3966', options);\n }\n }]);\n\n return PhoneNumber;\n}();\n\nexport { PhoneNumber as default };\n\nvar isCountryCode = function isCountryCode(value) {\n return /^[A-Z]{2}$/.test(value);\n};\n","// The minimum length of the national significant number.\nexport var MIN_LENGTH_FOR_NSN = 2; // The ITU says the maximum length should be 15,\n// but one can find longer numbers in Germany.\n\nexport var MAX_LENGTH_FOR_NSN = 17; // The maximum length of the country calling code.\n\nexport var MAX_LENGTH_COUNTRY_CODE = 3; // Digits accepted in phone numbers\n// (ascii, fullwidth, arabic-indic, and eastern arabic digits).\n\nexport var VALID_DIGITS = \"0-9\\uFF10-\\uFF19\\u0660-\\u0669\\u06F0-\\u06F9\"; // `DASHES` will be right after the opening square bracket of the \"character class\"\n\nvar DASHES = \"-\\u2010-\\u2015\\u2212\\u30FC\\uFF0D\";\nvar SLASHES = \"\\uFF0F/\";\nvar DOTS = \"\\uFF0E.\";\nexport var WHITESPACE = \" \\xA0\\xAD\\u200B\\u2060\\u3000\";\nvar BRACKETS = \"()\\uFF08\\uFF09\\uFF3B\\uFF3D\\\\[\\\\]\"; // export const OPENING_BRACKETS = '(\\uFF08\\uFF3B\\\\\\['\n\nvar TILDES = \"~\\u2053\\u223C\\uFF5E\"; // Regular expression of acceptable punctuation found in phone numbers. This\n// excludes punctuation found as a leading character only. This consists of dash\n// characters, white space characters, full stops, slashes, square brackets,\n// parentheses and tildes. Full-width variants are also present.\n\nexport var VALID_PUNCTUATION = \"\".concat(DASHES).concat(SLASHES).concat(DOTS).concat(WHITESPACE).concat(BRACKETS).concat(TILDES);\nexport var PLUS_CHARS = \"+\\uFF0B\"; // const LEADING_PLUS_CHARS_PATTERN = new RegExp('^[' + PLUS_CHARS + ']+')\n","function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; var ownKeys = Object.keys(source); if (typeof Object.getOwnPropertySymbols === 'function') { ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) { return Object.getOwnPropertyDescriptor(source, sym).enumerable; })); } ownKeys.forEach(function (key) { _defineProperty(target, key, source[key]); }); } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n// This is a port of Google Android `libphonenumber`'s\n// `phonenumberutil.js` of December 31th, 2018.\n//\n// https://github.com/googlei18n/libphonenumber/commits/master/javascript/i18n/phonenumbers/phonenumberutil.js\nimport matchesEntirely from './helpers/matchesEntirely';\nimport formatNationalNumberUsingFormat from './helpers/formatNationalNumberUsingFormat';\nimport Metadata, { getCountryCallingCode } from './metadata';\nimport getIddPrefix from './helpers/getIddPrefix';\nimport { formatRFC3966 } from './helpers/RFC3966';\nvar DEFAULT_OPTIONS = {\n formatExtension: function formatExtension(formattedNumber, extension, metadata) {\n return \"\".concat(formattedNumber).concat(metadata.ext()).concat(extension);\n } // Formats a phone number\n //\n // Example use cases:\n //\n // ```js\n // formatNumber('8005553535', 'RU', 'INTERNATIONAL')\n // formatNumber('8005553535', 'RU', 'INTERNATIONAL', metadata)\n // formatNumber({ phone: '8005553535', country: 'RU' }, 'INTERNATIONAL')\n // formatNumber({ phone: '8005553535', country: 'RU' }, 'INTERNATIONAL', metadata)\n // formatNumber('+78005553535', 'NATIONAL')\n // formatNumber('+78005553535', 'NATIONAL', metadata)\n // ```\n //\n\n};\nexport default function formatNumber(input, format, options, metadata) {\n // Apply default options.\n if (options) {\n options = _objectSpread({}, DEFAULT_OPTIONS, options);\n } else {\n options = DEFAULT_OPTIONS;\n }\n\n metadata = new Metadata(metadata);\n\n if (input.country && input.country !== '001') {\n // Validate `input.country`.\n if (!metadata.hasCountry(input.country)) {\n throw new Error(\"Unknown country: \".concat(input.country));\n }\n\n metadata.country(input.country);\n } else if (input.countryCallingCode) {\n metadata.selectNumberingPlan(input.countryCallingCode);\n } else return input.phone || '';\n\n var countryCallingCode = metadata.countryCallingCode();\n var nationalNumber = options.v2 ? input.nationalNumber : input.phone; // This variable should have been declared inside `case`s\n // but Babel has a bug and it says \"duplicate variable declaration\".\n\n var number;\n\n switch (format) {\n case 'NATIONAL':\n // Legacy argument support.\n // (`{ country: ..., phone: '' }`)\n if (!nationalNumber) {\n return '';\n }\n\n number = formatNationalNumber(nationalNumber, input.carrierCode, 'NATIONAL', metadata, options);\n return addExtension(number, input.ext, metadata, options.formatExtension);\n\n case 'INTERNATIONAL':\n // Legacy argument support.\n // (`{ country: ..., phone: '' }`)\n if (!nationalNumber) {\n return \"+\".concat(countryCallingCode);\n }\n\n number = formatNationalNumber(nationalNumber, null, 'INTERNATIONAL', metadata, options);\n number = \"+\".concat(countryCallingCode, \" \").concat(number);\n return addExtension(number, input.ext, metadata, options.formatExtension);\n\n case 'E.164':\n // `E.164` doesn't define \"phone number extensions\".\n return \"+\".concat(countryCallingCode).concat(nationalNumber);\n\n case 'RFC3966':\n return formatRFC3966({\n number: \"+\".concat(countryCallingCode).concat(nationalNumber),\n ext: input.ext\n });\n // For reference, here's Google's IDD formatter:\n // https://github.com/google/libphonenumber/blob/32719cf74e68796788d1ca45abc85dcdc63ba5b9/java/libphonenumber/src/com/google/i18n/phonenumbers/PhoneNumberUtil.java#L1546\n // Not saying that this IDD formatter replicates it 1:1, but it seems to work.\n // Who would even need to format phone numbers in IDD format anyway?\n\n case 'IDD':\n if (!options.fromCountry) {\n return; // throw new Error('`fromCountry` option not passed for IDD-prefixed formatting.')\n }\n\n var formattedNumber = formatIDD(nationalNumber, input.carrierCode, countryCallingCode, options.fromCountry, metadata);\n return addExtension(formattedNumber, input.ext, metadata, options.formatExtension);\n\n default:\n throw new Error(\"Unknown \\\"format\\\" argument passed to \\\"formatNumber()\\\": \\\"\".concat(format, \"\\\"\"));\n }\n}\n\nfunction formatNationalNumber(number, carrierCode, formatAs, metadata, options) {\n var format = chooseFormatForNumber(metadata.formats(), number);\n\n if (!format) {\n return number;\n }\n\n return formatNationalNumberUsingFormat(number, format, {\n useInternationalFormat: formatAs === 'INTERNATIONAL',\n withNationalPrefix: format.nationalPrefixIsOptionalWhenFormattingInNationalFormat() && options && options.nationalPrefix === false ? false : true,\n carrierCode: carrierCode,\n metadata: metadata\n });\n}\n\nfunction chooseFormatForNumber(availableFormats, nationalNnumber) {\n for (var _iterator = availableFormats, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {\n var _ref;\n\n if (_isArray) {\n if (_i >= _iterator.length) break;\n _ref = _iterator[_i++];\n } else {\n _i = _iterator.next();\n if (_i.done) break;\n _ref = _i.value;\n }\n\n var format = _ref;\n\n // Validate leading digits\n if (format.leadingDigitsPatterns().length > 0) {\n // The last leading_digits_pattern is used here, as it is the most detailed\n var lastLeadingDigitsPattern = format.leadingDigitsPatterns()[format.leadingDigitsPatterns().length - 1]; // If leading digits don't match then move on to the next phone number format\n\n if (nationalNnumber.search(lastLeadingDigitsPattern) !== 0) {\n continue;\n }\n } // Check that the national number matches the phone number format regular expression\n\n\n if (matchesEntirely(nationalNnumber, format.pattern())) {\n return format;\n }\n }\n}\n\nfunction addExtension(formattedNumber, ext, metadata, formatExtension) {\n return ext ? formatExtension(formattedNumber, ext, metadata) : formattedNumber;\n}\n\nfunction formatIDD(nationalNumber, carrierCode, countryCallingCode, fromCountry, metadata) {\n var fromCountryCallingCode = getCountryCallingCode(fromCountry, metadata.metadata); // When calling within the same country calling code.\n\n if (fromCountryCallingCode === countryCallingCode) {\n var formattedNumber = formatNationalNumber(nationalNumber, carrierCode, 'NATIONAL', metadata); // For NANPA regions, return the national format for these regions\n // but prefix it with the country calling code.\n\n if (countryCallingCode === '1') {\n return countryCallingCode + ' ' + formattedNumber;\n } // If regions share a country calling code, the country calling code need\n // not be dialled. This also applies when dialling within a region, so this\n // if clause covers both these cases. Technically this is the case for\n // dialling from La Reunion to other overseas departments of France (French\n // Guiana, Martinique, Guadeloupe), but not vice versa - so we don't cover\n // this edge case for now and for those cases return the version including\n // country calling code. Details here:\n // http://www.petitfute.com/voyage/225-info-pratiques-reunion\n //\n\n\n return formattedNumber;\n }\n\n var iddPrefix = getIddPrefix(fromCountry, undefined, metadata.metadata);\n\n if (iddPrefix) {\n return \"\".concat(iddPrefix, \" \").concat(countryCallingCode, \" \").concat(formatNationalNumber(nationalNumber, null, 'INTERNATIONAL', metadata));\n }\n}\n","function _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance\"); }\n\nfunction _iterableToArrayLimit(arr, i) { var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i[\"return\"] != null) _i[\"return\"](); } finally { if (_d) throw _e; } } return _arr; }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nimport isViablePhoneNumber from './isViablePhoneNumber'; // https://www.ietf.org/rfc/rfc3966.txt\n\n/**\r\n * @param {string} text - Phone URI (RFC 3966).\r\n * @return {object} `{ ?number, ?ext }`.\r\n */\n\nexport function parseRFC3966(text) {\n var number;\n var ext; // Replace \"tel:\" with \"tel=\" for parsing convenience.\n\n text = text.replace(/^tel:/, 'tel=');\n\n for (var _iterator = text.split(';'), _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {\n var _ref;\n\n if (_isArray) {\n if (_i >= _iterator.length) break;\n _ref = _iterator[_i++];\n } else {\n _i = _iterator.next();\n if (_i.done) break;\n _ref = _i.value;\n }\n\n var part = _ref;\n\n var _part$split = part.split('='),\n _part$split2 = _slicedToArray(_part$split, 2),\n name = _part$split2[0],\n value = _part$split2[1];\n\n switch (name) {\n case 'tel':\n number = value;\n break;\n\n case 'ext':\n ext = value;\n break;\n\n case 'phone-context':\n // Only \"country contexts\" are supported.\n // \"Domain contexts\" are ignored.\n if (value[0] === '+') {\n number = value + number;\n }\n\n break;\n }\n } // If the phone number is not viable, then abort.\n\n\n if (!isViablePhoneNumber(number)) {\n return {};\n }\n\n var result = {\n number: number\n };\n\n if (ext) {\n result.ext = ext;\n }\n\n return result;\n}\n/**\r\n * @param {object} - `{ ?number, ?extension }`.\r\n * @return {string} Phone URI (RFC 3966).\r\n */\n\nexport function formatRFC3966(_ref2) {\n var number = _ref2.number,\n ext = _ref2.ext;\n\n if (!number) {\n return '';\n }\n\n if (number[0] !== '+') {\n throw new Error(\"\\\"formatRFC3966()\\\" expects \\\"number\\\" to be in E.164 format.\");\n }\n\n return \"tel:\".concat(number).concat(ext ? ';ext=' + ext : '');\n}\n","import { VALID_PUNCTUATION } from '../constants'; // Removes brackets and replaces dashes with spaces.\n//\n// E.g. \"(999) 111-22-33\" -> \"999 111 22 33\"\n//\n// For some reason Google's metadata contains `
`s with brackets and dashes.\n// Meanwhile, there's no single opinion about using punctuation in international phone numbers.\n//\n// For example, Google's `
` for USA is `+1 213-373-4253`.\n// And here's a quote from WikiPedia's \"North American Numbering Plan\" page:\n// https://en.wikipedia.org/wiki/North_American_Numbering_Plan\n//\n// \"The country calling code for all countries participating in the NANP is 1.\n// In international format, an NANP number should be listed as +1 301 555 01 00,\n// where 301 is an area code (Maryland).\"\n//\n// I personally prefer the international format without any punctuation.\n// For example, brackets are remnants of the old age, meaning that the\n// phone number part in brackets (so called \"area code\") can be omitted\n// if dialing within the same \"area\".\n// And hyphens were clearly introduced for splitting local numbers into memorizable groups.\n// For example, remembering \"5553535\" is difficult but \"555-35-35\" is much simpler.\n// Imagine a man taking a bus from home to work and seeing an ad with a phone number.\n// He has a couple of seconds to memorize that number until it passes by.\n// If it were spaces instead of hyphens the man wouldn't necessarily get it,\n// but with hyphens instead of spaces the grouping is more explicit.\n// I personally think that hyphens introduce visual clutter,\n// so I prefer replacing them with spaces in international numbers.\n// In the modern age all output is done on displays where spaces are clearly distinguishable\n// so hyphens can be safely replaced with spaces without losing any legibility.\n//\n\nexport default function applyInternationalSeparatorStyle(formattedNumber) {\n return formattedNumber.replace(new RegExp(\"[\".concat(VALID_PUNCTUATION, \"]+\"), 'g'), ' ').trim();\n}\n","import mergeArrays from './mergeArrays';\nexport default function checkNumberLength(nationalNumber, metadata) {\n return checkNumberLengthForType(nationalNumber, undefined, metadata);\n} // Checks whether a number is possible for the country based on its length.\n// Should only be called for the \"new\" metadata which has \"possible lengths\".\n\nexport function checkNumberLengthForType(nationalNumber, type, metadata) {\n var type_info = metadata.type(type); // There should always be \"
\" set for every type element.\n // This is declared in the XML schema.\n // For size efficiency, where a sub-description (e.g. fixed-line)\n // has the same \"
\" as the \"general description\", this is missing,\n // so we fall back to the \"general description\". Where no numbers of the type\n // exist at all, there is one possible length (-1) which is guaranteed\n // not to match the length of any real phone number.\n\n var possible_lengths = type_info && type_info.possibleLengths() || metadata.possibleLengths(); // let local_lengths = type_info && type.possibleLengthsLocal() || metadata.possibleLengthsLocal()\n // Metadata before version `1.0.18` didn't contain `possible_lengths`.\n\n if (!possible_lengths) {\n return 'IS_POSSIBLE';\n }\n\n if (type === 'FIXED_LINE_OR_MOBILE') {\n // No such country in metadata.\n\n /* istanbul ignore next */\n if (!metadata.type('FIXED_LINE')) {\n // The rare case has been encountered where no fixedLine data is available\n // (true for some non-geographic entities), so we just check mobile.\n return checkNumberLengthForType(nationalNumber, 'MOBILE', metadata);\n }\n\n var mobile_type = metadata.type('MOBILE');\n\n if (mobile_type) {\n // Merge the mobile data in if there was any. \"Concat\" creates a new\n // array, it doesn't edit possible_lengths in place, so we don't need a copy.\n // Note that when adding the possible lengths from mobile, we have\n // to again check they aren't empty since if they are this indicates\n // they are the same as the general desc and should be obtained from there.\n possible_lengths = mergeArrays(possible_lengths, mobile_type.possibleLengths()); // The current list is sorted; we need to merge in the new list and\n // re-sort (duplicates are okay). Sorting isn't so expensive because\n // the lists are very small.\n // if (local_lengths) {\n // \tlocal_lengths = mergeArrays(local_lengths, mobile_type.possibleLengthsLocal())\n // } else {\n // \tlocal_lengths = mobile_type.possibleLengthsLocal()\n // }\n }\n } // If the type doesn't exist then return 'INVALID_LENGTH'.\n else if (type && !type_info) {\n return 'INVALID_LENGTH';\n }\n\n var actual_length = nationalNumber.length; // In `libphonenumber-js` all \"local-only\" formats are dropped for simplicity.\n // // This is safe because there is never an overlap beween the possible lengths\n // // and the local-only lengths; this is checked at build time.\n // if (local_lengths && local_lengths.indexOf(nationalNumber.length) >= 0)\n // {\n // \treturn 'IS_POSSIBLE_LOCAL_ONLY'\n // }\n\n var minimum_length = possible_lengths[0];\n\n if (minimum_length === actual_length) {\n return 'IS_POSSIBLE';\n }\n\n if (minimum_length > actual_length) {\n return 'TOO_SHORT';\n }\n\n if (possible_lengths[possible_lengths.length - 1] < actual_length) {\n return 'TOO_LONG';\n } // We skip the first element since we've already checked it.\n\n\n return possible_lengths.indexOf(actual_length, 1) >= 0 ? 'IS_POSSIBLE' : 'INVALID_LENGTH';\n}\n","import { VALID_DIGITS } from '../../constants'; // The RFC 3966 format for extensions.\n\nvar RFC3966_EXTN_PREFIX = ';ext=';\n/**\r\n * Helper method for constructing regular expressions for parsing. Creates\r\n * an expression that captures up to max_length digits.\r\n * @return {string} RegEx pattern to capture extension digits.\r\n */\n\nvar getExtensionDigitsPattern = function getExtensionDigitsPattern(maxLength) {\n return \"([\".concat(VALID_DIGITS, \"]{1,\").concat(maxLength, \"})\");\n};\n/**\r\n * Helper initialiser method to create the regular-expression pattern to match\r\n * extensions.\r\n * Copy-pasted from Google's `libphonenumber`:\r\n * https://github.com/google/libphonenumber/blob/55b2646ec9393f4d3d6661b9c82ef9e258e8b829/javascript/i18n/phonenumbers/phonenumberutil.js#L759-L766\r\n * @return {string} RegEx pattern to capture extensions.\r\n */\n\n\nexport default function createExtensionPattern(purpose) {\n // We cap the maximum length of an extension based on the ambiguity of the way\n // the extension is prefixed. As per ITU, the officially allowed length for\n // extensions is actually 40, but we don't support this since we haven't seen real\n // examples and this introduces many false interpretations as the extension labels\n // are not standardized.\n\n /** @type {string} */\n var extLimitAfterExplicitLabel = '20';\n /** @type {string} */\n\n var extLimitAfterLikelyLabel = '15';\n /** @type {string} */\n\n var extLimitAfterAmbiguousChar = '9';\n /** @type {string} */\n\n var extLimitWhenNotSure = '6';\n /** @type {string} */\n\n var possibleSeparatorsBetweenNumberAndExtLabel = \"[ \\xA0\\\\t,]*\"; // Optional full stop (.) or colon, followed by zero or more spaces/tabs/commas.\n\n /** @type {string} */\n\n var possibleCharsAfterExtLabel = \"[:\\\\.\\uFF0E]?[ \\xA0\\\\t,-]*\";\n /** @type {string} */\n\n var optionalExtnSuffix = \"#?\"; // Here the extension is called out in more explicit way, i.e mentioning it obvious\n // patterns like \"ext.\".\n\n /** @type {string} */\n\n var explicitExtLabels = \"(?:e?xt(?:ensi(?:o\\u0301?|\\xF3))?n?|\\uFF45?\\uFF58\\uFF54\\uFF4E?|\\u0434\\u043E\\u0431|anexo)\"; // One-character symbols that can be used to indicate an extension, and less\n // commonly used or more ambiguous extension labels.\n\n /** @type {string} */\n\n var ambiguousExtLabels = \"(?:[x\\uFF58#\\uFF03~\\uFF5E]|int|\\uFF49\\uFF4E\\uFF54)\"; // When extension is not separated clearly.\n\n /** @type {string} */\n\n var ambiguousSeparator = \"[- ]+\"; // This is the same as possibleSeparatorsBetweenNumberAndExtLabel, but not matching\n // comma as extension label may have it.\n\n /** @type {string} */\n\n var possibleSeparatorsNumberExtLabelNoComma = \"[ \\xA0\\\\t]*\"; // \",,\" is commonly used for auto dialling the extension when connected. First\n // comma is matched through possibleSeparatorsBetweenNumberAndExtLabel, so we do\n // not repeat it here. Semi-colon works in Iphone and Android also to pop up a\n // button with the extension number following.\n\n /** @type {string} */\n\n var autoDiallingAndExtLabelsFound = \"(?:,{2}|;)\";\n /** @type {string} */\n\n var rfcExtn = RFC3966_EXTN_PREFIX + getExtensionDigitsPattern(extLimitAfterExplicitLabel);\n /** @type {string} */\n\n var explicitExtn = possibleSeparatorsBetweenNumberAndExtLabel + explicitExtLabels + possibleCharsAfterExtLabel + getExtensionDigitsPattern(extLimitAfterExplicitLabel) + optionalExtnSuffix;\n /** @type {string} */\n\n var ambiguousExtn = possibleSeparatorsBetweenNumberAndExtLabel + ambiguousExtLabels + possibleCharsAfterExtLabel + getExtensionDigitsPattern(extLimitAfterAmbiguousChar) + optionalExtnSuffix;\n /** @type {string} */\n\n var americanStyleExtnWithSuffix = ambiguousSeparator + getExtensionDigitsPattern(extLimitWhenNotSure) + \"#\";\n /** @type {string} */\n\n var autoDiallingExtn = possibleSeparatorsNumberExtLabelNoComma + autoDiallingAndExtLabelsFound + possibleCharsAfterExtLabel + getExtensionDigitsPattern(extLimitAfterLikelyLabel) + optionalExtnSuffix;\n /** @type {string} */\n\n var onlyCommasExtn = possibleSeparatorsNumberExtLabelNoComma + \"(?:,)+\" + possibleCharsAfterExtLabel + getExtensionDigitsPattern(extLimitAfterAmbiguousChar) + optionalExtnSuffix; // The first regular expression covers RFC 3966 format, where the extension is added\n // using \";ext=\". The second more generic where extension is mentioned with explicit\n // labels like \"ext:\". In both the above cases we allow more numbers in extension than\n // any other extension labels. The third one captures when single character extension\n // labels or less commonly used labels are used. In such cases we capture fewer\n // extension digits in order to reduce the chance of falsely interpreting two\n // numbers beside each other as a number + extension. The fourth one covers the\n // special case of American numbers where the extension is written with a hash\n // at the end, such as \"- 503#\". The fifth one is exclusively for extension\n // autodialling formats which are used when dialling and in this case we accept longer\n // extensions. The last one is more liberal on the number of commas that acts as\n // extension labels, so we have a strict cap on the number of digits in such extensions.\n\n return rfcExtn + \"|\" + explicitExtn + \"|\" + ambiguousExtn + \"|\" + americanStyleExtnWithSuffix + \"|\" + autoDiallingExtn + \"|\" + onlyCommasExtn;\n}\n","import createExtensionPattern from './createExtensionPattern'; // Regexp of all known extension prefixes used by different regions followed by\n// 1 or more valid digits, for use when parsing.\n\nvar EXTN_PATTERN = new RegExp('(?:' + createExtensionPattern() + ')$', 'i'); // Strips any extension (as in, the part of the number dialled after the call is\n// connected, usually indicated with extn, ext, x or similar) from the end of\n// the number, and returns it.\n\nexport default function extractExtension(number) {\n var start = number.search(EXTN_PATTERN);\n\n if (start < 0) {\n return {};\n } // If we find a potential extension, and the number preceding this is a viable\n // number, we assume it is an extension.\n\n\n var numberWithoutExtension = number.slice(0, start);\n var matches = number.match(EXTN_PATTERN);\n var i = 1;\n\n while (i < matches.length) {\n if (matches[i]) {\n return {\n number: numberWithoutExtension,\n ext: matches[i]\n };\n }\n\n i++;\n }\n}\n","import stripIddPrefix from './stripIddPrefix';\nimport extractCountryCallingCodeFromInternationalNumberWithoutPlusSign from './extractCountryCallingCodeFromInternationalNumberWithoutPlusSign';\nimport Metadata from '../metadata';\nimport { MAX_LENGTH_COUNTRY_CODE } from '../constants';\n/**\r\n * Converts a phone number digits (possibly with a `+`)\r\n * into a calling code and the rest phone number digits.\r\n * The \"rest phone number digits\" could include\r\n * a national prefix, carrier code, and national\r\n * (significant) number.\r\n * @param {string} number — Phone number digits (possibly with a `+`).\r\n * @param {string} [country] — Default country.\r\n * @param {string} [callingCode] — Default calling code (some phone numbering plans are non-geographic).\r\n * @param {object} metadata\r\n * @return {object} `{ countryCallingCode: string?, number: string }`\r\n * @example\r\n * // Returns `{ countryCallingCode: \"1\", number: \"2133734253\" }`.\r\n * extractCountryCallingCode('2133734253', 'US', null, metadata)\r\n * extractCountryCallingCode('2133734253', null, '1', metadata)\r\n * extractCountryCallingCode('+12133734253', null, null, metadata)\r\n * extractCountryCallingCode('+12133734253', 'RU', null, metadata)\r\n */\n\nexport default function extractCountryCallingCode(number, country, callingCode, metadata) {\n if (!number) {\n return {};\n } // If this is not an international phone number,\n // then either extract an \"IDD\" prefix, or extract a\n // country calling code from a number by autocorrecting it\n // by prepending a leading `+` in cases when it starts\n // with the country calling code.\n // https://wikitravel.org/en/International_dialling_prefix\n // https://github.com/catamphetamine/libphonenumber-js/issues/376\n\n\n if (number[0] !== '+') {\n // Convert an \"out-of-country\" dialing phone number\n // to a proper international phone number.\n var numberWithoutIDD = stripIddPrefix(number, country, callingCode, metadata); // If an IDD prefix was stripped then\n // convert the number to international one\n // for subsequent parsing.\n\n if (numberWithoutIDD && numberWithoutIDD !== number) {\n number = '+' + numberWithoutIDD;\n } else {\n // Check to see if the number starts with the country calling code\n // for the default country. If so, we remove the country calling code,\n // and do some checks on the validity of the number before and after.\n // https://github.com/catamphetamine/libphonenumber-js/issues/376\n if (country || callingCode) {\n var _extractCountryCallin = extractCountryCallingCodeFromInternationalNumberWithoutPlusSign(number, country, callingCode, metadata),\n countryCallingCode = _extractCountryCallin.countryCallingCode,\n shorterNumber = _extractCountryCallin.number;\n\n if (countryCallingCode) {\n return {\n countryCallingCode: countryCallingCode,\n number: shorterNumber\n };\n }\n }\n\n return {\n number: number\n };\n }\n } // Fast abortion: country codes do not begin with a '0'\n\n\n if (number[1] === '0') {\n return {};\n }\n\n metadata = new Metadata(metadata); // The thing with country phone codes\n // is that they are orthogonal to each other\n // i.e. there's no such country phone code A\n // for which country phone code B exists\n // where B starts with A.\n // Therefore, while scanning digits,\n // if a valid country code is found,\n // that means that it is the country code.\n //\n\n var i = 2;\n\n while (i - 1 <= MAX_LENGTH_COUNTRY_CODE && i <= number.length) {\n var _countryCallingCode = number.slice(1, i);\n\n if (metadata.hasCallingCode(_countryCallingCode)) {\n metadata.selectNumberingPlan(_countryCallingCode);\n return {\n countryCallingCode: _countryCallingCode,\n number: number.slice(i)\n };\n }\n\n i++;\n }\n\n return {};\n}\n","import Metadata from '../metadata';\nimport matchesEntirely from './matchesEntirely';\nimport extractNationalNumber from './extractNationalNumber';\nimport checkNumberLength from './checkNumberLength';\nimport getCountryCallingCode from '../getCountryCallingCode';\n/**\r\n * Sometimes some people incorrectly input international phone numbers\r\n * without the leading `+`. This function corrects such input.\r\n * @param {string} number — Phone number digits.\r\n * @param {string?} country\r\n * @param {string?} callingCode\r\n * @param {object} metadata\r\n * @return {object} `{ countryCallingCode: string?, number: string }`.\r\n */\n\nexport default function extractCountryCallingCodeFromInternationalNumberWithoutPlusSign(number, country, callingCode, metadata) {\n var countryCallingCode = country ? getCountryCallingCode(country, metadata) : callingCode;\n\n if (number.indexOf(countryCallingCode) === 0) {\n metadata = new Metadata(metadata);\n metadata.selectNumberingPlan(country, callingCode);\n var possibleShorterNumber = number.slice(countryCallingCode.length);\n\n var _extractNationalNumbe = extractNationalNumber(possibleShorterNumber, metadata),\n possibleShorterNationalNumber = _extractNationalNumbe.nationalNumber;\n\n var _extractNationalNumbe2 = extractNationalNumber(number, metadata),\n nationalNumber = _extractNationalNumbe2.nationalNumber; // If the number was not valid before but is valid now,\n // or if it was too long before, we consider the number\n // with the country calling code stripped to be a better result\n // and keep that instead.\n // For example, in Germany (+49), `49` is a valid area code,\n // so if a number starts with `49`, it could be both a valid\n // national German number or an international number without\n // a leading `+`.\n\n\n if (!matchesEntirely(nationalNumber, metadata.nationalNumberPattern()) && matchesEntirely(possibleShorterNationalNumber, metadata.nationalNumberPattern()) || checkNumberLength(nationalNumber, metadata) === 'TOO_LONG') {\n return {\n countryCallingCode: countryCallingCode,\n number: possibleShorterNumber\n };\n }\n }\n\n return {\n number: number\n };\n}\n","import extractNationalNumberFromPossiblyIncompleteNumber from './extractNationalNumberFromPossiblyIncompleteNumber';\nimport matchesEntirely from './matchesEntirely';\nimport checkNumberLength from './checkNumberLength';\n/**\r\n * Strips national prefix and carrier code from a complete phone number.\r\n * The difference from the non-\"FromCompleteNumber\" function is that\r\n * it won't extract national prefix if the resultant number is too short\r\n * to be a complete number for the selected phone numbering plan.\r\n * @param {string} number — Complete phone number digits.\r\n * @param {Metadata} metadata — Metadata with a phone numbering plan selected.\r\n * @return {object} `{ nationalNumber: string, carrierCode: string? }`.\r\n */\n\nexport default function extractNationalNumber(number, metadata) {\n // Parsing national prefixes and carrier codes\n // is only required for local phone numbers\n // but some people don't understand that\n // and sometimes write international phone numbers\n // with national prefixes (or maybe even carrier codes).\n // http://ucken.blogspot.ru/2016/03/trunk-prefixes-in-skype4b.html\n // Google's original library forgives such mistakes\n // and so does this library, because it has been requested:\n // https://github.com/catamphetamine/libphonenumber-js/issues/127\n var _extractNationalNumbe = extractNationalNumberFromPossiblyIncompleteNumber(number, metadata),\n nationalNumber = _extractNationalNumbe.nationalNumber,\n carrierCode = _extractNationalNumbe.carrierCode;\n\n if (!shouldExtractNationalPrefix(number, nationalNumber, metadata)) {\n // Don't strip the national prefix.\n return {\n nationalNumber: number\n };\n } // If a national prefix has been extracted, check to see\n // if the resultant number isn't too short.\n // Same code in Google's `libphonenumber`:\n // https://github.com/google/libphonenumber/blob/e326fa1fc4283bb05eb35cb3c15c18f98a31af33/java/libphonenumber/src/com/google/i18n/phonenumbers/PhoneNumberUtil.java#L3291-L3302\n // For some reason, they do this check right after the `national_number_pattern` check\n // this library does in `shouldExtractNationalPrefix()` function.\n // Why is there a second \"resultant\" number validity check?\n // They don't provide an explanation.\n // This library just copies the behavior.\n\n\n if (number.length !== nationalNumber.length + (carrierCode ? carrierCode.length : 0)) {\n // If not using legacy generated metadata (before version `1.0.18`)\n // then it has \"possible lengths\", so use those to validate the number length.\n if (metadata.possibleLengths()) {\n // \"We require that the NSN remaining after stripping the national prefix and\n // carrier code be long enough to be a possible length for the region.\n // Otherwise, we don't do the stripping, since the original number could be\n // a valid short number.\"\n // https://github.com/google/libphonenumber/blob/876268eb1ad6cdc1b7b5bef17fc5e43052702d57/java/libphonenumber/src/com/google/i18n/phonenumbers/PhoneNumberUtil.java#L3236-L3250\n switch (checkNumberLength(nationalNumber, metadata)) {\n case 'TOO_SHORT':\n case 'INVALID_LENGTH':\n // case 'IS_POSSIBLE_LOCAL_ONLY':\n // Don't strip the national prefix.\n return {\n nationalNumber: number\n };\n }\n }\n }\n\n return {\n nationalNumber: nationalNumber,\n carrierCode: carrierCode\n };\n} // In some countries, the same digit could be a national prefix\n// or a leading digit of a valid phone number.\n// For example, in Russia, national prefix is `8`,\n// and also `800 555 35 35` is a valid number\n// in which `8` is not a national prefix, but the first digit\n// of a national (significant) number.\n// Same's with Belarus:\n// `82004910060` is a valid national (significant) number,\n// but `2004910060` is not.\n// To support such cases (to prevent the code from always stripping\n// national prefix), a condition is imposed: a national prefix\n// is not extracted when the original number is \"viable\" and the\n// resultant number is not, a \"viable\" national number being the one\n// that matches `national_number_pattern`.\n\nfunction shouldExtractNationalPrefix(number, nationalSignificantNumber, metadata) {\n // The equivalent in Google's code is:\n // https://github.com/google/libphonenumber/blob/e326fa1fc4283bb05eb35cb3c15c18f98a31af33/java/libphonenumber/src/com/google/i18n/phonenumbers/PhoneNumberUtil.java#L2969-L3004\n if (matchesEntirely(number, metadata.nationalNumberPattern()) && !matchesEntirely(nationalSignificantNumber, metadata.nationalNumberPattern())) {\n return false;\n } // Just \"possible\" number check would be more relaxed, so it's not used.\n // if (isPossibleNumber(number, metadata) &&\n // \t!isPossibleNumber(numberWithNationalPrefixExtracted, metadata)) {\n // \treturn false\n // }\n\n\n return true;\n}\n","/**\r\n * Strips any national prefix (such as 0, 1) present in a\r\n * (possibly incomplete) number provided.\r\n * \"Carrier codes\" are only used in Colombia and Brazil,\r\n * and only when dialing within those countries from a mobile phone to a fixed line number.\r\n * Sometimes it won't actually strip national prefix\r\n * and will instead prepend some digits to the `number`:\r\n * for example, when number `2345678` is passed with `VI` country selected,\r\n * it will return `{ number: \"3402345678\" }`, because `340` area code is prepended.\r\n * @param {string} number — National number digits.\r\n * @param {object} metadata — Metadata with country selected.\r\n * @return {object} `{ nationalNumber: string, nationalPrefix: string? carrierCode: string? }`.\r\n */\nexport default function extractNationalNumberFromPossiblyIncompleteNumber(number, metadata) {\n if (number && metadata.numberingPlan.nationalPrefixForParsing()) {\n // See METADATA.md for the description of\n // `national_prefix_for_parsing` and `national_prefix_transform_rule`.\n // Attempt to parse the first digits as a national prefix.\n var prefixPattern = new RegExp('^(?:' + metadata.numberingPlan.nationalPrefixForParsing() + ')');\n var prefixMatch = prefixPattern.exec(number);\n\n if (prefixMatch) {\n var nationalNumber;\n var carrierCode; // https://gitlab.com/catamphetamine/libphonenumber-js/-/blob/master/METADATA.md#national_prefix_for_parsing--national_prefix_transform_rule\n // If a `national_prefix_for_parsing` has any \"capturing groups\"\n // then it means that the national (significant) number is equal to\n // those \"capturing groups\" transformed via `national_prefix_transform_rule`,\n // and nothing could be said about the actual national prefix:\n // what is it and was it even there.\n // If a `national_prefix_for_parsing` doesn't have any \"capturing groups\",\n // then everything it matches is a national prefix.\n // To determine whether `national_prefix_for_parsing` matched any\n // \"capturing groups\", the value of the result of calling `.exec()`\n // is looked at, and if it has non-undefined values where there're\n // \"capturing groups\" in the regular expression, then it means\n // that \"capturing groups\" have been matched.\n // It's not possible to tell whether there'll be any \"capturing gropus\"\n // before the matching process, because a `national_prefix_for_parsing`\n // could exhibit both behaviors.\n\n var capturedGroupsCount = prefixMatch.length - 1;\n var hasCapturedGroups = capturedGroupsCount > 0 && prefixMatch[capturedGroupsCount];\n\n if (metadata.nationalPrefixTransformRule() && hasCapturedGroups) {\n nationalNumber = number.replace(prefixPattern, metadata.nationalPrefixTransformRule()); // If there's more than one captured group,\n // then carrier code is the second one.\n\n if (capturedGroupsCount > 1) {\n carrierCode = prefixMatch[1];\n }\n } // If there're no \"capturing groups\",\n // or if there're \"capturing groups\" but no\n // `national_prefix_transform_rule`,\n // then just strip the national prefix from the number,\n // and possibly a carrier code.\n // Seems like there could be more.\n else {\n // `prefixBeforeNationalNumber` is the whole substring matched by\n // the `national_prefix_for_parsing` regular expression.\n // There seem to be no guarantees that it's just a national prefix.\n // For example, if there's a carrier code, it's gonna be a\n // part of `prefixBeforeNationalNumber` too.\n var prefixBeforeNationalNumber = prefixMatch[0];\n nationalNumber = number.slice(prefixBeforeNationalNumber.length); // If there's at least one captured group,\n // then carrier code is the first one.\n\n if (hasCapturedGroups) {\n carrierCode = prefixMatch[1];\n }\n } // Tries to guess whether a national prefix was present in the input.\n // This is not something copy-pasted from Google's library:\n // they don't seem to have an equivalent for that.\n // So this isn't an \"officially approved\" way of doing something like that.\n // But since there seems no other existing method, this library uses it.\n\n\n var nationalPrefix;\n\n if (hasCapturedGroups) {\n var possiblePositionOfTheFirstCapturedGroup = number.indexOf(prefixMatch[1]);\n var possibleNationalPrefix = number.slice(0, possiblePositionOfTheFirstCapturedGroup); // Example: an Argentinian (AR) phone number `0111523456789`.\n // `prefixMatch[0]` is `01115`, and `$1` is `11`,\n // and the rest of the phone number is `23456789`.\n // The national number is transformed via `9$1` to `91123456789`.\n // National prefix `0` is detected being present at the start.\n // if (possibleNationalPrefix.indexOf(metadata.numberingPlan.nationalPrefix()) === 0) {\n\n if (possibleNationalPrefix === metadata.numberingPlan.nationalPrefix()) {\n nationalPrefix = metadata.numberingPlan.nationalPrefix();\n }\n } else {\n nationalPrefix = prefixMatch[0];\n }\n\n return {\n nationalNumber: nationalNumber,\n nationalPrefix: nationalPrefix,\n carrierCode: carrierCode\n };\n }\n }\n\n return {\n nationalNumber: number\n };\n}\n","import applyInternationalSeparatorStyle from './applyInternationalSeparatorStyle'; // This was originally set to $1 but there are some countries for which the\n// first group is not used in the national pattern (e.g. Argentina) so the $1\n// group does not match correctly. Therefore, we use `\\d`, so that the first\n// group actually used in the pattern will be matched.\n\nexport var FIRST_GROUP_PATTERN = /(\\$\\d)/;\nexport default function formatNationalNumberUsingFormat(number, format, _ref) {\n var useInternationalFormat = _ref.useInternationalFormat,\n withNationalPrefix = _ref.withNationalPrefix,\n carrierCode = _ref.carrierCode,\n metadata = _ref.metadata;\n var formattedNumber = number.replace(new RegExp(format.pattern()), useInternationalFormat ? format.internationalFormat() : // This library doesn't use `domestic_carrier_code_formatting_rule`,\n // because that one is only used when formatting phone numbers\n // for dialing from a mobile phone, and this is not a dialing library.\n // carrierCode && format.domesticCarrierCodeFormattingRule()\n // \t// First, replace the $CC in the formatting rule with the desired carrier code.\n // \t// Then, replace the $FG in the formatting rule with the first group\n // \t// and the carrier code combined in the appropriate way.\n // \t? format.format().replace(FIRST_GROUP_PATTERN, format.domesticCarrierCodeFormattingRule().replace('$CC', carrierCode))\n // \t: (\n // \t\twithNationalPrefix && format.nationalPrefixFormattingRule()\n // \t\t\t? format.format().replace(FIRST_GROUP_PATTERN, format.nationalPrefixFormattingRule())\n // \t\t\t: format.format()\n // \t)\n withNationalPrefix && format.nationalPrefixFormattingRule() ? format.format().replace(FIRST_GROUP_PATTERN, format.nationalPrefixFormattingRule()) : format.format());\n\n if (useInternationalFormat) {\n return applyInternationalSeparatorStyle(formattedNumber);\n }\n\n return formattedNumber;\n}\n","import Metadata from '../metadata';\nimport getNumberType from './getNumberType';\nvar USE_NON_GEOGRAPHIC_COUNTRY_CODE = false;\nexport default function getCountryByCallingCode(callingCode, nationalPhoneNumber, metadata) {\n /* istanbul ignore if */\n if (USE_NON_GEOGRAPHIC_COUNTRY_CODE) {\n if (metadata.isNonGeographicCallingCode(callingCode)) {\n return '001';\n }\n } // Is always non-empty, because `callingCode` is always valid\n\n\n var possibleCountries = metadata.getCountryCodesForCallingCode(callingCode);\n\n if (!possibleCountries) {\n return;\n } // If there's just one country corresponding to the country code,\n // then just return it, without further phone number digits validation.\n\n\n if (possibleCountries.length === 1) {\n return possibleCountries[0];\n }\n\n return selectCountryFromList(possibleCountries, nationalPhoneNumber, metadata.metadata);\n}\n\nfunction selectCountryFromList(possibleCountries, nationalPhoneNumber, metadata) {\n // Re-create `metadata` because it will be selecting a `country`.\n metadata = new Metadata(metadata);\n\n for (var _iterator = possibleCountries, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {\n var _ref;\n\n if (_isArray) {\n if (_i >= _iterator.length) break;\n _ref = _iterator[_i++];\n } else {\n _i = _iterator.next();\n if (_i.done) break;\n _ref = _i.value;\n }\n\n var country = _ref;\n metadata.country(country); // Leading digits check would be the simplest one\n\n if (metadata.leadingDigits()) {\n if (nationalPhoneNumber && nationalPhoneNumber.search(metadata.leadingDigits()) === 0) {\n return country;\n }\n } // Else perform full validation with all of those\n // fixed-line/mobile/etc regular expressions.\n else if (getNumberType({\n phone: nationalPhoneNumber,\n country: country\n }, undefined, metadata.metadata)) {\n return country;\n }\n }\n}\n","import Metadata from '../metadata';\n/**\r\n * Pattern that makes it easy to distinguish whether a region has a single\r\n * international dialing prefix or not. If a region has a single international\r\n * prefix (e.g. 011 in USA), it will be represented as a string that contains\r\n * a sequence of ASCII digits, and possibly a tilde, which signals waiting for\r\n * the tone. If there are multiple available international prefixes in a\r\n * region, they will be represented as a regex string that always contains one\r\n * or more characters that are not ASCII digits or a tilde.\r\n */\n\nvar SINGLE_IDD_PREFIX_REG_EXP = /^[\\d]+(?:[~\\u2053\\u223C\\uFF5E][\\d]+)?$/; // For regions that have multiple IDD prefixes\n// a preferred IDD prefix is returned.\n\nexport default function getIddPrefix(country, callingCode, metadata) {\n var countryMetadata = new Metadata(metadata);\n countryMetadata.selectNumberingPlan(country, callingCode);\n\n if (countryMetadata.defaultIDDPrefix()) {\n return countryMetadata.defaultIDDPrefix();\n }\n\n if (SINGLE_IDD_PREFIX_REG_EXP.test(countryMetadata.IDDPrefix())) {\n return countryMetadata.IDDPrefix();\n }\n}\n","import Metadata from '../metadata';\nimport matchesEntirely from './matchesEntirely';\nvar NON_FIXED_LINE_PHONE_TYPES = ['MOBILE', 'PREMIUM_RATE', 'TOLL_FREE', 'SHARED_COST', 'VOIP', 'PERSONAL_NUMBER', 'PAGER', 'UAN', 'VOICEMAIL']; // Finds out national phone number type (fixed line, mobile, etc)\n\nexport default function getNumberType(input, options, metadata) {\n // If assigning the `{}` default value is moved to the arguments above,\n // code coverage would decrease for some weird reason.\n options = options || {}; // When `parse()` returned `{}`\n // meaning that the phone number is not a valid one.\n\n if (!input.country) {\n return;\n }\n\n metadata = new Metadata(metadata);\n metadata.selectNumberingPlan(input.country, input.countryCallingCode);\n var nationalNumber = options.v2 ? input.nationalNumber : input.phone; // The following is copy-pasted from the original function:\n // https://github.com/googlei18n/libphonenumber/blob/3ea547d4fbaa2d0b67588904dfa5d3f2557c27ff/javascript/i18n/phonenumbers/phonenumberutil.js#L2835\n // Is this national number even valid for this country\n\n if (!matchesEntirely(nationalNumber, metadata.nationalNumberPattern())) {\n return;\n } // Is it fixed line number\n\n\n if (isNumberTypeEqualTo(nationalNumber, 'FIXED_LINE', metadata)) {\n // Because duplicate regular expressions are removed\n // to reduce metadata size, if \"mobile\" pattern is \"\"\n // then it means it was removed due to being a duplicate of the fixed-line pattern.\n //\n if (metadata.type('MOBILE') && metadata.type('MOBILE').pattern() === '') {\n return 'FIXED_LINE_OR_MOBILE';\n } // v1 metadata.\n // Legacy.\n // Deprecated.\n\n\n if (!metadata.type('MOBILE')) {\n return 'FIXED_LINE_OR_MOBILE';\n } // Check if the number happens to qualify as both fixed line and mobile.\n // (no such country in the minimal metadata set)\n\n /* istanbul ignore if */\n\n\n if (isNumberTypeEqualTo(nationalNumber, 'MOBILE', metadata)) {\n return 'FIXED_LINE_OR_MOBILE';\n }\n\n return 'FIXED_LINE';\n }\n\n for (var _i = 0, _NON_FIXED_LINE_PHONE = NON_FIXED_LINE_PHONE_TYPES; _i < _NON_FIXED_LINE_PHONE.length; _i++) {\n var type = _NON_FIXED_LINE_PHONE[_i];\n\n if (isNumberTypeEqualTo(nationalNumber, type, metadata)) {\n return type;\n }\n }\n}\nexport function isNumberTypeEqualTo(nationalNumber, type, metadata) {\n type = metadata.type(type);\n\n if (!type || !type.pattern()) {\n return false;\n } // Check if any possible number lengths are present;\n // if so, we use them to avoid checking\n // the validation pattern if they don't match.\n // If they are absent, this means they match\n // the general description, which we have\n // already checked before a specific number type.\n\n\n if (type.possibleLengths() && type.possibleLengths().indexOf(nationalNumber.length) < 0) {\n return false;\n }\n\n return matchesEntirely(nationalNumber, type.pattern());\n}\n","import { MIN_LENGTH_FOR_NSN, VALID_DIGITS, VALID_PUNCTUATION, PLUS_CHARS } from '../constants';\nimport createExtensionPattern from './extension/createExtensionPattern'; // Regular expression of viable phone numbers. This is location independent.\n// Checks we have at least three leading digits, and only valid punctuation,\n// alpha characters and digits in the phone number. Does not include extension\n// data. The symbol 'x' is allowed here as valid punctuation since it is often\n// used as a placeholder for carrier codes, for example in Brazilian phone\n// numbers. We also allow multiple '+' characters at the start.\n//\n// Corresponds to the following:\n// [digits]{minLengthNsn}|\n// plus_sign*\n// (([punctuation]|[star])*[digits]){3,}([punctuation]|[star]|[digits]|[alpha])*\n//\n// The first reg-ex is to allow short numbers (two digits long) to be parsed if\n// they are entered as \"15\" etc, but only if there is no punctuation in them.\n// The second expression restricts the number of digits to three or more, but\n// then allows them to be in international form, and to have alpha-characters\n// and punctuation. We split up the two reg-exes here and combine them when\n// creating the reg-ex VALID_PHONE_NUMBER_PATTERN itself so we can prefix it\n// with ^ and append $ to each branch.\n//\n// \"Note VALID_PUNCTUATION starts with a -,\n// so must be the first in the range\" (c) Google devs.\n// (wtf did they mean by saying that; probably nothing)\n//\n\nvar MIN_LENGTH_PHONE_NUMBER_PATTERN = '[' + VALID_DIGITS + ']{' + MIN_LENGTH_FOR_NSN + '}'; //\n// And this is the second reg-exp:\n// (see MIN_LENGTH_PHONE_NUMBER_PATTERN for a full description of this reg-exp)\n//\n\nexport var VALID_PHONE_NUMBER = '[' + PLUS_CHARS + ']{0,1}' + '(?:' + '[' + VALID_PUNCTUATION + ']*' + '[' + VALID_DIGITS + ']' + '){3,}' + '[' + VALID_PUNCTUATION + VALID_DIGITS + ']*';\nexport var VALID_PHONE_NUMBER_WITH_EXTENSION = VALID_PHONE_NUMBER + // Phone number extensions\n'(?:' + createExtensionPattern() + ')?'; // The combined regular expression for valid phone numbers:\n//\n\nvar VALID_PHONE_NUMBER_PATTERN = new RegExp( // Either a short two-digit-only phone number\n'^' + MIN_LENGTH_PHONE_NUMBER_PATTERN + '$' + '|' + // Or a longer fully parsed phone number (min 3 characters)\n'^' + VALID_PHONE_NUMBER_WITH_EXTENSION + '$', 'i'); // Checks to see if the string of characters could possibly be a phone number at\n// all. At the moment, checks to see that the string begins with at least 2\n// digits, ignoring any punctuation commonly found in phone numbers. This method\n// does not require the number to be normalized in advance - but does assume\n// that leading non-number symbols have been removed, such as by the method\n// `extract_possible_number`.\n//\n\nexport default function isViablePhoneNumber(number) {\n return number.length >= MIN_LENGTH_FOR_NSN && VALID_PHONE_NUMBER_PATTERN.test(number);\n}\n","/**\r\n * Checks whether the entire input sequence can be matched\r\n * against the regular expression.\r\n * @return {boolean}\r\n */\nexport default function matchesEntirely(text, regular_expression) {\n // If assigning the `''` default value is moved to the arguments above,\n // code coverage would decrease for some weird reason.\n text = text || '';\n return new RegExp('^(?:' + regular_expression + ')$').test(text);\n}\n","/**\r\n * Merges two arrays.\r\n * @param {*} a\r\n * @param {*} b\r\n * @return {*}\r\n */\nexport default function mergeArrays(a, b) {\n var merged = a.slice();\n\n for (var _iterator = b, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {\n var _ref;\n\n if (_isArray) {\n if (_i >= _iterator.length) break;\n _ref = _iterator[_i++];\n } else {\n _i = _iterator.next();\n if (_i.done) break;\n _ref = _i.value;\n }\n\n var element = _ref;\n\n if (a.indexOf(element) < 0) {\n merged.push(element);\n }\n }\n\n return merged.sort(function (a, b) {\n return a - b;\n }); // ES6 version, requires Set polyfill.\n // let merged = new Set(a)\n // for (const element of b) {\n // \tmerged.add(i)\n // }\n // return Array.from(merged).sort((a, b) => a - b)\n}\n","// These mappings map a character (key) to a specific digit that should\n// replace it for normalization purposes. Non-European digits that\n// may be used in phone numbers are mapped to a European equivalent.\n//\n// E.g. in Iraq they don't write `+442323234` but rather `+٤٤٢٣٢٣٢٣٤`.\n//\nexport var DIGITS = {\n '0': '0',\n '1': '1',\n '2': '2',\n '3': '3',\n '4': '4',\n '5': '5',\n '6': '6',\n '7': '7',\n '8': '8',\n '9': '9',\n \"\\uFF10\": '0',\n // Fullwidth digit 0\n \"\\uFF11\": '1',\n // Fullwidth digit 1\n \"\\uFF12\": '2',\n // Fullwidth digit 2\n \"\\uFF13\": '3',\n // Fullwidth digit 3\n \"\\uFF14\": '4',\n // Fullwidth digit 4\n \"\\uFF15\": '5',\n // Fullwidth digit 5\n \"\\uFF16\": '6',\n // Fullwidth digit 6\n \"\\uFF17\": '7',\n // Fullwidth digit 7\n \"\\uFF18\": '8',\n // Fullwidth digit 8\n \"\\uFF19\": '9',\n // Fullwidth digit 9\n \"\\u0660\": '0',\n // Arabic-indic digit 0\n \"\\u0661\": '1',\n // Arabic-indic digit 1\n \"\\u0662\": '2',\n // Arabic-indic digit 2\n \"\\u0663\": '3',\n // Arabic-indic digit 3\n \"\\u0664\": '4',\n // Arabic-indic digit 4\n \"\\u0665\": '5',\n // Arabic-indic digit 5\n \"\\u0666\": '6',\n // Arabic-indic digit 6\n \"\\u0667\": '7',\n // Arabic-indic digit 7\n \"\\u0668\": '8',\n // Arabic-indic digit 8\n \"\\u0669\": '9',\n // Arabic-indic digit 9\n \"\\u06F0\": '0',\n // Eastern-Arabic digit 0\n \"\\u06F1\": '1',\n // Eastern-Arabic digit 1\n \"\\u06F2\": '2',\n // Eastern-Arabic digit 2\n \"\\u06F3\": '3',\n // Eastern-Arabic digit 3\n \"\\u06F4\": '4',\n // Eastern-Arabic digit 4\n \"\\u06F5\": '5',\n // Eastern-Arabic digit 5\n \"\\u06F6\": '6',\n // Eastern-Arabic digit 6\n \"\\u06F7\": '7',\n // Eastern-Arabic digit 7\n \"\\u06F8\": '8',\n // Eastern-Arabic digit 8\n \"\\u06F9\": '9' // Eastern-Arabic digit 9\n\n};\nexport function parseDigit(character) {\n return DIGITS[character];\n}\n/**\r\n * Parses phone number digits from a string.\r\n * Drops all punctuation leaving only digits.\r\n * Also converts wide-ascii and arabic-indic numerals to conventional numerals.\r\n * E.g. in Iraq they don't write `+442323234` but rather `+٤٤٢٣٢٣٢٣٤`.\r\n * @param {string} string\r\n * @return {string}\r\n * @example\r\n * ```js\r\n * parseDigits('8 (800) 555')\r\n * // Outputs '8800555'.\r\n * ```\r\n */\n\nexport default function parseDigits(string) {\n var result = ''; // Using `.split('')` here instead of normal `for ... of`\n // because the importing application doesn't neccessarily include an ES6 polyfill.\n // The `.split('')` approach discards \"exotic\" UTF-8 characters\n // (the ones consisting of four bytes) but digits\n // (including non-European ones) don't fall into that range\n // so such \"exotic\" characters would be discarded anyway.\n\n for (var _iterator = string.split(''), _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {\n var _ref;\n\n if (_isArray) {\n if (_i >= _iterator.length) break;\n _ref = _iterator[_i++];\n } else {\n _i = _iterator.next();\n if (_i.done) break;\n _ref = _i.value;\n }\n\n var character = _ref;\n var digit = parseDigit(character);\n\n if (digit) {\n result += digit;\n }\n }\n\n return result;\n}\n","import Metadata from '../metadata';\nimport { VALID_DIGITS } from '../constants';\nvar CAPTURING_DIGIT_PATTERN = new RegExp('([' + VALID_DIGITS + '])');\nexport default function stripIddPrefix(number, country, callingCode, metadata) {\n if (!country) {\n return;\n } // Check if the number is IDD-prefixed.\n\n\n var countryMetadata = new Metadata(metadata);\n countryMetadata.selectNumberingPlan(country, callingCode);\n var IDDPrefixPattern = new RegExp(countryMetadata.IDDPrefix());\n\n if (number.search(IDDPrefixPattern) !== 0) {\n return;\n } // Strip IDD prefix.\n\n\n number = number.slice(number.match(IDDPrefixPattern)[0].length); // If there're any digits after an IDD prefix,\n // then those digits are a country calling code.\n // Since no country code starts with a `0`,\n // the code below validates that the next digit (if present) is not `0`.\n\n var matchedGroups = number.match(CAPTURING_DIGIT_PATTERN);\n\n if (matchedGroups && matchedGroups[1] != null && matchedGroups[1].length > 0) {\n if (matchedGroups[1] === '0') {\n return;\n }\n }\n\n return number;\n}\n","import Metadata from './metadata';\nimport checkNumberLength from './helpers/checkNumberLength';\nexport default function isPossiblePhoneNumber(input, options, metadata) {\n /* istanbul ignore if */\n if (options === undefined) {\n options = {};\n }\n\n metadata = new Metadata(metadata);\n\n if (options.v2) {\n if (!input.countryCallingCode) {\n throw new Error('Invalid phone number object passed');\n }\n\n metadata.selectNumberingPlan(input.countryCallingCode);\n } else {\n if (!input.phone) {\n return false;\n }\n\n if (input.country) {\n if (!metadata.hasCountry(input.country)) {\n throw new Error(\"Unknown country: \".concat(input.country));\n }\n\n metadata.country(input.country);\n } else {\n if (!input.countryCallingCode) {\n throw new Error('Invalid phone number object passed');\n }\n\n metadata.selectNumberingPlan(input.countryCallingCode);\n }\n }\n\n if (metadata.possibleLengths()) {\n return isPossibleNumber(input.phone || input.nationalNumber, metadata);\n } else {\n // There was a bug between `1.7.35` and `1.7.37` where \"possible_lengths\"\n // were missing for \"non-geographical\" numbering plans.\n // Just assume the number is possible in such cases:\n // it's unlikely that anyone generated their custom metadata\n // in that short period of time (one day).\n // This code can be removed in some future major version update.\n if (input.countryCallingCode && metadata.isNonGeographicCallingCode(input.countryCallingCode)) {\n // \"Non-geographic entities\" did't have `possibleLengths`\n // due to a bug in metadata generation process.\n return true;\n } else {\n throw new Error('Missing \"possibleLengths\" in metadata. Perhaps the metadata has been generated before v1.0.18.');\n }\n }\n}\nexport function isPossibleNumber(nationalNumber, metadata) {\n //, isInternational) {\n switch (checkNumberLength(nationalNumber, metadata)) {\n case 'IS_POSSIBLE':\n return true;\n // This library ignores \"local-only\" phone numbers (for simplicity).\n // See the readme for more info on what are \"local-only\" phone numbers.\n // case 'IS_POSSIBLE_LOCAL_ONLY':\n // \treturn !isInternational\n\n default:\n return false;\n }\n}\n","function _typeof(obj) { if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nimport compare from './tools/semver-compare'; // Added \"possibleLengths\" and renamed\n// \"country_phone_code_to_countries\" to \"country_calling_codes\".\n\nvar V2 = '1.0.18'; // Added \"idd_prefix\" and \"default_idd_prefix\".\n\nvar V3 = '1.2.0'; // Moved `001` country code to \"nonGeographic\" section of metadata.\n\nvar V4 = '1.7.35';\nvar DEFAULT_EXT_PREFIX = ' ext. ';\nvar CALLING_CODE_REG_EXP = /^\\d+$/;\n/**\r\n * See: https://gitlab.com/catamphetamine/libphonenumber-js/blob/master/METADATA.md\r\n */\n\nvar Metadata =\n/*#__PURE__*/\nfunction () {\n function Metadata(metadata) {\n _classCallCheck(this, Metadata);\n\n validateMetadata(metadata);\n this.metadata = metadata;\n setVersion.call(this, metadata);\n }\n\n _createClass(Metadata, [{\n key: \"getCountries\",\n value: function getCountries() {\n return Object.keys(this.metadata.countries).filter(function (_) {\n return _ !== '001';\n });\n }\n }, {\n key: \"getCountryMetadata\",\n value: function getCountryMetadata(countryCode) {\n return this.metadata.countries[countryCode];\n }\n }, {\n key: \"nonGeographic\",\n value: function nonGeographic() {\n if (this.v1 || this.v2 || this.v3) return; // `nonGeographical` was a typo.\n // It's present in metadata generated from `1.7.35` to `1.7.37`.\n\n return this.metadata.nonGeographic || this.metadata.nonGeographical;\n }\n }, {\n key: \"hasCountry\",\n value: function hasCountry(country) {\n return this.getCountryMetadata(country) !== undefined;\n }\n }, {\n key: \"hasCallingCode\",\n value: function hasCallingCode(callingCode) {\n if (this.getCountryCodesForCallingCode(callingCode)) {\n return true;\n }\n\n if (this.nonGeographic()) {\n if (this.nonGeographic()[callingCode]) {\n return true;\n }\n } else {\n // A hacky workaround for old custom metadata (generated before V4).\n var countryCodes = this.countryCallingCodes()[callingCode];\n\n if (countryCodes && countryCodes.length === 1 && countryCodes[0] === '001') {\n return true;\n }\n }\n }\n }, {\n key: \"isNonGeographicCallingCode\",\n value: function isNonGeographicCallingCode(callingCode) {\n if (this.nonGeographic()) {\n return this.nonGeographic()[callingCode] ? true : false;\n } else {\n return this.getCountryCodesForCallingCode(callingCode) ? false : true;\n }\n } // Deprecated.\n\n }, {\n key: \"country\",\n value: function country(countryCode) {\n return this.selectNumberingPlan(countryCode);\n }\n }, {\n key: \"selectNumberingPlan\",\n value: function selectNumberingPlan(countryCode, callingCode) {\n // Supports just passing `callingCode` as the first argument.\n if (countryCode && CALLING_CODE_REG_EXP.test(countryCode)) {\n callingCode = countryCode;\n countryCode = null;\n }\n\n if (countryCode && countryCode !== '001') {\n if (!this.hasCountry(countryCode)) {\n throw new Error(\"Unknown country: \".concat(countryCode));\n }\n\n this.numberingPlan = new NumberingPlan(this.getCountryMetadata(countryCode), this);\n } else if (callingCode) {\n if (!this.hasCallingCode(callingCode)) {\n throw new Error(\"Unknown calling code: \".concat(callingCode));\n }\n\n this.numberingPlan = new NumberingPlan(this.getNumberingPlanMetadata(callingCode), this);\n } else {\n this.numberingPlan = undefined;\n }\n\n return this;\n }\n }, {\n key: \"getCountryCodesForCallingCode\",\n value: function getCountryCodesForCallingCode(callingCode) {\n var countryCodes = this.countryCallingCodes()[callingCode];\n\n if (countryCodes) {\n // Metadata before V4 included \"non-geographic entity\" calling codes\n // inside `country_calling_codes` (for example, `\"881\":[\"001\"]`).\n // Now the semantics of `country_calling_codes` has changed:\n // it's specifically for \"countries\" now.\n // Older versions of custom metadata will simply skip parsing\n // \"non-geographic entity\" phone numbers with new versions\n // of this library: it's not considered a bug,\n // because such numbers are extremely rare,\n // and developers extremely rarely use custom metadata.\n if (countryCodes.length === 1 && countryCodes[0].length === 3) {\n return;\n }\n\n return countryCodes;\n }\n }\n }, {\n key: \"getCountryCodeForCallingCode\",\n value: function getCountryCodeForCallingCode(callingCode) {\n var countryCodes = this.getCountryCodesForCallingCode(callingCode);\n\n if (countryCodes) {\n return countryCodes[0];\n }\n }\n }, {\n key: \"getNumberingPlanMetadata\",\n value: function getNumberingPlanMetadata(callingCode) {\n var countryCode = this.getCountryCodeForCallingCode(callingCode);\n\n if (countryCode) {\n return this.getCountryMetadata(countryCode);\n }\n\n if (this.nonGeographic()) {\n var metadata = this.nonGeographic()[callingCode];\n\n if (metadata) {\n return metadata;\n }\n } else {\n // A hacky workaround for old custom metadata (generated before V4).\n var countryCodes = this.countryCallingCodes()[callingCode];\n\n if (countryCodes && countryCodes.length === 1 && countryCodes[0] === '001') {\n return this.metadata.countries['001'];\n }\n }\n } // Deprecated.\n\n }, {\n key: \"countryCallingCode\",\n value: function countryCallingCode() {\n return this.numberingPlan.callingCode();\n } // Deprecated.\n\n }, {\n key: \"IDDPrefix\",\n value: function IDDPrefix() {\n return this.numberingPlan.IDDPrefix();\n } // Deprecated.\n\n }, {\n key: \"defaultIDDPrefix\",\n value: function defaultIDDPrefix() {\n return this.numberingPlan.defaultIDDPrefix();\n } // Deprecated.\n\n }, {\n key: \"nationalNumberPattern\",\n value: function nationalNumberPattern() {\n return this.numberingPlan.nationalNumberPattern();\n } // Deprecated.\n\n }, {\n key: \"possibleLengths\",\n value: function possibleLengths() {\n return this.numberingPlan.possibleLengths();\n } // Deprecated.\n\n }, {\n key: \"formats\",\n value: function formats() {\n return this.numberingPlan.formats();\n } // Deprecated.\n\n }, {\n key: \"nationalPrefixForParsing\",\n value: function nationalPrefixForParsing() {\n return this.numberingPlan.nationalPrefixForParsing();\n } // Deprecated.\n\n }, {\n key: \"nationalPrefixTransformRule\",\n value: function nationalPrefixTransformRule() {\n return this.numberingPlan.nationalPrefixTransformRule();\n } // Deprecated.\n\n }, {\n key: \"leadingDigits\",\n value: function leadingDigits() {\n return this.numberingPlan.leadingDigits();\n } // Deprecated.\n\n }, {\n key: \"hasTypes\",\n value: function hasTypes() {\n return this.numberingPlan.hasTypes();\n } // Deprecated.\n\n }, {\n key: \"type\",\n value: function type(_type) {\n return this.numberingPlan.type(_type);\n } // Deprecated.\n\n }, {\n key: \"ext\",\n value: function ext() {\n return this.numberingPlan.ext();\n }\n }, {\n key: \"countryCallingCodes\",\n value: function countryCallingCodes() {\n if (this.v1) return this.metadata.country_phone_code_to_countries;\n return this.metadata.country_calling_codes;\n } // Deprecated.\n\n }, {\n key: \"chooseCountryByCountryCallingCode\",\n value: function chooseCountryByCountryCallingCode(callingCode) {\n return this.selectNumberingPlan(callingCode);\n }\n }, {\n key: \"hasSelectedNumberingPlan\",\n value: function hasSelectedNumberingPlan() {\n return this.numberingPlan !== undefined;\n }\n }]);\n\n return Metadata;\n}();\n\nexport { Metadata as default };\n\nvar NumberingPlan =\n/*#__PURE__*/\nfunction () {\n function NumberingPlan(metadata, globalMetadataObject) {\n _classCallCheck(this, NumberingPlan);\n\n this.globalMetadataObject = globalMetadataObject;\n this.metadata = metadata;\n setVersion.call(this, globalMetadataObject.metadata);\n }\n\n _createClass(NumberingPlan, [{\n key: \"callingCode\",\n value: function callingCode() {\n return this.metadata[0];\n } // Formatting information for regions which share\n // a country calling code is contained by only one region\n // for performance reasons. For example, for NANPA region\n // (\"North American Numbering Plan Administration\",\n // which includes USA, Canada, Cayman Islands, Bahamas, etc)\n // it will be contained in the metadata for `US`.\n\n }, {\n key: \"getDefaultCountryMetadataForRegion\",\n value: function getDefaultCountryMetadataForRegion() {\n return this.globalMetadataObject.getNumberingPlanMetadata(this.callingCode());\n }\n }, {\n key: \"IDDPrefix\",\n value: function IDDPrefix() {\n if (this.v1 || this.v2) return;\n return this.metadata[1];\n }\n }, {\n key: \"defaultIDDPrefix\",\n value: function defaultIDDPrefix() {\n if (this.v1 || this.v2) return;\n return this.metadata[12];\n }\n }, {\n key: \"nationalNumberPattern\",\n value: function nationalNumberPattern() {\n if (this.v1 || this.v2) return this.metadata[1];\n return this.metadata[2];\n }\n }, {\n key: \"possibleLengths\",\n value: function possibleLengths() {\n if (this.v1) return;\n return this.metadata[this.v2 ? 2 : 3];\n }\n }, {\n key: \"_getFormats\",\n value: function _getFormats(metadata) {\n return metadata[this.v1 ? 2 : this.v2 ? 3 : 4];\n } // For countries of the same region (e.g. NANPA)\n // formats are all stored in the \"main\" country for that region.\n // E.g. \"RU\" and \"KZ\", \"US\" and \"CA\".\n\n }, {\n key: \"formats\",\n value: function formats() {\n var _this = this;\n\n var formats = this._getFormats(this.metadata) || this._getFormats(this.getDefaultCountryMetadataForRegion()) || [];\n return formats.map(function (_) {\n return new Format(_, _this);\n });\n }\n }, {\n key: \"nationalPrefix\",\n value: function nationalPrefix() {\n return this.metadata[this.v1 ? 3 : this.v2 ? 4 : 5];\n }\n }, {\n key: \"_getNationalPrefixFormattingRule\",\n value: function _getNationalPrefixFormattingRule(metadata) {\n return metadata[this.v1 ? 4 : this.v2 ? 5 : 6];\n } // For countries of the same region (e.g. NANPA)\n // national prefix formatting rule is stored in the \"main\" country for that region.\n // E.g. \"RU\" and \"KZ\", \"US\" and \"CA\".\n\n }, {\n key: \"nationalPrefixFormattingRule\",\n value: function nationalPrefixFormattingRule() {\n return this._getNationalPrefixFormattingRule(this.metadata) || this._getNationalPrefixFormattingRule(this.getDefaultCountryMetadataForRegion());\n }\n }, {\n key: \"_nationalPrefixForParsing\",\n value: function _nationalPrefixForParsing() {\n return this.metadata[this.v1 ? 5 : this.v2 ? 6 : 7];\n }\n }, {\n key: \"nationalPrefixForParsing\",\n value: function nationalPrefixForParsing() {\n // If `national_prefix_for_parsing` is not set explicitly,\n // then infer it from `national_prefix` (if any)\n return this._nationalPrefixForParsing() || this.nationalPrefix();\n }\n }, {\n key: \"nationalPrefixTransformRule\",\n value: function nationalPrefixTransformRule() {\n return this.metadata[this.v1 ? 6 : this.v2 ? 7 : 8];\n }\n }, {\n key: \"_getNationalPrefixIsOptionalWhenFormatting\",\n value: function _getNationalPrefixIsOptionalWhenFormatting() {\n return !!this.metadata[this.v1 ? 7 : this.v2 ? 8 : 9];\n } // For countries of the same region (e.g. NANPA)\n // \"national prefix is optional when formatting\" flag is\n // stored in the \"main\" country for that region.\n // E.g. \"RU\" and \"KZ\", \"US\" and \"CA\".\n\n }, {\n key: \"nationalPrefixIsOptionalWhenFormattingInNationalFormat\",\n value: function nationalPrefixIsOptionalWhenFormattingInNationalFormat() {\n return this._getNationalPrefixIsOptionalWhenFormatting(this.metadata) || this._getNationalPrefixIsOptionalWhenFormatting(this.getDefaultCountryMetadataForRegion());\n }\n }, {\n key: \"leadingDigits\",\n value: function leadingDigits() {\n return this.metadata[this.v1 ? 8 : this.v2 ? 9 : 10];\n }\n }, {\n key: \"types\",\n value: function types() {\n return this.metadata[this.v1 ? 9 : this.v2 ? 10 : 11];\n }\n }, {\n key: \"hasTypes\",\n value: function hasTypes() {\n // Versions 1.2.0 - 1.2.4: can be `[]`.\n\n /* istanbul ignore next */\n if (this.types() && this.types().length === 0) {\n return false;\n } // Versions <= 1.2.4: can be `undefined`.\n // Version >= 1.2.5: can be `0`.\n\n\n return !!this.types();\n }\n }, {\n key: \"type\",\n value: function type(_type2) {\n if (this.hasTypes() && getType(this.types(), _type2)) {\n return new Type(getType(this.types(), _type2), this);\n }\n }\n }, {\n key: \"ext\",\n value: function ext() {\n if (this.v1 || this.v2) return DEFAULT_EXT_PREFIX;\n return this.metadata[13] || DEFAULT_EXT_PREFIX;\n }\n }]);\n\n return NumberingPlan;\n}();\n\nvar Format =\n/*#__PURE__*/\nfunction () {\n function Format(format, metadata) {\n _classCallCheck(this, Format);\n\n this._format = format;\n this.metadata = metadata;\n }\n\n _createClass(Format, [{\n key: \"pattern\",\n value: function pattern() {\n return this._format[0];\n }\n }, {\n key: \"format\",\n value: function format() {\n return this._format[1];\n }\n }, {\n key: \"leadingDigitsPatterns\",\n value: function leadingDigitsPatterns() {\n return this._format[2] || [];\n }\n }, {\n key: \"nationalPrefixFormattingRule\",\n value: function nationalPrefixFormattingRule() {\n return this._format[3] || this.metadata.nationalPrefixFormattingRule();\n }\n }, {\n key: \"nationalPrefixIsOptionalWhenFormattingInNationalFormat\",\n value: function nationalPrefixIsOptionalWhenFormattingInNationalFormat() {\n return !!this._format[4] || this.metadata.nationalPrefixIsOptionalWhenFormattingInNationalFormat();\n }\n }, {\n key: \"nationalPrefixIsMandatoryWhenFormattingInNationalFormat\",\n value: function nationalPrefixIsMandatoryWhenFormattingInNationalFormat() {\n // National prefix is omitted if there's no national prefix formatting rule\n // set for this country, or when the national prefix formatting rule\n // contains no national prefix itself, or when this rule is set but\n // national prefix is optional for this phone number format\n // (and it is not enforced explicitly)\n return this.usesNationalPrefix() && !this.nationalPrefixIsOptionalWhenFormattingInNationalFormat();\n } // Checks whether national prefix formatting rule contains national prefix.\n\n }, {\n key: \"usesNationalPrefix\",\n value: function usesNationalPrefix() {\n return this.nationalPrefixFormattingRule() && // Check that national prefix formatting rule is not a \"dummy\" one.\n !FIRST_GROUP_ONLY_PREFIX_PATTERN.test(this.nationalPrefixFormattingRule()) // In compressed metadata, `this.nationalPrefixFormattingRule()` is `0`\n // when `national_prefix_formatting_rule` is not present.\n // So, `true` or `false` are returned explicitly here, so that\n // `0` number isn't returned.\n ? true : false;\n }\n }, {\n key: \"internationalFormat\",\n value: function internationalFormat() {\n return this._format[5] || this.format();\n }\n }]);\n\n return Format;\n}();\n/**\r\n * A pattern that is used to determine if the national prefix formatting rule\r\n * has the first group only, i.e., does not start with the national prefix.\r\n * Note that the pattern explicitly allows for unbalanced parentheses.\r\n */\n\n\nvar FIRST_GROUP_ONLY_PREFIX_PATTERN = /^\\(?\\$1\\)?$/;\n\nvar Type =\n/*#__PURE__*/\nfunction () {\n function Type(type, metadata) {\n _classCallCheck(this, Type);\n\n this.type = type;\n this.metadata = metadata;\n }\n\n _createClass(Type, [{\n key: \"pattern\",\n value: function pattern() {\n if (this.metadata.v1) return this.type;\n return this.type[0];\n }\n }, {\n key: \"possibleLengths\",\n value: function possibleLengths() {\n if (this.metadata.v1) return;\n return this.type[1] || this.metadata.possibleLengths();\n }\n }]);\n\n return Type;\n}();\n\nfunction getType(types, type) {\n switch (type) {\n case 'FIXED_LINE':\n return types[0];\n\n case 'MOBILE':\n return types[1];\n\n case 'TOLL_FREE':\n return types[2];\n\n case 'PREMIUM_RATE':\n return types[3];\n\n case 'PERSONAL_NUMBER':\n return types[4];\n\n case 'VOICEMAIL':\n return types[5];\n\n case 'UAN':\n return types[6];\n\n case 'PAGER':\n return types[7];\n\n case 'VOIP':\n return types[8];\n\n case 'SHARED_COST':\n return types[9];\n }\n}\n\nexport function validateMetadata(metadata) {\n if (!metadata) {\n throw new Error('[libphonenumber-js] `metadata` argument not passed. Check your arguments.');\n } // `country_phone_code_to_countries` was renamed to\n // `country_calling_codes` in `1.0.18`.\n\n\n if (!is_object(metadata) || !is_object(metadata.countries)) {\n throw new Error(\"[libphonenumber-js] `metadata` argument was passed but it's not a valid metadata. Must be an object having `.countries` child object property. Got \".concat(is_object(metadata) ? 'an object of shape: { ' + Object.keys(metadata).join(', ') + ' }' : 'a ' + type_of(metadata) + ': ' + metadata, \".\"));\n }\n} // Babel transforms `typeof` into some \"branches\"\n// so istanbul will show this as \"branch not covered\".\n\n/* istanbul ignore next */\n\nvar is_object = function is_object(_) {\n return _typeof(_) === 'object';\n}; // Babel transforms `typeof` into some \"branches\"\n// so istanbul will show this as \"branch not covered\".\n\n/* istanbul ignore next */\n\n\nvar type_of = function type_of(_) {\n return _typeof(_);\n};\n/**\r\n * Returns extension prefix for a country.\r\n * @param {string} country\r\n * @param {object} metadata\r\n * @return {string?}\r\n * @example\r\n * // Returns \" ext. \"\r\n * getExtPrefix(\"US\")\r\n */\n\n\nexport function getExtPrefix(country, metadata) {\n metadata = new Metadata(metadata);\n\n if (metadata.hasCountry(country)) {\n return metadata.country(country).ext();\n }\n\n return DEFAULT_EXT_PREFIX;\n}\n/**\r\n * Returns \"country calling code\" for a country.\r\n * Throws an error if the country doesn't exist or isn't supported by this library.\r\n * @param {string} country\r\n * @param {object} metadata\r\n * @return {string}\r\n * @example\r\n * // Returns \"44\"\r\n * getCountryCallingCode(\"GB\")\r\n */\n\nexport function getCountryCallingCode(country, metadata) {\n metadata = new Metadata(metadata);\n\n if (metadata.hasCountry(country)) {\n return metadata.country(country).countryCallingCode();\n }\n\n throw new Error(\"Unknown country: \".concat(country));\n}\nexport function isSupportedCountry(country, metadata) {\n // metadata = new Metadata(metadata)\n // return metadata.hasCountry(country)\n return metadata.countries[country] !== undefined;\n}\n\nfunction setVersion(metadata) {\n var version = metadata.version;\n\n if (typeof version === 'number') {\n this.v1 = version === 1;\n this.v2 = version === 2;\n this.v3 = version === 3;\n this.v4 = version === 4;\n } else {\n if (!version) {\n this.v1 = true;\n } else if (compare(version, V3) === -1) {\n this.v2 = true;\n } else if (compare(version, V4) === -1) {\n this.v3 = true;\n } else {\n this.v4 = true;\n }\n }\n} // const ISO_COUNTRY_CODE = /^[A-Z]{2}$/\n// function isCountryCode(countryCode) {\n// \treturn ISO_COUNTRY_CODE.test(countryCodeOrCountryCallingCode)\n// }\n","import { parseDigit } from './helpers/parseDigits';\n/**\r\n * Parses phone number characters from a string.\r\n * Drops all punctuation leaving only digits and the leading `+` sign (if any).\r\n * Also converts wide-ascii and arabic-indic numerals to conventional numerals.\r\n * E.g. in Iraq they don't write `+442323234` but rather `+٤٤٢٣٢٣٢٣٤`.\r\n * @param {string} string\r\n * @return {string}\r\n * @example\r\n * ```js\r\n * // Outputs '8800555'.\r\n * parseIncompletePhoneNumber('8 (800) 555')\r\n * // Outputs '+7800555'.\r\n * parseIncompletePhoneNumber('+7 800 555')\r\n * ```\r\n */\n\nexport default function parseIncompletePhoneNumber(string) {\n var result = ''; // Using `.split('')` here instead of normal `for ... of`\n // because the importing application doesn't neccessarily include an ES6 polyfill.\n // The `.split('')` approach discards \"exotic\" UTF-8 characters\n // (the ones consisting of four bytes) but digits\n // (including non-European ones) don't fall into that range\n // so such \"exotic\" characters would be discarded anyway.\n\n for (var _iterator = string.split(''), _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {\n var _ref;\n\n if (_isArray) {\n if (_i >= _iterator.length) break;\n _ref = _iterator[_i++];\n } else {\n _i = _iterator.next();\n if (_i.done) break;\n _ref = _i.value;\n }\n\n var character = _ref;\n result += parsePhoneNumberCharacter(character, result) || '';\n }\n\n return result;\n}\n/**\r\n * Parses next character while parsing phone number digits (including a `+`)\r\n * from text: discards everything except `+` and digits, and `+` is only allowed\r\n * at the start of a phone number.\r\n * For example, is used in `react-phone-number-input` where it uses\r\n * [`input-format`](https://gitlab.com/catamphetamine/input-format).\r\n * @param {string} character - Yet another character from raw input string.\r\n * @param {string?} prevParsedCharacters - Previous parsed characters.\r\n * @param {object} meta - Optional custom use-case-specific metadata.\r\n * @return {string?} The parsed character.\r\n */\n\nexport function parsePhoneNumberCharacter(character, prevParsedCharacters) {\n // Only allow a leading `+`.\n if (character === '+') {\n // If this `+` is not the first parsed character\n // then discard it.\n if (prevParsedCharacters) {\n return;\n }\n\n return '+';\n } // Allow digits.\n\n\n return parseDigit(character);\n}\n","function _typeof(obj) { if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; var ownKeys = Object.keys(source); if (typeof Object.getOwnPropertySymbols === 'function') { ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) { return Object.getOwnPropertyDescriptor(source, sym).enumerable; })); } ownKeys.forEach(function (key) { _defineProperty(target, key, source[key]); }); } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _nonIterableRest(); }\n\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance\"); }\n\nfunction _iterableToArrayLimit(arr, i) { var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i[\"return\"] != null) _i[\"return\"](); } finally { if (_d) throw _e; } } return _arr; }\n\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n\nimport parsePhoneNumber_ from './parsePhoneNumber_';\nexport default function parsePhoneNumber() {\n var _normalizeArguments = normalizeArguments(arguments),\n text = _normalizeArguments.text,\n options = _normalizeArguments.options,\n metadata = _normalizeArguments.metadata;\n\n return parsePhoneNumber_(text, options, metadata);\n}\nexport function normalizeArguments(args) {\n var _Array$prototype$slic = Array.prototype.slice.call(args),\n _Array$prototype$slic2 = _slicedToArray(_Array$prototype$slic, 4),\n arg_1 = _Array$prototype$slic2[0],\n arg_2 = _Array$prototype$slic2[1],\n arg_3 = _Array$prototype$slic2[2],\n arg_4 = _Array$prototype$slic2[3];\n\n var text;\n var options;\n var metadata; // If the phone number is passed as a string.\n // `parsePhoneNumber('88005553535', ...)`.\n\n if (typeof arg_1 === 'string') {\n text = arg_1;\n } else throw new TypeError('A text for parsing must be a string.'); // If \"default country\" argument is being passed then move it to `options`.\n // `parsePhoneNumber('88005553535', 'RU', [options], metadata)`.\n\n\n if (!arg_2 || typeof arg_2 === 'string') {\n if (arg_4) {\n options = arg_3;\n metadata = arg_4;\n } else {\n options = undefined;\n metadata = arg_3;\n }\n\n if (arg_2) {\n options = _objectSpread({\n defaultCountry: arg_2\n }, options);\n }\n } // `defaultCountry` is not passed.\n // Example: `parsePhoneNumber('+78005553535', [options], metadata)`.\n else if (isObject(arg_2)) {\n if (arg_3) {\n options = arg_2;\n metadata = arg_3;\n } else {\n metadata = arg_2;\n }\n } else throw new Error(\"Invalid second argument: \".concat(arg_2));\n\n return {\n text: text,\n options: options,\n metadata: metadata\n };\n} // Otherwise istanbul would show this as \"branch not covered\".\n\n/* istanbul ignore next */\n\nvar isObject = function isObject(_) {\n return _typeof(_) === 'object';\n};\n","import { normalizeArguments } from './parsePhoneNumber';\nimport parsePhoneNumberFromString_ from './parsePhoneNumberFromString_';\nexport default function parsePhoneNumberFromString() {\n var _normalizeArguments = normalizeArguments(arguments),\n text = _normalizeArguments.text,\n options = _normalizeArguments.options,\n metadata = _normalizeArguments.metadata;\n\n return parsePhoneNumberFromString_(text, options, metadata);\n}\n","function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; var ownKeys = Object.keys(source); if (typeof Object.getOwnPropertySymbols === 'function') { ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) { return Object.getOwnPropertyDescriptor(source, sym).enumerable; })); } ownKeys.forEach(function (key) { _defineProperty(target, key, source[key]); }); } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport parsePhoneNumber from './parsePhoneNumber_';\nimport ParseError from './ParseError';\nimport { isSupportedCountry } from './metadata';\nexport default function parsePhoneNumberFromString(text, options, metadata) {\n // Validate `defaultCountry`.\n if (options && options.defaultCountry && !isSupportedCountry(options.defaultCountry, metadata)) {\n options = _objectSpread({}, options, {\n defaultCountry: undefined\n });\n } // Parse phone number.\n\n\n try {\n return parsePhoneNumber(text, options, metadata);\n } catch (error) {\n /* istanbul ignore else */\n if (error instanceof ParseError) {//\n } else {\n throw error;\n }\n }\n}\n","function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; var ownKeys = Object.keys(source); if (typeof Object.getOwnPropertySymbols === 'function') { ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) { return Object.getOwnPropertyDescriptor(source, sym).enumerable; })); } ownKeys.forEach(function (key) { _defineProperty(target, key, source[key]); }); } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport parseNumber from './parse_';\nexport default function parsePhoneNumber(text, options, metadata) {\n return parseNumber(text, _objectSpread({}, options, {\n v2: true\n }), metadata);\n}\n","// This is a port of Google Android `libphonenumber`'s\n// `phonenumberutil.js` of December 31th, 2018.\n//\n// https://github.com/googlei18n/libphonenumber/commits/master/javascript/i18n/phonenumbers/phonenumberutil.js\nimport { VALID_DIGITS, PLUS_CHARS, MIN_LENGTH_FOR_NSN, MAX_LENGTH_FOR_NSN } from './constants';\nimport ParseError from './ParseError';\nimport Metadata from './metadata';\nimport isViablePhoneNumber from './helpers/isViablePhoneNumber';\nimport extractExtension from './helpers/extension/extractExtension';\nimport parseIncompletePhoneNumber from './parseIncompletePhoneNumber';\nimport getCountryCallingCode from './getCountryCallingCode';\nimport { isPossibleNumber } from './isPossibleNumber_';\nimport { parseRFC3966 } from './helpers/RFC3966';\nimport PhoneNumber from './PhoneNumber';\nimport matchesEntirely from './helpers/matchesEntirely';\nimport extractCountryCallingCode from './helpers/extractCountryCallingCode';\nimport extractCountryCallingCodeFromInternationalNumberWithoutPlusSign from './helpers/extractCountryCallingCodeFromInternationalNumberWithoutPlusSign';\nimport extractNationalNumber from './helpers/extractNationalNumber';\nimport stripIddPrefix from './helpers/stripIddPrefix';\nimport getCountryByCallingCode from './helpers/getCountryByCallingCode'; // We don't allow input strings for parsing to be longer than 250 chars.\n// This prevents malicious input from consuming CPU.\n\nvar MAX_INPUT_STRING_LENGTH = 250; // This consists of the plus symbol, digits, and arabic-indic digits.\n\nvar PHONE_NUMBER_START_PATTERN = new RegExp('[' + PLUS_CHARS + VALID_DIGITS + ']'); // Regular expression of trailing characters that we want to remove.\n// A trailing `#` is sometimes used when writing phone numbers with extensions in US.\n// Example: \"+1 (645) 123 1234-910#\" number has extension \"910\".\n\nvar AFTER_PHONE_NUMBER_END_PATTERN = new RegExp('[^' + VALID_DIGITS + '#' + ']+$');\nvar USE_NON_GEOGRAPHIC_COUNTRY_CODE = false; // Examples:\n//\n// ```js\n// parse('8 (800) 555-35-35', 'RU')\n// parse('8 (800) 555-35-35', 'RU', metadata)\n// parse('8 (800) 555-35-35', { country: { default: 'RU' } })\n// parse('8 (800) 555-35-35', { country: { default: 'RU' } }, metadata)\n// parse('+7 800 555 35 35')\n// parse('+7 800 555 35 35', metadata)\n// ```\n//\n\nexport default function parse(text, options, metadata) {\n // If assigning the `{}` default value is moved to the arguments above,\n // code coverage would decrease for some weird reason.\n options = options || {};\n metadata = new Metadata(metadata); // Validate `defaultCountry`.\n\n if (options.defaultCountry && !metadata.hasCountry(options.defaultCountry)) {\n if (options.v2) {\n throw new ParseError('INVALID_COUNTRY');\n }\n\n throw new Error(\"Unknown country: \".concat(options.defaultCountry));\n } // Parse the phone number.\n\n\n var _parseInput = parseInput(text, options.v2, options.extract),\n formattedPhoneNumber = _parseInput.number,\n ext = _parseInput.ext; // If the phone number is not viable then return nothing.\n\n\n if (!formattedPhoneNumber) {\n if (options.v2) {\n throw new ParseError('NOT_A_NUMBER');\n }\n\n return {};\n }\n\n var _parsePhoneNumber = parsePhoneNumber(formattedPhoneNumber, options.defaultCountry, options.defaultCallingCode, metadata),\n country = _parsePhoneNumber.country,\n nationalNumber = _parsePhoneNumber.nationalNumber,\n countryCallingCode = _parsePhoneNumber.countryCallingCode,\n carrierCode = _parsePhoneNumber.carrierCode;\n\n if (!metadata.hasSelectedNumberingPlan()) {\n if (options.v2) {\n throw new ParseError('INVALID_COUNTRY');\n }\n\n return {};\n } // Validate national (significant) number length.\n\n\n if (!nationalNumber || nationalNumber.length < MIN_LENGTH_FOR_NSN) {\n // Won't throw here because the regexp already demands length > 1.\n\n /* istanbul ignore if */\n if (options.v2) {\n throw new ParseError('TOO_SHORT');\n } // Google's demo just throws an error in this case.\n\n\n return {};\n } // Validate national (significant) number length.\n //\n // A sidenote:\n //\n // They say that sometimes national (significant) numbers\n // can be longer than `MAX_LENGTH_FOR_NSN` (e.g. in Germany).\n // https://github.com/googlei18n/libphonenumber/blob/7e1748645552da39c4e1ba731e47969d97bdb539/resources/phonenumber.proto#L36\n // Such numbers will just be discarded.\n //\n\n\n if (nationalNumber.length > MAX_LENGTH_FOR_NSN) {\n if (options.v2) {\n throw new ParseError('TOO_LONG');\n } // Google's demo just throws an error in this case.\n\n\n return {};\n }\n\n if (options.v2) {\n var phoneNumber = new PhoneNumber(countryCallingCode, nationalNumber, metadata.metadata);\n\n if (country) {\n phoneNumber.country = country;\n }\n\n if (carrierCode) {\n phoneNumber.carrierCode = carrierCode;\n }\n\n if (ext) {\n phoneNumber.ext = ext;\n }\n\n return phoneNumber;\n } // Check if national phone number pattern matches the number.\n // National number pattern is different for each country,\n // even for those ones which are part of the \"NANPA\" group.\n\n\n var valid = (options.extended ? metadata.hasSelectedNumberingPlan() : country) ? matchesEntirely(nationalNumber, metadata.nationalNumberPattern()) : false;\n\n if (!options.extended) {\n return valid ? result(country, nationalNumber, ext) : {};\n } // isInternational: countryCallingCode !== undefined\n\n\n return {\n country: country,\n countryCallingCode: countryCallingCode,\n carrierCode: carrierCode,\n valid: valid,\n possible: valid ? true : options.extended === true && metadata.possibleLengths() && isPossibleNumber(nationalNumber, metadata) ? true : false,\n phone: nationalNumber,\n ext: ext\n };\n}\n/**\r\n * Extracts a formatted phone number from text.\r\n * Doesn't guarantee that the extracted phone number\r\n * is a valid phone number (for example, doesn't validate its length).\r\n * @param {string} text\r\n * @param {boolean} [extract] — If `false`, then will parse the entire `text` as a phone number.\r\n * @param {boolean} [throwOnError] — By default, it won't throw if the text is too long.\r\n * @return {string}\r\n * @example\r\n * // Returns \"(213) 373-4253\".\r\n * extractFormattedPhoneNumber(\"Call (213) 373-4253 for assistance.\")\r\n */\n\nfunction extractFormattedPhoneNumber(text, extract, throwOnError) {\n if (!text) {\n return;\n }\n\n if (text.length > MAX_INPUT_STRING_LENGTH) {\n if (throwOnError) {\n throw new ParseError('TOO_LONG');\n }\n\n return;\n }\n\n if (extract === false) {\n return text;\n } // Attempt to extract a possible number from the string passed in\n\n\n var startsAt = text.search(PHONE_NUMBER_START_PATTERN);\n\n if (startsAt < 0) {\n return;\n }\n\n return text // Trim everything to the left of the phone number\n .slice(startsAt) // Remove trailing non-numerical characters\n .replace(AFTER_PHONE_NUMBER_END_PATTERN, '');\n}\n/**\r\n * @param {string} text - Input.\r\n * @param {boolean} v2 - Legacy API functions don't pass `v2: true` flag.\r\n * @param {boolean} [extract] - Whether to extract a phone number from `text`, or attempt to parse the entire text as a phone number.\r\n * @return {object} `{ ?number, ?ext }`.\r\n */\n\n\nfunction parseInput(text, v2, extract) {\n // Parse RFC 3966 phone number URI.\n if (text && text.indexOf('tel:') === 0) {\n return parseRFC3966(text);\n }\n\n var number = extractFormattedPhoneNumber(text, extract, v2); // If the phone number is not viable, then abort.\n\n if (!number || !isViablePhoneNumber(number)) {\n return {};\n } // Attempt to parse extension first, since it doesn't require region-specific\n // data and we want to have the non-normalised number here.\n\n\n var withExtensionStripped = extractExtension(number);\n\n if (withExtensionStripped.ext) {\n return withExtensionStripped;\n }\n\n return {\n number: number\n };\n}\n/**\r\n * Creates `parse()` result object.\r\n */\n\n\nfunction result(country, nationalNumber, ext) {\n var result = {\n country: country,\n phone: nationalNumber\n };\n\n if (ext) {\n result.ext = ext;\n }\n\n return result;\n}\n/**\r\n * Parses a viable phone number.\r\n * @param {string} formattedPhoneNumber — Example: \"(213) 373-4253\".\r\n * @param {string} [defaultCountry]\r\n * @param {string} [defaultCallingCode]\r\n * @param {Metadata} metadata\r\n * @return {object} Returns `{ country: string?, countryCallingCode: string?, nationalNumber: string? }`.\r\n */\n\n\nfunction parsePhoneNumber(formattedPhoneNumber, defaultCountry, defaultCallingCode, metadata) {\n // Extract calling code from phone number.\n var _extractCountryCallin = extractCountryCallingCode(parseIncompletePhoneNumber(formattedPhoneNumber), defaultCountry, defaultCallingCode, metadata.metadata),\n countryCallingCode = _extractCountryCallin.countryCallingCode,\n number = _extractCountryCallin.number; // Choose a country by `countryCallingCode`.\n\n\n var country;\n\n if (countryCallingCode) {\n metadata.selectNumberingPlan(countryCallingCode);\n } // If `formattedPhoneNumber` is in \"national\" format\n // then `number` is defined and `countryCallingCode` isn't.\n else if (number && (defaultCountry || defaultCallingCode)) {\n metadata.selectNumberingPlan(defaultCountry, defaultCallingCode);\n\n if (defaultCountry) {\n country = defaultCountry;\n } else {\n /* istanbul ignore if */\n if (USE_NON_GEOGRAPHIC_COUNTRY_CODE) {\n if (metadata.isNonGeographicCallingCode(defaultCallingCode)) {\n country = '001';\n }\n }\n }\n\n countryCallingCode = defaultCallingCode || getCountryCallingCode(defaultCountry, metadata.metadata);\n } else return {};\n\n if (!number) {\n return {\n countryCallingCode: countryCallingCode\n };\n }\n\n var _extractNationalNumbe = extractNationalNumber(parseIncompletePhoneNumber(number), metadata),\n nationalNumber = _extractNationalNumbe.nationalNumber,\n carrierCode = _extractNationalNumbe.carrierCode; // Sometimes there are several countries\n // corresponding to the same country phone code\n // (e.g. NANPA countries all having `1` country phone code).\n // Therefore, to reliably determine the exact country,\n // national (significant) number should have been parsed first.\n //\n // When `metadata.json` is generated, all \"ambiguous\" country phone codes\n // get their countries populated with the full set of\n // \"phone number type\" regular expressions.\n //\n\n\n var exactCountry = getCountryByCallingCode(countryCallingCode, nationalNumber, metadata);\n\n if (exactCountry) {\n country = exactCountry;\n /* istanbul ignore if */\n\n if (exactCountry === '001') {// Can't happen with `USE_NON_GEOGRAPHIC_COUNTRY_CODE` being `false`.\n // If `USE_NON_GEOGRAPHIC_COUNTRY_CODE` is set to `true` for some reason,\n // then remove the \"istanbul ignore if\".\n } else {\n metadata.country(country);\n }\n }\n\n return {\n country: country,\n countryCallingCode: countryCallingCode,\n nationalNumber: nationalNumber,\n carrierCode: carrierCode\n };\n}\n","// Copy-pasted from:\n// https://github.com/substack/semver-compare/blob/master/index.js\n//\n// Inlining this function because some users reported issues with\n// importing from `semver-compare` in a browser with ES6 \"native\" modules.\n//\n// Fixes `semver-compare` not being able to compare versions with alpha/beta/etc \"tags\".\n// https://github.com/catamphetamine/libphonenumber-js/issues/381\nexport default function (a, b) {\n a = a.split('-');\n b = b.split('-');\n var pa = a[0].split('.');\n var pb = b[0].split('.');\n\n for (var i = 0; i < 3; i++) {\n var na = Number(pa[i]);\n var nb = Number(pb[i]);\n if (na > nb) return 1;\n if (nb > na) return -1;\n if (!isNaN(na) && isNaN(nb)) return 1;\n if (isNaN(na) && !isNaN(nb)) return -1;\n }\n\n if (a[1] && b[1]) {\n return a[1] > b[1] ? 1 : a[1] < b[1] ? -1 : 0;\n }\n\n return !a[1] && b[1] ? 1 : a[1] && !b[1] ? -1 : 0;\n}\n","import Metadata from './metadata';\nimport matchesEntirely from './helpers/matchesEntirely';\nimport getNumberType from './helpers/getNumberType';\n/**\r\n * Checks if a given phone number is valid.\r\n *\r\n * If the `number` is a string, it will be parsed to an object,\r\n * but only if it contains only valid phone number characters (including punctuation).\r\n * If the `number` is an object, it is used as is.\r\n *\r\n * The optional `defaultCountry` argument is the default country.\r\n * I.e. it does not restrict to just that country,\r\n * e.g. in those cases where several countries share\r\n * the same phone numbering rules (NANPA, Britain, etc).\r\n * For example, even though the number `07624 369230`\r\n * belongs to the Isle of Man (\"IM\" country code)\r\n * calling `isValidNumber('07624369230', 'GB', metadata)`\r\n * still returns `true` because the country is not restricted to `GB`,\r\n * it's just that `GB` is the default one for the phone numbering rules.\r\n * For restricting the country see `isValidNumberForRegion()`\r\n * though restricting a country might not be a good idea.\r\n * https://github.com/googlei18n/libphonenumber/blob/master/FAQ.md#when-should-i-use-isvalidnumberforregion\r\n *\r\n * Examples:\r\n *\r\n * ```js\r\n * isValidNumber('+78005553535', metadata)\r\n * isValidNumber('8005553535', 'RU', metadata)\r\n * isValidNumber('88005553535', 'RU', metadata)\r\n * isValidNumber({ phone: '8005553535', country: 'RU' }, metadata)\r\n * ```\r\n */\n\nexport default function isValidNumber(input, options, metadata) {\n // If assigning the `{}` default value is moved to the arguments above,\n // code coverage would decrease for some weird reason.\n options = options || {};\n metadata = new Metadata(metadata); // This is just to support `isValidNumber({})`\n // for cases when `parseNumber()` returns `{}`.\n\n if (!input.country) {\n return false;\n }\n\n metadata.selectNumberingPlan(input.country, input.countryCallingCode); // By default, countries only have type regexps when it's required for\n // distinguishing different countries having the same `countryCallingCode`.\n\n if (metadata.hasTypes()) {\n return getNumberType(input, options, metadata.metadata) !== undefined;\n } // If there are no type regexps for this country in metadata then use\n // `nationalNumberPattern` as a \"better than nothing\" replacement.\n\n\n var national_number = options.v2 ? input.nationalNumber : input.phone;\n return matchesEntirely(national_number, metadata.nationalNumberPattern());\n}\n","// This file is a workaround for a bug in web browsers' \"native\"\n// ES6 importing system which is uncapable of importing \"*.json\" files.\n// https://github.com/catamphetamine/libphonenumber-js/issues/239\nexport default {\"version\":4,\"country_calling_codes\":{\"1\":[\"US\",\"AG\",\"AI\",\"AS\",\"BB\",\"BM\",\"BS\",\"CA\",\"DM\",\"DO\",\"GD\",\"GU\",\"JM\",\"KN\",\"KY\",\"LC\",\"MP\",\"MS\",\"PR\",\"SX\",\"TC\",\"TT\",\"VC\",\"VG\",\"VI\"],\"7\":[\"RU\",\"KZ\"],\"20\":[\"EG\"],\"27\":[\"ZA\"],\"30\":[\"GR\"],\"31\":[\"NL\"],\"32\":[\"BE\"],\"33\":[\"FR\"],\"34\":[\"ES\"],\"36\":[\"HU\"],\"39\":[\"IT\",\"VA\"],\"40\":[\"RO\"],\"41\":[\"CH\"],\"43\":[\"AT\"],\"44\":[\"GB\",\"GG\",\"IM\",\"JE\"],\"45\":[\"DK\"],\"46\":[\"SE\"],\"47\":[\"NO\",\"SJ\"],\"48\":[\"PL\"],\"49\":[\"DE\"],\"51\":[\"PE\"],\"52\":[\"MX\"],\"53\":[\"CU\"],\"54\":[\"AR\"],\"55\":[\"BR\"],\"56\":[\"CL\"],\"57\":[\"CO\"],\"58\":[\"VE\"],\"60\":[\"MY\"],\"61\":[\"AU\",\"CC\",\"CX\"],\"62\":[\"ID\"],\"63\":[\"PH\"],\"64\":[\"NZ\"],\"65\":[\"SG\"],\"66\":[\"TH\"],\"81\":[\"JP\"],\"82\":[\"KR\"],\"84\":[\"VN\"],\"86\":[\"CN\"],\"90\":[\"TR\"],\"91\":[\"IN\"],\"92\":[\"PK\"],\"93\":[\"AF\"],\"94\":[\"LK\"],\"95\":[\"MM\"],\"98\":[\"IR\"],\"211\":[\"SS\"],\"212\":[\"MA\",\"EH\"],\"213\":[\"DZ\"],\"216\":[\"TN\"],\"218\":[\"LY\"],\"220\":[\"GM\"],\"221\":[\"SN\"],\"222\":[\"MR\"],\"223\":[\"ML\"],\"224\":[\"GN\"],\"225\":[\"CI\"],\"226\":[\"BF\"],\"227\":[\"NE\"],\"228\":[\"TG\"],\"229\":[\"BJ\"],\"230\":[\"MU\"],\"231\":[\"LR\"],\"232\":[\"SL\"],\"233\":[\"GH\"],\"234\":[\"NG\"],\"235\":[\"TD\"],\"236\":[\"CF\"],\"237\":[\"CM\"],\"238\":[\"CV\"],\"239\":[\"ST\"],\"240\":[\"GQ\"],\"241\":[\"GA\"],\"242\":[\"CG\"],\"243\":[\"CD\"],\"244\":[\"AO\"],\"245\":[\"GW\"],\"246\":[\"IO\"],\"247\":[\"AC\"],\"248\":[\"SC\"],\"249\":[\"SD\"],\"250\":[\"RW\"],\"251\":[\"ET\"],\"252\":[\"SO\"],\"253\":[\"DJ\"],\"254\":[\"KE\"],\"255\":[\"TZ\"],\"256\":[\"UG\"],\"257\":[\"BI\"],\"258\":[\"MZ\"],\"260\":[\"ZM\"],\"261\":[\"MG\"],\"262\":[\"RE\",\"YT\"],\"263\":[\"ZW\"],\"264\":[\"NA\"],\"265\":[\"MW\"],\"266\":[\"LS\"],\"267\":[\"BW\"],\"268\":[\"SZ\"],\"269\":[\"KM\"],\"290\":[\"SH\",\"TA\"],\"291\":[\"ER\"],\"297\":[\"AW\"],\"298\":[\"FO\"],\"299\":[\"GL\"],\"350\":[\"GI\"],\"351\":[\"PT\"],\"352\":[\"LU\"],\"353\":[\"IE\"],\"354\":[\"IS\"],\"355\":[\"AL\"],\"356\":[\"MT\"],\"357\":[\"CY\"],\"358\":[\"FI\",\"AX\"],\"359\":[\"BG\"],\"370\":[\"LT\"],\"371\":[\"LV\"],\"372\":[\"EE\"],\"373\":[\"MD\"],\"374\":[\"AM\"],\"375\":[\"BY\"],\"376\":[\"AD\"],\"377\":[\"MC\"],\"378\":[\"SM\"],\"380\":[\"UA\"],\"381\":[\"RS\"],\"382\":[\"ME\"],\"383\":[\"XK\"],\"385\":[\"HR\"],\"386\":[\"SI\"],\"387\":[\"BA\"],\"389\":[\"MK\"],\"420\":[\"CZ\"],\"421\":[\"SK\"],\"423\":[\"LI\"],\"500\":[\"FK\"],\"501\":[\"BZ\"],\"502\":[\"GT\"],\"503\":[\"SV\"],\"504\":[\"HN\"],\"505\":[\"NI\"],\"506\":[\"CR\"],\"507\":[\"PA\"],\"508\":[\"PM\"],\"509\":[\"HT\"],\"590\":[\"GP\",\"BL\",\"MF\"],\"591\":[\"BO\"],\"592\":[\"GY\"],\"593\":[\"EC\"],\"594\":[\"GF\"],\"595\":[\"PY\"],\"596\":[\"MQ\"],\"597\":[\"SR\"],\"598\":[\"UY\"],\"599\":[\"CW\",\"BQ\"],\"670\":[\"TL\"],\"672\":[\"NF\"],\"673\":[\"BN\"],\"674\":[\"NR\"],\"675\":[\"PG\"],\"676\":[\"TO\"],\"677\":[\"SB\"],\"678\":[\"VU\"],\"679\":[\"FJ\"],\"680\":[\"PW\"],\"681\":[\"WF\"],\"682\":[\"CK\"],\"683\":[\"NU\"],\"685\":[\"WS\"],\"686\":[\"KI\"],\"687\":[\"NC\"],\"688\":[\"TV\"],\"689\":[\"PF\"],\"690\":[\"TK\"],\"691\":[\"FM\"],\"692\":[\"MH\"],\"850\":[\"KP\"],\"852\":[\"HK\"],\"853\":[\"MO\"],\"855\":[\"KH\"],\"856\":[\"LA\"],\"880\":[\"BD\"],\"886\":[\"TW\"],\"960\":[\"MV\"],\"961\":[\"LB\"],\"962\":[\"JO\"],\"963\":[\"SY\"],\"964\":[\"IQ\"],\"965\":[\"KW\"],\"966\":[\"SA\"],\"967\":[\"YE\"],\"968\":[\"OM\"],\"970\":[\"PS\"],\"971\":[\"AE\"],\"972\":[\"IL\"],\"973\":[\"BH\"],\"974\":[\"QA\"],\"975\":[\"BT\"],\"976\":[\"MN\"],\"977\":[\"NP\"],\"992\":[\"TJ\"],\"993\":[\"TM\"],\"994\":[\"AZ\"],\"995\":[\"GE\"],\"996\":[\"KG\"],\"998\":[\"UZ\"]},\"countries\":{\"AC\":[\"247\",\"00\",\"(?:[01589]\\\\d|[46])\\\\d{4}\",[5,6]],\"AD\":[\"376\",\"00\",\"(?:1|6\\\\d)\\\\d{7}|[135-9]\\\\d{5}\",[6,8,9],[[\"(\\\\d{3})(\\\\d{3})\",\"$1 $2\",[\"[135-9]\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"1\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"6\"]]]],\"AE\":[\"971\",\"00\",\"(?:[4-7]\\\\d|9[0-689])\\\\d{7}|800\\\\d{2,9}|[2-4679]\\\\d{7}\",[5,6,7,8,9,10,11,12],[[\"(\\\\d{3})(\\\\d{2,9})\",\"$1 $2\",[\"60|8\"]],[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[236]|[479][2-8]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d)(\\\\d{5})\",\"$1 $2 $3\",[\"[479]\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"5\"],\"0$1\"]],\"0\"],\"AF\":[\"93\",\"00\",\"[2-7]\\\\d{8}\",[9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[2-7]\"],\"0$1\"]],\"0\"],\"AG\":[\"1\",\"011\",\"(?:268|[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([457]\\\\d{6})$\",\"268$1\",0,\"268\"],\"AI\":[\"1\",\"011\",\"(?:264|[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2457]\\\\d{6})$\",\"264$1\",0,\"264\"],\"AL\":[\"355\",\"00\",\"(?:700\\\\d\\\\d|900)\\\\d{3}|8\\\\d{5,7}|(?:[2-5]|6\\\\d)\\\\d{7}\",[6,7,8,9],[[\"(\\\\d{3})(\\\\d{3,4})\",\"$1 $2\",[\"80|9\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"4[2-6]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[2358][2-5]|4\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"[23578]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"6\"],\"0$1\"]],\"0\"],\"AM\":[\"374\",\"00\",\"(?:[1-489]\\\\d|55|60|77)\\\\d{6}\",[8],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"[89]0\"],\"0 $1\"],[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"2|3[12]\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"1|47\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"[3-9]\"],\"0$1\"]],\"0\"],\"AO\":[\"244\",\"00\",\"[29]\\\\d{8}\",[9],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[29]\"]]]],\"AR\":[\"54\",\"00\",\"(?:11|[89]\\\\d\\\\d)\\\\d{8}|[2368]\\\\d{9}\",[10,11],[[\"(\\\\d{4})(\\\\d{2})(\\\\d{4})\",\"$1 $2-$3\",[\"2(?:2[024-9]|3[0-59]|47|6[245]|9[02-8])|3(?:3[28]|4[03-9]|5[2-46-8]|7[1-578]|8[2-9])\",\"2(?:[23]02|6(?:[25]|4[6-8])|9(?:[02356]|4[02568]|72|8[23]))|3(?:3[28]|4(?:[04679]|3[5-8]|5[4-68]|8[2379])|5(?:[2467]|3[237]|8[2-5])|7[1-578]|8(?:[2469]|3[2578]|5[4-8]|7[36-8]|8[5-8]))|2(?:2[24-9]|3[1-59]|47)\",\"2(?:[23]02|6(?:[25]|4(?:64|[78]))|9(?:[02356]|4(?:[0268]|5[2-6])|72|8[23]))|3(?:3[28]|4(?:[04679]|3[78]|5(?:4[46]|8)|8[2379])|5(?:[2467]|3[237]|8[23])|7[1-578]|8(?:[2469]|3[278]|5[56][46]|86[3-6]))|2(?:2[24-9]|3[1-59]|47)|38(?:[58][78]|7[378])|3(?:4[35][56]|58[45]|8(?:[38]5|54|76))[4-6]\",\"2(?:[23]02|6(?:[25]|4(?:64|[78]))|9(?:[02356]|4(?:[0268]|5[2-6])|72|8[23]))|3(?:3[28]|4(?:[04679]|3(?:5(?:4[0-25689]|[56])|[78])|58|8[2379])|5(?:[2467]|3[237]|8(?:[23]|4(?:[45]|60)|5(?:4[0-39]|5|64)))|7[1-578]|8(?:[2469]|3[278]|54(?:4|5[13-7]|6[89])|86[3-6]))|2(?:2[24-9]|3[1-59]|47)|38(?:[58][78]|7[378])|3(?:454|85[56])[46]|3(?:4(?:36|5[56])|8(?:[38]5|76))[4-6]\"],\"0$1\",1],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2-$3\",[\"1\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1-$2-$3\",[\"[68]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2-$3\",[\"[23]\"],\"0$1\",1],[\"(\\\\d)(\\\\d{4})(\\\\d{2})(\\\\d{4})\",\"$2 15-$3-$4\",[\"9(?:2[2-469]|3[3-578])\",\"9(?:2(?:2[024-9]|3[0-59]|47|6[245]|9[02-8])|3(?:3[28]|4[03-9]|5[2-46-8]|7[1-578]|8[2-9]))\",\"9(?:2(?:[23]02|6(?:[25]|4[6-8])|9(?:[02356]|4[02568]|72|8[23]))|3(?:3[28]|4(?:[04679]|3[5-8]|5[4-68]|8[2379])|5(?:[2467]|3[237]|8[2-5])|7[1-578]|8(?:[2469]|3[2578]|5[4-8]|7[36-8]|8[5-8])))|92(?:2[24-9]|3[1-59]|47)\",\"9(?:2(?:[23]02|6(?:[25]|4(?:64|[78]))|9(?:[02356]|4(?:[0268]|5[2-6])|72|8[23]))|3(?:3[28]|4(?:[04679]|3[78]|5(?:4[46]|8)|8[2379])|5(?:[2467]|3[237]|8[23])|7[1-578]|8(?:[2469]|3[278]|5(?:[56][46]|[78])|7[378]|8(?:6[3-6]|[78]))))|92(?:2[24-9]|3[1-59]|47)|93(?:4[35][56]|58[45]|8(?:[38]5|54|76))[4-6]\",\"9(?:2(?:[23]02|6(?:[25]|4(?:64|[78]))|9(?:[02356]|4(?:[0268]|5[2-6])|72|8[23]))|3(?:3[28]|4(?:[04679]|3(?:5(?:4[0-25689]|[56])|[78])|5(?:4[46]|8)|8[2379])|5(?:[2467]|3[237]|8(?:[23]|4(?:[45]|60)|5(?:4[0-39]|5|64)))|7[1-578]|8(?:[2469]|3[278]|5(?:4(?:4|5[13-7]|6[89])|[56][46]|[78])|7[378]|8(?:6[3-6]|[78]))))|92(?:2[24-9]|3[1-59]|47)|93(?:4(?:36|5[56])|8(?:[38]5|76))[4-6]\"],\"0$1\",0,\"$1 $2 $3-$4\"],[\"(\\\\d)(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$2 15-$3-$4\",[\"91\"],\"0$1\",0,\"$1 $2 $3-$4\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{5})\",\"$1-$2-$3\",[\"8\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$2 15-$3-$4\",[\"9\"],\"0$1\",0,\"$1 $2 $3-$4\"]],\"0\",0,\"0?(?:(11|2(?:2(?:02?|[13]|2[13-79]|4[1-6]|5[2457]|6[124-8]|7[1-4]|8[13-6]|9[1267])|3(?:02?|1[467]|2[03-6]|3[13-8]|[49][2-6]|5[2-8]|[67])|4(?:7[3-578]|9)|6(?:[0136]|2[24-6]|4[6-8]?|5[15-8])|80|9(?:0[1-3]|[19]|2\\\\d|3[1-6]|4[02568]?|5[2-4]|6[2-46]|72?|8[23]?))|3(?:3(?:2[79]|6|8[2578])|4(?:0[0-24-9]|[12]|3[5-8]?|4[24-7]|5[4-68]?|6[02-9]|7[126]|8[2379]?|9[1-36-8])|5(?:1|2[1245]|3[237]?|4[1-46-9]|6[2-4]|7[1-6]|8[2-5]?)|6[24]|7(?:[069]|1[1568]|2[15]|3[145]|4[13]|5[14-8]|7[2-57]|8[126])|8(?:[01]|2[15-7]|3[2578]?|4[13-6]|5[4-8]?|6[1-357-9]|7[36-8]?|8[5-8]?|9[124])))15)?\",\"9$1\"],\"AS\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|684|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([267]\\\\d{6})$\",\"684$1\",0,\"684\"],\"AT\":[\"43\",\"00\",\"1\\\\d{3,12}|2\\\\d{6,12}|43(?:(?:0\\\\d|5[02-9])\\\\d{3,9}|2\\\\d{4,5}|[3467]\\\\d{4}|8\\\\d{4,6}|9\\\\d{4,7})|5\\\\d{4,12}|8\\\\d{7,12}|9\\\\d{8,12}|(?:[367]\\\\d|4[0-24-9])\\\\d{4,11}\",[4,5,6,7,8,9,10,11,12,13],[[\"(\\\\d)(\\\\d{3,12})\",\"$1 $2\",[\"1(?:11|[2-9])\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})\",\"$1 $2\",[\"517\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3,5})\",\"$1 $2\",[\"5[079]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3,10})\",\"$1 $2\",[\"(?:31|4)6|51|6(?:5[0-3579]|[6-9])|7(?:20|32|8)|[89]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3,9})\",\"$1 $2\",[\"[2-467]|5[2-6]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"5\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4,7})\",\"$1 $2 $3\",[\"5\"],\"0$1\"]],\"0\"],\"AU\":[\"61\",\"001[14-689]|14(?:1[14]|34|4[17]|[56]6|7[47]|88)0011\",\"1(?:[0-79]\\\\d{7,8}|8[0-24-9]\\\\d{7})|[2-478]\\\\d{8}|1\\\\d{4,7}\",[5,6,7,8,9,10],[[\"(\\\\d{2})(\\\\d{3,4})\",\"$1 $2\",[\"16\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2,4})\",\"$1 $2 $3\",[\"16\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"14|4\"],\"0$1\"],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"[2378]\"],\"(0$1)\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"1(?:30|[89])\"]]],\"0\",0,\"0|(183[12])\",0,0,0,[[\"(?:(?:2(?:[0-26-9]\\\\d|3[0-8]|4[02-9]|5[0135-9])|3(?:[0-3589]\\\\d|4[0-578]|6[1-9]|7[0-35-9])|7(?:[013-57-9]\\\\d|2[0-8]))\\\\d{3}|8(?:51(?:0(?:0[03-9]|[12479]\\\\d|3[2-9]|5[0-8]|6[1-9]|8[0-7])|1(?:[0235689]\\\\d|1[0-69]|4[0-589]|7[0-47-9])|2(?:0[0-79]|[18][13579]|2[14-9]|3[0-46-9]|[4-6]\\\\d|7[89]|9[0-4]))|(?:6[0-8]|[78]\\\\d)\\\\d{3}|9(?:[02-9]\\\\d{3}|1(?:(?:[0-58]\\\\d|6[0135-9])\\\\d|7(?:0[0-24-9]|[1-9]\\\\d)|9(?:[0-46-9]\\\\d|5[0-79])))))\\\\d{3}\",[9]],[\"4(?:83[0-38]|93[0-4])\\\\d{5}|4(?:[0-3]\\\\d|4[047-9]|5[0-25-9]|6[06-9]|7[02-9]|8[0-24-9]|9[0-27-9])\\\\d{6}\",[9]],[\"180(?:0\\\\d{3}|2)\\\\d{3}\",[7,10]],[\"190[0-26]\\\\d{6}\",[10]],0,0,0,[\"163\\\\d{2,6}\",[5,6,7,8,9]],[\"14(?:5(?:1[0458]|[23][458])|71\\\\d)\\\\d{4}\",[9]],[\"13(?:00\\\\d{3}|45[0-4])\\\\d{3}|13\\\\d{4}\",[6,8,10]]],\"0011\"],\"AW\":[\"297\",\"00\",\"(?:[25-79]\\\\d\\\\d|800)\\\\d{4}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[25-9]\"]]]],\"AX\":[\"358\",\"00|99(?:[01469]|5(?:[14]1|3[23]|5[59]|77|88|9[09]))\",\"2\\\\d{4,9}|35\\\\d{4,5}|(?:60\\\\d\\\\d|800)\\\\d{4,6}|7\\\\d{5,11}|(?:[14]\\\\d|3[0-46-9]|50)\\\\d{4,8}\",[5,6,7,8,9,10,11,12],0,\"0\",0,0,0,0,\"18\",0,\"00\"],\"AZ\":[\"994\",\"00\",\"365\\\\d{6}|(?:[124579]\\\\d|60|88)\\\\d{7}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"90\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"1[28]|2|365|46\",\"1[28]|2|365|46\",\"1[28]|2|365(?:[0-46-9]|5[0-35-9])|46\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[13-9]\"],\"0$1\"]],\"0\"],\"BA\":[\"387\",\"00\",\"6\\\\d{8}|(?:[35689]\\\\d|49|70)\\\\d{6}\",[8,9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"6[1-3]|[7-9]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2-$3\",[\"[3-5]|6[56]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"6\"],\"0$1\"]],\"0\"],\"BB\":[\"1\",\"011\",\"(?:246|[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-9]\\\\d{6})$\",\"246$1\",0,\"246\"],\"BD\":[\"880\",\"00\",\"1\\\\d{9}|2\\\\d{7,8}|88\\\\d{4,6}|(?:8[0-79]|9\\\\d)\\\\d{4,8}|(?:[346]\\\\d|[57])\\\\d{5,8}\",[6,7,8,9,10],[[\"(\\\\d{2})(\\\\d{4,6})\",\"$1-$2\",[\"31[5-8]|[459]1\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3,7})\",\"$1-$2\",[\"3(?:[67]|8[013-9])|4(?:6[168]|7|[89][18])|5(?:6[128]|9)|6(?:28|4[14]|5)|7[2-589]|8(?:0[014-9]|[12])|9[358]|(?:3[2-5]|4[235]|5[2-578]|6[0389]|76|8[3-7]|9[24])1|(?:44|66)[01346-9]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3,6})\",\"$1-$2\",[\"[13-9]\"],\"0$1\"],[\"(\\\\d)(\\\\d{7,8})\",\"$1-$2\",[\"2\"],\"0$1\"]],\"0\"],\"BE\":[\"32\",\"00\",\"4\\\\d{8}|[1-9]\\\\d{7}\",[8,9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"(?:80|9)0\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[239]|4[23]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[15-8]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"4\"],\"0$1\"]],\"0\"],\"BF\":[\"226\",\"00\",\"[025-7]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[025-7]\"]]]],\"BG\":[\"359\",\"00\",\"[2-7]\\\\d{6,7}|[89]\\\\d{6,8}|2\\\\d{5}\",[6,7,8,9],[[\"(\\\\d)(\\\\d)(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"2\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"43[1-6]|70[1-9]\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"2\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2,3})\",\"$1 $2 $3\",[\"[356]|4[124-7]|7[1-9]|8[1-6]|9[1-7]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"(?:70|8)0\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{2})\",\"$1 $2 $3\",[\"43[1-7]|7\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[48]|9[08]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"9\"],\"0$1\"]],\"0\"],\"BH\":[\"973\",\"00\",\"[136-9]\\\\d{7}\",[8],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[13679]|8[047]\"]]]],\"BI\":[\"257\",\"00\",\"(?:[267]\\\\d|31)\\\\d{6}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[2367]\"]]]],\"BJ\":[\"229\",\"00\",\"[25689]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[25689]\"]]]],\"BL\":[\"590\",\"00\",\"(?:590|(?:69|80)\\\\d|976)\\\\d{6}\",[9],0,\"0\",0,0,0,0,0,[[\"590(?:2[7-9]|5[12]|87)\\\\d{4}\"],[\"69(?:0\\\\d\\\\d|1(?:2[2-9]|3[0-5]))\\\\d{4}\"],[\"80[0-5]\\\\d{6}\"],0,0,0,0,0,[\"976[01]\\\\d{5}\"]]],\"BM\":[\"1\",\"011\",\"(?:441|[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-8]\\\\d{6})$\",\"441$1\",0,\"441\"],\"BN\":[\"673\",\"00\",\"[2-578]\\\\d{6}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[2-578]\"]]]],\"BO\":[\"591\",\"00(?:1\\\\d)?\",\"(?:[2-467]\\\\d\\\\d|8001)\\\\d{5}\",[8,9],[[\"(\\\\d)(\\\\d{7})\",\"$1 $2\",[\"[23]|4[46]\"]],[\"(\\\\d{8})\",\"$1\",[\"[67]\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{4})\",\"$1 $2 $3\",[\"8\"]]],\"0\",0,\"0(1\\\\d)?\"],\"BQ\":[\"599\",\"00\",\"(?:[34]1|7\\\\d)\\\\d{5}\",[7],0,0,0,0,0,0,\"[347]\"],\"BR\":[\"55\",\"00(?:1[245]|2[1-35]|31|4[13]|[56]5|99)\",\"(?:[1-46-9]\\\\d\\\\d|5(?:[0-46-9]\\\\d|5[0-24679]))\\\\d{8}|[1-9]\\\\d{9}|[3589]\\\\d{8}|[34]\\\\d{7}\",[8,9,10,11],[[\"(\\\\d{4})(\\\\d{4})\",\"$1-$2\",[\"300|4(?:0[02]|37)\",\"4(?:02|37)0|[34]00\"]],[\"(\\\\d{3})(\\\\d{2,3})(\\\\d{4})\",\"$1 $2 $3\",[\"(?:[358]|90)0\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2-$3\",[\"(?:[14689][1-9]|2[12478]|3[1-578]|5[13-5]|7[13-579])[2-57]\"],\"($1)\"],[\"(\\\\d{2})(\\\\d{5})(\\\\d{4})\",\"$1 $2-$3\",[\"[16][1-9]|[2-57-9]\"],\"($1)\"]],\"0\",0,\"(?:0|90)(?:(1[245]|2[1-35]|31|4[13]|[56]5|99)(\\\\d{10,11}))?\",\"$2\"],\"BS\":[\"1\",\"011\",\"(?:242|[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([3-8]\\\\d{6})$\",\"242$1\",0,\"242\"],\"BT\":[\"975\",\"00\",\"[17]\\\\d{7}|[2-8]\\\\d{6}\",[7,8],[[\"(\\\\d)(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[2-68]|7[246]\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"1[67]|7\"]]]],\"BW\":[\"267\",\"00\",\"(?:0800|(?:[37]|800)\\\\d)\\\\d{6}|(?:[2-6]\\\\d|90)\\\\d{5}\",[7,8,10],[[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"90\"]],[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[24-6]|3[15-79]\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[37]\"]],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"0\"]],[\"(\\\\d{3})(\\\\d{4})(\\\\d{3})\",\"$1 $2 $3\",[\"8\"]]]],\"BY\":[\"375\",\"810\",\"(?:[12]\\\\d|33|44|902)\\\\d{7}|8(?:0[0-79]\\\\d{5,7}|[1-7]\\\\d{9})|8(?:1[0-489]|[5-79]\\\\d)\\\\d{7}|8[1-79]\\\\d{6,7}|8[0-79]\\\\d{5}|8\\\\d{5}\",[6,7,8,9,10,11],[[\"(\\\\d{3})(\\\\d{3})\",\"$1 $2\",[\"800\"],\"8 $1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2,4})\",\"$1 $2 $3\",[\"800\"],\"8 $1\"],[\"(\\\\d{4})(\\\\d{2})(\\\\d{3})\",\"$1 $2-$3\",[\"1(?:5[169]|6[3-5]|7[179])|2(?:1[35]|2[34]|3[3-5])\",\"1(?:5[169]|6(?:3[1-3]|4|5[125])|7(?:1[3-9]|7[0-24-6]|9[2-7]))|2(?:1[35]|2[34]|3[3-5])\"],\"8 0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2-$3-$4\",[\"1(?:[56]|7[467])|2[1-3]\"],\"8 0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2-$3-$4\",[\"[1-4]\"],\"8 0$1\"],[\"(\\\\d{3})(\\\\d{3,4})(\\\\d{4})\",\"$1 $2 $3\",[\"[89]\"],\"8 $1\"]],\"8\",0,\"0|80?\",0,0,0,0,\"8~10\"],\"BZ\":[\"501\",\"00\",\"(?:0800\\\\d|[2-8])\\\\d{6}\",[7,11],[[\"(\\\\d{3})(\\\\d{4})\",\"$1-$2\",[\"[2-8]\"]],[\"(\\\\d)(\\\\d{3})(\\\\d{4})(\\\\d{3})\",\"$1-$2-$3-$4\",[\"0\"]]]],\"CA\":[\"1\",\"011\",\"(?:[2-8]\\\\d|90)\\\\d{8}\",[10],0,\"1\",0,0,0,0,0,[[\"(?:2(?:04|[23]6|[48]9|50)|3(?:06|43|6[578])|4(?:03|1[68]|3[178]|50|74)|5(?:06|1[49]|48|79|8[17])|6(?:04|13|39|47|72)|7(?:0[59]|78|8[02])|8(?:[06]7|19|25|73)|90[25])[2-9]\\\\d{6}\"],[\"\"],[\"8(?:00|33|44|55|66|77|88)[2-9]\\\\d{6}\"],[\"900[2-9]\\\\d{6}\"],[\"52(?:3(?:[2-46-9][02-9]\\\\d|5(?:[02-46-9]\\\\d|5[0-46-9]))|4(?:[2-478][02-9]\\\\d|5(?:[034]\\\\d|2[024-9]|5[0-46-9])|6(?:0[1-9]|[2-9]\\\\d)|9(?:[05-9]\\\\d|2[0-5]|49)))\\\\d{4}|52[34][2-9]1[02-9]\\\\d{4}|(?:5(?:00|2[12]|33|44|66|77|88)|622)[2-9]\\\\d{6}\"],0,0,0,[\"600[2-9]\\\\d{6}\"]]],\"CC\":[\"61\",\"001[14-689]|14(?:1[14]|34|4[17]|[56]6|7[47]|88)0011\",\"1(?:[0-79]\\\\d|8[0-24-9])\\\\d{7}|[148]\\\\d{8}|1\\\\d{5,7}\",[6,7,8,9,10],0,\"0\",0,\"0|([59]\\\\d{7})$\",\"8$1\",0,0,[[\"8(?:51(?:0(?:02|31|60|89)|1(?:18|76)|223)|91(?:0(?:1[0-2]|29)|1(?:[28]2|50|79)|2(?:10|64)|3(?:[06]8|22)|4[29]8|62\\\\d|70[23]|959))\\\\d{3}\",[9]],[\"4(?:83[0-38]|93[0-4])\\\\d{5}|4(?:[0-3]\\\\d|4[047-9]|5[0-25-9]|6[06-9]|7[02-9]|8[0-24-9]|9[0-27-9])\\\\d{6}\",[9]],[\"180(?:0\\\\d{3}|2)\\\\d{3}\",[7,10]],[\"190[0-26]\\\\d{6}\",[10]],0,0,0,0,[\"14(?:5(?:1[0458]|[23][458])|71\\\\d)\\\\d{4}\",[9]],[\"13(?:00\\\\d{3}|45[0-4])\\\\d{3}|13\\\\d{4}\",[6,8,10]]],\"0011\"],\"CD\":[\"243\",\"00\",\"[189]\\\\d{8}|[1-68]\\\\d{6}\",[7,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"88\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"[1-6]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[89]\"],\"0$1\"]],\"0\"],\"CF\":[\"236\",\"00\",\"(?:[27]\\\\d{3}|8776)\\\\d{4}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[278]\"]]]],\"CG\":[\"242\",\"00\",\"222\\\\d{6}|(?:0\\\\d|80)\\\\d{7}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"801\"]],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"8\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[02]\"]]]],\"CH\":[\"41\",\"00\",\"8\\\\d{11}|[2-9]\\\\d{8}\",[9],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"8[047]|90\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[2-79]|81\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4 $5\",[\"8\"],\"0$1\"]],\"0\"],\"CI\":[\"225\",\"00\",\"[02]\\\\d{9}\",[10],[[\"(\\\\d{2})(\\\\d{2})(\\\\d)(\\\\d{5})\",\"$1 $2 $3 $4\",[\"2\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{4})\",\"$1 $2 $3 $4\",[\"0\"]]]],\"CK\":[\"682\",\"00\",\"[2-578]\\\\d{4}\",[5],[[\"(\\\\d{2})(\\\\d{3})\",\"$1 $2\",[\"[2-578]\"]]]],\"CL\":[\"56\",\"(?:0|1(?:1[0-69]|2[02-5]|5[13-58]|69|7[0167]|8[018]))0\",\"12300\\\\d{6}|6\\\\d{9,10}|[2-9]\\\\d{8}\",[9,10,11],[[\"(\\\\d{5})(\\\\d{4})\",\"$1 $2\",[\"219\",\"2196\"],\"($1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"44\"]],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"2[1-3]\"],\"($1)\"],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"9[2-9]\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"3[2-5]|[47]|5[1-3578]|6[13-57]|8(?:0[1-9]|[1-9])\"],\"($1)\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"60|8\"]],[\"(\\\\d{4})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"60\"]]]],\"CM\":[\"237\",\"00\",\"[26]\\\\d{8}|88\\\\d{6,7}\",[8,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"88\"]],[\"(\\\\d)(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4 $5\",[\"[26]|88\"]]]],\"CN\":[\"86\",\"00|1(?:[12]\\\\d|79)\\\\d\\\\d00\",\"1[127]\\\\d{8,9}|2\\\\d{9}(?:\\\\d{2})?|[12]\\\\d{6,7}|86\\\\d{6}|(?:1[03-689]\\\\d|6)\\\\d{7,9}|(?:[3-579]\\\\d|8[0-57-9])\\\\d{6,9}\",[7,8,9,10,11,12],[[\"(\\\\d{2})(\\\\d{5,6})\",\"$1 $2\",[\"(?:10|2[0-57-9])[19]\",\"(?:10|2[0-57-9])(?:10|9[56])\",\"(?:10|2[0-57-9])(?:100|9[56])\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{5,6})\",\"$1 $2\",[\"3(?:[157]|35|49|9[1-68])|4(?:[17]|2[179]|6[47-9]|8[23])|5(?:[1357]|2[37]|4[36]|6[1-46]|80)|6(?:3[1-5]|6[0238]|9[12])|7(?:01|[1579]|2[248]|3[014-9]|4[3-6]|6[023689])|8(?:1[236-8]|2[5-7]|[37]|8[36-8]|9[1-8])|9(?:0[1-3689]|1[1-79]|[379]|4[13]|5[1-5])|(?:4[35]|59|85)[1-9]\",\"(?:3(?:[157]\\\\d|35|49|9[1-68])|4(?:[17]\\\\d|2[179]|[35][1-9]|6[47-9]|8[23])|5(?:[1357]\\\\d|2[37]|4[36]|6[1-46]|80|9[1-9])|6(?:3[1-5]|6[0238]|9[12])|7(?:01|[1579]\\\\d|2[248]|3[014-9]|4[3-6]|6[023689])|8(?:1[236-8]|2[5-7]|[37]\\\\d|5[1-9]|8[36-8]|9[1-8])|9(?:0[1-3689]|1[1-79]|[379]\\\\d|4[13]|5[1-5]))[19]\",\"85[23](?:10|95)|(?:3(?:[157]\\\\d|35|49|9[1-68])|4(?:[17]\\\\d|2[179]|[35][1-9]|6[47-9]|8[23])|5(?:[1357]\\\\d|2[37]|4[36]|6[1-46]|80|9[1-9])|6(?:3[1-5]|6[0238]|9[12])|7(?:01|[1579]\\\\d|2[248]|3[014-9]|4[3-6]|6[023689])|8(?:1[236-8]|2[5-7]|[37]\\\\d|5[14-9]|8[36-8]|9[1-8])|9(?:0[1-3689]|1[1-79]|[379]\\\\d|4[13]|5[1-5]))(?:10|9[56])\",\"85[23](?:100|95)|(?:3(?:[157]\\\\d|35|49|9[1-68])|4(?:[17]\\\\d|2[179]|[35][1-9]|6[47-9]|8[23])|5(?:[1357]\\\\d|2[37]|4[36]|6[1-46]|80|9[1-9])|6(?:3[1-5]|6[0238]|9[12])|7(?:01|[1579]\\\\d|2[248]|3[014-9]|4[3-6]|6[023689])|8(?:1[236-8]|2[5-7]|[37]\\\\d|5[14-9]|8[36-8]|9[1-8])|9(?:0[1-3689]|1[1-79]|[379]\\\\d|4[13]|5[1-5]))(?:100|9[56])\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"(?:4|80)0\"]],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"10|2(?:[02-57-9]|1[1-9])\",\"10|2(?:[02-57-9]|1[1-9])\",\"10[0-79]|2(?:[02-57-9]|1[1-79])|(?:10|21)8(?:0[1-9]|[1-9])\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"3(?:[3-59]|7[02-68])|4(?:[26-8]|3[3-9]|5[2-9])|5(?:3[03-9]|[468]|7[028]|9[2-46-9])|6|7(?:[0-247]|3[04-9]|5[0-4689]|6[2368])|8(?:[1-358]|9[1-7])|9(?:[013479]|5[1-5])|(?:[34]1|55|79|87)[02-9]\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{7,8})\",\"$1 $2\",[\"9\"]],[\"(\\\\d{4})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"80\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"[3-578]\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"1[3-9]\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3 $4\",[\"[12]\"],\"0$1\",1]],\"0\",0,\"0|(1(?:[12]\\\\d|79)\\\\d\\\\d)\",0,0,0,0,\"00\"],\"CO\":[\"57\",\"00(?:4(?:[14]4|56)|[579])\",\"(?:1\\\\d|3)\\\\d{9}|[124-8]\\\\d{7}\",[8,10,11],[[\"(\\\\d)(\\\\d{7})\",\"$1 $2\",[\"[14][2-9]|[25-8]\"],\"($1)\"],[\"(\\\\d{3})(\\\\d{7})\",\"$1 $2\",[\"3\"]],[\"(\\\\d)(\\\\d{3})(\\\\d{7})\",\"$1-$2-$3\",[\"1\"],\"0$1\",0,\"$1 $2 $3\"]],\"0\",0,\"0([3579]|4(?:[14]4|56))?\"],\"CR\":[\"506\",\"00\",\"(?:8\\\\d|90)\\\\d{8}|(?:[24-8]\\\\d{3}|3005)\\\\d{4}\",[8,10],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[2-7]|8[3-9]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1-$2-$3\",[\"[89]\"]]],0,0,\"(19(?:0[0-2468]|1[09]|20|66|77|99))\"],\"CU\":[\"53\",\"119\",\"[27]\\\\d{6,7}|[34]\\\\d{5,7}|(?:5|8\\\\d\\\\d)\\\\d{7}\",[6,7,8,10],[[\"(\\\\d{2})(\\\\d{4,6})\",\"$1 $2\",[\"2[1-4]|[34]\"],\"(0$1)\"],[\"(\\\\d)(\\\\d{6,7})\",\"$1 $2\",[\"7\"],\"(0$1)\"],[\"(\\\\d)(\\\\d{7})\",\"$1 $2\",[\"5\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{7})\",\"$1 $2\",[\"8\"],\"0$1\"]],\"0\"],\"CV\":[\"238\",\"0\",\"(?:[2-59]\\\\d\\\\d|800)\\\\d{4}\",[7],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"[2-589]\"]]]],\"CW\":[\"599\",\"00\",\"(?:[34]1|60|(?:7|9\\\\d)\\\\d)\\\\d{5}\",[7,8],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[3467]\"]],[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"9[4-8]\"]]],0,0,0,0,0,\"[69]\"],\"CX\":[\"61\",\"001[14-689]|14(?:1[14]|34|4[17]|[56]6|7[47]|88)0011\",\"1(?:[0-79]\\\\d|8[0-24-9])\\\\d{7}|[148]\\\\d{8}|1\\\\d{5,7}\",[6,7,8,9,10],0,\"0\",0,\"0|([59]\\\\d{7})$\",\"8$1\",0,0,[[\"8(?:51(?:0(?:01|30|59|88)|1(?:17|46|75)|2(?:22|35))|91(?:00[6-9]|1(?:[28]1|49|78)|2(?:09|63)|3(?:12|26|75)|4(?:56|97)|64\\\\d|7(?:0[01]|1[0-2])|958))\\\\d{3}\",[9]],[\"4(?:83[0-38]|93[0-4])\\\\d{5}|4(?:[0-3]\\\\d|4[047-9]|5[0-25-9]|6[06-9]|7[02-9]|8[0-24-9]|9[0-27-9])\\\\d{6}\",[9]],[\"180(?:0\\\\d{3}|2)\\\\d{3}\",[7,10]],[\"190[0-26]\\\\d{6}\",[10]],0,0,0,0,[\"14(?:5(?:1[0458]|[23][458])|71\\\\d)\\\\d{4}\",[9]],[\"13(?:00\\\\d{3}|45[0-4])\\\\d{3}|13\\\\d{4}\",[6,8,10]]],\"0011\"],\"CY\":[\"357\",\"00\",\"(?:[279]\\\\d|[58]0)\\\\d{6}\",[8],[[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"[257-9]\"]]]],\"CZ\":[\"420\",\"00\",\"(?:[2-578]\\\\d|60)\\\\d{7}|9\\\\d{8,11}\",[9],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[2-8]|9[015-7]\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"9\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"9\"]]]],\"DE\":[\"49\",\"00\",\"[2579]\\\\d{5,14}|49(?:[34]0|69|8\\\\d)\\\\d\\\\d?|49(?:37|49|60|7[089]|9\\\\d)\\\\d{1,3}|49(?:[12]\\\\d|3[2-689]|7[1-7])\\\\d{1,8}|(?:1|[368]\\\\d|4[0-8])\\\\d{3,13}|49(?:[05]\\\\d|31|[46][1-8])\\\\d{1,9}\",[4,5,6,7,8,9,10,11,12,13,14,15],[[\"(\\\\d{2})(\\\\d{3,13})\",\"$1 $2\",[\"3[02]|40|[68]9\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3,12})\",\"$1 $2\",[\"2(?:0[1-389]|1[124]|2[18]|3[14])|3(?:[35-9][15]|4[015])|906|(?:2[4-9]|4[2-9]|[579][1-9]|[68][1-8])1\",\"2(?:0[1-389]|12[0-8])|3(?:[35-9][15]|4[015])|906|2(?:[13][14]|2[18])|(?:2[4-9]|4[2-9]|[579][1-9]|[68][1-8])1\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{2,11})\",\"$1 $2\",[\"[24-6]|3(?:[3569][02-46-9]|4[2-4679]|7[2-467]|8[2-46-8])|70[2-8]|8(?:0[2-9]|[1-8])|90[7-9]|[79][1-9]\",\"[24-6]|3(?:3(?:0[1-467]|2[127-9]|3[124578]|7[1257-9]|8[1256]|9[145])|4(?:2[135]|4[13578]|9[1346])|5(?:0[14]|2[1-3589]|6[1-4]|7[13468]|8[13568])|6(?:2[1-489]|3[124-6]|6[13]|7[12579]|8[1-356]|9[135])|7(?:2[1-7]|4[145]|6[1-5]|7[1-4])|8(?:21|3[1468]|6|7[1467]|8[136])|9(?:0[12479]|2[1358]|4[134679]|6[1-9]|7[136]|8[147]|9[1468]))|70[2-8]|8(?:0[2-9]|[1-8])|90[7-9]|[79][1-9]|3[68]4[1347]|3(?:47|60)[1356]|3(?:3[46]|46|5[49])[1246]|3[4579]3[1357]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"138\"],\"0$1\"],[\"(\\\\d{5})(\\\\d{2,10})\",\"$1 $2\",[\"3\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{5,11})\",\"$1 $2\",[\"181\"],\"0$1\"],[\"(\\\\d{3})(\\\\d)(\\\\d{4,10})\",\"$1 $2 $3\",[\"1(?:3|80)|9\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{7,8})\",\"$1 $2\",[\"1[67]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{7,12})\",\"$1 $2\",[\"8\"],\"0$1\"],[\"(\\\\d{5})(\\\\d{6})\",\"$1 $2\",[\"185\",\"1850\",\"18500\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"7\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{7})\",\"$1 $2\",[\"18[68]\"],\"0$1\"],[\"(\\\\d{5})(\\\\d{6})\",\"$1 $2\",[\"15[0568]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{7})\",\"$1 $2\",[\"15[1279]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{8})\",\"$1 $2\",[\"18\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{7,8})\",\"$1 $2 $3\",[\"1(?:6[023]|7)\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{2})(\\\\d{7})\",\"$1 $2 $3\",[\"15[279]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{8})\",\"$1 $2 $3\",[\"15\"],\"0$1\"]],\"0\"],\"DJ\":[\"253\",\"00\",\"(?:2\\\\d|77)\\\\d{6}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[27]\"]]]],\"DK\":[\"45\",\"00\",\"[2-9]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[2-9]\"]]]],\"DM\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|767|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-7]\\\\d{6})$\",\"767$1\",0,\"767\"],\"DO\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,0,0,0,\"8001|8[024]9\"],\"DZ\":[\"213\",\"00\",\"(?:[1-4]|[5-79]\\\\d|80)\\\\d{7}\",[8,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[1-4]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"9\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[5-8]\"],\"0$1\"]],\"0\"],\"EC\":[\"593\",\"00\",\"1\\\\d{9,10}|(?:[2-7]|9\\\\d)\\\\d{7}\",[8,9,10,11],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2-$3\",[\"[2-7]\"],\"(0$1)\",0,\"$1-$2-$3\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"9\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"1\"]]],\"0\"],\"EE\":[\"372\",\"00\",\"8\\\\d{9}|[4578]\\\\d{7}|(?:[3-8]\\\\d|90)\\\\d{5}\",[7,8,10],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[369]|4[3-8]|5(?:[0-2]|5[0-478]|6[45])|7[1-9]|88\",\"[369]|4[3-8]|5(?:[02]|1(?:[0-8]|95)|5[0-478]|6(?:4[0-4]|5[1-589]))|7[1-9]|88\"]],[\"(\\\\d{4})(\\\\d{3,4})\",\"$1 $2\",[\"[45]|8(?:00|[1-49])\",\"[45]|8(?:00[1-9]|[1-49])\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{4})\",\"$1 $2 $3\",[\"7\"]],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"8\"]]]],\"EG\":[\"20\",\"00\",\"[189]\\\\d{8,9}|[24-6]\\\\d{8}|[135]\\\\d{7}\",[8,9,10],[[\"(\\\\d)(\\\\d{7,8})\",\"$1 $2\",[\"[23]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{6,7})\",\"$1 $2\",[\"1[35]|[4-6]|8[2468]|9[235-7]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[189]\"],\"0$1\"]],\"0\"],\"EH\":[\"212\",\"00\",\"[5-8]\\\\d{8}\",[9],0,\"0\",0,0,0,0,\"528[89]\"],\"ER\":[\"291\",\"00\",\"[178]\\\\d{6}\",[7],[[\"(\\\\d)(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[178]\"],\"0$1\"]],\"0\"],\"ES\":[\"34\",\"00\",\"[5-9]\\\\d{8}\",[9],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[89]00\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[5-9]\"]]]],\"ET\":[\"251\",\"00\",\"(?:11|[2-59]\\\\d)\\\\d{7}\",[9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[1-59]\"],\"0$1\"]],\"0\"],\"FI\":[\"358\",\"00|99(?:[01469]|5(?:[14]1|3[23]|5[59]|77|88|9[09]))\",\"[1-35689]\\\\d{4}|7\\\\d{10,11}|(?:[124-7]\\\\d|3[0-46-9])\\\\d{8}|[1-9]\\\\d{5,8}\",[5,6,7,8,9,10,11,12],[[\"(\\\\d)(\\\\d{4,9})\",\"$1 $2\",[\"[2568][1-8]|3(?:0[1-9]|[1-9])|9\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3,7})\",\"$1 $2\",[\"[12]00|[368]|70[07-9]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4,8})\",\"$1 $2\",[\"[1245]|7[135]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{6,10})\",\"$1 $2\",[\"7\"],\"0$1\"]],\"0\",0,0,0,0,\"1[03-79]|[2-9]\",0,\"00\"],\"FJ\":[\"679\",\"0(?:0|52)\",\"45\\\\d{5}|(?:0800\\\\d|[235-9])\\\\d{6}\",[7,11],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[235-9]|45\"]],[\"(\\\\d{4})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"0\"]]],0,0,0,0,0,0,0,\"00\"],\"FK\":[\"500\",\"00\",\"[2-7]\\\\d{4}\",[5]],\"FM\":[\"691\",\"00\",\"(?:[39]\\\\d\\\\d|820)\\\\d{4}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[389]\"]]]],\"FO\":[\"298\",\"00\",\"[2-9]\\\\d{5}\",[6],[[\"(\\\\d{6})\",\"$1\",[\"[2-9]\"]]],0,0,\"(10(?:01|[12]0|88))\"],\"FR\":[\"33\",\"00\",\"[1-9]\\\\d{8}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"8\"],\"0 $1\"],[\"(\\\\d)(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4 $5\",[\"[1-79]\"],\"0$1\"]],\"0\"],\"GA\":[\"241\",\"00\",\"(?:[067]\\\\d|11)\\\\d{6}|[2-7]\\\\d{6}\",[7,8],[[\"(\\\\d)(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[2-7]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"11|[67]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"0\"]]],0,0,\"0(11\\\\d{6}|6[256]\\\\d{6}|7[47]\\\\d{6})\",\"$1\"],\"GB\":[\"44\",\"00\",\"[1-357-9]\\\\d{9}|[18]\\\\d{8}|8\\\\d{6}\",[7,9,10],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"800\",\"8001\",\"80011\",\"800111\",\"8001111\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"845\",\"8454\",\"84546\",\"845464\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{6})\",\"$1 $2\",[\"800\"],\"0$1\"],[\"(\\\\d{5})(\\\\d{4,5})\",\"$1 $2\",[\"1(?:38|5[23]|69|76|94)\",\"1(?:(?:38|69)7|5(?:24|39)|768|946)\",\"1(?:3873|5(?:242|39[4-6])|(?:697|768)[347]|9467)\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{5,6})\",\"$1 $2\",[\"1(?:[2-69][02-9]|[78])\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"[25]|7(?:0|6[02-9])\",\"[25]|7(?:0|6(?:[03-9]|2[356]))\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{6})\",\"$1 $2\",[\"7\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[1389]\"],\"0$1\"]],\"0\",0,0,0,0,0,[[\"(?:1(?:1(?:3(?:[0-58]\\\\d\\\\d|73[023])|4(?:[0-5]\\\\d\\\\d|69[7-9]|70[059])|(?:5[0-26-9]|[78][0-49])\\\\d\\\\d|6(?:[0-4]\\\\d\\\\d|50[259]))|2(?:(?:0[024-9]|2[3-9]|3[3-79]|4[1-689]|[58][02-9]|6[0-47-9]|7[013-9]|9\\\\d)\\\\d\\\\d|1(?:[0-7]\\\\d\\\\d|8(?:[02]\\\\d|1[278])))|(?:3(?:0\\\\d|1[0-8]|[25][02-9]|3[02-579]|[468][0-46-9]|7[1-35-79]|9[2-578])|4(?:0[03-9]|[137]\\\\d|[28][02-57-9]|4[02-69]|5[0-8]|[69][0-79])|5(?:0[1-35-9]|[16]\\\\d|2[024-9]|3[015689]|4[02-9]|5[03-9]|7[0-35-9]|8[0-468]|9[0-57-9])|6(?:0[034689]|1\\\\d|2[0-35689]|[38][013-9]|4[1-467]|5[0-69]|6[13-9]|7[0-8]|9[0-24578])|7(?:0[0246-9]|2\\\\d|3[0236-8]|4[03-9]|5[0-46-9]|6[013-9]|7[0-35-9]|8[024-9]|9[02-9])|8(?:0[35-9]|2[1-57-9]|3[02-578]|4[0-578]|5[124-9]|6[2-69]|7\\\\d|8[02-9]|9[02569])|9(?:0[02-589]|[18]\\\\d|2[02-689]|3[1-57-9]|4[2-9]|5[0-579]|6[2-47-9]|7[0-24578]|9[2-57]))\\\\d\\\\d)|2(?:0[013478]|3[0189]|4[017]|8[0-46-9]|9[0-2])\\\\d{3})\\\\d{4}|1(?:2(?:0(?:46[1-4]|87[2-9])|545[1-79]|76(?:2\\\\d|3[1-8]|6[1-6])|9(?:7(?:2[0-4]|3[2-5])|8(?:2[2-8]|7[0-47-9]|8[3-5])))|3(?:6(?:38[2-5]|47[23])|8(?:47[04-9]|64[0157-9]))|4(?:044[1-7]|20(?:2[23]|8\\\\d)|6(?:0(?:30|5[2-57]|6[1-8]|7[2-8])|140)|8(?:052|87[1-3]))|5(?:2(?:4(?:3[2-79]|6\\\\d)|76\\\\d)|6(?:26[06-9]|686))|6(?:06(?:4\\\\d|7[4-79])|295[5-7]|35[34]\\\\d|47(?:24|61)|59(?:5[08]|6[67]|74)|9(?:55[0-4]|77[23]))|7(?:26(?:6[13-9]|7[0-7])|(?:442|688)\\\\d|50(?:2[0-3]|[3-68]2|76))|8(?:27[56]\\\\d|37(?:5[2-5]|8[239])|843[2-58])|9(?:0(?:0(?:6[1-8]|85)|52\\\\d)|3583|4(?:66[1-8]|9(?:2[01]|81))|63(?:23|3[1-4])|9561))\\\\d{3}\",[9,10]],[\"7(?:457[0-57-9]|700[01]|911[028])\\\\d{5}|7(?:[1-3]\\\\d\\\\d|4(?:[0-46-9]\\\\d|5[0-689])|5(?:0[0-8]|[13-9]\\\\d|2[0-35-9])|7(?:0[1-9]|[1-7]\\\\d|8[02-9]|9[0-689])|8(?:[014-9]\\\\d|[23][0-8])|9(?:[024-9]\\\\d|1[02-9]|3[0-689]))\\\\d{6}\",[10]],[\"80[08]\\\\d{7}|800\\\\d{6}|8001111\"],[\"(?:8(?:4[2-5]|7[0-3])|9(?:[01]\\\\d|8[2-49]))\\\\d{7}|845464\\\\d\",[7,10]],[\"70\\\\d{8}\",[10]],0,[\"(?:3[0347]|55)\\\\d{8}\",[10]],[\"76(?:464|652)\\\\d{5}|76(?:0[0-2]|2[356]|34|4[01347]|5[49]|6[0-369]|77|81|9[139])\\\\d{6}\",[10]],[\"56\\\\d{8}\",[10]]],0,\" x\"],\"GD\":[\"1\",\"011\",\"(?:473|[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-9]\\\\d{6})$\",\"473$1\",0,\"473\"],\"GE\":[\"995\",\"00\",\"(?:[3-57]\\\\d\\\\d|800)\\\\d{6}\",[9],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"70\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"32\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[57]\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[348]\"],\"0$1\"]],\"0\"],\"GF\":[\"594\",\"00\",\"(?:[56]94|80\\\\d|976)\\\\d{6}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[569]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"8\"],\"0$1\"]],\"0\"],\"GG\":[\"44\",\"00\",\"(?:1481|[357-9]\\\\d{3})\\\\d{6}|8\\\\d{6}(?:\\\\d{2})?\",[7,9,10],0,\"0\",0,\"0|([25-9]\\\\d{5})$\",\"1481$1\",0,0,[[\"1481[25-9]\\\\d{5}\",[10]],[\"7(?:(?:781|839)\\\\d|911[17])\\\\d{5}\",[10]],[\"80[08]\\\\d{7}|800\\\\d{6}|8001111\"],[\"(?:8(?:4[2-5]|7[0-3])|9(?:[01]\\\\d|8[0-3]))\\\\d{7}|845464\\\\d\",[7,10]],[\"70\\\\d{8}\",[10]],0,[\"(?:3[0347]|55)\\\\d{8}\",[10]],[\"76(?:464|652)\\\\d{5}|76(?:0[0-2]|2[356]|34|4[01347]|5[49]|6[0-369]|77|81|9[139])\\\\d{6}\",[10]],[\"56\\\\d{8}\",[10]]]],\"GH\":[\"233\",\"00\",\"(?:[235]\\\\d{3}|800)\\\\d{5}\",[8,9],[[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"8\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[235]\"],\"0$1\"]],\"0\"],\"GI\":[\"350\",\"00\",\"(?:[25]\\\\d\\\\d|606)\\\\d{5}\",[8],[[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"2\"]]]],\"GL\":[\"299\",\"00\",\"(?:19|[2-689]\\\\d)\\\\d{4}\",[6],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"19|[2-689]\"]]]],\"GM\":[\"220\",\"00\",\"[2-9]\\\\d{6}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[2-9]\"]]]],\"GN\":[\"224\",\"00\",\"722\\\\d{6}|(?:3|6\\\\d)\\\\d{7}\",[8,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"3\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[67]\"]]]],\"GP\":[\"590\",\"00\",\"(?:590|(?:69|80)\\\\d|976)\\\\d{6}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[569]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"8\"],\"0$1\"]],\"0\",0,0,0,0,0,[[\"590(?:0[1-68]|1[0-2]|2[0-68]|3[1289]|4[0-24-9]|5[3-579]|6[0189]|7[08]|8[0-689]|9\\\\d)\\\\d{4}\"],[\"69(?:0\\\\d\\\\d|1(?:2[2-9]|3[0-5]))\\\\d{4}\"],[\"80[0-5]\\\\d{6}\"],0,0,0,0,0,[\"976[01]\\\\d{5}\"]]],\"GQ\":[\"240\",\"00\",\"222\\\\d{6}|(?:3\\\\d|55|[89]0)\\\\d{7}\",[9],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[235]\"]],[\"(\\\\d{3})(\\\\d{6})\",\"$1 $2\",[\"[89]\"]]]],\"GR\":[\"30\",\"00\",\"5005000\\\\d{3}|8\\\\d{9,10}|(?:[269]\\\\d|70)\\\\d{8}\",[10,11],[[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"21|7\"]],[\"(\\\\d{4})(\\\\d{6})\",\"$1 $2\",[\"2(?:2|3[2-57-9]|4[2-469]|5[2-59]|6[2-9]|7[2-69]|8[2-49])|5\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[2689]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{5})\",\"$1 $2 $3\",[\"8\"]]]],\"GT\":[\"502\",\"00\",\"(?:1\\\\d{3}|[2-7])\\\\d{7}\",[8,11],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[2-7]\"]],[\"(\\\\d{4})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"]]]],\"GU\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|671|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([3-9]\\\\d{6})$\",\"671$1\",0,\"671\"],\"GW\":[\"245\",\"00\",\"[49]\\\\d{8}|4\\\\d{6}\",[7,9],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"40\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[49]\"]]]],\"GY\":[\"592\",\"001\",\"(?:862\\\\d|9008)\\\\d{3}|(?:[2-46]\\\\d|77)\\\\d{5}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[2-46-9]\"]]]],\"HK\":[\"852\",\"00(?:30|5[09]|[126-9]?)\",\"8[0-46-9]\\\\d{6,7}|9\\\\d{4}(?:\\\\d(?:\\\\d(?:\\\\d{4})?)?)?|(?:[235-79]\\\\d|46)\\\\d{6}\",[5,6,7,8,9,11],[[\"(\\\\d{3})(\\\\d{2,5})\",\"$1 $2\",[\"900\",\"9003\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[2-7]|8[1-4]|9(?:0[1-9]|[1-8])\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"8\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"9\"]]],0,0,0,0,0,0,0,\"00\"],\"HN\":[\"504\",\"00\",\"8\\\\d{10}|[237-9]\\\\d{7}\",[8,11],[[\"(\\\\d{4})(\\\\d{4})\",\"$1-$2\",[\"[237-9]\"]]]],\"HR\":[\"385\",\"00\",\"(?:[24-69]\\\\d|3[0-79])\\\\d{7}|80\\\\d{5,7}|[1-79]\\\\d{7}|6\\\\d{5,6}\",[6,7,8,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2,3})\",\"$1 $2 $3\",[\"6[01]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2,3})\",\"$1 $2 $3\",[\"8\"],\"0$1\"],[\"(\\\\d)(\\\\d{4})(\\\\d{3})\",\"$1 $2 $3\",[\"1\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[67]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"9\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[2-5]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"8\"],\"0$1\"]],\"0\"],\"HT\":[\"509\",\"00\",\"[2-489]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{4})\",\"$1 $2 $3\",[\"[2-489]\"]]]],\"HU\":[\"36\",\"00\",\"[235-7]\\\\d{8}|[1-9]\\\\d{7}\",[8,9],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"],\"(06 $1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[27][2-9]|3[2-7]|4[24-9]|5[2-79]|6|8[2-57-9]|9[2-69]\"],\"(06 $1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[2-9]\"],\"06 $1\"]],\"06\"],\"ID\":[\"62\",\"00[89]\",\"(?:(?:00[1-9]|8\\\\d)\\\\d{4}|[1-36])\\\\d{6}|00\\\\d{10}|[1-9]\\\\d{8,10}|[2-9]\\\\d{7}\",[7,8,9,10,11,12,13],[[\"(\\\\d)(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"15\"]],[\"(\\\\d{2})(\\\\d{5,9})\",\"$1 $2\",[\"2[124]|[36]1\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{5,7})\",\"$1 $2\",[\"800\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{5,8})\",\"$1 $2\",[\"[2-79]\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{3,4})(\\\\d{3})\",\"$1-$2-$3\",[\"8[1-35-9]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{6,8})\",\"$1 $2\",[\"1\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"804\"],\"0$1\"],[\"(\\\\d{3})(\\\\d)(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"80\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{4})(\\\\d{4,5})\",\"$1-$2-$3\",[\"8\"],\"0$1\"]],\"0\"],\"IE\":[\"353\",\"00\",\"(?:1\\\\d|[2569])\\\\d{6,8}|4\\\\d{6,9}|7\\\\d{8}|8\\\\d{8,9}\",[7,8,9,10],[[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"2[24-9]|47|58|6[237-9]|9[35-9]\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"[45]0\"],\"(0$1)\"],[\"(\\\\d)(\\\\d{3,4})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[2569]|4[1-69]|7[14]\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"70\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"81\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[78]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"1\"]],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"4\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3 $4\",[\"8\"],\"0$1\"]],\"0\"],\"IL\":[\"972\",\"0(?:0|1[2-9])\",\"1\\\\d{6}(?:\\\\d{3,5})?|[57]\\\\d{8}|[1-489]\\\\d{7}\",[7,8,9,10,11,12],[[\"(\\\\d{4})(\\\\d{3})\",\"$1-$2\",[\"125\"]],[\"(\\\\d{4})(\\\\d{2})(\\\\d{2})\",\"$1-$2-$3\",[\"121\"]],[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1-$2-$3\",[\"[2-489]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1-$2-$3\",[\"[57]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1-$2-$3\",[\"12\"]],[\"(\\\\d{4})(\\\\d{6})\",\"$1-$2\",[\"159\"]],[\"(\\\\d)(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1-$2-$3-$4\",[\"1[7-9]\"]],[\"(\\\\d{3})(\\\\d{1,2})(\\\\d{3})(\\\\d{4})\",\"$1-$2 $3-$4\",[\"15\"]]],\"0\"],\"IM\":[\"44\",\"00\",\"1624\\\\d{6}|(?:[3578]\\\\d|90)\\\\d{8}\",[10],0,\"0\",0,\"0|([25-8]\\\\d{5})$\",\"1624$1\",0,\"74576|(?:16|7[56])24\"],\"IN\":[\"91\",\"00\",\"(?:000800|[2-9]\\\\d\\\\d)\\\\d{7}|1\\\\d{7,12}\",[8,9,10,11,12,13],[[\"(\\\\d{8})\",\"$1\",[\"5(?:0|2[23]|3[03]|[67]1|88)\",\"5(?:0|2(?:21|3)|3(?:0|3[23])|616|717|888)\",\"5(?:0|2(?:21|3)|3(?:0|3[23])|616|717|8888)\"],0,1],[\"(\\\\d{4})(\\\\d{4,5})\",\"$1 $2\",[\"180\",\"1800\"],0,1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"140\"],0,1],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"11|2[02]|33|4[04]|79[1-7]|80[2-46]\",\"11|2[02]|33|4[04]|79(?:[1-6]|7[19])|80(?:[2-4]|6[0-589])\",\"11|2[02]|33|4[04]|79(?:[124-6]|3(?:[02-9]|1[0-24-9])|7(?:1|9[1-6]))|80(?:[2-4]|6[0-589])\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1(?:2[0-249]|3[0-25]|4[145]|[68]|7[1257])|2(?:1[257]|3[013]|4[01]|5[0137]|6[0158]|78|8[1568])|3(?:26|4[1-3]|5[34]|6[01489]|7[02-46]|8[159])|4(?:1[36]|2[1-47]|5[12]|6[0-26-9]|7[0-24-9]|8[013-57]|9[014-7])|5(?:1[025]|22|[36][25]|4[28]|5[12]|[78]1)|6(?:12|[2-4]1|5[17]|6[13]|80)|7(?:12|3[134]|4[47]|61|88)|8(?:16|2[014]|3[126]|6[136]|7[078]|8[34]|91)|(?:43|59|75)[15]|(?:1[59]|29|67|72)[14]\",\"1(?:2[0-24]|3[0-25]|4[145]|[59][14]|6[1-9]|7[1257]|8[1-57-9])|2(?:1[257]|3[013]|4[01]|5[0137]|6[058]|78|8[1568]|9[14])|3(?:26|4[1-3]|5[34]|6[01489]|7[02-46]|8[159])|4(?:1[36]|2[1-47]|3[15]|5[12]|6[0-26-9]|7[0-24-9]|8[013-57]|9[014-7])|5(?:1[025]|22|[36][25]|4[28]|[578]1|9[15])|674|7(?:(?:2[14]|3[34]|5[15])[2-6]|61[346]|88[0-8])|8(?:70[2-6]|84[235-7]|91[3-7])|(?:1(?:29|60|8[06])|261|552|6(?:12|[2-47]1|5[17]|6[13]|80)|7(?:12|31|4[47])|8(?:16|2[014]|3[126]|6[136]|7[78]|83))[2-7]\",\"1(?:2[0-24]|3[0-25]|4[145]|[59][14]|6[1-9]|7[1257]|8[1-57-9])|2(?:1[257]|3[013]|4[01]|5[0137]|6[058]|78|8[1568]|9[14])|3(?:26|4[1-3]|5[34]|6[01489]|7[02-46]|8[159])|4(?:1[36]|2[1-47]|3[15]|5[12]|6[0-26-9]|7[0-24-9]|8[013-57]|9[014-7])|5(?:1[025]|22|[36][25]|4[28]|[578]1|9[15])|6(?:12(?:[2-6]|7[0-8])|74[2-7])|7(?:(?:2[14]|5[15])[2-6]|3171|61[346]|88(?:[2-7]|82))|8(?:70[2-6]|84(?:[2356]|7[19])|91(?:[3-6]|7[19]))|73[134][2-6]|(?:74[47]|8(?:16|2[014]|3[126]|6[136]|7[78]|83))(?:[2-6]|7[19])|(?:1(?:29|60|8[06])|261|552|6(?:[2-4]1|5[17]|6[13]|7(?:1|4[0189])|80)|7(?:12|88[01]))[2-7]\"],\"0$1\",1],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"1(?:[2-479]|5[0235-9])|[2-5]|6(?:1[1358]|2[2457-9]|3[2-5]|4[235-7]|5[2-689]|6[24578]|7[235689]|8[1-6])|7(?:1[013-9]|28|3[129]|4[1-35689]|5[29]|6[02-5]|70)|807\",\"1(?:[2-479]|5[0235-9])|[2-5]|6(?:1[1358]|2(?:[2457]|84|95)|3(?:[2-4]|55)|4[235-7]|5[2-689]|6[24578]|7[235689]|8[1-6])|7(?:1(?:[013-8]|9[6-9])|28[6-8]|3(?:17|2[0-49]|9[2-57])|4(?:1[2-4]|[29][0-7]|3[0-8]|[56]|8[0-24-7])|5(?:2[1-3]|9[0-6])|6(?:0[5689]|2[5-9]|3[02-8]|4|5[0-367])|70[13-7])|807[19]\",\"1(?:[2-479]|5(?:[0236-9]|5[013-9]))|[2-5]|6(?:2(?:84|95)|355|83)|73179|807(?:1|9[1-3])|(?:1552|6(?:1[1358]|2[2457]|3[2-4]|4[235-7]|5[2-689]|6[24578]|7[235689]|8[124-6])\\\\d|7(?:1(?:[013-8]\\\\d|9[6-9])|28[6-8]|3(?:2[0-49]|9[2-57])|4(?:1[2-4]|[29][0-7]|3[0-8]|[56]\\\\d|8[0-24-7])|5(?:2[1-3]|9[0-6])|6(?:0[5689]|2[5-9]|3[02-8]|4\\\\d|5[0-367])|70[13-7]))[2-7]\"],\"0$1\",1],[\"(\\\\d{5})(\\\\d{5})\",\"$1 $2\",[\"[6-9]\"],\"0$1\",1],[\"(\\\\d{4})(\\\\d{2,4})(\\\\d{4})\",\"$1 $2 $3\",[\"1(?:6|8[06])\",\"1(?:6|8[06]0)\"],0,1],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"18\"],0,1]],\"0\"],\"IO\":[\"246\",\"00\",\"3\\\\d{6}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"3\"]]]],\"IQ\":[\"964\",\"00\",\"(?:1|7\\\\d\\\\d)\\\\d{7}|[2-6]\\\\d{7,8}\",[8,9,10],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[2-6]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"7\"],\"0$1\"]],\"0\"],\"IR\":[\"98\",\"00\",\"[1-9]\\\\d{9}|(?:[1-8]\\\\d\\\\d|9)\\\\d{3,4}\",[4,5,6,7,10],[[\"(\\\\d{4,5})\",\"$1\",[\"96\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4,5})\",\"$1 $2\",[\"(?:1[137]|2[13-68]|3[1458]|4[145]|5[1468]|6[16]|7[1467]|8[13467])[12689]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"9\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"[1-8]\"],\"0$1\"]],\"0\"],\"IS\":[\"354\",\"00|1(?:0(?:01|[12]0)|100)\",\"(?:38\\\\d|[4-9])\\\\d{6}\",[7,9],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[4-9]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"3\"]]],0,0,0,0,0,0,0,\"00\"],\"IT\":[\"39\",\"00\",\"0\\\\d{5,10}|3[0-8]\\\\d{7,10}|55\\\\d{8}|8\\\\d{5}(?:\\\\d{2,4})?|(?:1\\\\d|39)\\\\d{7,8}\",[6,7,8,9,10,11],[[\"(\\\\d{2})(\\\\d{4,6})\",\"$1 $2\",[\"0[26]\"]],[\"(\\\\d{3})(\\\\d{3,6})\",\"$1 $2\",[\"0[13-57-9][0159]|8(?:03|4[17]|9[245])\",\"0[13-57-9][0159]|8(?:03|4[17]|9(?:2|[45][0-4]))\"]],[\"(\\\\d{4})(\\\\d{2,6})\",\"$1 $2\",[\"0(?:[13-579][2-46-8]|8[236-8])\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"894\"]],[\"(\\\\d{2})(\\\\d{3,4})(\\\\d{4})\",\"$1 $2 $3\",[\"0[26]|5\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"1[4679]|[38]\"]],[\"(\\\\d{3})(\\\\d{3,4})(\\\\d{4})\",\"$1 $2 $3\",[\"0[13-57-9][0159]\"]],[\"(\\\\d{2})(\\\\d{4})(\\\\d{5})\",\"$1 $2 $3\",[\"0[26]\"]],[\"(\\\\d{4})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"0\"]],[\"(\\\\d{3})(\\\\d{4})(\\\\d{4,5})\",\"$1 $2 $3\",[\"3\"]]],0,0,0,0,0,0,[[\"0669[0-79]\\\\d{1,6}|0(?:1(?:[0159]\\\\d|[27][1-5]|31|4[1-4]|6[1356]|8[2-57])|2\\\\d\\\\d|3(?:[0159]\\\\d|2[1-4]|3[12]|[48][1-6]|6[2-59]|7[1-7])|4(?:[0159]\\\\d|[23][1-9]|4[245]|6[1-5]|7[1-4]|81)|5(?:[0159]\\\\d|2[1-5]|3[2-6]|4[1-79]|6[4-6]|7[1-578]|8[3-8])|6(?:[0-57-9]\\\\d|6[0-8])|7(?:[0159]\\\\d|2[12]|3[1-7]|4[2-46]|6[13569]|7[13-6]|8[1-59])|8(?:[0159]\\\\d|2[3-578]|3[1-356]|[6-8][1-5])|9(?:[0159]\\\\d|[238][1-5]|4[12]|6[1-8]|7[1-6]))\\\\d{2,7}\"],[\"3[1-9]\\\\d{8}|3[2-9]\\\\d{7}\",[9,10]],[\"80(?:0\\\\d{3}|3)\\\\d{3}\",[6,9]],[\"(?:0878\\\\d\\\\d|89(?:2|4[5-9]\\\\d))\\\\d{3}|89[45][0-4]\\\\d\\\\d|(?:1(?:44|6[346])|89(?:5[5-9]|9))\\\\d{6}\",[6,8,9,10]],[\"1(?:78\\\\d|99)\\\\d{6}\",[9,10]],0,0,0,[\"55\\\\d{8}\",[10]],[\"84(?:[08]\\\\d{3}|[17])\\\\d{3}\",[6,9]]]],\"JE\":[\"44\",\"00\",\"1534\\\\d{6}|(?:[3578]\\\\d|90)\\\\d{8}\",[10],0,\"0\",0,\"0|([0-24-8]\\\\d{5})$\",\"1534$1\",0,0,[[\"1534[0-24-8]\\\\d{5}\"],[\"7(?:(?:(?:50|82)9|937)\\\\d|7(?:00[378]|97[7-9]))\\\\d{5}\"],[\"80(?:07(?:35|81)|8901)\\\\d{4}\"],[\"(?:8(?:4(?:4(?:4(?:05|42|69)|703)|5(?:041|800))|7(?:0002|1206))|90(?:066[59]|1810|71(?:07|55)))\\\\d{4}\"],[\"701511\\\\d{4}\"],0,[\"(?:3(?:0(?:07(?:35|81)|8901)|3\\\\d{4}|4(?:4(?:4(?:05|42|69)|703)|5(?:041|800))|7(?:0002|1206))|55\\\\d{4})\\\\d{4}\"],[\"76(?:464|652)\\\\d{5}|76(?:0[0-2]|2[356]|34|4[01347]|5[49]|6[0-369]|77|81|9[139])\\\\d{6}\"],[\"56\\\\d{8}\"]]],\"JM\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|658|900)\\\\d{7}\",[10],0,\"1\",0,0,0,0,\"658|876\"],\"JO\":[\"962\",\"00\",\"(?:(?:[2689]|7\\\\d)\\\\d|32|53)\\\\d{6}\",[8,9],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[2356]|87\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{5,6})\",\"$1 $2\",[\"[89]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{7})\",\"$1 $2\",[\"70\"],\"0$1\"],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"7\"],\"0$1\"]],\"0\"],\"JP\":[\"81\",\"010\",\"00[1-9]\\\\d{6,14}|[257-9]\\\\d{9}|(?:00|[1-9]\\\\d\\\\d)\\\\d{6}\",[8,9,10,11,12,13,14,15,16,17],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1-$2-$3\",[\"(?:12|57|99)0\"],\"0$1\"],[\"(\\\\d{4})(\\\\d)(\\\\d{4})\",\"$1-$2-$3\",[\"1(?:26|3[79]|4[56]|5[4-68]|6[3-5])|499|5(?:76|97)|746|8(?:3[89]|47|51|63)|9(?:49|80|9[16])\",\"1(?:267|3(?:7[247]|9[278])|466|5(?:47|58|64)|6(?:3[245]|48|5[4-68]))|499[2468]|5(?:76|97)9|7468|8(?:3(?:8[7-9]|96)|477|51[2-9]|636)|9(?:496|802|9(?:1[23]|69))|1(?:45|58)[67]\",\"1(?:267|3(?:7[247]|9[278])|466|5(?:47|58|64)|6(?:3[245]|48|5[4-68]))|499[2468]|5(?:769|979[2-69])|7468|8(?:3(?:8[7-9]|96[2457-9])|477|51[2-9]|636[457-9])|9(?:496|802|9(?:1[23]|69))|1(?:45|58)[67]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1-$2-$3\",[\"60\"],\"0$1\"],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1-$2-$3\",[\"[36]|4(?:2[09]|7[01])\",\"[36]|4(?:2(?:0|9[02-69])|7(?:0[019]|1))\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1-$2-$3\",[\"1(?:1|5[45]|77|88|9[69])|2(?:2[1-37]|3[0-269]|4[59]|5|6[24]|7[1-358]|8[1369]|9[0-38])|4(?:[28][1-9]|3[0-57]|[45]|6[248]|7[2-579]|9[29])|5(?:2|3[045]|4[0-369]|5[29]|8[02389]|9[0-389])|7(?:2[02-46-9]|34|[58]|6[0249]|7[57]|9[2-6])|8(?:2[124589]|3[27-9]|49|51|6|7[0-468]|8[68]|9[019])|9(?:[23][1-9]|4[15]|5[138]|6[1-3]|7[156]|8[189]|9[1-489])\",\"1(?:1|5(?:4[018]|5[017])|77|88|9[69])|2(?:2(?:[127]|3[014-9])|3[0-269]|4[59]|5(?:[1-3]|5[0-69]|9[19])|62|7(?:[1-35]|8[0189])|8(?:[16]|3[0134]|9[0-5])|9(?:[028]|17))|4(?:2(?:[13-79]|8[014-6])|3[0-57]|[45]|6[248]|7[2-47]|8[1-9])|5(?:2|3[045]|4[0-369]|8[02389]|9[0-3])|7(?:2[02-46-9]|34|[58]|6[0249]|7[57]|9(?:[23]|4[0-59]|5[01569]|6[0167]))|8(?:2(?:[1258]|4[0-39]|9[0-2469])|49|51|6(?:[0-24]|36|5[0-3589]|72|9[01459])|7[0-468]|8[68])|9(?:[23][1-9]|4[15]|5[138]|6[1-3]|7[156]|8[189]|9(?:[1289]|3[34]|4[0178]))|(?:49|55|83)[29]|(?:264|837)[016-9]|2(?:57|93)[015-9]|(?:25[0468]|422|838)[01]|(?:47[59]|59[89]|8(?:6[68]|9))[019]\",\"1(?:1|5(?:4[018]|5[017])|77|88|9[69])|2(?:2[127]|3[0-269]|4[59]|5(?:[1-3]|5[0-69]|9(?:17|99))|6(?:2|4[016-9])|7(?:[1-35]|8[0189])|8(?:[16]|3[0134]|9[0-5])|9(?:[028]|17))|4(?:2(?:[13-79]|8[014-6])|3[0-57]|[45]|6[248]|7[2-47]|9[29])|5(?:2|3[045]|4[0-369]|5[29]|8[02389]|9[0-3])|7(?:2[02-46-9]|34|[58]|6[0249]|7[57]|9(?:[23]|4[0-59]|5[01569]|6[0167]))|8(?:2(?:[1258]|4[0-39]|9[0169])|3(?:[29]|7(?:[017-9]|6[6-8]))|49|51|6(?:[0-24]|36[23]|5(?:[0-389]|5[23])|6(?:[01]|9[178])|72|9[0145])|7[0-468]|8[68])|9(?:4[15]|5[138]|7[156]|8[189]|9(?:[1289]|3(?:31|4[357])|4[0178]))|(?:8294|96)[1-3]|2(?:57|93)[015-9]|(?:223|8699)[014-9]|(?:25[0468]|422|838)[01]|(?:48|8292|9[23])[1-9]|(?:47[59]|59[89]|8(?:68|9))[019]\",\"1(?:1|5(?:4[018]|5[017])|77|88|9[69])|2(?:2[127]|3[0-269]|4[59]|5(?:[1-3]|5[0-69]|7[015-9]|9(?:17|99))|6(?:2|4[016-9])|7(?:[1-35]|8[0189])|8(?:[16]|3[0134]|9[0-5])|9(?:[028]|17|3[015-9]))|4(?:2(?:[13-79]|8[014-6])|3[0-57]|[45]|6[248]|7[2-47]|9[29])|5(?:2|3[045]|4[0-369]|5[29]|8[02389]|9[0-3])|7(?:2[02-46-9]|34|[58]|6[0249]|7[57]|9(?:[23]|4[0-59]|5[01569]|6[0167]))|8(?:2(?:[1258]|4[0-39]|9(?:[019]|4[1-3]|6(?:[0-47-9]|5[01346-9])))|3(?:[29]|7(?:[017-9]|6[6-8]))|49|51|6(?:[0-24]|36[23]|5(?:[0-389]|5[23])|6(?:[01]|9[178])|72|9[0145])|7[0-468]|8[68])|9(?:4[15]|5[138]|6[1-3]|7[156]|8[189]|9(?:[1289]|3(?:31|4[357])|4[0178]))|(?:223|8699)[014-9]|(?:25[0468]|422|838)[01]|(?:48|829(?:2|66)|9[23])[1-9]|(?:47[59]|59[89]|8(?:68|9))[019]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{4})\",\"$1-$2-$3\",[\"[14]|[289][2-9]|5[3-9]|7[2-4679]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1-$2-$3\",[\"800\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1-$2-$3\",[\"[257-9]\"],\"0$1\"]],\"0\"],\"KE\":[\"254\",\"000\",\"(?:[17]\\\\d\\\\d|900)\\\\d{6}|(?:2|80)0\\\\d{6,7}|[4-6]\\\\d{6,8}\",[7,8,9,10],[[\"(\\\\d{2})(\\\\d{5,7})\",\"$1 $2\",[\"[24-6]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{6})\",\"$1 $2\",[\"[17]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[89]\"],\"0$1\"]],\"0\"],\"KG\":[\"996\",\"00\",\"8\\\\d{9}|(?:[235-8]\\\\d|99)\\\\d{7}\",[9,10],[[\"(\\\\d{4})(\\\\d{5})\",\"$1 $2\",[\"3(?:1[346]|[24-79])\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[235-79]|88\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d)(\\\\d{2,3})\",\"$1 $2 $3 $4\",[\"8\"],\"0$1\"]],\"0\"],\"KH\":[\"855\",\"00[14-9]\",\"1\\\\d{9}|[1-9]\\\\d{7,8}\",[8,9,10],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[1-9]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"1\"]]],\"0\"],\"KI\":[\"686\",\"00\",\"(?:[37]\\\\d|6[0-79])\\\\d{6}|(?:[2-48]\\\\d|50)\\\\d{3}\",[5,8],0,\"0\"],\"KM\":[\"269\",\"00\",\"[3478]\\\\d{6}\",[7],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"[3478]\"]]]],\"KN\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-7]\\\\d{6})$\",\"869$1\",0,\"869\"],\"KP\":[\"850\",\"00|99\",\"85\\\\d{6}|(?:19\\\\d|[2-7])\\\\d{7}\",[8,10],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"8\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[2-7]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"],\"0$1\"]],\"0\"],\"KR\":[\"82\",\"00(?:[125689]|3(?:[46]5|91)|7(?:00|27|3|55|6[126]))\",\"00[1-9]\\\\d{8,11}|(?:[12]|5\\\\d{3})\\\\d{7}|[13-6]\\\\d{9}|(?:[1-6]\\\\d|80)\\\\d{7}|[3-6]\\\\d{4,5}|(?:00|7)0\\\\d{8}\",[5,6,8,9,10,11,12,13,14],[[\"(\\\\d{2})(\\\\d{3,4})\",\"$1-$2\",[\"(?:3[1-3]|[46][1-4]|5[1-5])1\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{4})\",\"$1-$2\",[\"1\"]],[\"(\\\\d)(\\\\d{3,4})(\\\\d{4})\",\"$1-$2-$3\",[\"2\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1-$2-$3\",[\"60|8\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3,4})(\\\\d{4})\",\"$1-$2-$3\",[\"[1346]|5[1-5]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1-$2-$3\",[\"[57]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{5})(\\\\d{4})\",\"$1-$2-$3\",[\"5\"],\"0$1\"]],\"0\",0,\"0(8(?:[1-46-8]|5\\\\d\\\\d))?\"],\"KW\":[\"965\",\"00\",\"(?:18|[2569]\\\\d\\\\d)\\\\d{5}\",[7,8],[[\"(\\\\d{4})(\\\\d{3,4})\",\"$1 $2\",[\"[169]|2(?:[235]|4[1-35-9])|52\"]],[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"[25]\"]]]],\"KY\":[\"1\",\"011\",\"(?:345|[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-9]\\\\d{6})$\",\"345$1\",0,\"345\"],\"KZ\":[\"7\",\"810\",\"33622\\\\d{5}|(?:7\\\\d|80)\\\\d{8}\",[10],0,\"8\",0,0,0,0,\"33|7\",0,\"8~10\"],\"LA\":[\"856\",\"00\",\"[23]\\\\d{9}|3\\\\d{8}|(?:[235-8]\\\\d|41)\\\\d{6}\",[8,9,10],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"2[13]|3[14]|[4-8]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"30[013-9]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"[23]\"],\"0$1\"]],\"0\"],\"LB\":[\"961\",\"00\",\"[27-9]\\\\d{7}|[13-9]\\\\d{6}\",[7,8],[[\"(\\\\d)(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[13-69]|7(?:[2-57]|62|8[0-7]|9[04-9])|8[02-9]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[27-9]\"]]],\"0\"],\"LC\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|758|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-8]\\\\d{6})$\",\"758$1\",0,\"758\"],\"LI\":[\"423\",\"00\",\"90\\\\d{5}|(?:[2378]|6\\\\d\\\\d)\\\\d{6}\",[7,9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"[237-9]\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"69\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"6\"]]],\"0\",0,\"0|(1001)\"],\"LK\":[\"94\",\"00\",\"[1-9]\\\\d{8}\",[9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"7\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[1-689]\"],\"0$1\"]],\"0\"],\"LR\":[\"231\",\"00\",\"(?:2|33|5\\\\d|77|88)\\\\d{7}|[4-6]\\\\d{6}\",[7,8,9],[[\"(\\\\d)(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[4-6]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"2\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[3578]\"],\"0$1\"]],\"0\"],\"LS\":[\"266\",\"00\",\"(?:[256]\\\\d\\\\d|800)\\\\d{5}\",[8],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[2568]\"]]]],\"LT\":[\"370\",\"00\",\"(?:[3469]\\\\d|52|[78]0)\\\\d{6}\",[8],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"52[0-7]\"],\"(8-$1)\",1],[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"[7-9]\"],\"8 $1\",1],[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"37|4(?:[15]|6[1-8])\"],\"(8-$1)\",1],[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"[3-6]\"],\"(8-$1)\",1]],\"8\",0,\"[08]\"],\"LU\":[\"352\",\"00\",\"35[013-9]\\\\d{4,8}|6\\\\d{8}|35\\\\d{2,4}|(?:[2457-9]\\\\d|3[0-46-9])\\\\d{2,9}\",[4,5,6,7,8,9,10,11],[[\"(\\\\d{2})(\\\\d{3})\",\"$1 $2\",[\"2(?:0[2-689]|[2-9])|[3-57]|8(?:0[2-9]|[13-9])|9(?:0[89]|[2-579])\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"2(?:0[2-689]|[2-9])|[3-57]|8(?:0[2-9]|[13-9])|9(?:0[89]|[2-579])\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"20[2-689]\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{1,2})\",\"$1 $2 $3 $4\",[\"2(?:[0367]|4[3-8])\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"80[01]|90[015]\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"20\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"6\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{1,2})\",\"$1 $2 $3 $4 $5\",[\"2(?:[0367]|4[3-8])\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{1,5})\",\"$1 $2 $3 $4\",[\"[3-57]|8[13-9]|9(?:0[89]|[2-579])|(?:2|80)[2-9]\"]]],0,0,\"(15(?:0[06]|1[12]|[35]5|4[04]|6[26]|77|88|99)\\\\d)\"],\"LV\":[\"371\",\"00\",\"(?:[268]\\\\d|90)\\\\d{6}\",[8],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[269]|8[01]\"]]]],\"LY\":[\"218\",\"00\",\"[2-9]\\\\d{8}\",[9],[[\"(\\\\d{2})(\\\\d{7})\",\"$1-$2\",[\"[2-9]\"],\"0$1\"]],\"0\"],\"MA\":[\"212\",\"00\",\"[5-8]\\\\d{8}\",[9],[[\"(\\\\d{5})(\\\\d{4})\",\"$1-$2\",[\"5(?:29|38)\",\"5(?:29|38)[89]\",\"5(?:29|38)[89]0\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"5[45]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{5})\",\"$1-$2\",[\"5(?:2[2-489]|3[5-9]|9)|892\",\"5(?:2(?:[2-49]|8[235-9])|3[5-9]|9)|892\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{7})\",\"$1-$2\",[\"8\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{6})\",\"$1-$2\",[\"[5-7]\"],\"0$1\"]],\"0\",0,0,0,0,0,[[\"5(?:29(?:[189][05]|2[29]|3[01])|38[89][05])\\\\d{4}|5(?:2(?:[0-25-7]\\\\d|3[1-578]|4[02-46-8]|8[0235-7]|90)|3(?:[0-47]\\\\d|5[02-9]|6[02-8]|80|9[3-9])|(?:4[067]|5[03])\\\\d)\\\\d{5}\"],[\"(?:6(?:[0-79]\\\\d|8[0-247-9])|7(?:0\\\\d|1[0-2]|6[1267]|7[0-57]))\\\\d{6}\"],[\"80\\\\d{7}\"],[\"89\\\\d{7}\"],0,0,0,0,[\"592(?:4[0-2]|93)\\\\d{4}\"]]],\"MC\":[\"377\",\"00\",\"(?:[3489]|6\\\\d)\\\\d{7}\",[8,9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"4\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[389]\"]],[\"(\\\\d)(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4 $5\",[\"6\"],\"0$1\"]],\"0\"],\"MD\":[\"373\",\"00\",\"(?:[235-7]\\\\d|[89]0)\\\\d{6}\",[8],[[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"[89]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"22|3\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"[25-7]\"],\"0$1\"]],\"0\"],\"ME\":[\"382\",\"00\",\"(?:20|[3-79]\\\\d)\\\\d{6}|80\\\\d{6,7}\",[8,9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[2-9]\"],\"0$1\"]],\"0\"],\"MF\":[\"590\",\"00\",\"(?:590|(?:69|80)\\\\d|976)\\\\d{6}\",[9],0,\"0\",0,0,0,0,0,[[\"590(?:0[079]|[14]3|[27][79]|30|5[0-268]|87)\\\\d{4}\"],[\"69(?:0\\\\d\\\\d|1(?:2[2-9]|3[0-5]))\\\\d{4}\"],[\"80[0-5]\\\\d{6}\"],0,0,0,0,0,[\"976[01]\\\\d{5}\"]]],\"MG\":[\"261\",\"00\",\"[23]\\\\d{8}\",[9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{3})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[23]\"],\"0$1\"]],\"0\",0,\"0|([24-9]\\\\d{6})$\",\"20$1\"],\"MH\":[\"692\",\"011\",\"329\\\\d{4}|(?:[256]\\\\d|45)\\\\d{5}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1-$2\",[\"[2-6]\"]]],\"1\"],\"MK\":[\"389\",\"00\",\"[2-578]\\\\d{7}\",[8],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"2\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[347]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d)(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[58]\"],\"0$1\"]],\"0\"],\"ML\":[\"223\",\"00\",\"[24-9]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[24-9]\"]]]],\"MM\":[\"95\",\"00\",\"1\\\\d{5,7}|95\\\\d{6}|(?:[4-7]|9[0-46-9])\\\\d{6,8}|(?:2|8\\\\d)\\\\d{5,8}\",[6,7,8,9,10],[[\"(\\\\d)(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"16|2\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"[45]|6(?:0[23]|[1-689]|7[235-7])|7(?:[0-4]|5[2-7])|8[1-6]\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[12]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[4-7]|8[1-35]\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{4,6})\",\"$1 $2 $3\",[\"9(?:2[0-4]|[35-9]|4[137-9])\"],\"0$1\"],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"2\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"8\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"92\"],\"0$1\"],[\"(\\\\d)(\\\\d{5})(\\\\d{4})\",\"$1 $2 $3\",[\"9\"],\"0$1\"]],\"0\"],\"MN\":[\"976\",\"001\",\"[12]\\\\d{7,9}|[57-9]\\\\d{7}\",[8,9,10],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{4})\",\"$1 $2 $3\",[\"[12]1\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[57-9]\"]],[\"(\\\\d{3})(\\\\d{5,6})\",\"$1 $2\",[\"[12]2[1-3]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{5,6})\",\"$1 $2\",[\"[12](?:27|3[2-8]|4[2-68]|5[1-4689])\",\"[12](?:27|3[2-8]|4[2-68]|5[1-4689])[0-3]\"],\"0$1\"],[\"(\\\\d{5})(\\\\d{4,5})\",\"$1 $2\",[\"[12]\"],\"0$1\"]],\"0\"],\"MO\":[\"853\",\"00\",\"(?:28|[68]\\\\d)\\\\d{6}\",[8],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[268]\"]]]],\"MP\":[\"1\",\"011\",\"[58]\\\\d{9}|(?:67|90)0\\\\d{7}\",[10],0,\"1\",0,\"1|([2-9]\\\\d{6})$\",\"670$1\",0,\"670\"],\"MQ\":[\"596\",\"00\",\"(?:69|80)\\\\d{7}|(?:59|97)6\\\\d{6}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[569]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"8\"],\"0$1\"]],\"0\"],\"MR\":[\"222\",\"00\",\"(?:[2-4]\\\\d\\\\d|800)\\\\d{5}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[2-48]\"]]]],\"MS\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|664|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([34]\\\\d{6})$\",\"664$1\",0,\"664\"],\"MT\":[\"356\",\"00\",\"3550\\\\d{4}|(?:[2579]\\\\d\\\\d|800)\\\\d{5}\",[8],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[2357-9]\"]]]],\"MU\":[\"230\",\"0(?:0|[24-7]0|3[03])\",\"(?:[2-468]|5\\\\d)\\\\d{6}\",[7,8],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[2-46]|8[013]\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"5\"]]],0,0,0,0,0,0,0,\"020\"],\"MV\":[\"960\",\"0(?:0|19)\",\"(?:800|9[0-57-9]\\\\d)\\\\d{7}|[34679]\\\\d{6}\",[7,10],[[\"(\\\\d{3})(\\\\d{4})\",\"$1-$2\",[\"[3467]|9[13-9]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[89]\"]]],0,0,0,0,0,0,0,\"00\"],\"MW\":[\"265\",\"00\",\"(?:[19]\\\\d|[23]1|77|88)\\\\d{7}|1\\\\d{6}\",[7,9],[[\"(\\\\d)(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"1[2-9]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"2\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[137-9]\"],\"0$1\"]],\"0\"],\"MX\":[\"52\",\"0[09]\",\"(?:1(?:[01467]\\\\d|[2359][1-9]|8[1-79])|[2-9]\\\\d)\\\\d{8}\",[10,11],[[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"33|5[56]|81\"],0,1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[2-9]\"],0,1],[\"(\\\\d)(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$2 $3 $4\",[\"1(?:33|5[56]|81)\"],0,1],[\"(\\\\d)(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$2 $3 $4\",[\"1\"],0,1]],\"01\",0,\"0(?:[12]|4[45])|1\",0,0,0,0,\"00\"],\"MY\":[\"60\",\"00\",\"1\\\\d{8,9}|(?:3\\\\d|[4-9])\\\\d{7}\",[8,9,10],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1-$2 $3\",[\"[4-79]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1-$2 $3\",[\"1(?:[02469]|[378][1-9])|8\"],\"0$1\"],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1-$2 $3\",[\"3\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{2})(\\\\d{4})\",\"$1-$2-$3-$4\",[\"1[36-8]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1-$2 $3\",[\"15\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1-$2 $3\",[\"1\"],\"0$1\"]],\"0\"],\"MZ\":[\"258\",\"00\",\"(?:2|8\\\\d)\\\\d{7}\",[8,9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"2|8[2-79]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"8\"]]]],\"NA\":[\"264\",\"00\",\"[68]\\\\d{7,8}\",[8,9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"88\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"6\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"87\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"8\"],\"0$1\"]],\"0\"],\"NC\":[\"687\",\"00\",\"[2-57-9]\\\\d{5}\",[6],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1.$2.$3\",[\"[2-57-9]\"]]]],\"NE\":[\"227\",\"00\",\"[027-9]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"08\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[089]|2[013]|7[04]\"]]]],\"NF\":[\"672\",\"00\",\"[13]\\\\d{5}\",[6],[[\"(\\\\d{2})(\\\\d{4})\",\"$1 $2\",[\"1[0-3]\"]],[\"(\\\\d)(\\\\d{5})\",\"$1 $2\",[\"[13]\"]]],0,0,\"([0-258]\\\\d{4})$\",\"3$1\"],\"NG\":[\"234\",\"009\",\"(?:[124-7]|9\\\\d{3})\\\\d{6}|[1-9]\\\\d{7}|[78]\\\\d{9,13}\",[7,8,10,11,12,13,14],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"78\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[12]|9(?:0[3-9]|[1-9])\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2,3})\",\"$1 $2 $3\",[\"[3-7]|8[2-9]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[7-9]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{4})(\\\\d{4,5})\",\"$1 $2 $3\",[\"[78]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{5})(\\\\d{5,6})\",\"$1 $2 $3\",[\"[78]\"],\"0$1\"]],\"0\"],\"NI\":[\"505\",\"00\",\"(?:1800|[25-8]\\\\d{3})\\\\d{4}\",[8],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[125-8]\"]]]],\"NL\":[\"31\",\"00\",\"(?:[124-7]\\\\d\\\\d|3(?:[02-9]\\\\d|1[0-8]))\\\\d{6}|[89]\\\\d{6,9}|1\\\\d{4,5}\",[5,6,7,8,9,10],[[\"(\\\\d{3})(\\\\d{4,7})\",\"$1 $2\",[\"[89]0\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{7})\",\"$1 $2\",[\"66\"],\"0$1\"],[\"(\\\\d)(\\\\d{8})\",\"$1 $2\",[\"6\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"1[16-8]|2[259]|3[124]|4[17-9]|5[124679]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[1-57-9]\"],\"0$1\"]],\"0\"],\"NO\":[\"47\",\"00\",\"(?:0|[2-9]\\\\d{3})\\\\d{4}\",[5,8],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"[489]|59\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[235-7]\"]]],0,0,0,0,0,\"[02-689]|7[0-8]\"],\"NP\":[\"977\",\"00\",\"(?:1\\\\d|9)\\\\d{9}|[1-9]\\\\d{7}\",[8,10,11],[[\"(\\\\d)(\\\\d{7})\",\"$1-$2\",[\"1[2-6]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{6})\",\"$1-$2\",[\"1[01]|[2-8]|9(?:[1-579]|6[2-6])\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{7})\",\"$1-$2\",[\"9\"]]],\"0\"],\"NR\":[\"674\",\"00\",\"(?:444|(?:55|8\\\\d)\\\\d|666)\\\\d{4}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[4-68]\"]]]],\"NU\":[\"683\",\"00\",\"(?:[47]|888\\\\d)\\\\d{3}\",[4,7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"8\"]]]],\"NZ\":[\"64\",\"0(?:0|161)\",\"[29]\\\\d{7,9}|50\\\\d{5}(?:\\\\d{2,3})?|6[0-35-9]\\\\d{6}|7\\\\d{7,8}|8\\\\d{4,9}|(?:11\\\\d|[34])\\\\d{7}\",[5,6,7,8,9,10],[[\"(\\\\d{2})(\\\\d{3,8})\",\"$1 $2\",[\"8[1-579]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2,3})\",\"$1 $2 $3\",[\"50[036-8]|[89]0\",\"50(?:[0367]|88)|[89]0\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1-$2 $3\",[\"24|[346]|7[2-57-9]|9[2-9]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"2(?:10|74)|[59]|80\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3,4})(\\\\d{4})\",\"$1 $2 $3\",[\"1|2[028]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,5})\",\"$1 $2 $3\",[\"2(?:[169]|7[0-35-9])|7|86\"],\"0$1\"]],\"0\",0,0,0,0,0,0,\"00\"],\"OM\":[\"968\",\"00\",\"(?:1505|[279]\\\\d{3}|500)\\\\d{4}|800\\\\d{5,6}\",[7,8,9],[[\"(\\\\d{3})(\\\\d{4,6})\",\"$1 $2\",[\"[58]\"]],[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"2\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[179]\"]]]],\"PA\":[\"507\",\"00\",\"8\\\\d{9}|[68]\\\\d{7}|[1-57-9]\\\\d{6}\",[7,8,10],[[\"(\\\\d{3})(\\\\d{4})\",\"$1-$2\",[\"[1-57-9]\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1-$2\",[\"[68]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"8\"]]]],\"PE\":[\"51\",\"19(?:1[124]|77|90)00\",\"(?:[14-8]|9\\\\d)\\\\d{7}\",[8,9],[[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"80\"],\"(0$1)\"],[\"(\\\\d)(\\\\d{7})\",\"$1 $2\",[\"1\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"[4-8]\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"9\"]]],\"0\",0,0,0,0,0,0,0,\" Anexo \"],\"PF\":[\"689\",\"00\",\"4\\\\d{5}(?:\\\\d{2})?|8\\\\d{7,8}\",[6,8,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"44\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"4|8[7-9]\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"8\"]]]],\"PG\":[\"675\",\"00|140[1-3]\",\"(?:180|[78]\\\\d{3})\\\\d{4}|(?:[2-589]\\\\d|64)\\\\d{5}\",[7,8],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"18|[2-69]|85\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[78]\"]]],0,0,0,0,0,0,0,\"00\"],\"PH\":[\"63\",\"00\",\"(?:[2-7]|9\\\\d)\\\\d{8}|2\\\\d{5}|(?:1800|8)\\\\d{7,9}\",[6,8,9,10,11,12,13],[[\"(\\\\d)(\\\\d{5})\",\"$1 $2\",[\"2\"],\"(0$1)\"],[\"(\\\\d{4})(\\\\d{4,6})\",\"$1 $2\",[\"3(?:23|39|46)|4(?:2[3-6]|[35]9|4[26]|76)|544|88[245]|(?:52|64|86)2\",\"3(?:230|397|461)|4(?:2(?:35|[46]4|51)|396|4(?:22|63)|59[347]|76[15])|5(?:221|446)|642[23]|8(?:622|8(?:[24]2|5[13]))\"],\"(0$1)\"],[\"(\\\\d{5})(\\\\d{4})\",\"$1 $2\",[\"346|4(?:27|9[35])|883\",\"3469|4(?:279|9(?:30|56))|8834\"],\"(0$1)\"],[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"2\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[3-7]|8[2-8]\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[89]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"]],[\"(\\\\d{4})(\\\\d{1,2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3 $4\",[\"1\"]]],\"0\"],\"PK\":[\"92\",\"00\",\"122\\\\d{6}|[24-8]\\\\d{10,11}|9(?:[013-9]\\\\d{8,10}|2(?:[01]\\\\d\\\\d|2(?:[06-8]\\\\d|1[01]))\\\\d{7})|(?:[2-8]\\\\d{3}|92(?:[0-7]\\\\d|8[1-9]))\\\\d{6}|[24-9]\\\\d{8}|[89]\\\\d{7}\",[8,9,10,11,12],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{2,7})\",\"$1 $2 $3\",[\"[89]0\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{5})\",\"$1 $2\",[\"1\"]],[\"(\\\\d{3})(\\\\d{6,7})\",\"$1 $2\",[\"2(?:3[2358]|4[2-4]|9[2-8])|45[3479]|54[2-467]|60[468]|72[236]|8(?:2[2-689]|3[23578]|4[3478]|5[2356])|9(?:2[2-8]|3[27-9]|4[2-6]|6[3569]|9[25-8])\",\"9(?:2[3-8]|98)|(?:2(?:3[2358]|4[2-4]|9[2-8])|45[3479]|54[2-467]|60[468]|72[236]|8(?:2[2-689]|3[23578]|4[3478]|5[2356])|9(?:22|3[27-9]|4[2-6]|6[3569]|9[25-7]))[2-9]\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{7,8})\",\"$1 $2\",[\"(?:2[125]|4[0-246-9]|5[1-35-7]|6[1-8]|7[14]|8[16]|91)[2-9]\"],\"(0$1)\"],[\"(\\\\d{5})(\\\\d{5})\",\"$1 $2\",[\"58\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{7})\",\"$1 $2\",[\"3\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"2[125]|4[0-246-9]|5[1-35-7]|6[1-8]|7[14]|8[16]|91\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"[24-9]\"],\"(0$1)\"]],\"0\"],\"PL\":[\"48\",\"00\",\"6\\\\d{5}(?:\\\\d{2})?|8\\\\d{9}|[1-9]\\\\d{6}(?:\\\\d{2})?\",[6,7,8,9,10],[[\"(\\\\d{5})\",\"$1\",[\"19\"]],[\"(\\\\d{3})(\\\\d{3})\",\"$1 $2\",[\"11|64\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1 $2 $3\",[\"(?:1[2-8]|2[2-69]|3[2-4]|4[1-468]|5[24-689]|6[1-3578]|7[14-7]|8[1-79]|9[145])1\",\"(?:1[2-8]|2[2-69]|3[2-4]|4[1-468]|5[24-689]|6[1-3578]|7[14-7]|8[1-79]|9[145])19\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2,3})\",\"$1 $2 $3\",[\"64\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"21|39|45|5[0137]|6[0469]|7[02389]|8(?:0[14]|8)\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"1[2-8]|[2-7]|8[1-79]|9[145]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"8\"]]]],\"PM\":[\"508\",\"00\",\"(?:[45]|80\\\\d\\\\d)\\\\d{5}\",[6,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"[45]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"8\"],\"0$1\"]],\"0\"],\"PR\":[\"1\",\"011\",\"(?:[589]\\\\d\\\\d|787)\\\\d{7}\",[10],0,\"1\",0,0,0,0,\"787|939\"],\"PS\":[\"970\",\"00\",\"[2489]2\\\\d{6}|(?:1\\\\d|5)\\\\d{8}\",[8,9,10],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[2489]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"5\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"1\"]]],\"0\"],\"PT\":[\"351\",\"00\",\"1693\\\\d{5}|(?:[26-9]\\\\d|30)\\\\d{7}\",[9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"2[12]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"16|[236-9]\"]]]],\"PW\":[\"680\",\"01[12]\",\"(?:[24-8]\\\\d\\\\d|345|900)\\\\d{4}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[2-9]\"]]]],\"PY\":[\"595\",\"00\",\"59\\\\d{4,6}|9\\\\d{5,10}|(?:[2-46-8]\\\\d|5[0-8])\\\\d{4,7}\",[6,7,8,9,10,11],[[\"(\\\\d{3})(\\\\d{3,6})\",\"$1 $2\",[\"[2-9]0\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"[26]1|3[289]|4[1246-8]|7[1-3]|8[1-36]\"],\"(0$1)\"],[\"(\\\\d{3})(\\\\d{4,5})\",\"$1 $2\",[\"2[279]|3[13-5]|4[359]|5|6(?:[34]|7[1-46-8])|7[46-8]|85\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"2[14-68]|3[26-9]|4[1246-8]|6(?:1|75)|7[1-35]|8[1-36]\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"87\"]],[\"(\\\\d{3})(\\\\d{6})\",\"$1 $2\",[\"9(?:[5-79]|8[1-6])\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[2-8]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"9\"]]],\"0\"],\"QA\":[\"974\",\"00\",\"[2-7]\\\\d{7}|(?:2\\\\d\\\\d|800)\\\\d{4}\",[7,8],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"2[126]|8\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[2-7]\"]]]],\"RE\":[\"262\",\"00\",\"9769\\\\d{5}|(?:26|[68]\\\\d)\\\\d{7}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[2689]\"],\"0$1\"]],\"0\",0,0,0,0,\"26[23]|69|[89]\"],\"RO\":[\"40\",\"00\",\"(?:[237]\\\\d|[89]0)\\\\d{7}|[23]\\\\d{5}\",[6,9],[[\"(\\\\d{3})(\\\\d{3})\",\"$1 $2\",[\"2[3-6]\",\"2[3-6]\\\\d9\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})\",\"$1 $2\",[\"219|31\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[23]1\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[237-9]\"],\"0$1\"]],\"0\",0,0,0,0,0,0,0,\" int \"],\"RS\":[\"381\",\"00\",\"38[02-9]\\\\d{6,9}|6\\\\d{7,9}|90\\\\d{4,8}|38\\\\d{5,6}|(?:7\\\\d\\\\d|800)\\\\d{3,9}|(?:[12]\\\\d|3[0-79])\\\\d{5,10}\",[6,7,8,9,10,11,12],[[\"(\\\\d{3})(\\\\d{3,9})\",\"$1 $2\",[\"(?:2[389]|39)0|[7-9]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{5,10})\",\"$1 $2\",[\"[1-36]\"],\"0$1\"]],\"0\"],\"RU\":[\"7\",\"810\",\"[347-9]\\\\d{9}\",[10],[[\"(\\\\d{4})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"7(?:1[0-8]|2[1-9])\",\"7(?:1(?:[0-6]2|7|8[27])|2(?:1[23]|[2-9]2))\",\"7(?:1(?:[0-6]2|7|8[27])|2(?:13[03-69]|62[013-9]))|72[1-57-9]2\"],\"8 ($1)\",1],[\"(\\\\d{5})(\\\\d)(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"7(?:1[0-68]|2[1-9])\",\"7(?:1(?:[06][3-6]|[18]|2[35]|[3-5][3-5])|2(?:[13][3-5]|[24-689]|7[457]))\",\"7(?:1(?:0(?:[356]|4[023])|[18]|2(?:3[013-9]|5)|3[45]|43[013-79]|5(?:3[1-8]|4[1-7]|5)|6(?:3[0-35-9]|[4-6]))|2(?:1(?:3[178]|[45])|[24-689]|3[35]|7[457]))|7(?:14|23)4[0-8]|71(?:33|45)[1-79]\"],\"8 ($1)\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"7\"],\"8 ($1)\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2-$3-$4\",[\"[3489]\"],\"8 ($1)\",1]],\"8\",0,0,0,0,\"3[04-689]|[489]\",0,\"8~10\"],\"RW\":[\"250\",\"00\",\"(?:06|[27]\\\\d\\\\d|[89]00)\\\\d{6}\",[8,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"0\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[7-9]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"2\"]]],\"0\"],\"SA\":[\"966\",\"00\",\"92\\\\d{7}|(?:[15]|8\\\\d)\\\\d{8}\",[9,10],[[\"(\\\\d{4})(\\\\d{5})\",\"$1 $2\",[\"9\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"5\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"81\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"8\"]]],\"0\"],\"SB\":[\"677\",\"0[01]\",\"(?:[1-6]|[7-9]\\\\d\\\\d)\\\\d{4}\",[5,7],[[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"7|8[4-9]|9(?:[1-8]|9[0-8])\"]]]],\"SC\":[\"248\",\"010|0[0-2]\",\"8000\\\\d{3}|(?:[249]\\\\d|64)\\\\d{5}\",[7],[[\"(\\\\d)(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[246]|9[57]\"]]],0,0,0,0,0,0,0,\"00\"],\"SD\":[\"249\",\"00\",\"[19]\\\\d{8}\",[9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[19]\"],\"0$1\"]],\"0\"],\"SE\":[\"46\",\"00\",\"(?:[26]\\\\d\\\\d|9)\\\\d{9}|[1-9]\\\\d{8}|[1-689]\\\\d{7}|[1-4689]\\\\d{6}|2\\\\d{5}\",[6,7,8,9,10],[[\"(\\\\d{2})(\\\\d{2,3})(\\\\d{2})\",\"$1-$2 $3\",[\"20\"],\"0$1\",0,\"$1 $2 $3\"],[\"(\\\\d{3})(\\\\d{4})\",\"$1-$2\",[\"9(?:00|39|44)\"],\"0$1\",0,\"$1 $2\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})\",\"$1-$2 $3\",[\"[12][136]|3[356]|4[0246]|6[03]|90[1-9]\"],\"0$1\",0,\"$1 $2 $3\"],[\"(\\\\d)(\\\\d{2,3})(\\\\d{2})(\\\\d{2})\",\"$1-$2 $3 $4\",[\"8\"],\"0$1\",0,\"$1 $2 $3 $4\"],[\"(\\\\d{3})(\\\\d{2,3})(\\\\d{2})\",\"$1-$2 $3\",[\"1[2457]|2(?:[247-9]|5[0138])|3[0247-9]|4[1357-9]|5[0-35-9]|6(?:[125689]|4[02-57]|7[0-2])|9(?:[125-8]|3[02-5]|4[0-3])\"],\"0$1\",0,\"$1 $2 $3\"],[\"(\\\\d{3})(\\\\d{2,3})(\\\\d{3})\",\"$1-$2 $3\",[\"9(?:00|39|44)\"],\"0$1\",0,\"$1 $2 $3\"],[\"(\\\\d{2})(\\\\d{2,3})(\\\\d{2})(\\\\d{2})\",\"$1-$2 $3 $4\",[\"1[13689]|2[0136]|3[1356]|4[0246]|54|6[03]|90[1-9]\"],\"0$1\",0,\"$1 $2 $3 $4\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1-$2 $3 $4\",[\"10|7\"],\"0$1\",0,\"$1 $2 $3 $4\"],[\"(\\\\d)(\\\\d{3})(\\\\d{3})(\\\\d{2})\",\"$1-$2 $3 $4\",[\"8\"],\"0$1\",0,\"$1 $2 $3 $4\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1-$2 $3 $4\",[\"[13-5]|2(?:[247-9]|5[0138])|6(?:[124-689]|7[0-2])|9(?:[125-8]|3[02-5]|4[0-3])\"],\"0$1\",0,\"$1 $2 $3 $4\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{3})\",\"$1-$2 $3 $4\",[\"9\"],\"0$1\",0,\"$1 $2 $3 $4\"],[\"(\\\\d{3})(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1-$2 $3 $4 $5\",[\"[26]\"],\"0$1\",0,\"$1 $2 $3 $4 $5\"]],\"0\"],\"SG\":[\"65\",\"0[0-3]\\\\d\",\"(?:(?:1\\\\d|8)\\\\d\\\\d|7000)\\\\d{7}|[3689]\\\\d{7}\",[8,10,11],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[369]|8(?:0[1-4]|[1-9])\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"8\"]],[\"(\\\\d{4})(\\\\d{4})(\\\\d{3})\",\"$1 $2 $3\",[\"7\"]],[\"(\\\\d{4})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"]]]],\"SH\":[\"290\",\"00\",\"(?:[256]\\\\d|8)\\\\d{3}\",[4,5],0,0,0,0,0,0,\"[256]\"],\"SI\":[\"386\",\"00|10(?:22|66|88|99)\",\"[1-7]\\\\d{7}|8\\\\d{4,7}|90\\\\d{4,6}\",[5,6,7,8],[[\"(\\\\d{2})(\\\\d{3,6})\",\"$1 $2\",[\"8[09]|9\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"59|8\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[37][01]|4[0139]|51|6\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[1-57]\"],\"(0$1)\"]],\"0\",0,0,0,0,0,0,\"00\"],\"SJ\":[\"47\",\"00\",\"0\\\\d{4}|(?:[489]\\\\d|[57]9)\\\\d{6}\",[5,8],0,0,0,0,0,0,\"79\"],\"SK\":[\"421\",\"00\",\"[2-689]\\\\d{8}|[2-59]\\\\d{6}|[2-5]\\\\d{5}\",[6,7,9],[[\"(\\\\d)(\\\\d{2})(\\\\d{3,4})\",\"$1 $2 $3\",[\"21\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{2})(\\\\d{2,3})\",\"$1 $2 $3\",[\"[3-5][1-8]1\",\"[3-5][1-8]1[67]\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{3})(\\\\d{2})\",\"$1/$2 $3 $4\",[\"2\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[689]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1/$2 $3 $4\",[\"[3-5]\"],\"0$1\"]],\"0\"],\"SL\":[\"232\",\"00\",\"(?:[237-9]\\\\d|66)\\\\d{6}\",[8],[[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"[236-9]\"],\"(0$1)\"]],\"0\"],\"SM\":[\"378\",\"00\",\"(?:0549|[5-7]\\\\d)\\\\d{6}\",[8,10],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[5-7]\"]],[\"(\\\\d{4})(\\\\d{6})\",\"$1 $2\",[\"0\"]]],0,0,\"([89]\\\\d{5})$\",\"0549$1\"],\"SN\":[\"221\",\"00\",\"(?:[378]\\\\d{4}|93330)\\\\d{4}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"8\"]],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[379]\"]]]],\"SO\":[\"252\",\"00\",\"[346-9]\\\\d{8}|[12679]\\\\d{7}|[1-5]\\\\d{6}|[1348]\\\\d{5}\",[6,7,8,9],[[\"(\\\\d{2})(\\\\d{4})\",\"$1 $2\",[\"8[125]\"]],[\"(\\\\d{6})\",\"$1\",[\"[134]\"]],[\"(\\\\d)(\\\\d{6})\",\"$1 $2\",[\"[15]|2[0-79]|3[0-46-8]|4[0-7]\"]],[\"(\\\\d)(\\\\d{7})\",\"$1 $2\",[\"24|[67]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[3478]|64|90\"]],[\"(\\\\d{2})(\\\\d{5,7})\",\"$1 $2\",[\"1|28|6[1-35-9]|9[2-9]\"]]],\"0\"],\"SR\":[\"597\",\"00\",\"(?:[2-5]|68|[78]\\\\d)\\\\d{5}\",[6,7],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1-$2-$3\",[\"56\"]],[\"(\\\\d{3})(\\\\d{3})\",\"$1-$2\",[\"[2-5]\"]],[\"(\\\\d{3})(\\\\d{4})\",\"$1-$2\",[\"[6-8]\"]]]],\"SS\":[\"211\",\"00\",\"[19]\\\\d{8}\",[9],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[19]\"],\"0$1\"]],\"0\"],\"ST\":[\"239\",\"00\",\"(?:22|9\\\\d)\\\\d{5}\",[7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[29]\"]]]],\"SV\":[\"503\",\"00\",\"[267]\\\\d{7}|[89]00\\\\d{4}(?:\\\\d{4})?\",[7,8,11],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[89]\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[267]\"]],[\"(\\\\d{3})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"[89]\"]]]],\"SX\":[\"1\",\"011\",\"7215\\\\d{6}|(?:[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|(5\\\\d{6})$\",\"721$1\",0,\"721\"],\"SY\":[\"963\",\"00\",\"[1-39]\\\\d{8}|[1-5]\\\\d{7}\",[8,9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[1-5]\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"9\"],\"0$1\",1]],\"0\"],\"SZ\":[\"268\",\"00\",\"0800\\\\d{4}|(?:[237]\\\\d|900)\\\\d{6}\",[8,9],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[0237]\"]],[\"(\\\\d{5})(\\\\d{4})\",\"$1 $2\",[\"9\"]]]],\"TA\":[\"290\",\"00\",\"8\\\\d{3}\",[4],0,0,0,0,0,0,\"8\"],\"TC\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|649|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-479]\\\\d{6})$\",\"649$1\",0,\"649\"],\"TD\":[\"235\",\"00|16\",\"(?:22|[69]\\\\d|77)\\\\d{6}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[2679]\"]]],0,0,0,0,0,0,0,\"00\"],\"TG\":[\"228\",\"00\",\"[279]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[279]\"]]]],\"TH\":[\"66\",\"00[1-9]\",\"1\\\\d{9}|[1689]\\\\d{8}|[1-57]\\\\d{7}\",[8,9,10],[[\"(\\\\d)(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"2\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[13-9]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"1\"]]],\"0\"],\"TJ\":[\"992\",\"810\",\"(?:00|11|[2-57-9]\\\\d)\\\\d{7}\",[9],[[\"(\\\\d{6})(\\\\d)(\\\\d{2})\",\"$1 $2 $3\",[\"331\",\"3317\"],0,1],[\"(\\\\d{3})(\\\\d{2})(\\\\d{4})\",\"$1 $2 $3\",[\"[34]7|91[78]\"],0,1],[\"(\\\\d{4})(\\\\d)(\\\\d{4})\",\"$1 $2 $3\",[\"3[1-5]\"],0,1],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[02-57-9]|11\"],0,1]],\"8\",0,0,0,0,0,0,\"8~10\"],\"TK\":[\"690\",\"00\",\"[2-47]\\\\d{3,6}\",[4,5,6,7]],\"TL\":[\"670\",\"00\",\"7\\\\d{7}|(?:[2-47]\\\\d|[89]0)\\\\d{5}\",[7,8],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[2-489]|70\"]],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"7\"]]]],\"TM\":[\"993\",\"810\",\"[1-6]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2-$3-$4\",[\"12\"],\"(8 $1)\"],[\"(\\\\d{3})(\\\\d)(\\\\d{2})(\\\\d{2})\",\"$1 $2-$3-$4\",[\"[1-5]\"],\"(8 $1)\"],[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"6\"],\"8 $1\"]],\"8\",0,0,0,0,0,0,\"8~10\"],\"TN\":[\"216\",\"00\",\"[2-57-9]\\\\d{7}\",[8],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[2-57-9]\"]]]],\"TO\":[\"676\",\"00\",\"(?:0800|(?:[5-8]\\\\d\\\\d|999)\\\\d)\\\\d{3}|[2-8]\\\\d{4}\",[5,7],[[\"(\\\\d{2})(\\\\d{3})\",\"$1-$2\",[\"[2-4]|50|6[09]|7[0-24-69]|8[05]\"]],[\"(\\\\d{4})(\\\\d{3})\",\"$1 $2\",[\"0\"]],[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[5-9]\"]]]],\"TR\":[\"90\",\"00\",\"4\\\\d{6}|8\\\\d{11,12}|(?:[2-58]\\\\d\\\\d|900)\\\\d{7}\",[7,10,12,13],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"512|8[01589]|90\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"5(?:[0-59]|61)\",\"5(?:[0-59]|616)\",\"5(?:[0-59]|6161)\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[24][1-8]|3[1-9]\"],\"(0$1)\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{6,7})\",\"$1 $2 $3\",[\"80\"],\"0$1\",1]],\"0\"],\"TT\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-46-8]\\\\d{6})$\",\"868$1\",0,\"868\"],\"TV\":[\"688\",\"00\",\"(?:2|7\\\\d\\\\d|90)\\\\d{4}\",[5,6,7],[[\"(\\\\d{2})(\\\\d{3})\",\"$1 $2\",[\"2\"]],[\"(\\\\d{2})(\\\\d{4})\",\"$1 $2\",[\"90\"]],[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"7\"]]]],\"TW\":[\"886\",\"0(?:0[25-79]|19)\",\"[2-689]\\\\d{8}|7\\\\d{9,10}|[2-8]\\\\d{7}|2\\\\d{6}\",[7,8,9,10,11],[[\"(\\\\d{2})(\\\\d)(\\\\d{4})\",\"$1 $2 $3\",[\"202\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[258]0\"],\"0$1\"],[\"(\\\\d)(\\\\d{3,4})(\\\\d{4})\",\"$1 $2 $3\",[\"[23568]|4(?:0[02-48]|[1-47-9])|7[1-9]\",\"[23568]|4(?:0[2-48]|[1-47-9])|(?:400|7)[1-9]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[49]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4,5})\",\"$1 $2 $3\",[\"7\"],\"0$1\"]],\"0\",0,0,0,0,0,0,0,\"#\"],\"TZ\":[\"255\",\"00[056]\",\"(?:[26-8]\\\\d|41|90)\\\\d{7}\",[9],[[\"(\\\\d{3})(\\\\d{2})(\\\\d{4})\",\"$1 $2 $3\",[\"[89]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[24]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[67]\"],\"0$1\"]],\"0\"],\"UA\":[\"380\",\"00\",\"[89]\\\\d{9}|[3-9]\\\\d{8}\",[9,10],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"6[12][29]|(?:3[1-8]|4[136-8]|5[12457]|6[49])2|(?:56|65)[24]\",\"6[12][29]|(?:35|4[1378]|5[12457]|6[49])2|(?:56|65)[24]|(?:3[1-46-8]|46)2[013-9]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"4[45][0-5]|5(?:0|6[37])|6(?:[12][018]|[36-8])|7|89|9[1-9]|(?:48|57)[0137-9]\",\"4[45][0-5]|5(?:0|6(?:3[14-7]|7))|6(?:[12][018]|[36-8])|7|89|9[1-9]|(?:48|57)[0137-9]\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{5})\",\"$1 $2\",[\"[3-6]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[89]\"],\"0$1\"]],\"0\",0,0,0,0,0,0,\"0~0\"],\"UG\":[\"256\",\"00[057]\",\"800\\\\d{6}|(?:[29]0|[347]\\\\d)\\\\d{7}\",[9],[[\"(\\\\d{4})(\\\\d{5})\",\"$1 $2\",[\"202\",\"2024\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{6})\",\"$1 $2\",[\"[27-9]|4(?:6[45]|[7-9])\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{7})\",\"$1 $2\",[\"[34]\"],\"0$1\"]],\"0\"],\"US\":[\"1\",\"011\",\"[2-9]\\\\d{9}\",[10],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"($1) $2-$3\",[\"[2-9]\"],0,1,\"$1-$2-$3\"]],\"1\",0,0,0,0,0,[[\"(?:2(?:0[1-35-9]|1[02-9]|2[03-589]|3[149]|4[08]|5[1-46]|6[0279]|7[0269]|8[13])|3(?:0[1-57-9]|1[02-9]|2[01356]|3[0-24679]|4[167]|5[12]|6[014]|8[056])|4(?:0[124-9]|1[02-579]|2[3-5]|3[0245]|4[023578]|58|6[39]|7[0589]|8[04])|5(?:0[1-57-9]|1[0235-8]|20|3[0149]|4[01]|5[19]|6[1-47]|7[0-5]|8[056])|6(?:0[1-35-9]|1[024-9]|2[03689]|[34][016]|5[0179]|6[0-279]|78|8[0-29])|7(?:0[1-46-8]|1[2-9]|2[04-7]|3[1247]|4[037]|5[47]|6[02359]|7[02-59]|8[156])|8(?:0[1-68]|1[02-8]|2[08]|3[0-289]|4[03578]|5[046-9]|6[02-5]|7[028])|9(?:0[1346-9]|1[02-9]|2[0589]|3[0146-8]|4[01579]|5[12469]|7[0-389]|8[04-69]))[2-9]\\\\d{6}\"],[\"\"],[\"8(?:00|33|44|55|66|77|88)[2-9]\\\\d{6}\"],[\"900[2-9]\\\\d{6}\"],[\"52(?:3(?:[2-46-9][02-9]\\\\d|5(?:[02-46-9]\\\\d|5[0-46-9]))|4(?:[2-478][02-9]\\\\d|5(?:[034]\\\\d|2[024-9]|5[0-46-9])|6(?:0[1-9]|[2-9]\\\\d)|9(?:[05-9]\\\\d|2[0-5]|49)))\\\\d{4}|52[34][2-9]1[02-9]\\\\d{4}|5(?:00|2[12]|33|44|66|77|88)[2-9]\\\\d{6}\"]]],\"UY\":[\"598\",\"0(?:0|1[3-9]\\\\d)\",\"4\\\\d{9}|[249]\\\\d{7}|(?:[49]\\\\d|80)\\\\d{5}\",[7,8,10],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"405|8|90\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"9\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[24]\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"4\"],\"0$1\"]],\"0\",0,0,0,0,0,0,\"00\",\" int. \"],\"UZ\":[\"998\",\"810\",\"(?:33|55|[679]\\\\d|88)\\\\d{7}\",[9],[[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[35-9]\"],\"8 $1\"]],\"8\",0,0,0,0,0,0,\"8~10\"],\"VA\":[\"39\",\"00\",\"0\\\\d{5,10}|3[0-8]\\\\d{7,10}|55\\\\d{8}|8\\\\d{5}(?:\\\\d{2,4})?|(?:1\\\\d|39)\\\\d{7,8}\",[6,7,8,9,10,11],0,0,0,0,0,0,\"06698\"],\"VC\":[\"1\",\"011\",\"(?:[58]\\\\d\\\\d|784|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-7]\\\\d{6})$\",\"784$1\",0,\"784\"],\"VE\":[\"58\",\"00\",\"[68]00\\\\d{7}|(?:[24]\\\\d|[59]0)\\\\d{8}\",[10],[[\"(\\\\d{3})(\\\\d{7})\",\"$1-$2\",[\"[24-689]\"],\"0$1\"]],\"0\"],\"VG\":[\"1\",\"011\",\"(?:284|[58]\\\\d\\\\d|900)\\\\d{7}\",[10],0,\"1\",0,\"1|([2-578]\\\\d{6})$\",\"284$1\",0,\"284\"],\"VI\":[\"1\",\"011\",\"[58]\\\\d{9}|(?:34|90)0\\\\d{7}\",[10],0,\"1\",0,\"1|([2-9]\\\\d{6})$\",\"340$1\",0,\"340\"],\"VN\":[\"84\",\"00\",\"[12]\\\\d{9}|[135-9]\\\\d{8}|[16]\\\\d{7}|[16-8]\\\\d{6}\",[7,8,9,10],[[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"80\"],\"0$1\",1],[\"(\\\\d{4})(\\\\d{4,6})\",\"$1 $2\",[\"1\"],0,1],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"[69]\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[3578]\"],\"0$1\",1],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"2[48]\"],\"0$1\",1],[\"(\\\\d{3})(\\\\d{4})(\\\\d{3})\",\"$1 $2 $3\",[\"2\"],\"0$1\",1]],\"0\"],\"VU\":[\"678\",\"00\",\"[57-9]\\\\d{6}|(?:[238]\\\\d|48)\\\\d{3}\",[5,7],[[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"[57-9]\"]]]],\"WF\":[\"681\",\"00\",\"(?:40|72)\\\\d{4}|8\\\\d{5}(?:\\\\d{3})?\",[6,9],[[\"(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3\",[\"[478]\"]],[\"(\\\\d{3})(\\\\d{2})(\\\\d{2})(\\\\d{2})\",\"$1 $2 $3 $4\",[\"8\"]]]],\"WS\":[\"685\",\"0\",\"(?:[2-6]|8\\\\d{5})\\\\d{4}|[78]\\\\d{6}|[68]\\\\d{5}\",[5,6,7,10],[[\"(\\\\d{5})\",\"$1\",[\"[2-5]|6[1-9]\"]],[\"(\\\\d{3})(\\\\d{3,7})\",\"$1 $2\",[\"[68]\"]],[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"7\"]]]],\"XK\":[\"383\",\"00\",\"[23]\\\\d{7,8}|(?:4\\\\d\\\\d|[89]00)\\\\d{5}\",[8,9],[[\"(\\\\d{3})(\\\\d{5})\",\"$1 $2\",[\"[89]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[2-4]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[23]\"],\"0$1\"]],\"0\"],\"YE\":[\"967\",\"00\",\"(?:1|7\\\\d)\\\\d{7}|[1-7]\\\\d{6}\",[7,8,9],[[\"(\\\\d)(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"[1-6]|7[24-68]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"7\"],\"0$1\"]],\"0\"],\"YT\":[\"262\",\"00\",\"80\\\\d{7}|(?:26|63)9\\\\d{6}\",[9],0,\"0\",0,0,0,0,\"269|63\"],\"ZA\":[\"27\",\"00\",\"[1-79]\\\\d{8}|8\\\\d{4,9}\",[5,6,7,8,9,10],[[\"(\\\\d{2})(\\\\d{3,4})\",\"$1 $2\",[\"8[1-4]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{2,3})\",\"$1 $2 $3\",[\"8[1-4]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"860\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"[1-9]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"8\"],\"0$1\"]],\"0\"],\"ZM\":[\"260\",\"00\",\"(?:63|80)0\\\\d{6}|(?:21|[79]\\\\d)\\\\d{7}\",[9],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[28]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{7})\",\"$1 $2\",[\"[79]\"],\"0$1\"]],\"0\"],\"ZW\":[\"263\",\"00\",\"2(?:[0-57-9]\\\\d{6,8}|6[0-24-9]\\\\d{6,7})|[38]\\\\d{9}|[35-8]\\\\d{8}|[3-6]\\\\d{7}|[1-689]\\\\d{6}|[1-3569]\\\\d{5}|[1356]\\\\d{4}\",[5,6,7,8,9,10],[[\"(\\\\d{3})(\\\\d{3,5})\",\"$1 $2\",[\"2(?:0[45]|2[278]|[49]8)|3(?:[09]8|17)|6(?:[29]8|37|75)|[23][78]|(?:33|5[15]|6[68])[78]\"],\"0$1\"],[\"(\\\\d)(\\\\d{3})(\\\\d{2,4})\",\"$1 $2 $3\",[\"[49]\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{4})\",\"$1 $2\",[\"80\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{7})\",\"$1 $2\",[\"24|8[13-59]|(?:2[05-79]|39|5[45]|6[15-8])2\",\"2(?:02[014]|4|[56]20|[79]2)|392|5(?:42|525)|6(?:[16-8]21|52[013])|8[13-59]\"],\"(0$1)\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"7\"],\"0$1\"],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"2(?:1[39]|2[0157]|[378]|[56][14])|3(?:12|29)\",\"2(?:1[39]|2[0157]|[378]|[56][14])|3(?:123|29)\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{6})\",\"$1 $2\",[\"8\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3,5})\",\"$1 $2\",[\"1|2(?:0[0-36-9]|12|29|[56])|3(?:1[0-689]|[24-6])|5(?:[0236-9]|1[2-4])|6(?:[013-59]|7[0-46-9])|(?:33|55|6[68])[0-69]|(?:29|3[09]|62)[0-79]\"],\"0$1\"],[\"(\\\\d{2})(\\\\d{3})(\\\\d{3,4})\",\"$1 $2 $3\",[\"29[013-9]|39|54\"],\"0$1\"],[\"(\\\\d{4})(\\\\d{3,5})\",\"$1 $2\",[\"(?:25|54)8\",\"258|5483\"],\"0$1\"]],\"0\"]},\"nonGeographic\":{\"800\":[\"800\",0,\"[1-9]\\\\d{7}\",[8],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[1-9]\"]]],0,0,0,0,0,0,[0,0,[\"[1-9]\\\\d{7}\"]]],\"808\":[\"808\",0,\"[1-9]\\\\d{7}\",[8],[[\"(\\\\d{4})(\\\\d{4})\",\"$1 $2\",[\"[1-9]\"]]],0,0,0,0,0,0,[0,0,0,0,0,0,0,0,0,[\"[1-9]\\\\d{7}\"]]],\"870\":[\"870\",0,\"7\\\\d{11}|[35-7]\\\\d{8}\",[9,12],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"[35-7]\"]]],0,0,0,0,0,0,[0,[\"(?:[356]|774[45])\\\\d{8}|7[6-8]\\\\d{7}\"]]],\"878\":[\"878\",0,\"10\\\\d{10}\",[12],[[\"(\\\\d{2})(\\\\d{5})(\\\\d{5})\",\"$1 $2 $3\",[\"1\"]]],0,0,0,0,0,0,[0,0,0,0,0,0,0,0,[\"10\\\\d{10}\"]]],\"881\":[\"881\",0,\"[0-36-9]\\\\d{8}\",[9],[[\"(\\\\d)(\\\\d{3})(\\\\d{5})\",\"$1 $2 $3\",[\"[0-36-9]\"]]],0,0,0,0,0,0,[0,[\"[0-36-9]\\\\d{8}\"]]],\"882\":[\"882\",0,\"[13]\\\\d{6}(?:\\\\d{2,5})?|285\\\\d{9}|(?:[19]\\\\d|49)\\\\d{6}\",[7,8,9,10,11,12],[[\"(\\\\d{2})(\\\\d{5})\",\"$1 $2\",[\"16|342\"]],[\"(\\\\d{2})(\\\\d{6})\",\"$1 $2\",[\"4\"]],[\"(\\\\d{2})(\\\\d{2})(\\\\d{4})\",\"$1 $2 $3\",[\"[19]\"]],[\"(\\\\d{2})(\\\\d{4})(\\\\d{3})\",\"$1 $2 $3\",[\"3[23]\"]],[\"(\\\\d{2})(\\\\d{3,4})(\\\\d{4})\",\"$1 $2 $3\",[\"1\"]],[\"(\\\\d{2})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"34[57]\"]],[\"(\\\\d{3})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"34\"]],[\"(\\\\d{2})(\\\\d{4,5})(\\\\d{5})\",\"$1 $2 $3\",[\"[1-3]\"]]],0,0,0,0,0,0,[0,[\"342\\\\d{4}|(?:337|49)\\\\d{6}|3(?:2|47|7\\\\d{3})\\\\d{7}\",[7,8,9,10,12]],0,0,0,0,0,0,[\"1(?:3(?:0[0347]|[13][0139]|2[035]|4[013568]|6[0459]|7[06]|8[15-8]|9[0689])\\\\d{4}|6\\\\d{5,10})|(?:(?:285\\\\d\\\\d|3(?:45|[69]\\\\d{3}))\\\\d|9[89])\\\\d{6}\"]]],\"883\":[\"883\",0,\"210\\\\d{7}|51\\\\d{7}(?:\\\\d{3})?\",[9,10,12],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3\",[\"510\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{4})\",\"$1 $2 $3\",[\"2\"]],[\"(\\\\d{3})(\\\\d{3})(\\\\d{3})(\\\\d{3})\",\"$1 $2 $3 $4\",[\"510\"]],[\"(\\\\d{4})(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"5\"]]],0,0,0,0,0,0,[0,0,0,0,0,0,0,0,[\"(?:210|51[013]0\\\\d)\\\\d{7}|5100\\\\d{5}\"]]],\"888\":[\"888\",0,\"\\\\d{11}\",[11],[[\"(\\\\d{3})(\\\\d{3})(\\\\d{5})\",\"$1 $2 $3\"]],0,0,0,0,0,0,[0,0,0,0,0,0,[\"\\\\d{11}\"]]],\"979\":[\"979\",0,\"[1359]\\\\d{8}\",[9],[[\"(\\\\d)(\\\\d{4})(\\\\d{4})\",\"$1 $2 $3\",[\"[1359]\"]]],0,0,0,0,0,0,[0,0,0,[\"[1359]\\\\d{8}\"]]]}}","import { withMetadata } from '../metadata'\r\nimport { parsePhoneNumberFromString as _parsePhoneNumberFromString } from '../../core/index'\r\n\r\nexport function parsePhoneNumberFromString() {\r\n\treturn withMetadata(_parsePhoneNumberFromString, arguments)\r\n}","// Importing from `.json.js` a workaround for a bug in web browsers' \"native\"\r\n// ES6 importing system which is uncapable of importing \"*.json\" files.\r\n// https://github.com/catamphetamine/libphonenumber-js/issues/239\r\nimport metadata from '../metadata.min.json.js'\r\nexport default metadata\r\n\r\nexport function withMetadata(func, _arguments) {\r\n\tvar args = Array.prototype.slice.call(_arguments)\r\n\targs.push(metadata)\r\n\treturn func.apply(this, args)\r\n}","import * as i0 from '@angular/core';\nimport { Injectable, Inject, InjectionToken, PLATFORM_ID } from '@angular/core';\nimport * as i1 from '@angular/common';\nimport { isPlatformBrowser, DOCUMENT } from '@angular/common';\n\n// This service is based on the `ng2-cookies` package which sadly is not a service and does\nimport * as ɵngcc0 from '@angular/core';\nclass CookieService {\n constructor(\n // The type `Document` may not be used here. Although a fix is on its way,\n // we will go with `any` for now to support Angular 2.4.x projects.\n // Issue: https://github.com/angular/angular/issues/12631\n // Fix: https://github.com/angular/angular/pull/14894\n document, \n // Get the `PLATFORM_ID` so we can check if we're in a browser.\n platformId) {\n this.document = document;\n this.platformId = platformId;\n this.documentIsAccessible = isPlatformBrowser(this.platformId);\n }\n /**\n * Get cookie Regular Expression\n *\n * @param name Cookie name\n * @returns property RegExp\n */\n static getCookieRegExp(name) {\n const escapedName = name.replace(/([\\[\\]\\{\\}\\(\\)\\|\\=\\;\\+\\?\\,\\.\\*\\^\\$])/gi, '\\\\$1');\n return new RegExp('(?:^' + escapedName + '|;\\\\s*' + escapedName + ')=(.*?)(?:;|$)', 'g');\n }\n static safeDecodeURIComponent(encodedURIComponent) {\n try {\n return decodeURIComponent(encodedURIComponent);\n }\n catch (_a) {\n // probably it is not uri encoded. return as is\n return encodedURIComponent;\n }\n }\n /**\n * Return `true` if {@link Document} is accessible, otherwise return `false`\n *\n * @param name Cookie name\n * @returns boolean - whether cookie with specified name exists\n */\n check(name) {\n if (!this.documentIsAccessible) {\n return false;\n }\n name = encodeURIComponent(name);\n const regExp = CookieService.getCookieRegExp(name);\n return regExp.test(this.document.cookie);\n }\n /**\n * Get cookies by name\n *\n * @param name Cookie name\n * @returns property value\n */\n get(name) {\n if (this.documentIsAccessible && this.check(name)) {\n name = encodeURIComponent(name);\n const regExp = CookieService.getCookieRegExp(name);\n const result = regExp.exec(this.document.cookie);\n return result[1] ? CookieService.safeDecodeURIComponent(result[1]) : '';\n }\n else {\n return '';\n }\n }\n /**\n * Get all cookies in JSON format\n *\n * @returns all the cookies in json\n */\n getAll() {\n if (!this.documentIsAccessible) {\n return {};\n }\n const cookies = {};\n const document = this.document;\n if (document.cookie && document.cookie !== '') {\n document.cookie.split(';').forEach((currentCookie) => {\n const [cookieName, cookieValue] = currentCookie.split('=');\n cookies[CookieService.safeDecodeURIComponent(cookieName.replace(/^ /, ''))] = CookieService.safeDecodeURIComponent(cookieValue);\n });\n }\n return cookies;\n }\n set(name, value, expiresOrOptions, path, domain, secure, sameSite) {\n if (!this.documentIsAccessible) {\n return;\n }\n if (typeof expiresOrOptions === 'number' || expiresOrOptions instanceof Date || path || domain || secure || sameSite) {\n const optionsBody = {\n expires: expiresOrOptions,\n path,\n domain,\n secure,\n sameSite: sameSite ? sameSite : 'Lax',\n };\n this.set(name, value, optionsBody);\n return;\n }\n let cookieString = encodeURIComponent(name) + '=' + encodeURIComponent(value) + ';';\n const options = expiresOrOptions ? expiresOrOptions : {};\n if (options.expires) {\n if (typeof options.expires === 'number') {\n const dateExpires = new Date(new Date().getTime() + options.expires * 1000 * 60 * 60 * 24);\n cookieString += 'expires=' + dateExpires.toUTCString() + ';';\n }\n else {\n cookieString += 'expires=' + options.expires.toUTCString() + ';';\n }\n }\n if (options.path) {\n cookieString += 'path=' + options.path + ';';\n }\n if (options.domain) {\n cookieString += 'domain=' + options.domain + ';';\n }\n if (options.secure === false && options.sameSite === 'None') {\n options.secure = true;\n console.warn(`[ngx-cookie-service] Cookie ${name} was forced with secure flag because sameSite=None.` +\n `More details : https://github.com/stevermeister/ngx-cookie-service/issues/86#issuecomment-597720130`);\n }\n if (options.secure) {\n cookieString += 'secure;';\n }\n if (!options.sameSite) {\n options.sameSite = 'Lax';\n }\n cookieString += 'sameSite=' + options.sameSite + ';';\n this.document.cookie = cookieString;\n }\n /**\n * Delete cookie by name\n *\n * @param name Cookie name\n * @param path Cookie path\n * @param domain Cookie domain\n * @param secure Cookie secure flag\n * @param sameSite Cookie sameSite flag - https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Set-Cookie/SameSite\n */\n delete(name, path, domain, secure, sameSite = 'Lax') {\n if (!this.documentIsAccessible) {\n return;\n }\n const expiresDate = new Date('Thu, 01 Jan 1970 00:00:01 GMT');\n this.set(name, '', { expires: expiresDate, path, domain, secure, sameSite });\n }\n /**\n * Delete all cookies\n *\n * @param path Cookie path\n * @param domain Cookie domain\n * @param secure Is the Cookie secure\n * @param sameSite Is the cookie same site\n */\n deleteAll(path, domain, secure, sameSite = 'Lax') {\n if (!this.documentIsAccessible) {\n return;\n }\n const cookies = this.getAll();\n for (const cookieName in cookies) {\n if (cookies.hasOwnProperty(cookieName)) {\n this.delete(cookieName, path, domain, secure, sameSite);\n }\n }\n }\n}\nCookieService.ɵfac = function CookieService_Factory(t) { return new (t || CookieService)(ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(PLATFORM_ID)); };\nCookieService.ɵprov = i0.ɵɵdefineInjectable({ factory: function CookieService_Factory() { return new CookieService(i0.ɵɵinject(i1.DOCUMENT), i0.ɵɵinject(i0.PLATFORM_ID)); }, token: CookieService, providedIn: \"root\" });\nCookieService.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: InjectionToken, decorators: [{ type: Inject, args: [PLATFORM_ID,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CookieService, [{\n type: Injectable,\n args: [{\n providedIn: 'root'\n }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc0.InjectionToken, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }]; }, null); })();\n\n/*\n * Public API Surface of ngx-cookie-service\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CookieService };\n\n","import * as i0 from '@angular/core';\nimport { LOCALE_ID, Injectable, Inject, EventEmitter, Component, ViewEncapsulation, ChangeDetectionStrategy, Input, Output, NgModule } from '@angular/core';\nimport * as i3 from '@angular/common';\nimport { formatDate, CommonModule } from '@angular/common';\n\nvar CountdownStatus;\n(function (CountdownStatus) {\n CountdownStatus[CountdownStatus[\"ing\"] = 0] = \"ing\";\n CountdownStatus[CountdownStatus[\"pause\"] = 1] = \"pause\";\n CountdownStatus[CountdownStatus[\"stop\"] = 2] = \"stop\";\n CountdownStatus[CountdownStatus[\"done\"] = 3] = \"done\";\n})(CountdownStatus || (CountdownStatus = {}));\n\n// tslint:disable: no-inferrable-types\nclass CountdownGlobalConfig {\n constructor(locale) {\n this.locale = locale;\n this.demand = false;\n this.leftTime = 0;\n this.format = 'HH:mm:ss';\n this.timezone = '+0000';\n this.formatDate = ({ date, formatStr, timezone }) => {\n return formatDate(new Date(date), formatStr, this.locale, timezone || this.timezone || '+0000');\n };\n }\n}\nCountdownGlobalConfig.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownGlobalConfig, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nCountdownGlobalConfig.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownGlobalConfig, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownGlobalConfig, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n\nclass CountdownTimer {\n constructor(ngZone) {\n this.ngZone = ngZone;\n this.fns = [];\n this.commands = [];\n this.nextTime = 0;\n this.ing = false;\n }\n start() {\n if (this.ing === true) {\n return;\n }\n this.ing = true;\n this.nextTime = +new Date();\n this.ngZone.runOutsideAngular(() => {\n this.process();\n });\n }\n process() {\n while (this.commands.length) {\n this.commands.shift()();\n }\n let diff = +new Date() - this.nextTime;\n const count = 1 + Math.floor(diff / 100);\n diff = 100 - (diff % 100);\n this.nextTime += 100 * count;\n for (let i = 0, len = this.fns.length; i < len; i += 2) {\n let frequency = this.fns[i + 1];\n // 100/s\n if (0 === frequency) {\n this.fns[i](count);\n // 1000/s\n }\n else {\n // 先把末位至0，再每次加2\n frequency += 2 * count - 1;\n const step = Math.floor(frequency / 20);\n if (step > 0) {\n this.fns[i](step);\n }\n // 把末位还原成1\n this.fns[i + 1] = (frequency % 20) + 1;\n }\n }\n if (!this.ing) {\n return;\n }\n setTimeout(() => this.process(), diff);\n }\n add(fn, frequency) {\n this.commands.push(() => {\n this.fns.push(fn);\n this.fns.push(frequency === 1000 ? 1 : 0);\n this.ing = true;\n });\n return this;\n }\n remove(fn) {\n this.commands.push(() => {\n const i = this.fns.indexOf(fn);\n if (i !== -1) {\n this.fns.splice(i, 2);\n }\n this.ing = this.fns.length > 0;\n });\n return this;\n }\n}\nCountdownTimer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownTimer, deps: [{ token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Injectable });\nCountdownTimer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownTimer });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownTimer, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: i0.NgZone }]; } });\n\nclass CountdownComponent {\n constructor(locale, timer, defCog, cdr, ngZone) {\n this.locale = locale;\n this.timer = timer;\n this.defCog = defCog;\n this.cdr = cdr;\n this.ngZone = ngZone;\n this.frequency = 1000;\n this._notify = {};\n this.status = CountdownStatus.ing;\n this.isDestroy = false;\n this.i = {};\n this.left = 0;\n this.event = new EventEmitter();\n }\n set config(i) {\n if (i.notify != null && !Array.isArray(i.notify) && i.notify > 0) {\n i.notify = [i.notify];\n }\n this._config = i;\n }\n get config() {\n return this._config;\n }\n /**\n * Start countdown, you must manually call when `demand: false`\n */\n begin() {\n this.status = CountdownStatus.ing;\n this.callEvent('start');\n }\n /**\n * Restart countdown\n */\n restart() {\n if (this.status !== CountdownStatus.stop) {\n this.destroy();\n }\n this.init();\n this.callEvent('restart');\n }\n /**\n * Stop countdown, must call `restart` when stopped, it's different from pause, unable to recover\n */\n stop() {\n if (this.status === CountdownStatus.stop) {\n return;\n }\n this.status = CountdownStatus.stop;\n this.destroy();\n this.callEvent('stop');\n }\n /**\n * Pause countdown, you can use `resume` to recover again\n */\n pause() {\n if (this.status === CountdownStatus.stop || this.status === CountdownStatus.pause) {\n return;\n }\n this.status = CountdownStatus.pause;\n this.callEvent('pause');\n }\n /**\n * Resume countdown\n */\n resume() {\n if (this.status === CountdownStatus.stop || this.status !== CountdownStatus.pause) {\n return;\n }\n this.status = CountdownStatus.ing;\n this.callEvent('resume');\n }\n callEvent(action) {\n this.event.emit({ action, left: this.left, status: this.status, text: this.i.text });\n }\n init() {\n const { locale, defCog } = this;\n const config = (this.config = Object.assign(Object.assign(Object.assign({}, new CountdownGlobalConfig(locale)), defCog), this.config));\n // tslint:disable-next-line: no-bitwise\n const frq = (this.frequency = ~config.format.indexOf('S') ? 100 : 1000);\n this.status = config.demand ? CountdownStatus.pause : CountdownStatus.ing;\n this.getLeft();\n // bind reflow to me\n const _reflow = this.reflow;\n this.reflow = (count = 0, force = false) => _reflow.apply(this, [count, force]);\n if (Array.isArray(config.notify)) {\n config.notify.forEach((time) => {\n if (time < 1) {\n throw new Error(`The notify config must be a positive integer.`);\n }\n time = time * 1000;\n time = time - (time % frq);\n this._notify[time] = true;\n });\n }\n this.timer.add(this.reflow, frq).start();\n this.reflow(0, true);\n }\n destroy() {\n this.timer.remove(this.reflow);\n return this;\n }\n /**\n * 更新时钟\n */\n reflow(count = 0, force = false) {\n if (this.isDestroy) {\n return;\n }\n const { status, config, _notify } = this;\n if (!force && status !== CountdownStatus.ing) {\n return;\n }\n let value = (this.left = this.left - this.frequency * count);\n if (value < 1) {\n value = 0;\n }\n this.i = {\n value,\n text: config.formatDate({ date: value, formatStr: config.format, timezone: config.timezone }),\n };\n if (typeof config.prettyText === 'function') {\n this.i.text = config.prettyText(this.i.text);\n }\n this.cdr.detectChanges();\n if (config.notify === 0 || _notify[value]) {\n this.ngZone.run(() => {\n this.callEvent('notify');\n });\n }\n if (value === 0) {\n this.ngZone.run(() => {\n this.status = CountdownStatus.done;\n this.destroy();\n this.callEvent('done');\n });\n }\n }\n /**\n * 获取倒计时剩余帧数\n */\n getLeft() {\n const { config, frequency } = this;\n let left = config.leftTime * 1000;\n const end = config.stopTime;\n if (!left && end) {\n left = end - new Date().getTime();\n }\n this.left = left - (left % frequency);\n }\n ngOnInit() {\n this.init();\n if (!this.config.demand) {\n this.begin();\n }\n }\n ngOnDestroy() {\n this.isDestroy = true;\n this.destroy();\n }\n ngOnChanges(changes) {\n if (!changes.config.firstChange) {\n this.restart();\n }\n }\n}\nCountdownComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownComponent, deps: [{ token: LOCALE_ID }, { token: CountdownTimer }, { token: CountdownGlobalConfig }, { token: i0.ChangeDetectorRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Component });\nCountdownComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"12.0.0\", version: \"12.0.2\", type: CountdownComponent, selector: \"countdown\", inputs: { config: \"config\", render: \"render\" }, outputs: { event: \"event\" }, host: { properties: { \"class.count-down\": \"true\" } }, usesOnChanges: true, ngImport: i0, template: `\n
\n \n \n
\n `, isInline: true, directives: [{ type: i3.NgIf, selector: \"[ngIf]\", inputs: [\"ngIf\", \"ngIfThen\", \"ngIfElse\"] }, { type: i3.NgTemplateOutlet, selector: \"[ngTemplateOutlet]\", inputs: [\"ngTemplateOutletContext\", \"ngTemplateOutlet\"] }], changeDetection: i0.ChangeDetectionStrategy.OnPush, encapsulation: i0.ViewEncapsulation.None });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownComponent, decorators: [{\n type: Component,\n args: [{\n selector: 'countdown',\n template: `\n
\n \n \n
\n `,\n host: { '[class.count-down]': 'true' },\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: CountdownTimer }, { type: CountdownGlobalConfig }, { type: i0.ChangeDetectorRef }, { type: i0.NgZone }]; }, propDecorators: { config: [{\n type: Input\n }], render: [{\n type: Input\n }], event: [{\n type: Output\n }] } });\n\nclass CountdownModule {\n}\nCountdownModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCountdownModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownModule, declarations: [CountdownComponent], imports: [CommonModule], exports: [CountdownComponent] });\nCountdownModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownModule, providers: [CountdownTimer], imports: [[CommonModule]] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.0.2\", ngImport: i0, type: CountdownModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [CommonModule],\n providers: [CountdownTimer],\n declarations: [CountdownComponent],\n exports: [CountdownComponent],\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CountdownComponent, CountdownGlobalConfig, CountdownModule, CountdownStatus, CountdownTimer };\n","import { InjectionToken, Injectable, Inject, ElementRef, Renderer2, Directive, forwardRef, Input, HostListener, Pipe, NgModule } from '@angular/core';\nimport { __awaiter } from 'tslib';\nimport { NG_VALUE_ACCESSOR, NG_VALIDATORS } from '@angular/forms';\nimport { DOCUMENT } from '@angular/common';\n\nimport * as ɵngcc0 from '@angular/core';\nconst config = new InjectionToken('config');\nconst NEW_CONFIG = new InjectionToken('NEW_CONFIG');\nconst INITIAL_CONFIG = new InjectionToken('INITIAL_CONFIG');\nconst initialConfig = {\n suffix: '',\n prefix: '',\n thousandSeparator: ' ',\n decimalMarker: '.',\n clearIfNotMatch: false,\n showTemplate: false,\n showMaskTyped: false,\n placeHolderCharacter: '_',\n dropSpecialCharacters: true,\n hiddenInput: undefined,\n shownMaskExpression: '',\n separatorLimit: '',\n allowNegativeNumbers: false,\n validation: true,\n // tslint:disable-next-line: quotemark\n specialCharacters: ['-', '/', '(', ')', '.', ':', ' ', '+', ',', '@', '[', ']', '\"', \"'\"],\n leadZeroDateTime: false,\n patterns: {\n '0': {\n pattern: new RegExp('\\\\d'),\n },\n '9': {\n pattern: new RegExp('\\\\d'),\n optional: true,\n },\n X: {\n pattern: new RegExp('\\\\d'),\n symbol: '*',\n },\n A: {\n pattern: new RegExp('[a-zA-Z0-9]'),\n },\n S: {\n pattern: new RegExp('[a-zA-Z]'),\n },\n d: {\n pattern: new RegExp('\\\\d'),\n },\n m: {\n pattern: new RegExp('\\\\d'),\n },\n M: {\n pattern: new RegExp('\\\\d'),\n },\n H: {\n pattern: new RegExp('\\\\d'),\n },\n h: {\n pattern: new RegExp('\\\\d'),\n },\n s: {\n pattern: new RegExp('\\\\d'),\n },\n },\n};\nconst timeMasks = ['Hh:m0:s0', 'Hh:m0', 'm0:s0'];\nconst withoutValidation = [\n 'percent',\n 'Hh',\n 's0',\n 'm0',\n 'separator',\n 'd0/M0/0000',\n 'd0/M0',\n 'd0',\n 'M0',\n];\n\nclass MaskApplierService {\n constructor(_config) {\n this._config = _config;\n this.maskExpression = '';\n this.actualValue = '';\n this.shownMaskExpression = '';\n this._formatWithSeparators = (str, thousandSeparatorChar, decimalChar, precision) => {\n const x = str.split(decimalChar);\n const decimals = x.length > 1 ? `${decimalChar}${x[1]}` : '';\n let res = x[0];\n const separatorLimit = this.separatorLimit.replace(/\\s/g, '');\n if (separatorLimit && +separatorLimit) {\n if (res[0] === '-') {\n res = `-${res.slice(1, res.length).slice(0, separatorLimit.length)}`;\n }\n else {\n res = res.slice(0, separatorLimit.length);\n }\n }\n const rgx = /(\\d+)(\\d{3})/;\n while (thousandSeparatorChar && rgx.test(res)) {\n res = res.replace(rgx, '$1' + thousandSeparatorChar + '$2');\n }\n if (precision === undefined) {\n return res + decimals;\n }\n else if (precision === 0) {\n return res;\n }\n return res + decimals.substr(0, precision + 1);\n };\n this.percentage = (str) => {\n return Number(str) >= 0 && Number(str) <= 100;\n };\n this.getPrecision = (maskExpression) => {\n const x = maskExpression.split('.');\n if (x.length > 1) {\n return Number(x[x.length - 1]);\n }\n return Infinity;\n };\n this.checkAndRemoveSuffix = (inputValue) => {\n var _a, _b, _c;\n for (let i = ((_a = this.suffix) === null || _a === void 0 ? void 0 : _a.length) - 1; i >= 0; i--) {\n const substr = this.suffix.substr(i, (_b = this.suffix) === null || _b === void 0 ? void 0 : _b.length);\n if (inputValue.includes(substr) &&\n (i - 1 < 0 || !inputValue.includes(this.suffix.substr(i - 1, (_c = this.suffix) === null || _c === void 0 ? void 0 : _c.length)))) {\n return inputValue.replace(substr, '');\n }\n }\n return inputValue;\n };\n this.checkInputPrecision = (inputValue, precision, decimalMarker) => {\n if (precision < Infinity) {\n const precisionRegEx = new RegExp(this._charToRegExpExpression(decimalMarker) + `\\\\d{${precision}}.*$`);\n const precisionMatch = inputValue.match(precisionRegEx);\n if (precisionMatch && precisionMatch[0].length - 1 > precision) {\n const diff = precisionMatch[0].length - 1 - precision;\n inputValue = inputValue.substring(0, inputValue.length - diff);\n }\n if (precision === 0 && inputValue.endsWith(decimalMarker)) {\n inputValue = inputValue.substring(0, inputValue.length - 1);\n }\n }\n return inputValue;\n };\n this._shift = new Set();\n this.clearIfNotMatch = this._config.clearIfNotMatch;\n this.dropSpecialCharacters = this._config.dropSpecialCharacters;\n this.maskSpecialCharacters = this._config.specialCharacters;\n this.maskAvailablePatterns = this._config.patterns;\n this.prefix = this._config.prefix;\n this.suffix = this._config.suffix;\n this.thousandSeparator = this._config.thousandSeparator;\n this.decimalMarker = this._config.decimalMarker;\n this.hiddenInput = this._config.hiddenInput;\n this.showMaskTyped = this._config.showMaskTyped;\n this.placeHolderCharacter = this._config.placeHolderCharacter;\n this.validation = this._config.validation;\n this.separatorLimit = this._config.separatorLimit;\n this.allowNegativeNumbers = this._config.allowNegativeNumbers;\n this.leadZeroDateTime = this._config.leadZeroDateTime;\n }\n applyMaskWithPattern(inputValue, maskAndPattern) {\n const [mask, customPattern] = maskAndPattern;\n this.customPattern = customPattern;\n return this.applyMask(inputValue, mask);\n }\n applyMask(inputValue, maskExpression, position = 0, justPasted = false, backspaced = false, cb = () => { }) {\n if (inputValue === undefined || inputValue === null || maskExpression === undefined) {\n return '';\n }\n let cursor = 0;\n let result = '';\n let multi = false;\n let backspaceShift = false;\n let shift = 1;\n let stepBack = false;\n if (inputValue.slice(0, this.prefix.length) === this.prefix) {\n inputValue = inputValue.slice(this.prefix.length, inputValue.length);\n }\n if (!!this.suffix && (inputValue === null || inputValue === void 0 ? void 0 : inputValue.length) > 0) {\n inputValue = this.checkAndRemoveSuffix(inputValue);\n }\n const inputArray = inputValue.toString().split('');\n if (maskExpression === 'IP') {\n this.ipError = !!(inputArray.filter((i) => i === '.').length < 3 && inputArray.length < 7);\n maskExpression = '099.099.099.099';\n }\n const arr = [];\n for (let i = 0; i < inputValue.length; i++) {\n if (inputValue[i].match('\\\\d')) {\n arr.push(inputValue[i]);\n }\n }\n if (maskExpression === 'CPF_CNPJ') {\n this.cpfCnpjError = !!(arr.length !== 11 && arr.length !== 14);\n if (arr.length > 11) {\n maskExpression = '00.000.000/0000-00';\n }\n else {\n maskExpression = '000.000.000-00';\n }\n }\n if (maskExpression.startsWith('percent')) {\n if (inputValue.match('[a-z]|[A-Z]') || inputValue.match(/[-!$%^&*()_+|~=`{}\\[\\]:\";'<>?,\\/.]/)) {\n inputValue = this._stripToDecimal(inputValue);\n const precision = this.getPrecision(maskExpression);\n inputValue = this.checkInputPrecision(inputValue, precision, this.decimalMarker);\n }\n if (inputValue.indexOf('.') > 0 && !this.percentage(inputValue.substring(0, inputValue.indexOf('.')))) {\n const base = inputValue.substring(0, inputValue.indexOf('.') - 1);\n inputValue = `${base}${inputValue.substring(inputValue.indexOf('.'), inputValue.length)}`;\n }\n if (this.percentage(inputValue)) {\n result = inputValue;\n }\n else {\n result = inputValue.substring(0, inputValue.length - 1);\n }\n }\n else if (maskExpression.startsWith('separator')) {\n if (inputValue.match('[wа-яА-Я]') ||\n inputValue.match('[ЁёА-я]') ||\n inputValue.match('[a-z]|[A-Z]') ||\n inputValue.match(/[-@#!$%\\\\^&*()_£¬'+|~=`{}\\[\\]:\";<>.?\\/]/) ||\n inputValue.match('[^A-Za-z0-9,]')) {\n inputValue = this._stripToDecimal(inputValue);\n }\n inputValue =\n inputValue.length > 1 && inputValue[0] === '0' && inputValue[1] !== this.decimalMarker && !backspaced\n ? inputValue.slice(1, inputValue.length)\n : inputValue;\n // TODO: we had different rexexps here for the different cases... but tests dont seam to bother - check this\n // separator: no COMMA, dot-sep: no SPACE, COMMA OK, comma-sep: no SPACE, COMMA OK\n const thousandSeperatorCharEscaped = this._charToRegExpExpression(this.thousandSeparator);\n const decimalMarkerEscaped = this._charToRegExpExpression(this.decimalMarker);\n const invalidChars = '@#!$%^&*()_+|~=`{}\\\\[\\\\]:\\\\s,\\\\.\";<>?\\\\/'\n .replace(thousandSeperatorCharEscaped, '')\n .replace(decimalMarkerEscaped, '');\n const invalidCharRegexp = new RegExp('[' + invalidChars + ']');\n if (inputValue.match(invalidCharRegexp)) {\n inputValue = inputValue.substring(0, inputValue.length - 1);\n }\n const precision = this.getPrecision(maskExpression);\n inputValue = this.checkInputPrecision(inputValue, precision, this.decimalMarker);\n const strForSep = inputValue.replace(new RegExp(thousandSeperatorCharEscaped, 'g'), '');\n result = this._formatWithSeparators(strForSep, this.thousandSeparator, this.decimalMarker, precision);\n const commaShift = result.indexOf(',') - inputValue.indexOf(',');\n const shiftStep = result.length - inputValue.length;\n if (shiftStep > 0 && result[position] !== ',') {\n backspaceShift = true;\n let _shift = 0;\n do {\n this._shift.add(position + _shift);\n _shift++;\n } while (_shift < shiftStep);\n }\n else if ((commaShift !== 0 && position > 0 && !(result.indexOf(',') >= position && position > 3)) ||\n (!(result.indexOf('.') >= position && position > 3) && shiftStep <= 0)) {\n this._shift.clear();\n backspaceShift = true;\n shift = shiftStep;\n position += shiftStep;\n this._shift.add(position);\n }\n else {\n this._shift.clear();\n }\n }\n else {\n for (\n // tslint:disable-next-line\n let i = 0, inputSymbol = inputArray[0]; i < inputArray.length; i++, inputSymbol = inputArray[i]) {\n if (cursor === maskExpression.length) {\n break;\n }\n if (this._checkSymbolMask(inputSymbol, maskExpression[cursor]) && maskExpression[cursor + 1] === '?') {\n result += inputSymbol;\n cursor += 2;\n }\n else if (maskExpression[cursor + 1] === '*' &&\n multi &&\n this._checkSymbolMask(inputSymbol, maskExpression[cursor + 2])) {\n result += inputSymbol;\n cursor += 3;\n multi = false;\n }\n else if (this._checkSymbolMask(inputSymbol, maskExpression[cursor]) && maskExpression[cursor + 1] === '*') {\n result += inputSymbol;\n multi = true;\n }\n else if (maskExpression[cursor + 1] === '?' &&\n this._checkSymbolMask(inputSymbol, maskExpression[cursor + 2])) {\n result += inputSymbol;\n cursor += 3;\n }\n else if (this._checkSymbolMask(inputSymbol, maskExpression[cursor])) {\n if (maskExpression[cursor] === 'H') {\n if (Number(inputSymbol) > 2) {\n cursor += 1;\n this._shiftStep(maskExpression, cursor, inputArray.length);\n i--;\n if (this.leadZeroDateTime) {\n result += '0';\n }\n continue;\n }\n }\n if (maskExpression[cursor] === 'h') {\n if (result === '2' && Number(inputSymbol) > 3) {\n cursor += 1;\n i--;\n continue;\n }\n }\n if (maskExpression[cursor] === 'm') {\n if (Number(inputSymbol) > 5) {\n cursor += 1;\n this._shiftStep(maskExpression, cursor, inputArray.length);\n i--;\n if (this.leadZeroDateTime) {\n result += '0';\n }\n continue;\n }\n }\n if (maskExpression[cursor] === 's') {\n if (Number(inputSymbol) > 5) {\n cursor += 1;\n this._shiftStep(maskExpression, cursor, inputArray.length);\n i--;\n if (this.leadZeroDateTime) {\n result += '0';\n }\n continue;\n }\n }\n const daysCount = 31;\n if (maskExpression[cursor] === 'd') {\n if ((Number(inputSymbol) > 3 && this.leadZeroDateTime) ||\n Number(inputValue.slice(cursor, cursor + 2)) > daysCount ||\n inputValue[cursor + 1] === '/') {\n cursor += 1;\n this._shiftStep(maskExpression, cursor, inputArray.length);\n i--;\n if (this.leadZeroDateTime) {\n result += '0';\n }\n continue;\n }\n }\n if (maskExpression[cursor] === 'M') {\n const monthsCount = 12;\n // mask without day\n const withoutDays = cursor === 0 &&\n (Number(inputSymbol) > 2 ||\n Number(inputValue.slice(cursor, cursor + 2)) > monthsCount ||\n inputValue[cursor + 1] === '/');\n // day<10 && month<12 for input\n const day1monthInput = inputValue.slice(cursor - 3, cursor - 1).includes('/') &&\n ((inputValue[cursor - 2] === '/' &&\n Number(inputValue.slice(cursor - 1, cursor + 1)) > monthsCount &&\n inputValue[cursor] !== '/') ||\n inputValue[cursor] === '/' ||\n (inputValue[cursor - 3] === '/' &&\n Number(inputValue.slice(cursor - 2, cursor)) > monthsCount &&\n inputValue[cursor - 1] !== '/') ||\n inputValue[cursor - 1] === '/');\n // 10
monthsCount || inputValue[cursor + 1] === '/');\n // day<10 && month<12 for paste whole data\n const day1monthPaste = Number(inputValue.slice(cursor - 3, cursor - 1)) > daysCount &&\n !inputValue.slice(cursor - 3, cursor - 1).includes('/') &&\n !inputValue.slice(cursor - 2, cursor).includes('/') &&\n Number(inputValue.slice(cursor - 2, cursor)) > monthsCount;\n // 10 monthsCount;\n if ((Number(inputSymbol) > 1 && this.leadZeroDateTime) ||\n withoutDays ||\n day1monthInput ||\n day2monthInput ||\n day1monthPaste ||\n day2monthPaste) {\n cursor += 1;\n this._shiftStep(maskExpression, cursor, inputArray.length);\n i--;\n if (this.leadZeroDateTime) {\n result += '0';\n }\n continue;\n }\n }\n result += inputSymbol;\n cursor++;\n }\n else if (this.maskSpecialCharacters.indexOf(maskExpression[cursor]) !== -1) {\n result += maskExpression[cursor];\n cursor++;\n this._shiftStep(maskExpression, cursor, inputArray.length);\n i--;\n }\n else if (this.maskSpecialCharacters.indexOf(inputSymbol) > -1 &&\n this.maskAvailablePatterns[maskExpression[cursor]] &&\n this.maskAvailablePatterns[maskExpression[cursor]].optional) {\n if (!!inputArray[cursor] &&\n maskExpression !== '099.099.099.099' &&\n maskExpression !== '000.000.000-00' &&\n maskExpression !== '00.000.000/0000-00') {\n result += inputArray[cursor];\n }\n cursor++;\n i--;\n }\n else if (this.maskExpression[cursor + 1] === '*' &&\n this._findSpecialChar(this.maskExpression[cursor + 2]) &&\n this._findSpecialChar(inputSymbol) === this.maskExpression[cursor + 2] &&\n multi) {\n cursor += 3;\n result += inputSymbol;\n }\n else if (this.maskExpression[cursor + 1] === '?' &&\n this._findSpecialChar(this.maskExpression[cursor + 2]) &&\n this._findSpecialChar(inputSymbol) === this.maskExpression[cursor + 2] &&\n multi) {\n cursor += 3;\n result += inputSymbol;\n }\n else if (this.showMaskTyped &&\n this.maskSpecialCharacters.indexOf(inputSymbol) < 0 &&\n inputSymbol !== this.placeHolderCharacter) {\n stepBack = true;\n }\n }\n }\n if (result.length + 1 === maskExpression.length &&\n this.maskSpecialCharacters.indexOf(maskExpression[maskExpression.length - 1]) !== -1) {\n result += maskExpression[maskExpression.length - 1];\n }\n let newPosition = position + 1;\n while (this._shift.has(newPosition)) {\n shift++;\n newPosition++;\n }\n let actualShift = justPasted ? cursor : this._shift.has(position) ? shift : 0;\n if (stepBack) {\n actualShift--;\n }\n cb(actualShift, backspaceShift);\n if (shift < 0) {\n this._shift.clear();\n }\n let onlySpecial = false;\n if (backspaced) {\n onlySpecial = inputArray.every((char) => this.maskSpecialCharacters.includes(char));\n }\n let res = `${this.prefix}${onlySpecial ? '' : result}${this.suffix}`;\n if (result.length === 0) {\n res = `${this.prefix}${result}`;\n }\n return res;\n }\n _findSpecialChar(inputSymbol) {\n return this.maskSpecialCharacters.find((val) => val === inputSymbol);\n }\n _checkSymbolMask(inputSymbol, maskSymbol) {\n this.maskAvailablePatterns = this.customPattern ? this.customPattern : this.maskAvailablePatterns;\n return (this.maskAvailablePatterns[maskSymbol] &&\n this.maskAvailablePatterns[maskSymbol].pattern &&\n this.maskAvailablePatterns[maskSymbol].pattern.test(inputSymbol));\n }\n _stripToDecimal(str) {\n return str\n .split('')\n .filter((i, idx) => {\n return (i.match('^-?\\\\d') ||\n i.match('\\\\s') ||\n i === '.' ||\n i === ',' ||\n (i === '-' && idx === 0 && this.allowNegativeNumbers));\n })\n .join('');\n }\n _charToRegExpExpression(char) {\n if (char) {\n const charsToEscape = '[\\\\^$.|?*+()';\n return char === ' ' ? '\\\\s' : charsToEscape.indexOf(char) >= 0 ? '\\\\' + char : char;\n }\n return char;\n }\n _shiftStep(maskExpression, cursor, inputLength) {\n const shiftStep = /[*?]/g.test(maskExpression.slice(0, cursor)) ? inputLength : cursor;\n this._shift.add(shiftStep + this.prefix.length || 0);\n }\n}\nMaskApplierService.ɵfac = function MaskApplierService_Factory(t) { return new (t || MaskApplierService)(ɵngcc0.ɵɵinject(config)); };\nMaskApplierService.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: MaskApplierService, factory: MaskApplierService.ɵfac });\nMaskApplierService.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [config,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(MaskApplierService, [{\n type: Injectable\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [config]\n }] }]; }, null); })();\n\nclass MaskService extends MaskApplierService {\n constructor(document, _config, _elementRef, _renderer) {\n super(_config);\n this.document = document;\n this._config = _config;\n this._elementRef = _elementRef;\n this._renderer = _renderer;\n this.maskExpression = '';\n this.isNumberValue = false;\n this.placeHolderCharacter = '_';\n this.maskIsShown = '';\n this.selStart = null;\n this.selEnd = null;\n /**\n * Whether we are currently in writeValue function, in this case when applying the mask we don't want to trigger onChange function,\n * since writeValue should be a one way only process of writing the DOM value based on the Angular model value.\n */\n this.writingValue = false;\n this.maskChanged = false;\n this.onChange = (_) => { };\n }\n // tslint:disable-next-line:cyclomatic-complexity\n applyMask(inputValue, maskExpression, position = 0, justPasted = false, backspaced = false, cb = () => { }) {\n if (!maskExpression) {\n return inputValue;\n }\n this.maskIsShown = this.showMaskTyped ? this.showMaskInInput() : '';\n if (this.maskExpression === 'IP' && this.showMaskTyped) {\n this.maskIsShown = this.showMaskInInput(inputValue || '#');\n }\n if (this.maskExpression === 'CPF_CNPJ' && this.showMaskTyped) {\n this.maskIsShown = this.showMaskInInput(inputValue || '#');\n }\n if (!inputValue && this.showMaskTyped) {\n this.formControlResult(this.prefix);\n return this.prefix + this.maskIsShown;\n }\n const getSymbol = !!inputValue && typeof this.selStart === 'number' ? inputValue[this.selStart] : '';\n let newInputValue = '';\n if (this.hiddenInput && !this.writingValue) {\n let actualResult = this.actualValue.split('');\n // tslint:disable no-unused-expression\n inputValue !== '' && actualResult.length\n ? typeof this.selStart === 'number' && typeof this.selEnd === 'number'\n ? inputValue.length > actualResult.length\n ? actualResult.splice(this.selStart, 0, getSymbol)\n : inputValue.length < actualResult.length\n ? actualResult.length - inputValue.length === 1\n ? actualResult.splice(this.selStart - 1, 1)\n : actualResult.splice(this.selStart, this.selEnd - this.selStart)\n : null\n : null\n : (actualResult = []);\n // tslint:enable no-unused-expression\n newInputValue =\n this.actualValue.length && actualResult.length <= inputValue.length\n ? this.shiftTypedSymbols(actualResult.join(''))\n : inputValue;\n }\n newInputValue = Boolean(newInputValue) && newInputValue.length ? newInputValue : inputValue;\n const result = super.applyMask(newInputValue, maskExpression, position, justPasted, backspaced, cb);\n this.actualValue = this.getActualValue(result);\n // handle some separator implications:\n // a.) adjust decimalMarker default (. -> ,) if thousandSeparator is a dot\n if (this.thousandSeparator === '.' && this.decimalMarker === '.') {\n this.decimalMarker = ',';\n }\n // b) remove decimal marker from list of special characters to mask\n if (this.maskExpression.startsWith('separator') && this.dropSpecialCharacters === true) {\n this.maskSpecialCharacters = this.maskSpecialCharacters.filter((item) => item !== this.decimalMarker);\n }\n this.formControlResult(result);\n if (!this.showMaskTyped) {\n if (this.hiddenInput) {\n return result && result.length ? this.hideInput(result, this.maskExpression) : result;\n }\n return result;\n }\n const resLen = result.length;\n const prefNmask = this.prefix + this.maskIsShown;\n if (this.maskExpression.includes('H')) {\n const countSkipedSymbol = this._numberSkipedSymbols(result);\n return result + prefNmask.slice(resLen + countSkipedSymbol);\n }\n else if (this.maskExpression === 'IP' || this.maskExpression === 'CPF_CNPJ') {\n return result + prefNmask;\n }\n return result + prefNmask.slice(resLen);\n }\n // get the number of characters that were shifted\n _numberSkipedSymbols(value) {\n const regex = /(^|\\D)(\\d\\D)/g;\n let match = regex.exec(value);\n let countSkipedSymbol = 0;\n while (match != null) {\n countSkipedSymbol += 1;\n match = regex.exec(value);\n }\n return countSkipedSymbol;\n }\n applyValueChanges(position = 0, justPasted, backspaced, cb = () => { }) {\n const formElement = this._elementRef.nativeElement;\n formElement.value = this.applyMask(formElement.value, this.maskExpression, position, justPasted, backspaced, cb);\n if (formElement === this.document.activeElement) {\n return;\n }\n this.clearIfNotMatchFn();\n }\n hideInput(inputValue, maskExpression) {\n return inputValue\n .split('')\n .map((curr, index) => {\n if (this.maskAvailablePatterns &&\n this.maskAvailablePatterns[maskExpression[index]] &&\n this.maskAvailablePatterns[maskExpression[index]].symbol) {\n return this.maskAvailablePatterns[maskExpression[index]].symbol;\n }\n return curr;\n })\n .join('');\n }\n // this function is not necessary, it checks result against maskExpression\n getActualValue(res) {\n const compare = res\n .split('')\n .filter((symbol, i) => this._checkSymbolMask(symbol, this.maskExpression[i]) ||\n (this.maskSpecialCharacters.includes(this.maskExpression[i]) && symbol === this.maskExpression[i]));\n if (compare.join('') === res) {\n return compare.join('');\n }\n return res;\n }\n shiftTypedSymbols(inputValue) {\n let symbolToReplace = '';\n const newInputValue = (inputValue &&\n inputValue.split('').map((currSymbol, index) => {\n if (this.maskSpecialCharacters.includes(inputValue[index + 1]) &&\n inputValue[index + 1] !== this.maskExpression[index + 1]) {\n symbolToReplace = currSymbol;\n return inputValue[index + 1];\n }\n if (symbolToReplace.length) {\n const replaceSymbol = symbolToReplace;\n symbolToReplace = '';\n return replaceSymbol;\n }\n return currSymbol;\n })) ||\n [];\n return newInputValue.join('');\n }\n showMaskInInput(inputVal) {\n if (this.showMaskTyped && !!this.shownMaskExpression) {\n if (this.maskExpression.length !== this.shownMaskExpression.length) {\n throw new Error('Mask expression must match mask placeholder length');\n }\n else {\n return this.shownMaskExpression;\n }\n }\n else if (this.showMaskTyped) {\n if (inputVal) {\n if (this.maskExpression === 'IP') {\n return this._checkForIp(inputVal);\n }\n if (this.maskExpression === 'CPF_CNPJ') {\n return this._checkForCpfCnpj(inputVal);\n }\n }\n return this.maskExpression.replace(/\\w/g, this.placeHolderCharacter);\n }\n return '';\n }\n clearIfNotMatchFn() {\n const formElement = this._elementRef.nativeElement;\n if (this.clearIfNotMatch &&\n this.prefix.length + this.maskExpression.length + this.suffix.length !==\n formElement.value.replace(/_/g, '').length) {\n this.formElementProperty = ['value', ''];\n this.applyMask(formElement.value, this.maskExpression);\n }\n }\n set formElementProperty([name, value]) {\n Promise.resolve().then(() => this._renderer.setProperty(this._elementRef.nativeElement, name, value));\n }\n checkSpecialCharAmount(mask) {\n const chars = mask.split('').filter((item) => this._findSpecialChar(item));\n return chars.length;\n }\n removeMask(inputValue) {\n return this._removeMask(this._removeSuffix(this._removePrefix(inputValue)), this.maskSpecialCharacters.concat('_').concat(this.placeHolderCharacter));\n }\n _checkForIp(inputVal) {\n if (inputVal === '#') {\n return `${this.placeHolderCharacter}.${this.placeHolderCharacter}.${this.placeHolderCharacter}.${this.placeHolderCharacter}`;\n }\n const arr = [];\n for (let i = 0; i < inputVal.length; i++) {\n if (inputVal[i].match('\\\\d')) {\n arr.push(inputVal[i]);\n }\n }\n if (arr.length <= 3) {\n return `${this.placeHolderCharacter}.${this.placeHolderCharacter}.${this.placeHolderCharacter}`;\n }\n if (arr.length > 3 && arr.length <= 6) {\n return `${this.placeHolderCharacter}.${this.placeHolderCharacter}`;\n }\n if (arr.length > 6 && arr.length <= 9) {\n return this.placeHolderCharacter;\n }\n if (arr.length > 9 && arr.length <= 12) {\n return '';\n }\n return '';\n }\n _checkForCpfCnpj(inputVal) {\n const cpf = `${this.placeHolderCharacter}${this.placeHolderCharacter}${this.placeHolderCharacter}` +\n `.${this.placeHolderCharacter}${this.placeHolderCharacter}${this.placeHolderCharacter}` +\n `.${this.placeHolderCharacter}${this.placeHolderCharacter}${this.placeHolderCharacter}` +\n `-${this.placeHolderCharacter}${this.placeHolderCharacter}`;\n const cnpj = `${this.placeHolderCharacter}${this.placeHolderCharacter}` +\n `.${this.placeHolderCharacter}${this.placeHolderCharacter}${this.placeHolderCharacter}` +\n `.${this.placeHolderCharacter}${this.placeHolderCharacter}${this.placeHolderCharacter}` +\n `/${this.placeHolderCharacter}${this.placeHolderCharacter}${this.placeHolderCharacter}${this.placeHolderCharacter}` +\n `-${this.placeHolderCharacter}${this.placeHolderCharacter}`;\n if (inputVal === '#') {\n return cpf;\n }\n const arr = [];\n for (let i = 0; i < inputVal.length; i++) {\n if (inputVal[i].match('\\\\d')) {\n arr.push(inputVal[i]);\n }\n }\n if (arr.length <= 3) {\n return cpf.slice(arr.length, cpf.length);\n }\n if (arr.length > 3 && arr.length <= 6) {\n return cpf.slice(arr.length + 1, cpf.length);\n }\n if (arr.length > 6 && arr.length <= 9) {\n return cpf.slice(arr.length + 2, cpf.length);\n }\n if (arr.length > 9 && arr.length < 11) {\n return cpf.slice(arr.length + 3, cpf.length);\n }\n if (arr.length === 11) {\n return '';\n }\n if (arr.length === 12) {\n if (inputVal.length === 17) {\n return cnpj.slice(16, cnpj.length);\n }\n return cnpj.slice(15, cnpj.length);\n }\n if (arr.length > 12 && arr.length <= 14) {\n return cnpj.slice(arr.length + 4, cnpj.length);\n }\n return '';\n }\n /**\n * Propogates the input value back to the Angular model by triggering the onChange function. It won't do this if writingValue\n * is true. If that is true it means we are currently in the writeValue function, which is supposed to only update the actual\n * DOM element based on the Angular model value. It should be a one way process, i.e. writeValue should not be modifying the Angular\n * model value too. Therefore, we don't trigger onChange in this scenario.\n * @param inputValue the current form input value\n */\n formControlResult(inputValue) {\n if (this.writingValue || this.maskChanged) {\n this.maskChanged = false;\n return;\n }\n if (Array.isArray(this.dropSpecialCharacters)) {\n this.onChange(this._toNumber(this._removeMask(this._removeSuffix(this._removePrefix(inputValue)), this.dropSpecialCharacters)));\n }\n else if (this.dropSpecialCharacters) {\n this.onChange(this._toNumber(this._checkSymbols(inputValue)));\n }\n else {\n this.onChange(this._removeSuffix(inputValue));\n }\n }\n _toNumber(value) {\n if (!this.isNumberValue || value === '') {\n return value;\n }\n const num = Number(value);\n return Number.isNaN(num) ? value : num;\n }\n _removeMask(value, specialCharactersForRemove) {\n return value ? value.replace(this._regExpForRemove(specialCharactersForRemove), '') : value;\n }\n _removePrefix(value) {\n if (!this.prefix) {\n return value;\n }\n return value ? value.replace(this.prefix, '') : value;\n }\n _removeSuffix(value) {\n if (!this.suffix) {\n return value;\n }\n return value ? value.replace(this.suffix, '') : value;\n }\n _retrieveSeparatorValue(result) {\n return this._removeMask(this._removeSuffix(this._removePrefix(result)), this.maskSpecialCharacters);\n }\n _regExpForRemove(specialCharactersForRemove) {\n return new RegExp(specialCharactersForRemove.map((item) => `\\\\${item}`).join('|'), 'gi');\n }\n _checkSymbols(result) {\n if (result === '') {\n return result;\n }\n const separatorPrecision = this._retrieveSeparatorPrecision(this.maskExpression);\n let separatorValue = this._retrieveSeparatorValue(result);\n if (this.decimalMarker !== '.') {\n separatorValue = separatorValue.replace(this.decimalMarker, '.');\n }\n if (!this.isNumberValue) {\n return separatorValue;\n }\n if (separatorPrecision) {\n if (result === this.decimalMarker) {\n return null;\n }\n return this._checkPrecision(this.maskExpression, separatorValue);\n }\n else {\n return Number(separatorValue);\n }\n }\n // TODO should think about helpers or separting decimal precision to own property\n _retrieveSeparatorPrecision(maskExpretion) {\n const matcher = maskExpretion.match(new RegExp(`^separator\\\\.([^d]*)`));\n return matcher ? Number(matcher[1]) : null;\n }\n _checkPrecision(separatorExpression, separatorValue) {\n if (separatorExpression.indexOf('2') > 0) {\n return Number(separatorValue).toFixed(2);\n }\n return Number(separatorValue);\n }\n}\nMaskService.ɵfac = function MaskService_Factory(t) { return new (t || MaskService)(ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(config), ɵngcc0.ɵɵinject(ɵngcc0.ElementRef), ɵngcc0.ɵɵinject(ɵngcc0.Renderer2)); };\nMaskService.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: MaskService, factory: MaskService.ɵfac });\nMaskService.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: undefined, decorators: [{ type: Inject, args: [config,] }] },\n { type: ElementRef },\n { type: Renderer2 }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(MaskService, [{\n type: Injectable\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [config]\n }] }, { type: ɵngcc0.ElementRef }, { type: ɵngcc0.Renderer2 }]; }, null); })();\n\n// tslint:disable deprecation\n// tslint:disable no-input-rename\nclass MaskDirective {\n constructor(document, _maskService, _config) {\n this.document = document;\n this._maskService = _maskService;\n this._config = _config;\n this.maskExpression = '';\n this.specialCharacters = [];\n this.patterns = {};\n this.prefix = '';\n this.suffix = '';\n this.thousandSeparator = ' ';\n this.decimalMarker = '.';\n this.dropSpecialCharacters = null;\n this.hiddenInput = null;\n this.showMaskTyped = null;\n this.placeHolderCharacter = null;\n this.shownMaskExpression = null;\n this.showTemplate = null;\n this.clearIfNotMatch = null;\n this.validation = null;\n this.separatorLimit = null;\n this.allowNegativeNumbers = null;\n this.leadZeroDateTime = null;\n this._maskValue = '';\n this._position = null;\n this._maskExpressionArray = [];\n this._justPasted = false;\n this.onChange = (_) => { };\n this.onTouch = () => { };\n }\n ngOnChanges(changes) {\n const { maskExpression, specialCharacters, patterns, prefix, suffix, thousandSeparator, decimalMarker, dropSpecialCharacters, hiddenInput, showMaskTyped, placeHolderCharacter, shownMaskExpression, showTemplate, clearIfNotMatch, validation, separatorLimit, allowNegativeNumbers, leadZeroDateTime, } = changes;\n if (maskExpression) {\n if (maskExpression.currentValue !== maskExpression.previousValue && !maskExpression.firstChange) {\n this._maskService.maskChanged = true;\n }\n this._maskValue = maskExpression.currentValue || '';\n if (maskExpression.currentValue && maskExpression.currentValue.split('||').length > 1) {\n this._maskExpressionArray = maskExpression.currentValue.split('||').sort((a, b) => {\n return a.length - b.length;\n });\n this._maskValue = this._maskExpressionArray[0];\n this.maskExpression = this._maskExpressionArray[0];\n this._maskService.maskExpression = this._maskExpressionArray[0];\n }\n }\n if (specialCharacters) {\n if (!specialCharacters.currentValue || !Array.isArray(specialCharacters.currentValue)) {\n return;\n }\n else {\n this._maskService.maskSpecialCharacters = specialCharacters.currentValue || [];\n }\n }\n // Only overwrite the mask available patterns if a pattern has actually been passed in\n if (patterns && patterns.currentValue) {\n this._maskService.maskAvailablePatterns = patterns.currentValue;\n }\n if (prefix) {\n this._maskService.prefix = prefix.currentValue;\n }\n if (suffix) {\n this._maskService.suffix = suffix.currentValue;\n }\n if (thousandSeparator) {\n this._maskService.thousandSeparator = thousandSeparator.currentValue;\n }\n if (decimalMarker) {\n this._maskService.decimalMarker = decimalMarker.currentValue;\n }\n if (dropSpecialCharacters) {\n this._maskService.dropSpecialCharacters = dropSpecialCharacters.currentValue;\n }\n if (hiddenInput) {\n this._maskService.hiddenInput = hiddenInput.currentValue;\n }\n if (showMaskTyped) {\n this._maskService.showMaskTyped = showMaskTyped.currentValue;\n }\n if (placeHolderCharacter) {\n this._maskService.placeHolderCharacter = placeHolderCharacter.currentValue;\n }\n if (shownMaskExpression) {\n this._maskService.shownMaskExpression = shownMaskExpression.currentValue;\n }\n if (showTemplate) {\n this._maskService.showTemplate = showTemplate.currentValue;\n }\n if (clearIfNotMatch) {\n this._maskService.clearIfNotMatch = clearIfNotMatch.currentValue;\n }\n if (validation) {\n this._maskService.validation = validation.currentValue;\n }\n if (separatorLimit) {\n this._maskService.separatorLimit = separatorLimit.currentValue;\n }\n if (allowNegativeNumbers) {\n this._maskService.allowNegativeNumbers = allowNegativeNumbers.currentValue;\n if (this._maskService.allowNegativeNumbers) {\n this._maskService.maskSpecialCharacters = this._maskService.maskSpecialCharacters.filter((c) => c !== '-');\n }\n }\n if (leadZeroDateTime) {\n this._maskService.leadZeroDateTime = leadZeroDateTime.currentValue;\n }\n this._applyMask();\n }\n // tslint:disable-next-line: cyclomatic-complexity\n validate({ value }) {\n if (!this._maskService.validation || !this._maskValue) {\n return null;\n }\n if (this._maskService.ipError) {\n return this._createValidationError(value);\n }\n if (this._maskService.cpfCnpjError) {\n return this._createValidationError(value);\n }\n if (this._maskValue.startsWith('separator')) {\n return null;\n }\n if (withoutValidation.includes(this._maskValue)) {\n return null;\n }\n if (this._maskService.clearIfNotMatch) {\n return null;\n }\n if (timeMasks.includes(this._maskValue)) {\n return this._validateTime(value);\n }\n if (value && value.toString().length >= 1) {\n let counterOfOpt = 0;\n for (const key in this._maskService.maskAvailablePatterns) {\n if (this._maskService.maskAvailablePatterns[key].optional &&\n this._maskService.maskAvailablePatterns[key].optional === true) {\n if (this._maskValue.indexOf(key) !== this._maskValue.lastIndexOf(key)) {\n const opt = this._maskValue\n .split('')\n .filter((i) => i === key)\n .join('');\n counterOfOpt += opt.length;\n }\n else if (this._maskValue.indexOf(key) !== -1) {\n counterOfOpt++;\n }\n if (this._maskValue.indexOf(key) !== -1 && value.toString().length >= this._maskValue.indexOf(key)) {\n return null;\n }\n if (counterOfOpt === this._maskValue.length) {\n return null;\n }\n }\n }\n if (this._maskValue.indexOf('{') === 1 &&\n value.toString().length === this._maskValue.length + Number(this._maskValue.split('{')[1].split('}')[0]) - 4) {\n return null;\n }\n if (this._maskValue.indexOf('*') === 1 || this._maskValue.indexOf('?') === 1) {\n return null;\n }\n else if ((this._maskValue.indexOf('*') > 1 && value.toString().length < this._maskValue.indexOf('*')) ||\n (this._maskValue.indexOf('?') > 1 && value.toString().length < this._maskValue.indexOf('?')) ||\n this._maskValue.indexOf('{') === 1) {\n return this._createValidationError(value);\n }\n if (this._maskValue.indexOf('*') === -1 || this._maskValue.indexOf('?') === -1) {\n const length = this._maskService.dropSpecialCharacters\n ? this._maskValue.length - this._maskService.checkSpecialCharAmount(this._maskValue) - counterOfOpt\n : this._maskValue.length - counterOfOpt;\n if (value.toString().length < length) {\n return this._createValidationError(value);\n }\n }\n }\n return null;\n }\n onPaste() {\n this._justPasted = true;\n }\n onInput(e) {\n const el = e.target;\n this._inputValue = el.value;\n this._setMask();\n if (!this._maskValue) {\n this.onChange(el.value);\n return;\n }\n const position = el.selectionStart === 1\n ? el.selectionStart + this._maskService.prefix.length\n : el.selectionStart;\n let caretShift = 0;\n let backspaceShift = false;\n this._maskService.applyValueChanges(position, this._justPasted, this._code === 'Backspace' || this._code === 'Delete', (shift, _backspaceShift) => {\n this._justPasted = false;\n caretShift = shift;\n backspaceShift = _backspaceShift;\n });\n // only set the selection if the element is active\n if (this.document.activeElement !== el) {\n return;\n }\n this._position = this._position === 1 && this._inputValue.length === 1 ? null : this._position;\n let positionToApply = this._position\n ? this._inputValue.length + position + caretShift\n : position + (this._code === 'Backspace' && !backspaceShift ? 0 : caretShift);\n if (positionToApply > this._getActualInputLength()) {\n positionToApply = this._getActualInputLength();\n }\n if (positionToApply < 0) {\n positionToApply = 0;\n }\n el.setSelectionRange(positionToApply, positionToApply);\n this._position = null;\n }\n onBlur() {\n if (this._maskValue) {\n this._maskService.clearIfNotMatchFn();\n }\n this.onTouch();\n }\n onFocus(e) {\n if (!this._maskValue) {\n return;\n }\n const el = e.target;\n const posStart = 0;\n const posEnd = 0;\n if (el !== null &&\n el.selectionStart !== null &&\n el.selectionStart === el.selectionEnd &&\n el.selectionStart > this._maskService.prefix.length &&\n // tslint:disable-next-line\n e.keyCode !== 38) {\n if (this._maskService.showMaskTyped) {\n // We are showing the mask in the input\n this._maskService.maskIsShown = this._maskService.showMaskInInput();\n if (el.setSelectionRange && this._maskService.prefix + this._maskService.maskIsShown === el.value) {\n // the input ONLY contains the mask, so position the cursor at the start\n el.focus();\n el.setSelectionRange(posStart, posEnd);\n }\n else {\n // the input contains some characters already\n if (el.selectionStart > this._maskService.actualValue.length) {\n // if the user clicked beyond our value's length, position the cursor at the end of our value\n el.setSelectionRange(this._maskService.actualValue.length, this._maskService.actualValue.length);\n }\n }\n }\n }\n const nextValue = !el.value || el.value === this._maskService.prefix\n ? this._maskService.prefix + this._maskService.maskIsShown\n : el.value;\n /** Fix of cursor position jumping to end in most browsers no matter where cursor is inserted onFocus */\n if (el.value !== nextValue) {\n el.value = nextValue;\n }\n /** fix of cursor position with prefix when mouse click occur */\n if ((el.selectionStart || el.selectionEnd) <= this._maskService.prefix.length) {\n el.selectionStart = this._maskService.prefix.length;\n return;\n }\n /** select only inserted text */\n if (el.selectionEnd > this._getActualInputLength()) {\n el.selectionEnd = this._getActualInputLength();\n }\n }\n // tslint:disable-next-line: cyclomatic-complexity\n onKeyDown(e) {\n var _a;\n if (!this._maskValue) {\n return;\n }\n this._code = e.code ? e.code : e.key;\n const el = e.target;\n this._inputValue = el.value;\n this._setMask();\n if (e.keyCode === 38) {\n e.preventDefault();\n }\n if (e.keyCode === 37 || e.keyCode === 8 || e.keyCode === 46) {\n if (e.keyCode === 8 && el.value.length === 0) {\n el.selectionStart = el.selectionEnd;\n }\n if (e.keyCode === 8 && el.selectionStart !== 0) {\n // If specialChars is false, (shouldn't ever happen) then set to the defaults\n this.specialCharacters = ((_a = this.specialCharacters) === null || _a === void 0 ? void 0 : _a.length)\n ? this.specialCharacters\n : this._config.specialCharacters;\n if (this.prefix.length > 1 && el.selectionStart <= this.prefix.length) {\n el.setSelectionRange(this.prefix.length, this.prefix.length);\n }\n else {\n if (this._inputValue.length !== el.selectionStart && el.selectionStart !== 1) {\n while (this.specialCharacters.includes(this._inputValue[el.selectionStart - 1].toString()) &&\n ((this.prefix.length >= 1 && el.selectionStart > this.prefix.length) ||\n this.prefix.length === 0)) {\n el.setSelectionRange(el.selectionStart - 1, el.selectionStart - 1);\n }\n }\n this.suffixCheckOnPressDelete(e.keyCode, el);\n }\n }\n this.suffixCheckOnPressDelete(e.keyCode, el);\n if (this._maskService.prefix.length &&\n el.selectionStart <= this._maskService.prefix.length &&\n el.selectionEnd <= this._maskService.prefix.length) {\n e.preventDefault();\n }\n const cursorStart = el.selectionStart;\n // this.onFocus(e);\n if (e.keyCode === 8 &&\n !el.readOnly &&\n cursorStart === 0 &&\n el.selectionEnd === el.value.length &&\n el.value.length !== 0) {\n this._position = this._maskService.prefix ? this._maskService.prefix.length : 0;\n this._maskService.applyMask(this._maskService.prefix, this._maskService.maskExpression, this._position);\n }\n }\n if (!!this.suffix &&\n this.suffix.length > 1 &&\n this._inputValue.length - this.suffix.length < el.selectionStart) {\n el.setSelectionRange(this._inputValue.length - this.suffix.length, this._inputValue.length);\n }\n else if ((e.keyCode === 65 && e.ctrlKey === true) || // Ctrl+ A\n (e.keyCode === 65 && e.metaKey === true) // Cmd + A (Mac)\n ) {\n el.setSelectionRange(0, this._getActualInputLength());\n e.preventDefault();\n }\n this._maskService.selStart = el.selectionStart;\n this._maskService.selEnd = el.selectionEnd;\n }\n /** It writes the value in the input */\n writeValue(inputValue) {\n return __awaiter(this, void 0, void 0, function* () {\n if (typeof inputValue === 'object' && inputValue !== null && 'value' in inputValue) {\n if ('disable' in inputValue) {\n this.setDisabledState(Boolean(inputValue.disable));\n }\n inputValue = inputValue.value;\n }\n if (inputValue === undefined) {\n inputValue = '';\n }\n if (typeof inputValue === 'number') {\n inputValue = String(inputValue);\n inputValue = this.decimalMarker !== '.' ? inputValue.replace('.', this.decimalMarker) : inputValue;\n this._maskService.isNumberValue = true;\n }\n this._inputValue = inputValue;\n this._setMask();\n if ((inputValue && this._maskService.maskExpression) ||\n (this._maskService.maskExpression && (this._maskService.prefix || this._maskService.showMaskTyped))) {\n // Let the service we know we are writing value so that triggering onChange function wont happen during applyMask\n this._maskService.writingValue = true;\n this._maskService.formElementProperty = [\n 'value',\n this._maskService.applyMask(inputValue, this._maskService.maskExpression),\n ];\n // Let the service know we've finished writing value\n this._maskService.writingValue = false;\n }\n else {\n this._maskService.formElementProperty = ['value', inputValue];\n }\n this._inputValue = inputValue;\n });\n }\n registerOnChange(fn) {\n this.onChange = fn;\n this._maskService.onChange = this.onChange;\n }\n registerOnTouched(fn) {\n this.onTouch = fn;\n }\n suffixCheckOnPressDelete(keyCode, el) {\n if (keyCode === 46 && this.suffix.length > 0) {\n if (this._inputValue.length - this.suffix.length <= el.selectionStart) {\n el.setSelectionRange(this._inputValue.length - this.suffix.length, this._inputValue.length);\n }\n }\n if (keyCode === 8) {\n if (this.suffix.length > 1 && this._inputValue.length - this.suffix.length < el.selectionStart) {\n el.setSelectionRange(this._inputValue.length - this.suffix.length, this._inputValue.length);\n }\n if (this.suffix.length === 1 && this._inputValue.length === el.selectionStart) {\n el.setSelectionRange(el.selectionStart - 1, el.selectionStart - 1);\n }\n }\n }\n /** It disables the input element */\n setDisabledState(isDisabled) {\n this._maskService.formElementProperty = ['disabled', isDisabled];\n }\n _repeatPatternSymbols(maskExp) {\n return ((maskExp.match(/{[0-9]+}/) &&\n maskExp.split('').reduce((accum, currval, index) => {\n this._start = currval === '{' ? index : this._start;\n if (currval !== '}') {\n return this._maskService._findSpecialChar(currval) ? accum + currval : accum;\n }\n this._end = index;\n const repeatNumber = Number(maskExp.slice(this._start + 1, this._end));\n const replaceWith = new Array(repeatNumber + 1).join(maskExp[this._start - 1]);\n return accum + replaceWith;\n }, '')) ||\n maskExp);\n }\n // tslint:disable-next-line:no-any\n _applyMask() {\n this._maskService.maskExpression = this._repeatPatternSymbols(this._maskValue || '');\n this._maskService.formElementProperty = [\n 'value',\n this._maskService.applyMask(this._inputValue, this._maskService.maskExpression),\n ];\n }\n _validateTime(value) {\n const rowMaskLen = this._maskValue.split('').filter((s) => s !== ':').length;\n if (!value) {\n return null; // Don't validate empty values to allow for optional form control\n }\n if ((+value[value.length - 1] === 0 && value.length < rowMaskLen) || value.length <= rowMaskLen - 2) {\n return this._createValidationError(value);\n }\n return null;\n }\n _getActualInputLength() {\n return (this._maskService.actualValue.length || this._maskService.actualValue.length + this._maskService.prefix.length);\n }\n _createValidationError(actualValue) {\n return {\n mask: {\n requiredMask: this._maskValue,\n actualValue,\n },\n };\n }\n _setMask() {\n if (this._maskExpressionArray.length > 0) {\n this._maskExpressionArray.some((mask) => {\n var _a, _b;\n const test = ((_a = this._maskService.removeMask(this._inputValue)) === null || _a === void 0 ? void 0 : _a.length) <= ((_b = this._maskService.removeMask(mask)) === null || _b === void 0 ? void 0 : _b.length);\n if (this._inputValue && test) {\n this._maskValue = mask;\n this.maskExpression = mask;\n this._maskService.maskExpression = mask;\n return test;\n }\n else {\n this._maskValue = this._maskExpressionArray[this._maskExpressionArray.length - 1];\n this.maskExpression = this._maskExpressionArray[this._maskExpressionArray.length - 1];\n this._maskService.maskExpression = this._maskExpressionArray[this._maskExpressionArray.length - 1];\n }\n });\n }\n }\n}\nMaskDirective.ɵfac = function MaskDirective_Factory(t) { return new (t || MaskDirective)(ɵngcc0.ɵɵdirectiveInject(DOCUMENT), ɵngcc0.ɵɵdirectiveInject(MaskService), ɵngcc0.ɵɵdirectiveInject(config)); };\nMaskDirective.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: MaskDirective, selectors: [[\"input\", \"mask\", \"\"], [\"textarea\", \"mask\", \"\"]], hostBindings: function MaskDirective_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"paste\", function MaskDirective_paste_HostBindingHandler() { return ctx.onPaste(); })(\"input\", function MaskDirective_input_HostBindingHandler($event) { return ctx.onInput($event); })(\"blur\", function MaskDirective_blur_HostBindingHandler() { return ctx.onBlur(); })(\"click\", function MaskDirective_click_HostBindingHandler($event) { return ctx.onFocus($event); })(\"keydown\", function MaskDirective_keydown_HostBindingHandler($event) { return ctx.onKeyDown($event); });\n } }, inputs: { maskExpression: [\"mask\", \"maskExpression\"], specialCharacters: \"specialCharacters\", patterns: \"patterns\", prefix: \"prefix\", suffix: \"suffix\", thousandSeparator: \"thousandSeparator\", decimalMarker: \"decimalMarker\", dropSpecialCharacters: \"dropSpecialCharacters\", hiddenInput: \"hiddenInput\", showMaskTyped: \"showMaskTyped\", placeHolderCharacter: \"placeHolderCharacter\", shownMaskExpression: \"shownMaskExpression\", showTemplate: \"showTemplate\", clearIfNotMatch: \"clearIfNotMatch\", validation: \"validation\", separatorLimit: \"separatorLimit\", allowNegativeNumbers: \"allowNegativeNumbers\", leadZeroDateTime: \"leadZeroDateTime\" }, features: [ɵngcc0.ɵɵProvidersFeature([\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => MaskDirective),\n multi: true\n },\n {\n provide: NG_VALIDATORS,\n useExisting: forwardRef(() => MaskDirective),\n multi: true\n },\n MaskService,\n ]), ɵngcc0.ɵɵNgOnChangesFeature] });\nMaskDirective.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: MaskService },\n { type: undefined, decorators: [{ type: Inject, args: [config,] }] }\n];\nMaskDirective.propDecorators = {\n maskExpression: [{ type: Input, args: ['mask',] }],\n specialCharacters: [{ type: Input }],\n patterns: [{ type: Input }],\n prefix: [{ type: Input }],\n suffix: [{ type: Input }],\n thousandSeparator: [{ type: Input }],\n decimalMarker: [{ type: Input }],\n dropSpecialCharacters: [{ type: Input }],\n hiddenInput: [{ type: Input }],\n showMaskTyped: [{ type: Input }],\n placeHolderCharacter: [{ type: Input }],\n shownMaskExpression: [{ type: Input }],\n showTemplate: [{ type: Input }],\n clearIfNotMatch: [{ type: Input }],\n validation: [{ type: Input }],\n separatorLimit: [{ type: Input }],\n allowNegativeNumbers: [{ type: Input }],\n leadZeroDateTime: [{ type: Input }],\n onPaste: [{ type: HostListener, args: ['paste',] }],\n onInput: [{ type: HostListener, args: ['input', ['$event'],] }],\n onBlur: [{ type: HostListener, args: ['blur',] }],\n onFocus: [{ type: HostListener, args: ['click', ['$event'],] }],\n onKeyDown: [{ type: HostListener, args: ['keydown', ['$event'],] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(MaskDirective, [{\n type: Directive,\n args: [{\n selector: 'input[mask], textarea[mask]',\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => MaskDirective),\n multi: true\n },\n {\n provide: NG_VALIDATORS,\n useExisting: forwardRef(() => MaskDirective),\n multi: true\n },\n MaskService,\n ]\n }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: MaskService }, { type: undefined, decorators: [{\n type: Inject,\n args: [config]\n }] }]; }, { maskExpression: [{\n type: Input,\n args: ['mask']\n }], specialCharacters: [{\n type: Input\n }], patterns: [{\n type: Input\n }], prefix: [{\n type: Input\n }], suffix: [{\n type: Input\n }], thousandSeparator: [{\n type: Input\n }], decimalMarker: [{\n type: Input\n }], dropSpecialCharacters: [{\n type: Input\n }], hiddenInput: [{\n type: Input\n }], showMaskTyped: [{\n type: Input\n }], placeHolderCharacter: [{\n type: Input\n }], shownMaskExpression: [{\n type: Input\n }], showTemplate: [{\n type: Input\n }], clearIfNotMatch: [{\n type: Input\n }], validation: [{\n type: Input\n }], separatorLimit: [{\n type: Input\n }], allowNegativeNumbers: [{\n type: Input\n }], leadZeroDateTime: [{\n type: Input\n }], onPaste: [{\n type: HostListener,\n args: ['paste']\n }], onInput: [{\n type: HostListener,\n args: ['input', ['$event']]\n }], onBlur: [{\n type: HostListener,\n args: ['blur']\n }], onFocus: [{\n type: HostListener,\n args: ['click', ['$event']]\n }], \n // tslint:disable-next-line: cyclomatic-complexity\n onKeyDown: [{\n type: HostListener,\n args: ['keydown', ['$event']]\n }] }); })();\n\nclass MaskPipe {\n constructor(_maskService) {\n this._maskService = _maskService;\n }\n transform(value, mask, thousandSeparator = null) {\n if (!value && typeof value !== 'number') {\n return '';\n }\n if (thousandSeparator) {\n this._maskService.thousandSeparator = thousandSeparator;\n }\n if (typeof mask === 'string') {\n return this._maskService.applyMask(`${value}`, mask);\n }\n return this._maskService.applyMaskWithPattern(`${value}`, mask);\n }\n}\nMaskPipe.ɵfac = function MaskPipe_Factory(t) { return new (t || MaskPipe)(ɵngcc0.ɵɵdirectiveInject(MaskApplierService, 16)); };\nMaskPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"mask\", type: MaskPipe, pure: true });\nMaskPipe.ctorParameters = () => [\n { type: MaskApplierService }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(MaskPipe, [{\n type: Pipe,\n args: [{\n name: 'mask',\n pure: true\n }]\n }], function () { return [{ type: MaskApplierService }]; }, null); })();\n\nclass NgxMaskModule {\n static forRoot(configValue) {\n return {\n ngModule: NgxMaskModule,\n providers: [\n {\n provide: NEW_CONFIG,\n useValue: configValue,\n },\n {\n provide: INITIAL_CONFIG,\n useValue: initialConfig,\n },\n {\n provide: config,\n useFactory: _configFactory,\n deps: [INITIAL_CONFIG, NEW_CONFIG],\n },\n MaskApplierService,\n ],\n };\n }\n static forChild() {\n return {\n ngModule: NgxMaskModule,\n };\n }\n}\nNgxMaskModule.ɵfac = function NgxMaskModule_Factory(t) { return new (t || NgxMaskModule)(); };\nNgxMaskModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: NgxMaskModule });\nNgxMaskModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMaskModule, [{\n type: NgModule,\n args: [{\n exports: [MaskDirective, MaskPipe],\n declarations: [MaskDirective, MaskPipe]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(NgxMaskModule, { declarations: [MaskDirective, MaskPipe], exports: [MaskDirective, MaskPipe] }); })();\n/**\n * @internal\n */\nfunction _configFactory(initConfig, configValue) {\n return configValue instanceof Function ? Object.assign(Object.assign({}, initConfig), configValue()) : Object.assign(Object.assign({}, initConfig), configValue);\n}\n\nconst commonjsGlobal = typeof globalThis !== 'undefined'\n ? globalThis\n : typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : typeof self !== 'undefined'\n ? self\n : {};\n(function () {\n if (!commonjsGlobal.KeyboardEvent) {\n commonjsGlobal.KeyboardEvent = function (_eventType, _init) { };\n }\n})();\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { INITIAL_CONFIG, MaskApplierService, MaskDirective, MaskPipe, MaskService, NEW_CONFIG, NgxMaskModule, _configFactory, config, initialConfig, timeMasks, withoutValidation };\n\n","import { Directive, HostListener, Input, NgModule } from '@angular/core';\n\n/**\r\n * @fileoverview added by tsickle\r\n * @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\r\n */\r\nimport * as ɵngcc0 from '@angular/core';\nclass NgxPrintDirective {\r\n constructor() {\r\n this._printStyle = [];\r\n /**\r\n *\r\n *\r\n * \\@memberof NgxPrintDirective\r\n */\r\n this.useExistingCss = false;\r\n /**\r\n * A delay in milliseconds to force the print dialog to wait before opened. Default: 0\r\n *\r\n * \\@memberof NgxPrintDirective\r\n */\r\n this.printDelay = 0;\r\n /**\r\n *\r\n *\r\n * @return html for the given tag\r\n *\r\n * \\@memberof NgxPrintDirective\r\n */\r\n this._styleSheetFile = '';\r\n }\r\n /**\r\n *\r\n *\r\n * \\@memberof NgxPrintDirective\r\n * @param {?} values\r\n * @return {?}\r\n */\r\n set printStyle(values) {\r\n for (let key in values) {\r\n if (values.hasOwnProperty(key)) {\r\n this._printStyle.push((key + JSON.stringify(values[key])).replace(/['\"]+/g, ''));\r\n }\r\n }\r\n this.returnStyleValues();\r\n }\r\n /**\r\n *\r\n *\r\n * \\@memberof NgxPrintDirective\r\n * @return {?} the string that create the stylesheet which will be injected\r\n * later within tag.\r\n *\r\n * -join/replace to transform an array objects to css-styled string\r\n *\r\n */\r\n returnStyleValues() {\r\n return ``;\r\n }\r\n /**\r\n * \\@memberof NgxPrintDirective\r\n * @param {?} cssList\r\n * @return {?}\r\n */\r\n set styleSheetFile(cssList) {\r\n /** @type {?} */\r\n let linkTagFn = (/**\r\n * @param {?} cssFileName\r\n * @return {?}\r\n */\r\n function (cssFileName) {\r\n return ``;\r\n });\r\n if (cssList.indexOf(',') !== -1) {\r\n /** @type {?} */\r\n const valueArr = cssList.split(',');\r\n for (let val of valueArr) {\r\n this._styleSheetFile = this._styleSheetFile + linkTagFn(val);\r\n }\r\n }\r\n else {\r\n this._styleSheetFile = linkTagFn(cssList);\r\n }\r\n }\r\n /**\r\n * @private\r\n * @return {?} string which contains the link tags containing the css which will\r\n * be injected later within tag.\r\n *\r\n */\r\n returnStyleSheetLinkTags() {\r\n return this._styleSheetFile;\r\n }\r\n /**\r\n * @private\r\n * @param {?} tag\r\n * @return {?}\r\n */\r\n getElementTag(tag) {\r\n /** @type {?} */\r\n const html = [];\r\n /** @type {?} */\r\n const elements = document.getElementsByTagName(tag);\r\n for (let index = 0; index < elements.length; index++) {\r\n html.push(elements[index].outerHTML);\r\n }\r\n return html.join('\\r\\n');\r\n }\r\n /**\r\n *\r\n * @private\r\n * @param {?} data the html element collection to save defaults to\r\n *\r\n * @return {?}\r\n */\r\n getFormData(data) {\r\n for (var i = 0; i < data.length; i++) {\r\n data[i].defaultValue = data[i].value;\r\n if (data[i].checked) {\r\n data[i].defaultChecked = true;\r\n }\r\n }\r\n }\r\n /**\r\n * @private\r\n * @return {?} html section to be printed along with some associated inputs\r\n *\r\n */\r\n getHtmlContents() {\r\n /** @type {?} */\r\n let printContents = document.getElementById(this.printSectionId);\r\n /** @type {?} */\r\n let innards = printContents.getElementsByTagName('input');\r\n this.getFormData(innards);\r\n /** @type {?} */\r\n let txt = printContents.getElementsByTagName('textarea');\r\n this.getFormData(txt);\r\n return printContents.innerHTML;\r\n }\r\n /**\r\n *\r\n *\r\n * \\@memberof NgxPrintDirective\r\n * @return {?}\r\n */\r\n print() {\r\n /** @type {?} */\r\n let printContents;\r\n /** @type {?} */\r\n let popupWin;\r\n /** @type {?} */\r\n let styles = '';\r\n /** @type {?} */\r\n let links = '';\r\n /** @type {?} */\r\n const baseTag = this.getElementTag('base');\r\n if (this.useExistingCss) {\r\n styles = this.getElementTag('style');\r\n links = this.getElementTag('link');\r\n }\r\n printContents = this.getHtmlContents();\r\n popupWin = window.open(\"\", \"_blank\", \"top=0,left=0,height=auto,width=auto\");\r\n popupWin.document.open();\r\n popupWin.document.write(`\r\n \r\n \r\n ${this.printTitle ? this.printTitle : \"\"}\r\n ${baseTag}\r\n ${this.returnStyleValues()}\r\n ${this.returnStyleSheetLinkTags()}\r\n ${styles}\r\n ${links}\r\n \r\n \r\n ${printContents}\r\n \r\n \r\n `);\r\n popupWin.document.close();\r\n }\r\n}\nNgxPrintDirective.ɵfac = function NgxPrintDirective_Factory(t) { return new (t || NgxPrintDirective)(); };\nNgxPrintDirective.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgxPrintDirective, selectors: [[\"button\", \"ngxPrint\", \"\"]], hostBindings: function NgxPrintDirective_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"click\", function NgxPrintDirective_click_HostBindingHandler() { return ctx.print(); });\n } }, inputs: { useExistingCss: \"useExistingCss\", printDelay: \"printDelay\", printStyle: \"printStyle\", styleSheetFile: \"styleSheetFile\", printSectionId: \"printSectionId\", printTitle: \"printTitle\" } });\r\nNgxPrintDirective.propDecorators = {\r\n printSectionId: [{ type: Input }],\r\n printTitle: [{ type: Input }],\r\n useExistingCss: [{ type: Input }],\r\n printDelay: [{ type: Input }],\r\n printStyle: [{ type: Input }],\r\n styleSheetFile: [{ type: Input }],\r\n print: [{ type: HostListener, args: ['click',] }]\r\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxPrintDirective, [{\n type: Directive,\n args: [{\n selector: \"button[ngxPrint]\"\n }]\n }], function () { return []; }, { useExistingCss: [{\n type: Input\n }], printDelay: [{\n type: Input\n }], printStyle: [{\n type: Input\n }], styleSheetFile: [{\n type: Input\n }], \n /**\n *\n *\n * \\@memberof NgxPrintDirective\n * @return {?}\n */\n print: [{\n type: HostListener,\n args: ['click']\n }], printSectionId: [{\n type: Input\n }], printTitle: [{\n type: Input\n }] }); })();\n\n/**\r\n * @fileoverview added by tsickle\r\n * @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\r\n */\r\nclass NgxPrintModule {\r\n}\nNgxPrintModule.ɵfac = function NgxPrintModule_Factory(t) { return new (t || NgxPrintModule)(); };\nNgxPrintModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: NgxPrintModule });\nNgxPrintModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [[]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxPrintModule, [{\n type: NgModule,\n args: [{\n declarations: [NgxPrintDirective],\n imports: [],\n exports: [NgxPrintDirective]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(NgxPrintModule, { declarations: [NgxPrintDirective], exports: [NgxPrintDirective] }); })();\n\n/**\r\n * @fileoverview added by tsickle\r\n * @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\r\n */\n\n/**\r\n * @fileoverview added by tsickle\r\n * @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\r\n */\n\nexport { NgxPrintDirective, NgxPrintModule };\n\n","import { InjectionToken, isDevMode, Component, ChangeDetectionStrategy, Inject, Optional, Input, NgModule } from '@angular/core';\nimport { start, end } from 'perf-marks/marks';\nimport { CommonModule } from '@angular/common';\n\n/**\n * @fileoverview added by tsickle\n * Generated from: lib/ngx-skeleton-loader-config.types.ts\n * @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\n */\n/**\n * @record\n */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/common';\n\nconst _c0 = function (a0, a1, a2, a3) { return { circle: a0, progress: a1, \"progress-dark\": a2, pulse: a3 }; };\nfunction NgxSkeletonLoaderComponent_span_0_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelement(0, \"span\", 1);\n} if (rf & 2) {\n const ctx_r0 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵproperty(\"ngClass\", ɵngcc0.ɵɵpureFunction4(3, _c0, ctx_r0.appearance === \"circle\", ctx_r0.animation === \"progress\", ctx_r0.animation === \"progress-dark\", ctx_r0.animation === \"pulse\"))(\"ngStyle\", ctx_r0.theme);\n ɵngcc0.ɵɵattribute(\"aria-valuetext\", ctx_r0.loadingText);\n} }\nfunction NgxSkeletonLoaderConfig() { }\nif (false) {\n /** @type {?} */\n NgxSkeletonLoaderConfig.prototype.appearance;\n /** @type {?} */\n NgxSkeletonLoaderConfig.prototype.animation;\n /** @type {?} */\n NgxSkeletonLoaderConfig.prototype.theme;\n /** @type {?} */\n NgxSkeletonLoaderConfig.prototype.loadingText;\n /** @type {?} */\n NgxSkeletonLoaderConfig.prototype.count;\n}\n/** @type {?} */\nconst NGX_SKELETON_LOADER_CONFIG = new InjectionToken('ngx-skeleton-loader.config');\n\n/**\n * @fileoverview added by tsickle\n * Generated from: lib/ngx-skeleton-loader.component.ts\n * @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\n */\nclass NgxSkeletonLoaderComponent {\n /**\n * @param {?=} config\n */\n constructor(config) {\n const { appearance = 'line', animation = 'progress', theme = null, loadingText = 'Loading...', count = 1 } = config || {};\n this.appearance = appearance;\n this.animation = animation;\n this.theme = theme;\n this.loadingText = loadingText;\n this.count = count;\n this.items = [];\n }\n /**\n * @return {?}\n */\n ngOnInit() {\n start('NgxSkeletonLoader:Rendered');\n start('NgxSkeletonLoader:Loaded');\n this.validateInputValues();\n }\n /**\n * @private\n * @return {?}\n */\n validateInputValues() {\n // Checking if it's receiving a numeric value (string having ONLY numbers or if it's a number)\n if (!/^\\d+$/.test(`${this.count}`)) {\n // Shows error message only in Development\n if (isDevMode()) {\n console.error(`\\`NgxSkeletonLoaderComponent\\` need to receive 'count' a numeric value. Forcing default to \"1\".`);\n }\n this.count = 1;\n }\n this.items.length = this.count;\n /** @type {?} */\n const allowedAnimations = ['progress', 'progress-dark', 'pulse', 'false'];\n if (allowedAnimations.indexOf(String(this.animation)) === -1) {\n // Shows error message only in Development\n if (isDevMode()) {\n console.error(`\\`NgxSkeletonLoaderComponent\\` need to receive 'animation' as: ${allowedAnimations.join(', ')}. Forcing default to \"progress\".`);\n }\n this.animation = 'progress';\n }\n if (['circle', 'line', ''].indexOf(String(this.appearance)) === -1) {\n // Shows error message only in Development\n if (isDevMode()) {\n console.error(`\\`NgxSkeletonLoaderComponent\\` need to receive 'appearance' as: circle or line or empty string. Forcing default to \"''\".`);\n }\n this.appearance = '';\n }\n }\n /**\n * @param {?} changes\n * @return {?}\n */\n ngOnChanges(changes) {\n // Avoiding multiple calls for the same input in case there's no changes in the fields\n // Checking if the fields that require validation are available and if they were changed\n // In case were not changed, we stop the function. Otherwise, `validateInputValues` will be called.\n if (['count', 'animation', 'appearance'].find((/**\n * @param {?} key\n * @return {?}\n */\n key => changes[key] && (changes[key].isFirstChange() || changes[key].previousValue === changes[key].currentValue)))) {\n return;\n }\n this.validateInputValues();\n }\n /**\n * @return {?}\n */\n ngAfterViewInit() {\n end('NgxSkeletonLoader:Rendered');\n }\n /**\n * @return {?}\n */\n ngOnDestroy() {\n end('NgxSkeletonLoader:Loaded');\n }\n}\nNgxSkeletonLoaderComponent.ɵfac = function NgxSkeletonLoaderComponent_Factory(t) { return new (t || NgxSkeletonLoaderComponent)(ɵngcc0.ɵɵdirectiveInject(NGX_SKELETON_LOADER_CONFIG, 8)); };\nNgxSkeletonLoaderComponent.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: NgxSkeletonLoaderComponent, selectors: [[\"ngx-skeleton-loader\"]], inputs: { appearance: \"appearance\", animation: \"animation\", theme: \"theme\", loadingText: \"loadingText\", count: \"count\" }, features: [ɵngcc0.ɵɵNgOnChangesFeature], decls: 1, vars: 1, consts: [[\"class\", \"loader\", \"aria-busy\", \"true\", \"aria-valuemin\", \"0\", \"aria-valuemax\", \"100\", \"role\", \"progressbar\", \"tabindex\", \"0\", 3, \"ngClass\", \"ngStyle\", 4, \"ngFor\", \"ngForOf\"], [\"aria-busy\", \"true\", \"aria-valuemin\", \"0\", \"aria-valuemax\", \"100\", \"role\", \"progressbar\", \"tabindex\", \"0\", 1, \"loader\", 3, \"ngClass\", \"ngStyle\"]], template: function NgxSkeletonLoaderComponent_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵtemplate(0, NgxSkeletonLoaderComponent_span_0_Template, 1, 8, \"span\", 0);\n } if (rf & 2) {\n ɵngcc0.ɵɵproperty(\"ngForOf\", ctx.items);\n } }, directives: [ɵngcc1.NgForOf, ɵngcc1.NgClass, ɵngcc1.NgStyle], styles: [\".loader[_ngcontent-%COMP%]{background:#eff1f6 no-repeat;border-radius:4px;box-sizing:border-box;display:inline-block;height:20px;margin-bottom:10px;overflow:hidden;position:relative;width:100%;will-change:transform}.loader[_ngcontent-%COMP%]:after, .loader[_ngcontent-%COMP%]:before{box-sizing:border-box}.loader.circle[_ngcontent-%COMP%]{border-radius:50%;height:40px;margin:5px;width:40px}.loader.progress[_ngcontent-%COMP%], .loader.progress-dark[_ngcontent-%COMP%]{transform:translateZ(0)}.loader.progress-dark[_ngcontent-%COMP%]:after, .loader.progress-dark[_ngcontent-%COMP%]:before, .loader.progress[_ngcontent-%COMP%]:after, .loader.progress[_ngcontent-%COMP%]:before{box-sizing:border-box}.loader.progress-dark[_ngcontent-%COMP%]:before, .loader.progress[_ngcontent-%COMP%]:before{-webkit-animation:progress 2s ease-in-out infinite;animation:progress 2s ease-in-out infinite;background-size:200px 100%;content:\\\"\\\";height:100%;left:0;position:absolute;top:0;width:200px;z-index:1}.loader.progress[_ngcontent-%COMP%]:before{background-image:linear-gradient(90deg,hsla(0,0%,100%,0),hsla(0,0%,100%,.6),hsla(0,0%,100%,0))}.loader.progress-dark[_ngcontent-%COMP%]:before{background-image:linear-gradient(90deg,transparent,rgba(0,0,0,.2),transparent)}.loader.pulse[_ngcontent-%COMP%]{-webkit-animation:pulse 1.5s cubic-bezier(.4,0,.2,1) infinite;-webkit-animation-delay:.5s;animation:pulse 1.5s cubic-bezier(.4,0,.2,1) infinite;animation-delay:.5s}@media (prefers-reduced-motion:reduce){.loader.progress[_ngcontent-%COMP%], .loader.progress-dark[_ngcontent-%COMP%], .loader.pulse[_ngcontent-%COMP%]{-webkit-animation:none;animation:none}.loader.progress[_ngcontent-%COMP%], .loader.progress-dark[_ngcontent-%COMP%]{background-image:none}}@-webkit-keyframes progress{0%{transform:translate3d(-200px,0,0)}to{transform:translate3d(calc(200px + 100vw),0,0)}}@keyframes progress{0%{transform:translate3d(-200px,0,0)}to{transform:translate3d(calc(200px + 100vw),0,0)}}@-webkit-keyframes pulse{0%{opacity:1}50%{opacity:.4}to{opacity:1}}@keyframes pulse{0%{opacity:1}50%{opacity:.4}to{opacity:1}}\"], changeDetection: 0 });\n/** @nocollapse */\nNgxSkeletonLoaderComponent.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [NGX_SKELETON_LOADER_CONFIG,] }, { type: Optional }] }\n];\nNgxSkeletonLoaderComponent.propDecorators = {\n count: [{ type: Input }],\n loadingText: [{ type: Input }],\n appearance: [{ type: Input }],\n animation: [{ type: Input }],\n theme: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxSkeletonLoaderComponent, [{\n type: Component,\n args: [{\n selector: 'ngx-skeleton-loader',\n template: \"\\n\\n\",\n changeDetection: ChangeDetectionStrategy.OnPush,\n styles: [\".loader{background:#eff1f6 no-repeat;border-radius:4px;box-sizing:border-box;display:inline-block;height:20px;margin-bottom:10px;overflow:hidden;position:relative;width:100%;will-change:transform}.loader:after,.loader:before{box-sizing:border-box}.loader.circle{border-radius:50%;height:40px;margin:5px;width:40px}.loader.progress,.loader.progress-dark{transform:translateZ(0)}.loader.progress-dark:after,.loader.progress-dark:before,.loader.progress:after,.loader.progress:before{box-sizing:border-box}.loader.progress-dark:before,.loader.progress:before{-webkit-animation:progress 2s ease-in-out infinite;animation:progress 2s ease-in-out infinite;background-size:200px 100%;content:\\\"\\\";height:100%;left:0;position:absolute;top:0;width:200px;z-index:1}.loader.progress:before{background-image:linear-gradient(90deg,hsla(0,0%,100%,0),hsla(0,0%,100%,.6),hsla(0,0%,100%,0))}.loader.progress-dark:before{background-image:linear-gradient(90deg,transparent,rgba(0,0,0,.2),transparent)}.loader.pulse{-webkit-animation:pulse 1.5s cubic-bezier(.4,0,.2,1) infinite;-webkit-animation-delay:.5s;animation:pulse 1.5s cubic-bezier(.4,0,.2,1) infinite;animation-delay:.5s}@media (prefers-reduced-motion:reduce){.loader.progress,.loader.progress-dark,.loader.pulse{-webkit-animation:none;animation:none}.loader.progress,.loader.progress-dark{background-image:none}}@-webkit-keyframes progress{0%{transform:translate3d(-200px,0,0)}to{transform:translate3d(calc(200px + 100vw),0,0)}}@keyframes progress{0%{transform:translate3d(-200px,0,0)}to{transform:translate3d(calc(200px + 100vw),0,0)}}@-webkit-keyframes pulse{0%{opacity:1}50%{opacity:.4}to{opacity:1}}@keyframes pulse{0%{opacity:1}50%{opacity:.4}to{opacity:1}}\"]\n }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [NGX_SKELETON_LOADER_CONFIG]\n }, {\n type: Optional\n }] }]; }, { appearance: [{\n type: Input\n }], animation: [{\n type: Input\n }], theme: [{\n type: Input\n }], loadingText: [{\n type: Input\n }], count: [{\n type: Input\n }] }); })();\nif (false) {\n /** @type {?} */\n NgxSkeletonLoaderComponent.ngAcceptInputType_count;\n /** @type {?} */\n NgxSkeletonLoaderComponent.ngAcceptInputType_animation;\n /** @type {?} */\n NgxSkeletonLoaderComponent.prototype.count;\n /** @type {?} */\n NgxSkeletonLoaderComponent.prototype.loadingText;\n /** @type {?} */\n NgxSkeletonLoaderComponent.prototype.appearance;\n /** @type {?} */\n NgxSkeletonLoaderComponent.prototype.animation;\n /** @type {?} */\n NgxSkeletonLoaderComponent.prototype.theme;\n /** @type {?} */\n NgxSkeletonLoaderComponent.prototype.items;\n}\n\n/**\n * @fileoverview added by tsickle\n * Generated from: lib/ngx-skeleton-loader.module.ts\n * @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\n */\nclass NgxSkeletonLoaderModule {\n /**\n * @param {?=} config\n * @return {?}\n */\n static forRoot(config) {\n return {\n ngModule: NgxSkeletonLoaderModule,\n providers: [{ provide: NGX_SKELETON_LOADER_CONFIG, useValue: config }],\n };\n }\n}\nNgxSkeletonLoaderModule.ɵfac = function NgxSkeletonLoaderModule_Factory(t) { return new (t || NgxSkeletonLoaderModule)(); };\nNgxSkeletonLoaderModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: NgxSkeletonLoaderModule });\nNgxSkeletonLoaderModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [[CommonModule]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxSkeletonLoaderModule, [{\n type: NgModule,\n args: [{\n declarations: [NgxSkeletonLoaderComponent],\n imports: [CommonModule],\n exports: [NgxSkeletonLoaderComponent]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(NgxSkeletonLoaderModule, { declarations: function () { return [NgxSkeletonLoaderComponent]; }, imports: function () { return [CommonModule]; }, exports: function () { return [NgxSkeletonLoaderComponent]; } }); })();\n\n/**\n * @fileoverview added by tsickle\n * Generated from: public-api.ts\n * @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\n */\n\n/**\n * @fileoverview added by tsickle\n * Generated from: ngx-skeleton-loader.ts\n * @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc\n */\n\nexport { NGX_SKELETON_LOADER_CONFIG, NgxSkeletonLoaderComponent, NgxSkeletonLoaderModule };\n\n","/**\n * Boolean with the result of the check if package\n * is running on the browser or in a NodeJS environment\n *\n * @returns boolean\n *\n */\nconst isNodeJSEnv = Object.prototype.toString.call(typeof process !== 'undefined' ? process : 0) === '[object process]';\n// Interesting fact:\n// Some bundlers are resolving `process`, so it needs to check for process.release.name\n// since it's a NodeJS only environment value.\n// More details in https://nodejs.org/api/process.html#process_process_release\nexport { isNodeJSEnv };\n","/**\n * Boolean with the result of the check if PerformanceObservable\n * is supported for the current browser/NodeJS version\n *\n * @returns boolean\n *\n */\nconst isPerformanceObservableSupported = typeof PerformanceObserver !== 'undefined' &&\n // eslint-disable-next-line compat/compat\n typeof PerformanceObserver.prototype !== 'undefined' &&\n // eslint-disable-next-line compat/compat\n typeof PerformanceObserver.prototype.constructor === 'function';\nexport { isPerformanceObservableSupported };\n","/**\n * Boolean with the result of the check if User Timing API\n * is supported for the current browser/NodeJS version\n *\n * @returns boolean\n *\n */\nconst isUserTimingAPISupported = typeof performance !== 'undefined' &&\n typeof performance.now !== 'undefined' &&\n typeof performance.mark === 'function' &&\n typeof performance.measure === 'function' &&\n (typeof performance.clearMarks === 'function' || typeof performance.clearMeasures === 'function');\nexport { isUserTimingAPISupported };\n","import { isUserTimingAPISupported } from './is-user-timing-api-supported';\nimport { isPerformanceObservableSupported } from './is-performance-observable-supported';\nimport { isNodeJSEnv } from './is-nodejs-env';\n// Map() is not used in order to decrease the bundle\nlet marksMap = {};\nlet marksObserver = {};\n/**\n * Get the current time based on User Timing API or Date\n *\n * @returns number\n *\n */\nconst getTimeNow = () => (isUserTimingAPISupported ? performance.now() : Date.now());\n/**\n * Clear marks and measure of performance event\n *\n * @param markName - Performance marker to be checked\n *\n * @returns void\n *\n */\nconst clear = (markName) => {\n marksMap[markName] = undefined;\n // Removes PerformanceObserver references from memory\n if (!!marksObserver[markName]) {\n marksObserver[markName] = undefined;\n }\n if (!isUserTimingAPISupported) {\n return;\n }\n // Some versions of NodeJS doesn't support this method\n if (!isNodeJSEnv) {\n performance.clearMeasures(markName);\n }\n performance.clearMarks(markName);\n};\n/**\n * Start performance measure of event\n *\n * @param markName - Performance marker to be started\n *\n * @returns number\n *\n */\nconst start = (markName) => {\n if (isUserTimingAPISupported) {\n if (isNodeJSEnv && isPerformanceObservableSupported) {\n // eslint-disable-next-line compat/compat\n const obs = new PerformanceObserver(list => {\n marksObserver[markName] = list.getEntries().find(f => f.name === markName);\n obs.disconnect();\n });\n obs.observe({ entryTypes: ['measure'] });\n }\n performance.mark(markName);\n }\n marksMap[markName] = getTimeNow();\n};\n/**\n * Finishes performance measure of event and\n * clear marks and measure if applicable\n *\n * @param markName - Performance marker to be checked\n * @param markNameToCompare - Optional mark to compare to\n *\n * @returns PerfMarksPerformanceEntry\n *\n */\nconst end = (markName, markNameToCompare) => {\n try {\n const startTime = marksMap[markName];\n if (!isUserTimingAPISupported) {\n return startTime\n ? { duration: getTimeNow() - startTime, startTime, entryType: 'measure', name: markName }\n : {};\n }\n // If there's no User Timing mark to be compared with,\n // the package will create one to be used for better comparison\n if (!markNameToCompare) {\n performance.mark(`${markName}-end`);\n }\n performance.measure(markName, markName, markNameToCompare || `${markName}-end`);\n if (isNodeJSEnv) {\n if (!!marksObserver[markName]) {\n return marksObserver[markName];\n }\n return startTime\n ? { duration: getTimeNow() - startTime, startTime, entryType: 'measure', name: markName }\n : {};\n }\n const entry = performance.getEntriesByName(markName).pop();\n return entry || {};\n }\n catch (e) {\n // If previous mark was missing for some reason, this will throw.\n // This could only happen if something in event loop crashed\n // in an unexpected place earlier.\n // Don't pile on with more errors.\n return {};\n }\n finally {\n // Clear marks immediately to avoid growing buffer.\n clear(markName);\n // Clear marks used for comparison in case of it's value was passed\n // If the mark to compare is not passed, it should remove the one we create with `-end` suffix\n clear(markNameToCompare || `${markName}-end`);\n }\n};\n/**\n * Clear all marks and measures of performance event\n *\n * @returns void\n *\n */\nconst clearAll = () => {\n marksMap = {};\n marksObserver = {};\n if (!isUserTimingAPISupported) {\n return;\n }\n // Some versions of NodeJS doesn't support this method\n if (!isNodeJSEnv) {\n performance.clearMeasures();\n }\n performance.clearMarks();\n};\nexport { start, end, clear, clearAll, isUserTimingAPISupported, isPerformanceObservableSupported };\n","import { Subject } from './Subject';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nexport class BehaviorSubject extends Subject {\n constructor(_value) {\n super();\n this._value = _value;\n }\n get value() {\n return this.getValue();\n }\n _subscribe(subscriber) {\n const subscription = super._subscribe(subscriber);\n if (subscription && !subscription.closed) {\n subscriber.next(this._value);\n }\n return subscription;\n }\n getValue() {\n if (this.hasError) {\n throw this.thrownError;\n }\n else if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return this._value;\n }\n }\n next(value) {\n super.next(this._value = value);\n }\n}\n","import { Subscriber } from './Subscriber';\nexport class InnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n this.index = 0;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this.index++, this);\n }\n _error(error) {\n this.parent.notifyError(error, this);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\n","import { empty } from './observable/empty';\nimport { of } from './observable/of';\nimport { throwError } from './observable/throwError';\nexport var NotificationKind;\n(function (NotificationKind) {\n NotificationKind[\"NEXT\"] = \"N\";\n NotificationKind[\"ERROR\"] = \"E\";\n NotificationKind[\"COMPLETE\"] = \"C\";\n})(NotificationKind || (NotificationKind = {}));\nexport class Notification {\n constructor(kind, value, error) {\n this.kind = kind;\n this.value = value;\n this.error = error;\n this.hasValue = kind === 'N';\n }\n observe(observer) {\n switch (this.kind) {\n case 'N':\n return observer.next && observer.next(this.value);\n case 'E':\n return observer.error && observer.error(this.error);\n case 'C':\n return observer.complete && observer.complete();\n }\n }\n do(next, error, complete) {\n const kind = this.kind;\n switch (kind) {\n case 'N':\n return next && next(this.value);\n case 'E':\n return error && error(this.error);\n case 'C':\n return complete && complete();\n }\n }\n accept(nextOrObserver, error, complete) {\n if (nextOrObserver && typeof nextOrObserver.next === 'function') {\n return this.observe(nextOrObserver);\n }\n else {\n return this.do(nextOrObserver, error, complete);\n }\n }\n toObservable() {\n const kind = this.kind;\n switch (kind) {\n case 'N':\n return of(this.value);\n case 'E':\n return throwError(this.error);\n case 'C':\n return empty();\n }\n throw new Error('unexpected notification kind value');\n }\n static createNext(value) {\n if (typeof value !== 'undefined') {\n return new Notification('N', value);\n }\n return Notification.undefinedValueNotification;\n }\n static createError(err) {\n return new Notification('E', undefined, err);\n }\n static createComplete() {\n return Notification.completeNotification;\n }\n}\nNotification.completeNotification = new Notification('C');\nNotification.undefinedValueNotification = new Notification('N', undefined);\n","import { canReportError } from './util/canReportError';\nimport { toSubscriber } from './util/toSubscriber';\nimport { observable as Symbol_observable } from './symbol/observable';\nimport { pipeFromArray } from './util/pipe';\nimport { config } from './config';\nexport class Observable {\n constructor(subscribe) {\n this._isScalar = false;\n if (subscribe) {\n this._subscribe = subscribe;\n }\n }\n lift(operator) {\n const observable = new Observable();\n observable.source = this;\n observable.operator = operator;\n return observable;\n }\n subscribe(observerOrNext, error, complete) {\n const { operator } = this;\n const sink = toSubscriber(observerOrNext, error, complete);\n if (operator) {\n sink.add(operator.call(sink, this.source));\n }\n else {\n sink.add(this.source || (config.useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ?\n this._subscribe(sink) :\n this._trySubscribe(sink));\n }\n if (config.useDeprecatedSynchronousErrorHandling) {\n if (sink.syncErrorThrowable) {\n sink.syncErrorThrowable = false;\n if (sink.syncErrorThrown) {\n throw sink.syncErrorValue;\n }\n }\n }\n return sink;\n }\n _trySubscribe(sink) {\n try {\n return this._subscribe(sink);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n sink.syncErrorThrown = true;\n sink.syncErrorValue = err;\n }\n if (canReportError(sink)) {\n sink.error(err);\n }\n else {\n console.warn(err);\n }\n }\n }\n forEach(next, promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let subscription;\n subscription = this.subscribe((value) => {\n try {\n next(value);\n }\n catch (err) {\n reject(err);\n if (subscription) {\n subscription.unsubscribe();\n }\n }\n }, reject, resolve);\n });\n }\n _subscribe(subscriber) {\n const { source } = this;\n return source && source.subscribe(subscriber);\n }\n [Symbol_observable]() {\n return this;\n }\n pipe(...operations) {\n if (operations.length === 0) {\n return this;\n }\n return pipeFromArray(operations)(this);\n }\n toPromise(promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let value;\n this.subscribe((x) => value = x, (err) => reject(err), () => resolve(value));\n });\n }\n}\nObservable.create = (subscribe) => {\n return new Observable(subscribe);\n};\nfunction getPromiseCtor(promiseCtor) {\n if (!promiseCtor) {\n promiseCtor = config.Promise || Promise;\n }\n if (!promiseCtor) {\n throw new Error('no Promise impl found');\n }\n return promiseCtor;\n}\n","import { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport const empty = {\n closed: true,\n next(value) { },\n error(err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n },\n complete() { }\n};\n","import { Subscriber } from './Subscriber';\nexport class OuterSubscriber extends Subscriber {\n notifyNext(outerValue, innerValue, outerIndex, innerIndex, innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error, innerSub) {\n this.destination.error(error);\n }\n notifyComplete(innerSub) {\n this.destination.complete();\n }\n}\n","import { Subject } from './Subject';\nimport { queue } from './scheduler/queue';\nimport { Subscription } from './Subscription';\nimport { ObserveOnSubscriber } from './operators/observeOn';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nexport class ReplaySubject extends Subject {\n constructor(bufferSize = Number.POSITIVE_INFINITY, windowTime = Number.POSITIVE_INFINITY, scheduler) {\n super();\n this.scheduler = scheduler;\n this._events = [];\n this._infiniteTimeWindow = false;\n this._bufferSize = bufferSize < 1 ? 1 : bufferSize;\n this._windowTime = windowTime < 1 ? 1 : windowTime;\n if (windowTime === Number.POSITIVE_INFINITY) {\n this._infiniteTimeWindow = true;\n this.next = this.nextInfiniteTimeWindow;\n }\n else {\n this.next = this.nextTimeWindow;\n }\n }\n nextInfiniteTimeWindow(value) {\n if (!this.isStopped) {\n const _events = this._events;\n _events.push(value);\n if (_events.length > this._bufferSize) {\n _events.shift();\n }\n }\n super.next(value);\n }\n nextTimeWindow(value) {\n if (!this.isStopped) {\n this._events.push(new ReplayEvent(this._getNow(), value));\n this._trimBufferThenGetEvents();\n }\n super.next(value);\n }\n _subscribe(subscriber) {\n const _infiniteTimeWindow = this._infiniteTimeWindow;\n const _events = _infiniteTimeWindow ? this._events : this._trimBufferThenGetEvents();\n const scheduler = this.scheduler;\n const len = _events.length;\n let subscription;\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.isStopped || this.hasError) {\n subscription = Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n subscription = new SubjectSubscription(this, subscriber);\n }\n if (scheduler) {\n subscriber.add(subscriber = new ObserveOnSubscriber(subscriber, scheduler));\n }\n if (_infiniteTimeWindow) {\n for (let i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i]);\n }\n }\n else {\n for (let i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i].value);\n }\n }\n if (this.hasError) {\n subscriber.error(this.thrownError);\n }\n else if (this.isStopped) {\n subscriber.complete();\n }\n return subscription;\n }\n _getNow() {\n return (this.scheduler || queue).now();\n }\n _trimBufferThenGetEvents() {\n const now = this._getNow();\n const _bufferSize = this._bufferSize;\n const _windowTime = this._windowTime;\n const _events = this._events;\n const eventsCount = _events.length;\n let spliceCount = 0;\n while (spliceCount < eventsCount) {\n if ((now - _events[spliceCount].time) < _windowTime) {\n break;\n }\n spliceCount++;\n }\n if (eventsCount > _bufferSize) {\n spliceCount = Math.max(spliceCount, eventsCount - _bufferSize);\n }\n if (spliceCount > 0) {\n _events.splice(0, spliceCount);\n }\n return _events;\n }\n}\nclass ReplayEvent {\n constructor(time, value) {\n this.time = time;\n this.value = value;\n }\n}\n","export class Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n this.SchedulerAction = SchedulerAction;\n this.now = now;\n }\n schedule(work, delay = 0, state) {\n return new this.SchedulerAction(this, work).schedule(state, delay);\n }\n}\nScheduler.now = () => Date.now();\n","import { Observable } from './Observable';\nimport { Subscriber } from './Subscriber';\nimport { Subscription } from './Subscription';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nexport class SubjectSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n this.destination = destination;\n }\n}\nexport class Subject extends Observable {\n constructor() {\n super();\n this.observers = [];\n this.closed = false;\n this.isStopped = false;\n this.hasError = false;\n this.thrownError = null;\n }\n [rxSubscriberSymbol]() {\n return new SubjectSubscriber(this);\n }\n lift(operator) {\n const subject = new AnonymousSubject(this, this);\n subject.operator = operator;\n return subject;\n }\n next(value) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n if (!this.isStopped) {\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].next(value);\n }\n }\n }\n error(err) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.hasError = true;\n this.thrownError = err;\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].error(err);\n }\n this.observers.length = 0;\n }\n complete() {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].complete();\n }\n this.observers.length = 0;\n }\n unsubscribe() {\n this.isStopped = true;\n this.closed = true;\n this.observers = null;\n }\n _trySubscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return super._trySubscribe(subscriber);\n }\n }\n _subscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.hasError) {\n subscriber.error(this.thrownError);\n return Subscription.EMPTY;\n }\n else if (this.isStopped) {\n subscriber.complete();\n return Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n return new SubjectSubscription(this, subscriber);\n }\n }\n asObservable() {\n const observable = new Observable();\n observable.source = this;\n return observable;\n }\n}\nSubject.create = (destination, source) => {\n return new AnonymousSubject(destination, source);\n};\nexport class AnonymousSubject extends Subject {\n constructor(destination, source) {\n super();\n this.destination = destination;\n this.source = source;\n }\n next(value) {\n const { destination } = this;\n if (destination && destination.next) {\n destination.next(value);\n }\n }\n error(err) {\n const { destination } = this;\n if (destination && destination.error) {\n this.destination.error(err);\n }\n }\n complete() {\n const { destination } = this;\n if (destination && destination.complete) {\n this.destination.complete();\n }\n }\n _subscribe(subscriber) {\n const { source } = this;\n if (source) {\n return this.source.subscribe(subscriber);\n }\n else {\n return Subscription.EMPTY;\n }\n }\n}\n","import { Subscription } from './Subscription';\nexport class SubjectSubscription extends Subscription {\n constructor(subject, subscriber) {\n super();\n this.subject = subject;\n this.subscriber = subscriber;\n this.closed = false;\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.closed = true;\n const subject = this.subject;\n const observers = subject.observers;\n this.subject = null;\n if (!observers || observers.length === 0 || subject.isStopped || subject.closed) {\n return;\n }\n const subscriberIndex = observers.indexOf(this.subscriber);\n if (subscriberIndex !== -1) {\n observers.splice(subscriberIndex, 1);\n }\n }\n}\n","import { isFunction } from './util/isFunction';\nimport { empty as emptyObserver } from './Observer';\nimport { Subscription } from './Subscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nimport { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport class Subscriber extends Subscription {\n constructor(destinationOrNext, error, complete) {\n super();\n this.syncErrorValue = null;\n this.syncErrorThrown = false;\n this.syncErrorThrowable = false;\n this.isStopped = false;\n switch (arguments.length) {\n case 0:\n this.destination = emptyObserver;\n break;\n case 1:\n if (!destinationOrNext) {\n this.destination = emptyObserver;\n break;\n }\n if (typeof destinationOrNext === 'object') {\n if (destinationOrNext instanceof Subscriber) {\n this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;\n this.destination = destinationOrNext;\n destinationOrNext.add(this);\n }\n else {\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext);\n }\n break;\n }\n default:\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext, error, complete);\n break;\n }\n }\n [rxSubscriberSymbol]() { return this; }\n static create(next, error, complete) {\n const subscriber = new Subscriber(next, error, complete);\n subscriber.syncErrorThrowable = false;\n return subscriber;\n }\n next(value) {\n if (!this.isStopped) {\n this._next(value);\n }\n }\n error(err) {\n if (!this.isStopped) {\n this.isStopped = true;\n this._error(err);\n }\n }\n complete() {\n if (!this.isStopped) {\n this.isStopped = true;\n this._complete();\n }\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.isStopped = true;\n super.unsubscribe();\n }\n _next(value) {\n this.destination.next(value);\n }\n _error(err) {\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.destination.complete();\n this.unsubscribe();\n }\n _unsubscribeAndRecycle() {\n const { _parentOrParents } = this;\n this._parentOrParents = null;\n this.unsubscribe();\n this.closed = false;\n this.isStopped = false;\n this._parentOrParents = _parentOrParents;\n return this;\n }\n}\nexport class SafeSubscriber extends Subscriber {\n constructor(_parentSubscriber, observerOrNext, error, complete) {\n super();\n this._parentSubscriber = _parentSubscriber;\n let next;\n let context = this;\n if (isFunction(observerOrNext)) {\n next = observerOrNext;\n }\n else if (observerOrNext) {\n next = observerOrNext.next;\n error = observerOrNext.error;\n complete = observerOrNext.complete;\n if (observerOrNext !== emptyObserver) {\n context = Object.create(observerOrNext);\n if (isFunction(context.unsubscribe)) {\n this.add(context.unsubscribe.bind(context));\n }\n context.unsubscribe = this.unsubscribe.bind(this);\n }\n }\n this._context = context;\n this._next = next;\n this._error = error;\n this._complete = complete;\n }\n next(value) {\n if (!this.isStopped && this._next) {\n const { _parentSubscriber } = this;\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._next, value);\n }\n else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {\n this.unsubscribe();\n }\n }\n }\n error(err) {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n const { useDeprecatedSynchronousErrorHandling } = config;\n if (this._error) {\n if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._error, err);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, this._error, err);\n this.unsubscribe();\n }\n }\n else if (!_parentSubscriber.syncErrorThrowable) {\n this.unsubscribe();\n if (useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n hostReportError(err);\n }\n else {\n if (useDeprecatedSynchronousErrorHandling) {\n _parentSubscriber.syncErrorValue = err;\n _parentSubscriber.syncErrorThrown = true;\n }\n else {\n hostReportError(err);\n }\n this.unsubscribe();\n }\n }\n }\n complete() {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n if (this._complete) {\n const wrappedComplete = () => this._complete.call(this._context);\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(wrappedComplete);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, wrappedComplete);\n this.unsubscribe();\n }\n }\n else {\n this.unsubscribe();\n }\n }\n }\n __tryOrUnsub(fn, value) {\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n this.unsubscribe();\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n }\n }\n __tryOrSetError(parent, fn, value) {\n if (!config.useDeprecatedSynchronousErrorHandling) {\n throw new Error('bad call');\n }\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n parent.syncErrorValue = err;\n parent.syncErrorThrown = true;\n return true;\n }\n else {\n hostReportError(err);\n return true;\n }\n }\n return false;\n }\n _unsubscribe() {\n const { _parentSubscriber } = this;\n this._context = null;\n this._parentSubscriber = null;\n _parentSubscriber.unsubscribe();\n }\n}\n","import { isArray } from './util/isArray';\nimport { isObject } from './util/isObject';\nimport { isFunction } from './util/isFunction';\nimport { UnsubscriptionError } from './util/UnsubscriptionError';\nexport class Subscription {\n constructor(unsubscribe) {\n this.closed = false;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (unsubscribe) {\n this._ctorUnsubscribe = true;\n this._unsubscribe = unsubscribe;\n }\n }\n unsubscribe() {\n let errors;\n if (this.closed) {\n return;\n }\n let { _parentOrParents, _ctorUnsubscribe, _unsubscribe, _subscriptions } = this;\n this.closed = true;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (_parentOrParents instanceof Subscription) {\n _parentOrParents.remove(this);\n }\n else if (_parentOrParents !== null) {\n for (let index = 0; index < _parentOrParents.length; ++index) {\n const parent = _parentOrParents[index];\n parent.remove(this);\n }\n }\n if (isFunction(_unsubscribe)) {\n if (_ctorUnsubscribe) {\n this._unsubscribe = undefined;\n }\n try {\n _unsubscribe.call(this);\n }\n catch (e) {\n errors = e instanceof UnsubscriptionError ? flattenUnsubscriptionErrors(e.errors) : [e];\n }\n }\n if (isArray(_subscriptions)) {\n let index = -1;\n let len = _subscriptions.length;\n while (++index < len) {\n const sub = _subscriptions[index];\n if (isObject(sub)) {\n try {\n sub.unsubscribe();\n }\n catch (e) {\n errors = errors || [];\n if (e instanceof UnsubscriptionError) {\n errors = errors.concat(flattenUnsubscriptionErrors(e.errors));\n }\n else {\n errors.push(e);\n }\n }\n }\n }\n }\n if (errors) {\n throw new UnsubscriptionError(errors);\n }\n }\n add(teardown) {\n let subscription = teardown;\n if (!teardown) {\n return Subscription.EMPTY;\n }\n switch (typeof teardown) {\n case 'function':\n subscription = new Subscription(teardown);\n case 'object':\n if (subscription === this || subscription.closed || typeof subscription.unsubscribe !== 'function') {\n return subscription;\n }\n else if (this.closed) {\n subscription.unsubscribe();\n return subscription;\n }\n else if (!(subscription instanceof Subscription)) {\n const tmp = subscription;\n subscription = new Subscription();\n subscription._subscriptions = [tmp];\n }\n break;\n default: {\n throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.');\n }\n }\n let { _parentOrParents } = subscription;\n if (_parentOrParents === null) {\n subscription._parentOrParents = this;\n }\n else if (_parentOrParents instanceof Subscription) {\n if (_parentOrParents === this) {\n return subscription;\n }\n subscription._parentOrParents = [_parentOrParents, this];\n }\n else if (_parentOrParents.indexOf(this) === -1) {\n _parentOrParents.push(this);\n }\n else {\n return subscription;\n }\n const subscriptions = this._subscriptions;\n if (subscriptions === null) {\n this._subscriptions = [subscription];\n }\n else {\n subscriptions.push(subscription);\n }\n return subscription;\n }\n remove(subscription) {\n const subscriptions = this._subscriptions;\n if (subscriptions) {\n const subscriptionIndex = subscriptions.indexOf(subscription);\n if (subscriptionIndex !== -1) {\n subscriptions.splice(subscriptionIndex, 1);\n }\n }\n }\n}\nSubscription.EMPTY = (function (empty) {\n empty.closed = true;\n return empty;\n}(new Subscription()));\nfunction flattenUnsubscriptionErrors(errors) {\n return errors.reduce((errs, err) => errs.concat((err instanceof UnsubscriptionError) ? err.errors : err), []);\n}\n","let _enable_super_gross_mode_that_will_cause_bad_things = false;\nexport const config = {\n Promise: undefined,\n set useDeprecatedSynchronousErrorHandling(value) {\n if (value) {\n const error = new Error();\n console.warn('DEPRECATED! RxJS was set to use deprecated synchronous error handling behavior by code at: \\n' + error.stack);\n }\n else if (_enable_super_gross_mode_that_will_cause_bad_things) {\n console.log('RxJS: Back to a better error behavior. Thank you. <3');\n }\n _enable_super_gross_mode_that_will_cause_bad_things = value;\n },\n get useDeprecatedSynchronousErrorHandling() {\n return _enable_super_gross_mode_that_will_cause_bad_things;\n },\n};\n","import { Subscriber } from './Subscriber';\nimport { Observable } from './Observable';\nimport { subscribeTo } from './util/subscribeTo';\nexport class SimpleInnerSubscriber extends Subscriber {\n constructor(parent) {\n super();\n this.parent = parent;\n }\n _next(value) {\n this.parent.notifyNext(value);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete();\n this.unsubscribe();\n }\n}\nexport class ComplexInnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\nexport class SimpleOuterSubscriber extends Subscriber {\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyError(err) {\n this.destination.error(err);\n }\n notifyComplete() {\n this.destination.complete();\n }\n}\nexport class ComplexOuterSubscriber extends Subscriber {\n notifyNext(_outerValue, innerValue, _outerIndex, _innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error) {\n this.destination.error(error);\n }\n notifyComplete(_innerSub) {\n this.destination.complete();\n }\n}\nexport function innerSubscribe(result, innerSubscriber) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n let subscription;\n try {\n subscription = subscribeTo(result)(innerSubscriber);\n }\n catch (error) {\n innerSubscriber.error(error);\n }\n return subscription;\n}\n","import { SubjectSubscriber } from '../Subject';\nimport { Observable } from '../Observable';\nimport { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nimport { refCount as higherOrderRefCount } from '../operators/refCount';\nexport class ConnectableObservable extends Observable {\n constructor(source, subjectFactory) {\n super();\n this.source = source;\n this.subjectFactory = subjectFactory;\n this._refCount = 0;\n this._isComplete = false;\n }\n _subscribe(subscriber) {\n return this.getSubject().subscribe(subscriber);\n }\n getSubject() {\n const subject = this._subject;\n if (!subject || subject.isStopped) {\n this._subject = this.subjectFactory();\n }\n return this._subject;\n }\n connect() {\n let connection = this._connection;\n if (!connection) {\n this._isComplete = false;\n connection = this._connection = new Subscription();\n connection.add(this.source\n .subscribe(new ConnectableSubscriber(this.getSubject(), this)));\n if (connection.closed) {\n this._connection = null;\n connection = Subscription.EMPTY;\n }\n }\n return connection;\n }\n refCount() {\n return higherOrderRefCount()(this);\n }\n}\nexport const connectableObservableDescriptor = (() => {\n const connectableProto = ConnectableObservable.prototype;\n return {\n operator: { value: null },\n _refCount: { value: 0, writable: true },\n _subject: { value: null, writable: true },\n _connection: { value: null, writable: true },\n _subscribe: { value: connectableProto._subscribe },\n _isComplete: { value: connectableProto._isComplete, writable: true },\n getSubject: { value: connectableProto.getSubject },\n connect: { value: connectableProto.connect },\n refCount: { value: connectableProto.refCount }\n };\n})();\nclass ConnectableSubscriber extends SubjectSubscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _error(err) {\n this._unsubscribe();\n super._error(err);\n }\n _complete() {\n this.connectable._isComplete = true;\n this._unsubscribe();\n super._complete();\n }\n _unsubscribe() {\n const connectable = this.connectable;\n if (connectable) {\n this.connectable = null;\n const connection = connectable._connection;\n connectable._refCount = 0;\n connectable._subject = null;\n connectable._connection = null;\n if (connection) {\n connection.unsubscribe();\n }\n }\n }\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { isArray } from '../util/isArray';\nimport { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nimport { fromArray } from './fromArray';\nconst NONE = {};\nexport function combineLatest(...observables) {\n let resultSelector = undefined;\n let scheduler = undefined;\n if (isScheduler(observables[observables.length - 1])) {\n scheduler = observables.pop();\n }\n if (typeof observables[observables.length - 1] === 'function') {\n resultSelector = observables.pop();\n }\n if (observables.length === 1 && isArray(observables[0])) {\n observables = observables[0];\n }\n return fromArray(observables, scheduler).lift(new CombineLatestOperator(resultSelector));\n}\nexport class CombineLatestOperator {\n constructor(resultSelector) {\n this.resultSelector = resultSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new CombineLatestSubscriber(subscriber, this.resultSelector));\n }\n}\nexport class CombineLatestSubscriber extends OuterSubscriber {\n constructor(destination, resultSelector) {\n super(destination);\n this.resultSelector = resultSelector;\n this.active = 0;\n this.values = [];\n this.observables = [];\n }\n _next(observable) {\n this.values.push(NONE);\n this.observables.push(observable);\n }\n _complete() {\n const observables = this.observables;\n const len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n this.active = len;\n this.toRespond = len;\n for (let i = 0; i < len; i++) {\n const observable = observables[i];\n this.add(subscribeToResult(this, observable, undefined, i));\n }\n }\n }\n notifyComplete(unused) {\n if ((this.active -= 1) === 0) {\n this.destination.complete();\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n const values = this.values;\n const oldVal = values[outerIndex];\n const toRespond = !this.toRespond\n ? 0\n : oldVal === NONE ? --this.toRespond : this.toRespond;\n values[outerIndex] = innerValue;\n if (toRespond === 0) {\n if (this.resultSelector) {\n this._tryResultSelector(values);\n }\n else {\n this.destination.next(values.slice());\n }\n }\n }\n _tryResultSelector(values) {\n let result;\n try {\n result = this.resultSelector.apply(this, values);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { of } from './of';\nimport { concatAll } from '../operators/concatAll';\nexport function concat(...observables) {\n return concatAll()(of(...observables));\n}\n","import { Observable } from '../Observable';\nimport { from } from './from';\nimport { empty } from './empty';\nexport function defer(observableFactory) {\n return new Observable(subscriber => {\n let input;\n try {\n input = observableFactory();\n }\n catch (err) {\n subscriber.error(err);\n return undefined;\n }\n const source = input ? from(input) : empty();\n return source.subscribe(subscriber);\n });\n}\n","import { Observable } from '../Observable';\nexport const EMPTY = new Observable(subscriber => subscriber.complete());\nexport function empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : EMPTY;\n}\nfunction emptyScheduled(scheduler) {\n return new Observable(subscriber => scheduler.schedule(() => subscriber.complete()));\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { map } from '../operators/map';\nimport { isObject } from '../util/isObject';\nimport { from } from './from';\nexport function forkJoin(...sources) {\n if (sources.length === 1) {\n const first = sources[0];\n if (isArray(first)) {\n return forkJoinInternal(first, null);\n }\n if (isObject(first) && Object.getPrototypeOf(first) === Object.prototype) {\n const keys = Object.keys(first);\n return forkJoinInternal(keys.map(key => first[key]), keys);\n }\n }\n if (typeof sources[sources.length - 1] === 'function') {\n const resultSelector = sources.pop();\n sources = (sources.length === 1 && isArray(sources[0])) ? sources[0] : sources;\n return forkJoinInternal(sources, null).pipe(map((args) => resultSelector(...args)));\n }\n return forkJoinInternal(sources, null);\n}\nfunction forkJoinInternal(sources, keys) {\n return new Observable(subscriber => {\n const len = sources.length;\n if (len === 0) {\n subscriber.complete();\n return;\n }\n const values = new Array(len);\n let completed = 0;\n let emitted = 0;\n for (let i = 0; i < len; i++) {\n const source = from(sources[i]);\n let hasValue = false;\n subscriber.add(source.subscribe({\n next: value => {\n if (!hasValue) {\n hasValue = true;\n emitted++;\n }\n values[i] = value;\n },\n error: err => subscriber.error(err),\n complete: () => {\n completed++;\n if (completed === len || !hasValue) {\n if (emitted === len) {\n subscriber.next(keys ?\n keys.reduce((result, key, i) => (result[key] = values[i], result), {}) :\n values);\n }\n subscriber.complete();\n }\n }\n }));\n }\n });\n}\n","import { Observable } from '../Observable';\nimport { subscribeTo } from '../util/subscribeTo';\nimport { scheduled } from '../scheduled/scheduled';\nexport function from(input, scheduler) {\n if (!scheduler) {\n if (input instanceof Observable) {\n return input;\n }\n return new Observable(subscribeTo(input));\n }\n else {\n return scheduled(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { subscribeToArray } from '../util/subscribeToArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function fromArray(input, scheduler) {\n if (!scheduler) {\n return new Observable(subscribeToArray(input));\n }\n else {\n return scheduleArray(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { isScheduler } from '../util/isScheduler';\nimport { mergeAll } from '../operators/mergeAll';\nimport { fromArray } from './fromArray';\nexport function merge(...observables) {\n let concurrent = Number.POSITIVE_INFINITY;\n let scheduler = null;\n let last = observables[observables.length - 1];\n if (isScheduler(last)) {\n scheduler = observables.pop();\n if (observables.length > 1 && typeof observables[observables.length - 1] === 'number') {\n concurrent = observables.pop();\n }\n }\n else if (typeof last === 'number') {\n concurrent = observables.pop();\n }\n if (scheduler === null && observables.length === 1 && observables[0] instanceof Observable) {\n return observables[0];\n }\n return mergeAll(concurrent)(fromArray(observables, scheduler));\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { fromArray } from './fromArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function of(...args) {\n let scheduler = args[args.length - 1];\n if (isScheduler(scheduler)) {\n args.pop();\n return scheduleArray(args, scheduler);\n }\n else {\n return fromArray(args);\n }\n}\n","import { isArray } from '../util/isArray';\nimport { fromArray } from './fromArray';\nimport { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nexport function race(...observables) {\n if (observables.length === 1) {\n if (isArray(observables[0])) {\n observables = observables[0];\n }\n else {\n return observables[0];\n }\n }\n return fromArray(observables, undefined).lift(new RaceOperator());\n}\nexport class RaceOperator {\n call(subscriber, source) {\n return source.subscribe(new RaceSubscriber(subscriber));\n }\n}\nexport class RaceSubscriber extends OuterSubscriber {\n constructor(destination) {\n super(destination);\n this.hasFirst = false;\n this.observables = [];\n this.subscriptions = [];\n }\n _next(observable) {\n this.observables.push(observable);\n }\n _complete() {\n const observables = this.observables;\n const len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n for (let i = 0; i < len && !this.hasFirst; i++) {\n const observable = observables[i];\n const subscription = subscribeToResult(this, observable, undefined, i);\n if (this.subscriptions) {\n this.subscriptions.push(subscription);\n }\n this.add(subscription);\n }\n this.observables = null;\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n if (!this.hasFirst) {\n this.hasFirst = true;\n for (let i = 0; i < this.subscriptions.length; i++) {\n if (i !== outerIndex) {\n let subscription = this.subscriptions[i];\n subscription.unsubscribe();\n this.remove(subscription);\n }\n }\n this.subscriptions = null;\n }\n this.destination.next(innerValue);\n }\n}\n","import { Observable } from '../Observable';\nexport function throwError(error, scheduler) {\n if (!scheduler) {\n return new Observable(subscriber => subscriber.error(error));\n }\n else {\n return new Observable(subscriber => scheduler.schedule(dispatch, 0, { error, subscriber }));\n }\n}\nfunction dispatch({ error, subscriber }) {\n subscriber.error(error);\n}\n","import { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function catchError(selector) {\n return function catchErrorOperatorFunction(source) {\n const operator = new CatchOperator(selector);\n const caught = source.lift(operator);\n return (operator.caught = caught);\n };\n}\nclass CatchOperator {\n constructor(selector) {\n this.selector = selector;\n }\n call(subscriber, source) {\n return source.subscribe(new CatchSubscriber(subscriber, this.selector, this.caught));\n }\n}\nclass CatchSubscriber extends SimpleOuterSubscriber {\n constructor(destination, selector, caught) {\n super(destination);\n this.selector = selector;\n this.caught = caught;\n }\n error(err) {\n if (!this.isStopped) {\n let result;\n try {\n result = this.selector(err, this.caught);\n }\n catch (err2) {\n super.error(err2);\n return;\n }\n this._unsubscribeAndRecycle();\n const innerSubscriber = new SimpleInnerSubscriber(this);\n this.add(innerSubscriber);\n const innerSubscription = innerSubscribe(result, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n this.add(innerSubscription);\n }\n }\n }\n}\n","import { mergeAll } from './mergeAll';\nexport function concatAll() {\n return mergeAll(1);\n}\n","import { mergeMap } from './mergeMap';\nexport function concatMap(project, resultSelector) {\n return mergeMap(project, resultSelector, 1);\n}\n","import { Subscriber } from '../Subscriber';\nimport { async } from '../scheduler/async';\nexport function debounceTime(dueTime, scheduler = async) {\n return (source) => source.lift(new DebounceTimeOperator(dueTime, scheduler));\n}\nclass DebounceTimeOperator {\n constructor(dueTime, scheduler) {\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new DebounceTimeSubscriber(subscriber, this.dueTime, this.scheduler));\n }\n}\nclass DebounceTimeSubscriber extends Subscriber {\n constructor(destination, dueTime, scheduler) {\n super(destination);\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n this.debouncedSubscription = null;\n this.lastValue = null;\n this.hasValue = false;\n }\n _next(value) {\n this.clearDebounce();\n this.lastValue = value;\n this.hasValue = true;\n this.add(this.debouncedSubscription = this.scheduler.schedule(dispatchNext, this.dueTime, this));\n }\n _complete() {\n this.debouncedNext();\n this.destination.complete();\n }\n debouncedNext() {\n this.clearDebounce();\n if (this.hasValue) {\n const { lastValue } = this;\n this.lastValue = null;\n this.hasValue = false;\n this.destination.next(lastValue);\n }\n }\n clearDebounce() {\n const debouncedSubscription = this.debouncedSubscription;\n if (debouncedSubscription !== null) {\n this.remove(debouncedSubscription);\n debouncedSubscription.unsubscribe();\n this.debouncedSubscription = null;\n }\n }\n}\nfunction dispatchNext(subscriber) {\n subscriber.debouncedNext();\n}\n","import { Subscriber } from '../Subscriber';\nexport function defaultIfEmpty(defaultValue = null) {\n return (source) => source.lift(new DefaultIfEmptyOperator(defaultValue));\n}\nclass DefaultIfEmptyOperator {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n call(subscriber, source) {\n return source.subscribe(new DefaultIfEmptySubscriber(subscriber, this.defaultValue));\n }\n}\nclass DefaultIfEmptySubscriber extends Subscriber {\n constructor(destination, defaultValue) {\n super(destination);\n this.defaultValue = defaultValue;\n this.isEmpty = true;\n }\n _next(value) {\n this.isEmpty = false;\n this.destination.next(value);\n }\n _complete() {\n if (this.isEmpty) {\n this.destination.next(this.defaultValue);\n }\n this.destination.complete();\n }\n}\n","import { async } from '../scheduler/async';\nimport { isDate } from '../util/isDate';\nimport { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function delay(delay, scheduler = async) {\n const absoluteDelay = isDate(delay);\n const delayFor = absoluteDelay ? (+delay - scheduler.now()) : Math.abs(delay);\n return (source) => source.lift(new DelayOperator(delayFor, scheduler));\n}\nclass DelayOperator {\n constructor(delay, scheduler) {\n this.delay = delay;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new DelaySubscriber(subscriber, this.delay, this.scheduler));\n }\n}\nclass DelaySubscriber extends Subscriber {\n constructor(destination, delay, scheduler) {\n super(destination);\n this.delay = delay;\n this.scheduler = scheduler;\n this.queue = [];\n this.active = false;\n this.errored = false;\n }\n static dispatch(state) {\n const source = state.source;\n const queue = source.queue;\n const scheduler = state.scheduler;\n const destination = state.destination;\n while (queue.length > 0 && (queue[0].time - scheduler.now()) <= 0) {\n queue.shift().notification.observe(destination);\n }\n if (queue.length > 0) {\n const delay = Math.max(0, queue[0].time - scheduler.now());\n this.schedule(state, delay);\n }\n else {\n this.unsubscribe();\n source.active = false;\n }\n }\n _schedule(scheduler) {\n this.active = true;\n const destination = this.destination;\n destination.add(scheduler.schedule(DelaySubscriber.dispatch, this.delay, {\n source: this, destination: this.destination, scheduler: scheduler\n }));\n }\n scheduleNotification(notification) {\n if (this.errored === true) {\n return;\n }\n const scheduler = this.scheduler;\n const message = new DelayMessage(scheduler.now() + this.delay, notification);\n this.queue.push(message);\n if (this.active === false) {\n this._schedule(scheduler);\n }\n }\n _next(value) {\n this.scheduleNotification(Notification.createNext(value));\n }\n _error(err) {\n this.errored = true;\n this.queue = [];\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.scheduleNotification(Notification.createComplete());\n this.unsubscribe();\n }\n}\nclass DelayMessage {\n constructor(time, notification) {\n this.time = time;\n this.notification = notification;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function filter(predicate, thisArg) {\n return function filterOperatorFunction(source) {\n return source.lift(new FilterOperator(predicate, thisArg));\n };\n}\nclass FilterOperator {\n constructor(predicate, thisArg) {\n this.predicate = predicate;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new FilterSubscriber(subscriber, this.predicate, this.thisArg));\n }\n}\nclass FilterSubscriber extends Subscriber {\n constructor(destination, predicate, thisArg) {\n super(destination);\n this.predicate = predicate;\n this.thisArg = thisArg;\n this.count = 0;\n }\n _next(value) {\n let result;\n try {\n result = this.predicate.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n if (result) {\n this.destination.next(value);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nexport function finalize(callback) {\n return (source) => source.lift(new FinallyOperator(callback));\n}\nclass FinallyOperator {\n constructor(callback) {\n this.callback = callback;\n }\n call(subscriber, source) {\n return source.subscribe(new FinallySubscriber(subscriber, this.callback));\n }\n}\nclass FinallySubscriber extends Subscriber {\n constructor(destination, callback) {\n super(destination);\n this.add(new Subscription(callback));\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { take } from './take';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { identity } from '../util/identity';\nexport function first(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, take(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { takeLast } from './takeLast';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { identity } from '../util/identity';\nexport function last(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, takeLast(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { Subscriber } from '../Subscriber';\nexport function map(project, thisArg) {\n return function mapOperation(source) {\n if (typeof project !== 'function') {\n throw new TypeError('argument is not a function. Are you looking for `mapTo()`?');\n }\n return source.lift(new MapOperator(project, thisArg));\n };\n}\nexport class MapOperator {\n constructor(project, thisArg) {\n this.project = project;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new MapSubscriber(subscriber, this.project, this.thisArg));\n }\n}\nclass MapSubscriber extends Subscriber {\n constructor(destination, project, thisArg) {\n super(destination);\n this.project = project;\n this.count = 0;\n this.thisArg = thisArg || this;\n }\n _next(value) {\n let result;\n try {\n result = this.project.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { mergeMap } from './mergeMap';\nimport { identity } from '../util/identity';\nexport function mergeAll(concurrent = Number.POSITIVE_INFINITY) {\n return mergeMap(identity, concurrent);\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function mergeMap(project, resultSelector, concurrent = Number.POSITIVE_INFINITY) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(mergeMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii))), concurrent));\n }\n else if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return (source) => source.lift(new MergeMapOperator(project, concurrent));\n}\nexport class MergeMapOperator {\n constructor(project, concurrent = Number.POSITIVE_INFINITY) {\n this.project = project;\n this.concurrent = concurrent;\n }\n call(observer, source) {\n return source.subscribe(new MergeMapSubscriber(observer, this.project, this.concurrent));\n }\n}\nexport class MergeMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project, concurrent = Number.POSITIVE_INFINITY) {\n super(destination);\n this.project = project;\n this.concurrent = concurrent;\n this.hasCompleted = false;\n this.buffer = [];\n this.active = 0;\n this.index = 0;\n }\n _next(value) {\n if (this.active < this.concurrent) {\n this._tryNext(value);\n }\n else {\n this.buffer.push(value);\n }\n }\n _tryNext(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.active++;\n this._innerSub(result);\n }\n _innerSub(ish) {\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n const innerSubscription = innerSubscribe(ish, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n }\n _complete() {\n this.hasCompleted = true;\n if (this.active === 0 && this.buffer.length === 0) {\n this.destination.complete();\n }\n this.unsubscribe();\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyComplete() {\n const buffer = this.buffer;\n this.active--;\n if (buffer.length > 0) {\n this._next(buffer.shift());\n }\n else if (this.active === 0 && this.hasCompleted) {\n this.destination.complete();\n }\n }\n}\nexport const flatMap = mergeMap;\n","import { connectableObservableDescriptor } from '../observable/ConnectableObservable';\nexport function multicast(subjectOrSubjectFactory, selector) {\n return function multicastOperatorFunction(source) {\n let subjectFactory;\n if (typeof subjectOrSubjectFactory === 'function') {\n subjectFactory = subjectOrSubjectFactory;\n }\n else {\n subjectFactory = function subjectFactory() {\n return subjectOrSubjectFactory;\n };\n }\n if (typeof selector === 'function') {\n return source.lift(new MulticastOperator(subjectFactory, selector));\n }\n const connectable = Object.create(source, connectableObservableDescriptor);\n connectable.source = source;\n connectable.subjectFactory = subjectFactory;\n return connectable;\n };\n}\nexport class MulticastOperator {\n constructor(subjectFactory, selector) {\n this.subjectFactory = subjectFactory;\n this.selector = selector;\n }\n call(subscriber, source) {\n const { selector } = this;\n const subject = this.subjectFactory();\n const subscription = selector(subject).subscribe(subscriber);\n subscription.add(source.subscribe(subject));\n return subscription;\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function observeOn(scheduler, delay = 0) {\n return function observeOnOperatorFunction(source) {\n return source.lift(new ObserveOnOperator(scheduler, delay));\n };\n}\nexport class ObserveOnOperator {\n constructor(scheduler, delay = 0) {\n this.scheduler = scheduler;\n this.delay = delay;\n }\n call(subscriber, source) {\n return source.subscribe(new ObserveOnSubscriber(subscriber, this.scheduler, this.delay));\n }\n}\nexport class ObserveOnSubscriber extends Subscriber {\n constructor(destination, scheduler, delay = 0) {\n super(destination);\n this.scheduler = scheduler;\n this.delay = delay;\n }\n static dispatch(arg) {\n const { notification, destination } = arg;\n notification.observe(destination);\n this.unsubscribe();\n }\n scheduleMessage(notification) {\n const destination = this.destination;\n destination.add(this.scheduler.schedule(ObserveOnSubscriber.dispatch, this.delay, new ObserveOnMessage(notification, this.destination)));\n }\n _next(value) {\n this.scheduleMessage(Notification.createNext(value));\n }\n _error(err) {\n this.scheduleMessage(Notification.createError(err));\n this.unsubscribe();\n }\n _complete() {\n this.scheduleMessage(Notification.createComplete());\n this.unsubscribe();\n }\n}\nexport class ObserveOnMessage {\n constructor(notification, destination) {\n this.notification = notification;\n this.destination = destination;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function refCount() {\n return function refCountOperatorFunction(source) {\n return source.lift(new RefCountOperator(source));\n };\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function scan(accumulator, seed) {\n let hasSeed = false;\n if (arguments.length >= 2) {\n hasSeed = true;\n }\n return function scanOperatorFunction(source) {\n return source.lift(new ScanOperator(accumulator, seed, hasSeed));\n };\n}\nclass ScanOperator {\n constructor(accumulator, seed, hasSeed = false) {\n this.accumulator = accumulator;\n this.seed = seed;\n this.hasSeed = hasSeed;\n }\n call(subscriber, source) {\n return source.subscribe(new ScanSubscriber(subscriber, this.accumulator, this.seed, this.hasSeed));\n }\n}\nclass ScanSubscriber extends Subscriber {\n constructor(destination, accumulator, _seed, hasSeed) {\n super(destination);\n this.accumulator = accumulator;\n this._seed = _seed;\n this.hasSeed = hasSeed;\n this.index = 0;\n }\n get seed() {\n return this._seed;\n }\n set seed(value) {\n this.hasSeed = true;\n this._seed = value;\n }\n _next(value) {\n if (!this.hasSeed) {\n this.seed = value;\n this.destination.next(value);\n }\n else {\n return this._tryNext(value);\n }\n }\n _tryNext(value) {\n const index = this.index++;\n let result;\n try {\n result = this.accumulator(this.seed, value, index);\n }\n catch (err) {\n this.destination.error(err);\n }\n this.seed = result;\n this.destination.next(result);\n }\n}\n","import { multicast } from './multicast';\nimport { refCount } from './refCount';\nimport { Subject } from '../Subject';\nfunction shareSubjectFactory() {\n return new Subject();\n}\nexport function share() {\n return (source) => refCount()(multicast(shareSubjectFactory)(source));\n}\n","import { ReplaySubject } from '../ReplaySubject';\nexport function shareReplay(configOrBufferSize, windowTime, scheduler) {\n let config;\n if (configOrBufferSize && typeof configOrBufferSize === 'object') {\n config = configOrBufferSize;\n }\n else {\n config = {\n bufferSize: configOrBufferSize,\n windowTime,\n refCount: false,\n scheduler,\n };\n }\n return (source) => source.lift(shareReplayOperator(config));\n}\nfunction shareReplayOperator({ bufferSize = Number.POSITIVE_INFINITY, windowTime = Number.POSITIVE_INFINITY, refCount: useRefCount, scheduler, }) {\n let subject;\n let refCount = 0;\n let subscription;\n let hasError = false;\n let isComplete = false;\n return function shareReplayOperation(source) {\n refCount++;\n let innerSub;\n if (!subject || hasError) {\n hasError = false;\n subject = new ReplaySubject(bufferSize, windowTime, scheduler);\n innerSub = subject.subscribe(this);\n subscription = source.subscribe({\n next(value) {\n subject.next(value);\n },\n error(err) {\n hasError = true;\n subject.error(err);\n },\n complete() {\n isComplete = true;\n subscription = undefined;\n subject.complete();\n },\n });\n if (isComplete) {\n subscription = undefined;\n }\n }\n else {\n innerSub = subject.subscribe(this);\n }\n this.add(() => {\n refCount--;\n innerSub.unsubscribe();\n innerSub = undefined;\n if (subscription && !isComplete && useRefCount && refCount === 0) {\n subscription.unsubscribe();\n subscription = undefined;\n subject = undefined;\n }\n });\n };\n}\n","import { concat } from '../observable/concat';\nimport { isScheduler } from '../util/isScheduler';\nexport function startWith(...array) {\n const scheduler = array[array.length - 1];\n if (isScheduler(scheduler)) {\n array.pop();\n return (source) => concat(array, source, scheduler);\n }\n else {\n return (source) => concat(array, source);\n }\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function switchMap(project, resultSelector) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(switchMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii)))));\n }\n return (source) => source.lift(new SwitchMapOperator(project));\n}\nclass SwitchMapOperator {\n constructor(project) {\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new SwitchMapSubscriber(subscriber, this.project));\n }\n}\nclass SwitchMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project) {\n super(destination);\n this.project = project;\n this.index = 0;\n }\n _next(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (error) {\n this.destination.error(error);\n return;\n }\n this._innerSub(result);\n }\n _innerSub(result) {\n const innerSubscription = this.innerSubscription;\n if (innerSubscription) {\n innerSubscription.unsubscribe();\n }\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n this.innerSubscription = innerSubscribe(result, innerSubscriber);\n if (this.innerSubscription !== innerSubscriber) {\n destination.add(this.innerSubscription);\n }\n }\n _complete() {\n const { innerSubscription } = this;\n if (!innerSubscription || innerSubscription.closed) {\n super._complete();\n }\n this.unsubscribe();\n }\n _unsubscribe() {\n this.innerSubscription = undefined;\n }\n notifyComplete() {\n this.innerSubscription = undefined;\n if (this.isStopped) {\n super._complete();\n }\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function take(count) {\n return (source) => {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeOperator(count));\n }\n };\n}\nclass TakeOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeSubscriber(subscriber, this.total));\n }\n}\nclass TakeSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.count = 0;\n }\n _next(value) {\n const total = this.total;\n const count = ++this.count;\n if (count <= total) {\n this.destination.next(value);\n if (count === total) {\n this.destination.complete();\n this.unsubscribe();\n }\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function takeLast(count) {\n return function takeLastOperatorFunction(source) {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeLastOperator(count));\n }\n };\n}\nclass TakeLastOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeLastSubscriber(subscriber, this.total));\n }\n}\nclass TakeLastSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.ring = new Array();\n this.count = 0;\n }\n _next(value) {\n const ring = this.ring;\n const total = this.total;\n const count = this.count++;\n if (ring.length < total) {\n ring.push(value);\n }\n else {\n const index = count % total;\n ring[index] = value;\n }\n }\n _complete() {\n const destination = this.destination;\n let count = this.count;\n if (count > 0) {\n const total = this.count >= this.total ? this.total : this.count;\n const ring = this.ring;\n for (let i = 0; i < total; i++) {\n const idx = (count++) % total;\n destination.next(ring[idx]);\n }\n }\n destination.complete();\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { noop } from '../util/noop';\nimport { isFunction } from '../util/isFunction';\nexport function tap(nextOrObserver, error, complete) {\n return function tapOperatorFunction(source) {\n return source.lift(new DoOperator(nextOrObserver, error, complete));\n };\n}\nclass DoOperator {\n constructor(nextOrObserver, error, complete) {\n this.nextOrObserver = nextOrObserver;\n this.error = error;\n this.complete = complete;\n }\n call(subscriber, source) {\n return source.subscribe(new TapSubscriber(subscriber, this.nextOrObserver, this.error, this.complete));\n }\n}\nclass TapSubscriber extends Subscriber {\n constructor(destination, observerOrNext, error, complete) {\n super(destination);\n this._tapNext = noop;\n this._tapError = noop;\n this._tapComplete = noop;\n this._tapError = error || noop;\n this._tapComplete = complete || noop;\n if (isFunction(observerOrNext)) {\n this._context = this;\n this._tapNext = observerOrNext;\n }\n else if (observerOrNext) {\n this._context = observerOrNext;\n this._tapNext = observerOrNext.next || noop;\n this._tapError = observerOrNext.error || noop;\n this._tapComplete = observerOrNext.complete || noop;\n }\n }\n _next(value) {\n try {\n this._tapNext.call(this._context, value);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(value);\n }\n _error(err) {\n try {\n this._tapError.call(this._context, err);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.error(err);\n }\n _complete() {\n try {\n this._tapComplete.call(this._context);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n return this.destination.complete();\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { Subscriber } from '../Subscriber';\nexport function throwIfEmpty(errorFactory = defaultErrorFactory) {\n return (source) => {\n return source.lift(new ThrowIfEmptyOperator(errorFactory));\n };\n}\nclass ThrowIfEmptyOperator {\n constructor(errorFactory) {\n this.errorFactory = errorFactory;\n }\n call(subscriber, source) {\n return source.subscribe(new ThrowIfEmptySubscriber(subscriber, this.errorFactory));\n }\n}\nclass ThrowIfEmptySubscriber extends Subscriber {\n constructor(destination, errorFactory) {\n super(destination);\n this.errorFactory = errorFactory;\n this.hasValue = false;\n }\n _next(value) {\n this.hasValue = true;\n this.destination.next(value);\n }\n _complete() {\n if (!this.hasValue) {\n let err;\n try {\n err = this.errorFactory();\n }\n catch (e) {\n err = e;\n }\n this.destination.error(err);\n }\n else {\n return this.destination.complete();\n }\n }\n}\nfunction defaultErrorFactory() {\n return new EmptyError();\n}\n","import { async } from '../scheduler/async';\nimport { TimeoutError } from '../util/TimeoutError';\nimport { timeoutWith } from './timeoutWith';\nimport { throwError } from '../observable/throwError';\nexport function timeout(due, scheduler = async) {\n return timeoutWith(due, throwError(new TimeoutError()), scheduler);\n}\n","import { async } from '../scheduler/async';\nimport { isDate } from '../util/isDate';\nimport { SimpleOuterSubscriber, innerSubscribe, SimpleInnerSubscriber } from '../innerSubscribe';\nexport function timeoutWith(due, withObservable, scheduler = async) {\n return (source) => {\n let absoluteTimeout = isDate(due);\n let waitFor = absoluteTimeout ? (+due - scheduler.now()) : Math.abs(due);\n return source.lift(new TimeoutWithOperator(waitFor, absoluteTimeout, withObservable, scheduler));\n };\n}\nclass TimeoutWithOperator {\n constructor(waitFor, absoluteTimeout, withObservable, scheduler) {\n this.waitFor = waitFor;\n this.absoluteTimeout = absoluteTimeout;\n this.withObservable = withObservable;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new TimeoutWithSubscriber(subscriber, this.absoluteTimeout, this.waitFor, this.withObservable, this.scheduler));\n }\n}\nclass TimeoutWithSubscriber extends SimpleOuterSubscriber {\n constructor(destination, absoluteTimeout, waitFor, withObservable, scheduler) {\n super(destination);\n this.absoluteTimeout = absoluteTimeout;\n this.waitFor = waitFor;\n this.withObservable = withObservable;\n this.scheduler = scheduler;\n this.scheduleTimeout();\n }\n static dispatchTimeout(subscriber) {\n const { withObservable } = subscriber;\n subscriber._unsubscribeAndRecycle();\n subscriber.add(innerSubscribe(withObservable, new SimpleInnerSubscriber(subscriber)));\n }\n scheduleTimeout() {\n const { action } = this;\n if (action) {\n this.action = action.schedule(this, this.waitFor);\n }\n else {\n this.add(this.action = this.scheduler.schedule(TimeoutWithSubscriber.dispatchTimeout, this.waitFor, this));\n }\n }\n _next(value) {\n if (!this.absoluteTimeout) {\n this.scheduleTimeout();\n }\n super._next(value);\n }\n _unsubscribe() {\n this.action = undefined;\n this.scheduler = null;\n this.withObservable = null;\n }\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function scheduleArray(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n let i = 0;\n sub.add(scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n return;\n }\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n sub.add(this.schedule());\n }\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function scheduleIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable(subscriber => {\n const sub = new Subscription();\n let iterator;\n sub.add(() => {\n if (iterator && typeof iterator.return === 'function') {\n iterator.return();\n }\n });\n sub.add(scheduler.schedule(() => {\n iterator = input[Symbol_iterator]();\n sub.add(scheduler.schedule(function () {\n if (subscriber.closed) {\n return;\n }\n let value;\n let done;\n try {\n const result = iterator.next();\n value = result.value;\n done = result.done;\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n this.schedule();\n }\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport function scheduleObservable(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => {\n const observable = input[Symbol_observable]();\n sub.add(observable.subscribe({\n next(value) { sub.add(scheduler.schedule(() => subscriber.next(value))); },\n error(err) { sub.add(scheduler.schedule(() => subscriber.error(err))); },\n complete() { sub.add(scheduler.schedule(() => subscriber.complete())); },\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function schedulePromise(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => input.then(value => {\n sub.add(scheduler.schedule(() => {\n subscriber.next(value);\n sub.add(scheduler.schedule(() => subscriber.complete()));\n }));\n }, err => {\n sub.add(scheduler.schedule(() => subscriber.error(err)));\n })));\n return sub;\n });\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n else if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n else if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n else if (isIterable(input) || typeof input === 'string') {\n return scheduleIterable(input, scheduler);\n }\n }\n throw new TypeError((input !== null && typeof input || input) + ' is not observable');\n}\n","import { Subscription } from '../Subscription';\nexport class Action extends Subscription {\n constructor(scheduler, work) {\n super();\n }\n schedule(state, delay = 0) {\n return this;\n }\n}\n","import { Action } from './Action';\nexport class AsyncAction extends Action {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n this.pending = false;\n }\n schedule(state, delay = 0) {\n if (this.closed) {\n return this;\n }\n this.state = state;\n const id = this.id;\n const scheduler = this.scheduler;\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, delay);\n }\n this.pending = true;\n this.delay = delay;\n this.id = this.id || this.requestAsyncId(scheduler, this.id, delay);\n return this;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n return setInterval(scheduler.flush.bind(scheduler, this), delay);\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && this.delay === delay && this.pending === false) {\n return id;\n }\n clearInterval(id);\n return undefined;\n }\n execute(state, delay) {\n if (this.closed) {\n return new Error('executing a cancelled action');\n }\n this.pending = false;\n const error = this._execute(state, delay);\n if (error) {\n return error;\n }\n else if (this.pending === false && this.id != null) {\n this.id = this.recycleAsyncId(this.scheduler, this.id, null);\n }\n }\n _execute(state, delay) {\n let errored = false;\n let errorValue = undefined;\n try {\n this.work(state);\n }\n catch (e) {\n errored = true;\n errorValue = !!e && e || new Error(e);\n }\n if (errored) {\n this.unsubscribe();\n return errorValue;\n }\n }\n _unsubscribe() {\n const id = this.id;\n const scheduler = this.scheduler;\n const actions = scheduler.actions;\n const index = actions.indexOf(this);\n this.work = null;\n this.state = null;\n this.pending = false;\n this.scheduler = null;\n if (index !== -1) {\n actions.splice(index, 1);\n }\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, null);\n }\n this.delay = null;\n }\n}\n","import { Scheduler } from '../Scheduler';\nexport class AsyncScheduler extends Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n super(SchedulerAction, () => {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.now();\n }\n else {\n return now();\n }\n });\n this.actions = [];\n this.active = false;\n this.scheduled = undefined;\n }\n schedule(work, delay = 0, state) {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.schedule(work, delay, state);\n }\n else {\n return super.schedule(work, delay, state);\n }\n }\n flush(action) {\n const { actions } = this;\n if (this.active) {\n actions.push(action);\n return;\n }\n let error;\n this.active = true;\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (action = actions.shift());\n this.active = false;\n if (error) {\n while (action = actions.shift()) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { AsyncAction } from './AsyncAction';\nexport class QueueAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n schedule(state, delay = 0) {\n if (delay > 0) {\n return super.schedule(state, delay);\n }\n this.delay = delay;\n this.state = state;\n this.scheduler.flush(this);\n return this;\n }\n execute(state, delay) {\n return (delay > 0 || this.closed) ?\n super.execute(state, delay) :\n this._execute(state, delay);\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n return scheduler.flush(this);\n }\n}\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class QueueScheduler extends AsyncScheduler {\n}\n","import { AsyncAction } from './AsyncAction';\nimport { AsyncScheduler } from './AsyncScheduler';\nexport const asyncScheduler = new AsyncScheduler(AsyncAction);\nexport const async = asyncScheduler;\n","import { QueueAction } from './QueueAction';\nimport { QueueScheduler } from './QueueScheduler';\nexport const queueScheduler = new QueueScheduler(QueueAction);\nexport const queue = queueScheduler;\n","export function getSymbolIterator() {\n if (typeof Symbol !== 'function' || !Symbol.iterator) {\n return '@@iterator';\n }\n return Symbol.iterator;\n}\nexport const iterator = getSymbolIterator();\nexport const $$iterator = iterator;\n","export const observable = (() => typeof Symbol === 'function' && Symbol.observable || '@@observable')();\n","export const rxSubscriber = (() => typeof Symbol === 'function'\n ? Symbol('rxSubscriber')\n : '@@rxSubscriber_' + Math.random())();\nexport const $$rxSubscriber = rxSubscriber;\n","const ArgumentOutOfRangeErrorImpl = (() => {\n function ArgumentOutOfRangeErrorImpl() {\n Error.call(this);\n this.message = 'argument out of range';\n this.name = 'ArgumentOutOfRangeError';\n return this;\n }\n ArgumentOutOfRangeErrorImpl.prototype = Object.create(Error.prototype);\n return ArgumentOutOfRangeErrorImpl;\n})();\nexport const ArgumentOutOfRangeError = ArgumentOutOfRangeErrorImpl;\n","const EmptyErrorImpl = (() => {\n function EmptyErrorImpl() {\n Error.call(this);\n this.message = 'no elements in sequence';\n this.name = 'EmptyError';\n return this;\n }\n EmptyErrorImpl.prototype = Object.create(Error.prototype);\n return EmptyErrorImpl;\n})();\nexport const EmptyError = EmptyErrorImpl;\n","const ObjectUnsubscribedErrorImpl = (() => {\n function ObjectUnsubscribedErrorImpl() {\n Error.call(this);\n this.message = 'object unsubscribed';\n this.name = 'ObjectUnsubscribedError';\n return this;\n }\n ObjectUnsubscribedErrorImpl.prototype = Object.create(Error.prototype);\n return ObjectUnsubscribedErrorImpl;\n})();\nexport const ObjectUnsubscribedError = ObjectUnsubscribedErrorImpl;\n","const TimeoutErrorImpl = (() => {\n function TimeoutErrorImpl() {\n Error.call(this);\n this.message = 'Timeout has occurred';\n this.name = 'TimeoutError';\n return this;\n }\n TimeoutErrorImpl.prototype = Object.create(Error.prototype);\n return TimeoutErrorImpl;\n})();\nexport const TimeoutError = TimeoutErrorImpl;\n","const UnsubscriptionErrorImpl = (() => {\n function UnsubscriptionErrorImpl(errors) {\n Error.call(this);\n this.message = errors ?\n `${errors.length} errors occurred during unsubscription:\n${errors.map((err, i) => `${i + 1}) ${err.toString()}`).join('\\n ')}` : '';\n this.name = 'UnsubscriptionError';\n this.errors = errors;\n return this;\n }\n UnsubscriptionErrorImpl.prototype = Object.create(Error.prototype);\n return UnsubscriptionErrorImpl;\n})();\nexport const UnsubscriptionError = UnsubscriptionErrorImpl;\n","import { Subscriber } from '../Subscriber';\nexport function canReportError(observer) {\n while (observer) {\n const { closed, destination, isStopped } = observer;\n if (closed || isStopped) {\n return false;\n }\n else if (destination && destination instanceof Subscriber) {\n observer = destination;\n }\n else {\n observer = null;\n }\n }\n return true;\n}\n","export function hostReportError(err) {\n setTimeout(() => { throw err; }, 0);\n}\n","export function identity(x) {\n return x;\n}\n","export const isArray = (() => Array.isArray || ((x) => x && typeof x.length === 'number'))();\n","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","export function isDate(value) {\n return value instanceof Date && !isNaN(+value);\n}\n","export function isFunction(x) {\n return typeof x === 'function';\n}\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport function isInteropObservable(input) {\n return input && typeof input[Symbol_observable] === 'function';\n}\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function isIterable(input) {\n return input && typeof input[Symbol_iterator] === 'function';\n}\n","export function isObject(x) {\n return x !== null && typeof x === 'object';\n}\n","export function isPromise(value) {\n return !!value && typeof value.subscribe !== 'function' && typeof value.then === 'function';\n}\n","export function isScheduler(value) {\n return value && typeof value.schedule === 'function';\n}\n","export function noop() { }\n","import { identity } from './identity';\nexport function pipe(...fns) {\n return pipeFromArray(fns);\n}\nexport function pipeFromArray(fns) {\n if (fns.length === 0) {\n return identity;\n }\n if (fns.length === 1) {\n return fns[0];\n }\n return function piped(input) {\n return fns.reduce((prev, fn) => fn(prev), input);\n };\n}\n","import { subscribeToArray } from './subscribeToArray';\nimport { subscribeToPromise } from './subscribeToPromise';\nimport { subscribeToIterable } from './subscribeToIterable';\nimport { subscribeToObservable } from './subscribeToObservable';\nimport { isArrayLike } from './isArrayLike';\nimport { isPromise } from './isPromise';\nimport { isObject } from './isObject';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeTo = (result) => {\n if (!!result && typeof result[Symbol_observable] === 'function') {\n return subscribeToObservable(result);\n }\n else if (isArrayLike(result)) {\n return subscribeToArray(result);\n }\n else if (isPromise(result)) {\n return subscribeToPromise(result);\n }\n else if (!!result && typeof result[Symbol_iterator] === 'function') {\n return subscribeToIterable(result);\n }\n else {\n const value = isObject(result) ? 'an invalid object' : `'${result}'`;\n const msg = `You provided ${value} where a stream was expected.`\n + ' You can provide an Observable, Promise, Array, or Iterable.';\n throw new TypeError(msg);\n }\n};\n","export const subscribeToArray = (array) => (subscriber) => {\n for (let i = 0, len = array.length; i < len && !subscriber.closed; i++) {\n subscriber.next(array[i]);\n }\n subscriber.complete();\n};\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport const subscribeToIterable = (iterable) => (subscriber) => {\n const iterator = iterable[Symbol_iterator]();\n do {\n let item;\n try {\n item = iterator.next();\n }\n catch (err) {\n subscriber.error(err);\n return subscriber;\n }\n if (item.done) {\n subscriber.complete();\n break;\n }\n subscriber.next(item.value);\n if (subscriber.closed) {\n break;\n }\n } while (true);\n if (typeof iterator.return === 'function') {\n subscriber.add(() => {\n if (iterator.return) {\n iterator.return();\n }\n });\n }\n return subscriber;\n};\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeToObservable = (obj) => (subscriber) => {\n const obs = obj[Symbol_observable]();\n if (typeof obs.subscribe !== 'function') {\n throw new TypeError('Provided object does not correctly implement Symbol.observable');\n }\n else {\n return obs.subscribe(subscriber);\n }\n};\n","import { hostReportError } from './hostReportError';\nexport const subscribeToPromise = (promise) => (subscriber) => {\n promise.then((value) => {\n if (!subscriber.closed) {\n subscriber.next(value);\n subscriber.complete();\n }\n }, (err) => subscriber.error(err))\n .then(null, hostReportError);\n return subscriber;\n};\n","import { InnerSubscriber } from '../InnerSubscriber';\nimport { subscribeTo } from './subscribeTo';\nimport { Observable } from '../Observable';\nexport function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, innerSubscriber = new InnerSubscriber(outerSubscriber, outerValue, outerIndex)) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n return subscribeTo(result)(innerSubscriber);\n}\n","import { Subscriber } from '../Subscriber';\nimport { rxSubscriber as rxSubscriberSymbol } from '../symbol/rxSubscriber';\nimport { empty as emptyObserver } from '../Observer';\nexport function toSubscriber(nextOrObserver, error, complete) {\n if (nextOrObserver) {\n if (nextOrObserver instanceof Subscriber) {\n return nextOrObserver;\n }\n if (nextOrObserver[rxSubscriberSymbol]) {\n return nextOrObserver[rxSubscriberSymbol]();\n }\n }\n if (!nextOrObserver && !error && !complete) {\n return new Subscriber(emptyObserver);\n }\n return new Subscriber(nextOrObserver, error, complete);\n}\n","const randomUUID = typeof crypto !== 'undefined' && crypto.randomUUID && crypto.randomUUID.bind(crypto);\nexport default {\n randomUUID\n};","export default /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i;","// Unique ID creation requires a high quality random # generator. In the browser we therefore\n// require the crypto API and do not support built-in fallback to lower quality random number\n// generators (like Math.random()).\nlet getRandomValues;\nconst rnds8 = new Uint8Array(16);\nexport default function rng() {\n // lazy load so that environments that need to polyfill have a chance to do so\n if (!getRandomValues) {\n // getRandomValues needs to be invoked in a context where \"this\" is a Crypto implementation.\n getRandomValues = typeof crypto !== 'undefined' && crypto.getRandomValues && crypto.getRandomValues.bind(crypto);\n\n if (!getRandomValues) {\n throw new Error('crypto.getRandomValues() not supported. See https://github.com/uuidjs/uuid#getrandomvalues-not-supported');\n }\n }\n\n return getRandomValues(rnds8);\n}","import validate from './validate.js';\n/**\n * Convert array of 16 byte values to UUID string format of the form:\n * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX\n */\n\nconst byteToHex = [];\n\nfor (let i = 0; i < 256; ++i) {\n byteToHex.push((i + 0x100).toString(16).slice(1));\n}\n\nexport function unsafeStringify(arr, offset = 0) {\n // Note: Be careful editing this code! It's been tuned for performance\n // and works in ways you may not expect. See https://github.com/uuidjs/uuid/pull/434\n return byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + '-' + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + '-' + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + '-' + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + '-' + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]];\n}\n\nfunction stringify(arr, offset = 0) {\n const uuid = unsafeStringify(arr, offset); // Consistency check for valid UUID. If this throws, it's likely due to one\n // of the following:\n // - One or more input array values don't map to a hex octet (leading to\n // \"undefined\" in the uuid)\n // - Invalid input values for the RFC `version` or `variant` fields\n\n if (!validate(uuid)) {\n throw TypeError('Stringified UUID is invalid');\n }\n\n return uuid;\n}\n\nexport default stringify;","import native from './native.js';\nimport rng from './rng.js';\nimport { unsafeStringify } from './stringify.js';\n\nfunction v4(options, buf, offset) {\n if (native.randomUUID && !buf && !options) {\n return native.randomUUID();\n }\n\n options = options || {};\n const rnds = options.random || (options.rng || rng)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved`\n\n rnds[6] = rnds[6] & 0x0f | 0x40;\n rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided\n\n if (buf) {\n offset = offset || 0;\n\n for (let i = 0; i < 16; ++i) {\n buf[offset + i] = rnds[i];\n }\n\n return buf;\n }\n\n return unsafeStringify(rnds);\n}\n\nexport default v4;","import REGEX from './regex.js';\n\nfunction validate(uuid) {\n return typeof uuid === 'string' && REGEX.test(uuid);\n}\n\nexport default validate;","/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n extendStatics = Object.setPrototypeOf ||\r\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };\r\n return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n if (typeof b !== \"function\" && b !== null)\r\n throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\r\n extendStatics(d, b);\r\n function __() { this.constructor = d; }\r\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n __assign = Object.assign || function __assign(t) {\r\n for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n s = arguments[i];\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n }\r\n return t;\r\n }\r\n return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n var t = {};\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n t[p] = s[p];\r\n if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n t[p[i]] = s[p[i]];\r\n }\r\n return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n return new (P || (P = Promise))(function (resolve, reject) {\r\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n function verb(n) { return function (v) { return step([n, v]); }; }\r\n function step(op) {\r\n if (f) throw new TypeError(\"Generator is already executing.\");\r\n while (_) try {\r\n if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n if (y = 0, t) op = [op[0] & 2, t.value];\r\n switch (op[0]) {\r\n case 0: case 1: t = op; break;\r\n case 4: _.label++; return { value: op[1], done: false };\r\n case 5: _.label++; y = op[1]; op = [0]; continue;\r\n case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n default:\r\n if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n if (t[2]) _.ops.pop();\r\n _.trys.pop(); continue;\r\n }\r\n op = body.call(thisArg, _);\r\n } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n }\r\n}\r\n\r\nexport var __createBinding = Object.create ? (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });\r\n}) : (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n o[k2] = m[k];\r\n});\r\n\r\nexport function __exportStar(m, o) {\r\n for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);\r\n}\r\n\r\nexport function __values(o) {\r\n var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n if (m) return m.call(o);\r\n if (o && typeof o.length === \"number\") return {\r\n next: function () {\r\n if (o && i >= o.length) o = void 0;\r\n return { value: o && o[i++], done: !o };\r\n }\r\n };\r\n throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n if (!m) return o;\r\n var i = m.call(o), r, ar = [], e;\r\n try {\r\n while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n }\r\n catch (error) { e = { error: error }; }\r\n finally {\r\n try {\r\n if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n }\r\n finally { if (e) throw e.error; }\r\n }\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spread() {\r\n for (var ar = [], i = 0; i < arguments.length; i++)\r\n ar = ar.concat(__read(arguments[i]));\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spreadArrays() {\r\n for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n r[k] = a[j];\r\n return r;\r\n}\r\n\r\nexport function __spreadArray(to, from, pack) {\r\n if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {\r\n if (ar || !(i in from)) {\r\n if (!ar) ar = Array.prototype.slice.call(from, 0, i);\r\n ar[i] = from[i];\r\n }\r\n }\r\n return to.concat(ar || from);\r\n}\r\n\r\nexport function __await(v) {\r\n return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n function fulfill(value) { resume(\"next\", value); }\r\n function reject(value) { resume(\"throw\", value); }\r\n function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n var i, p;\r\n return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var m = o[Symbol.asyncIterator], i;\r\n return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n return cooked;\r\n};\r\n\r\nvar __setModuleDefault = Object.create ? (function(o, v) {\r\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\r\n}) : function(o, v) {\r\n o[\"default\"] = v;\r\n};\r\n\r\nexport function __importStar(mod) {\r\n if (mod && mod.__esModule) return mod;\r\n var result = {};\r\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\r\n __setModuleDefault(result, mod);\r\n return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, state, kind, f) {\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a getter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot read private member from an object whose class did not declare it\");\r\n return kind === \"m\" ? f : kind === \"a\" ? f.call(receiver) : f ? f.value : state.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, state, value, kind, f) {\r\n if (kind === \"m\") throw new TypeError(\"Private method is not writable\");\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a setter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot write private member to an object whose class did not declare it\");\r\n return (kind === \"a\" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;\r\n}\r\n","/**\n * @license Angular v13.4.0\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Injectable, ɵɵinject, Inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵisListLikeIterable, ɵstringify, Directive, Input, NgModuleRef, ComponentFactoryResolver, ɵRuntimeError, inject, ɵformatRuntimeError, InjectFlags, NgZone, Renderer2, ElementRef, Injector, PLATFORM_ID, NgModule, Host, Attribute, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, Version, ɵɵdefineInjectable } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setDOM(adapter) {\n _DOM = adapter;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A DI Token representing the main rendering context. In a browser this is the DOM Document.\n *\n * Note: Document might not be available in the Application Context when Application and Rendering\n * Contexts are not the same (e.g. when running the application in a Web Worker).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: useBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }] });\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._init();\n }\n // This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it\n /** @internal */\n _init() {\n this.location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this.location.href;\n }\n get protocol() {\n return this.location.protocol;\n }\n get hostname() {\n return this.location.hostname;\n }\n get port() {\n return this.location.port;\n }\n get pathname() {\n return this.location.pathname;\n }\n get search() {\n return this.location.search;\n }\n get hash() {\n return this.location.hash;\n }\n set pathname(newPath) {\n this.location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: BrowserPlatformLocation, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBrowserPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: createBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: provideLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: provideLocationStrategy }]\n }] });\nfunction provideLocationStrategy(platformLocation) {\n // See #23917\n const location = ɵɵinject(DOCUMENT).location;\n return new PathLocationStrategy(ɵɵinject(PlatformLocation), location && location.origin || '');\n}\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you must provide a {@link APP_BASE_HREF}\n * or add a `` element to the document.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n if (href == null) {\n href = this._platformLocation.getBaseHrefFromDOM();\n }\n if (href == null) {\n throw new Error(`No base href set. Please provide a value for the APP_BASE_HREF token or add a base element to the document.`);\n }\n this._baseHref = href;\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n}\nPathLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nPathLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PathLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n}\nHashLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nHashLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: HashLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(platformStrategy, platformLocation) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n this._platformStrategy = platformStrategy;\n const browserBaseHref = this._platformStrategy.getBaseHref();\n this._platformLocation = platformLocation;\n this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref));\n this._platformStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._platformStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._platformLocation.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._platformStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._platformStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._platformStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._platformStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._platformStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n this._platformStrategy.historyGo?.(relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }, { token: PlatformLocation }], target: i0.ɵɵFactoryTarget.Injectable });\nLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: function () { return [{ type: LocationStrategy }, { type: PlatformLocation }]; } });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy), ɵɵinject(PlatformLocation));\n}\nfunction _stripBaseHref(baseHref, url) {\n return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, \"р.\", 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RUR\": [undefined, \"р.\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()`\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formating string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formating string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ISO8601_DATE_REGEX = /^(\\d{4})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' :\n value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.substr(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substr(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is supressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substr(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substr(0, pos).replace(/'/g, '');\n p.negSuf = negative.substr(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\nNgLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocaleLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgLocaleLocalization });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n-common-format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._initialClasses = [];\n this._rawClass = null;\n }\n set klass(value) {\n this._removeClasses(this._initialClasses);\n this._initialClasses = typeof value === 'string' ? value.split(/\\s+/) : [];\n this._applyClasses(this._initialClasses);\n this._applyClasses(this._rawClass);\n }\n set ngClass(value) {\n this._removeClasses(this._rawClass);\n this._applyClasses(this._initialClasses);\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._rawClass = typeof value === 'string' ? value.split(/\\s+/) : value;\n if (this._rawClass) {\n if (ɵisListLikeIterable(this._rawClass)) {\n this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create();\n }\n else {\n this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create();\n }\n }\n }\n ngDoCheck() {\n if (this._iterableDiffer) {\n const iterableChanges = this._iterableDiffer.diff(this._rawClass);\n if (iterableChanges) {\n this._applyIterableChanges(iterableChanges);\n }\n }\n else if (this._keyValueDiffer) {\n const keyValueChanges = this._keyValueDiffer.diff(this._rawClass);\n if (keyValueChanges) {\n this._applyKeyValueChanges(keyValueChanges);\n }\n }\n }\n _applyKeyValueChanges(changes) {\n changes.forEachAddedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachRemovedItem((record) => {\n if (record.previousValue) {\n this._toggleClass(record.key, false);\n }\n });\n }\n _applyIterableChanges(changes) {\n changes.forEachAddedItem((record) => {\n if (typeof record.item === 'string') {\n this._toggleClass(record.item, true);\n }\n else {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(record.item)}`);\n }\n });\n changes.forEachRemovedItem((record) => this._toggleClass(record.item, false));\n }\n /**\n * Applies a collection of CSS classes to the DOM element.\n *\n * For argument of type Set and Array CSS class names contained in those collections are always\n * added.\n * For argument of type Map CSS class name in the map's key is toggled based on the value (added\n * for truthy and removed for falsy).\n */\n _applyClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, true));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, !!rawClassVal[klass]));\n }\n }\n }\n /**\n * Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup\n * purposes.\n */\n _removeClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, false));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, false));\n }\n }\n }\n _toggleClass(klass, enabled) {\n klass = klass.trim();\n if (klass) {\n klass.split(/\\s+/g).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgClass, deps: [{ token: i0.IterableDiffers }, { token: i0.KeyValueDiffers }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgClass.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgClass, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{ selector: '[ngClass]' }]\n }], ctorParameters: function () { return [{ type: i0.IterableDiffers }, { type: i0.KeyValueDiffers }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModuleFactory`: Optional module factory to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized ngModuleFactory\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._componentRef = null;\n this._moduleRef = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n this._viewContainerRef.clear();\n this._componentRef = null;\n if (this.ngComponentOutlet) {\n const elInjector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (this.ngComponentOutletNgModuleFactory) {\n const parentModule = elInjector.get(NgModuleRef);\n this._moduleRef = this.ngComponentOutletNgModuleFactory.create(parentModule.injector);\n }\n else {\n this._moduleRef = null;\n }\n }\n const componentFactoryResolver = this._moduleRef ? this._moduleRef.componentFactoryResolver :\n elInjector.get(ComponentFactoryResolver);\n const componentFactory = componentFactoryResolver.resolveComponentFactory(this.ngComponentOutlet);\n this._componentRef = this._viewContainerRef.createComponent(componentFactory, this._viewContainerRef.length, elInjector, this.ngComponentOutletContent);\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgComponentOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgComponentOutlet, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{ selector: '[ngComponentOutlet]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `` element.\n *\n * ```\n * ...\n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n * ...\n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For futher discussion, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n * \n * {{i}}/{{users.length}}. {{user}} default\n * \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see `TrackByFunction`\n */\n set ngForTrackBy(fn) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') {\n // TODO(vicb): use a log service once there is a public one available\n if (console && console.warn) {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n throw new Error(`Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables such as Arrays.`);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\nNgForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgForOf, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{ selector: '[ngFor][ngForOf]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }]; }, propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n * Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n * Content to render when condition is\n * true.
\n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n * Content to render when condition is true.
\n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n * \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n * {{value}}
\n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n * \n * ...\n *
\n *\n * \n * Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n * \n * ...\n *
\n * \n *\n * \n * Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgIf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgIf, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{ selector: '[ngIf]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }]; }, propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(ngSrc, includeNgSrc = true) {\n const ngSrcInfo = includeNgSrc ? `(activated on an ![]()
element with the \\`ngSrc=\"${ngSrc}\"\\`) ` : '';\n return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? (new URL(url)).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken('ImageLoader', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`![]()
\\` tag with an invalid \\`ngSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`ngSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`ngSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ?\n [\n 'https://res.cloudinary.com/mysite', 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com'\n ] :\n undefined);\n// Exported for testing purposes in backport only. Not to be accessed except in unit tests.\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n let params = `f_auto,q_auto`; // sets image format and quality to \"auto\"\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n let params = `tr:q-auto`; // applies the \"auto quality\" transformation\n if (config.width) {\n params += `,w-${config.width}`;\n }\n return `${path}/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\n// Exported for testing purposes in backport only. Not to be accessed except in unit tests.\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n return url.href;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n constructor() {\n // Map of full image URLs -> original `ngSrc` values.\n this.images = new Map();\n // Keep track of images for which `console.warn` was produced.\n this.alreadyWarned = new Set();\n this.window = null;\n this.observer = null;\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (typeof win !== 'undefined' && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = lcpElement.element?.src ?? '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const imgNgSrc = this.images.get(imgSrc);\n if (imgNgSrc && !this.alreadyWarned.has(imgSrc)) {\n this.alreadyWarned.add(imgSrc);\n logMissingPriorityWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, originalNgSrc) {\n if (!this.observer)\n return;\n this.images.set(getUrl(rewrittenSrc, this.window).href, originalNgSrc);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n this.alreadyWarned.clear();\n }\n}\nLCPImageObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLCPImageObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\nfunction logMissingPriorityWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2955 /* LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken('PRECONNECT_CHECK_BLOCKLIST');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding `` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n constructor() {\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n this.preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n this.alreadySeen = new Set();\n this.window = null;\n this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n this.document = inject(DOCUMENT);\n assertDevMode('preconnect link checker');\n const win = this.document.defaultView;\n if (typeof win !== 'undefined') {\n this.window = win;\n }\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, InjectFlags.Optional);\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, origin => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n this.blocklist.add(extractHostname(origins));\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head for the\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param originalNgSrc ngSrc value\n */\n assertPreconnect(rewrittenSrc, originalNgSrc) {\n if (!this.window)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n if (!this.preconnectLinks) {\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks = this.queryPreconnectLinks();\n }\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this ` +\n `image. Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(this.document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n this.preconnectLinks?.clear();\n this.alreadySeen.clear();\n }\n}\nPreconnectLinkChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreconnectLinkChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * In SSR scenarios, a preload `` element is generated for priority images.\n * Having a large number of preload tags may negatively affect the performance,\n * so we warn developers (by throwing an error) if the number of preloaded images\n * is above a certain threshold. This const specifies this threshold.\n */\nconst DEFAULT_PRELOADED_IMAGES_LIMIT = 5;\n/**\n * Helps to keep track of priority images that already have a corresponding\n * preload tag (to avoid generating multiple preload tags with the same URL).\n *\n * This Set tracks the original src passed into the `ngSrc` input not the src after it has been\n * run through the specified `IMAGE_LOADER`.\n */\nconst PRELOADED_IMAGES = new InjectionToken('NG_OPTIMIZED_PRELOADED_IMAGES', { providedIn: 'root', factory: () => new Set() });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description Contains the logic needed to track and add preload link tags to the `` tag. It\n * will also track what images have already had preload link tags added so as to not duplicate link\n * tags.\n *\n * In dev mode this service will validate that the number of preloaded images does not exceed the\n * configured default preloaded images limit: {@link DEFAULT_PRELOADED_IMAGES_LIMIT}.\n */\nclass PreloadLinkCreator {\n constructor() {\n this.preloadedImages = inject(PRELOADED_IMAGES);\n this.document = inject(DOCUMENT);\n }\n /**\n * @description Add a preload `` to the `` of the `index.html` that is served from the\n * server while using Angular Universal and SSR to kick off image loads for high priority images.\n *\n * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)\n * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`\n * respectively, on the preload `` tag so that the correctly sized image is preloaded from\n * the CDN.\n *\n * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}\n *\n * @param renderer The `Renderer2` passed in from the directive\n * @param src The original src of the image that is set on the `ngSrc` input.\n * @param srcset The parsed and formatted srcset created from the `ngSrcset` input\n * @param sizes The value of the `sizes` attribute passed in to the `![]()
` tag\n */\n createPreloadLinkTag(renderer, src, srcset, sizes) {\n if (ngDevMode) {\n if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {\n throw new ɵRuntimeError(2961 /* TOO_MANY_PRELOADED_IMAGES */, ngDevMode &&\n `The \\`NgOptimizedImage\\` directive has detected that more than ` +\n `${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. ` +\n `This might negatively affect an overall performance of the page. ` +\n `To fix this, remove the \"priority\" attribute from images with less priority.`);\n }\n }\n if (this.preloadedImages.has(src)) {\n return;\n }\n this.preloadedImages.add(src);\n const preload = renderer.createElement('link');\n renderer.setAttribute(preload, 'as', 'image');\n renderer.setAttribute(preload, 'href', src);\n renderer.setAttribute(preload, 'rel', 'preload');\n renderer.setAttribute(preload, 'fetchpriority', 'high');\n if (sizes) {\n renderer.setAttribute(preload, 'imageSizes', sizes);\n }\n if (srcset) {\n renderer.setAttribute(preload, 'imageSrcset', srcset);\n }\n renderer.appendChild(this.document.head, preload);\n }\n}\nPreloadLinkCreator.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PreloadLinkCreator, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreloadLinkCreator.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PreloadLinkCreator, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PreloadLinkCreator, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used in generating automatic density-based srcsets\n */\nconst DENSITY_SRCSET_MULTIPLIERS = [1, 2];\n/**\n * Used to determine which breakpoints to use on full-width images\n */\nconst VIEWPORT_BREAKPOINT_CUTOFF = 640;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = .1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Used to limit automatic srcset generation of very large sources for\n * fixed-size images. In pixels.\n */\nconst FIXED_SRCSET_WIDTH_LIMIT = 1920;\nconst FIXED_SRCSET_HEIGHT_LIMIT = 1080;\n/** Info about built-in loaders we can test for. */\nconst BUILT_IN_LOADERS = [imgixLoaderInfo, imageKitLoaderInfo, cloudinaryLoaderInfo];\nconst defaultConfig = {\n breakpoints: [16, 32, 48, 64, 96, 128, 256, 384, 640, 750, 828, 1080, 1200, 1920, 2048, 3840],\n};\n/**\n * Injection token that configures the image optimized image functionality.\n *\n * @see `NgOptimizedImage`\n * @publicApi\n */\nconst IMAGE_CONFIG = new InjectionToken('ImageConfig', { providedIn: 'root', factory: () => defaultConfig });\n/**\n * @ngModule NgOptimizedImageModule\n *\n * @description\n *\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the `![]()
` tag\n * - Lazy loading non-priority images by default\n * - Asserting that there is a corresponding preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Automatically generates a srcset\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary `![]()
` tags in templates and replace `src` attributes with `ngSrc`.\n * Using a `ngSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```typescript\n * import { NgOptimizedImageModule } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImageModule],\n * })\n * class AppModule {}\n *\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `ngSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```typescript\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```typescript\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg}`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update `![]()
` tags in templates to use `ngSrc` instead of `src`.\n *\n * ```\n * ![]()
\n * ```\n *\n * @publicApi\n */\nclass NgOptimizedImage {\n constructor(imageLoader, config, renderer, elementRef, injector, platformId, preloadLinkChecker) {\n this.imageLoader = imageLoader;\n this.config = config;\n this.renderer = renderer;\n this.elementRef = elementRef;\n this.injector = injector;\n this.platformId = platformId;\n this.preloadLinkChecker = preloadLinkChecker;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n this._renderedSrc = null;\n this._priority = false;\n this._disableOptimizedSrcset = false;\n this._fill = false;\n this.config = processConfig(this.config);\n this.imgElement = this.elementRef.nativeElement;\n this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;\n }\n /**\n * For responsive images: the intrinsic width of the image in pixels.\n * For fixed size images: the desired rendered width of the image in pixels.\n */\n set width(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'width');\n this._width = inputToInteger(value);\n }\n get width() {\n return this._width;\n }\n /**\n * For responsive images: the intrinsic height of the image in pixels.\n * For fixed size images: the desired rendered height of the image in pixels.* The intrinsic\n * height of the image in pixels.\n */\n set height(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'height');\n this._height = inputToInteger(value);\n }\n get height() {\n return this._height;\n }\n /**\n * Indicates whether this image should have a high priority.\n */\n set priority(value) {\n this._priority = inputToBoolean(value);\n }\n get priority() {\n return this._priority;\n }\n /**\n * Disables automatic srcset generation for this image.\n */\n set disableOptimizedSrcset(value) {\n this._disableOptimizedSrcset = inputToBoolean(value);\n }\n get disableOptimizedSrcset() {\n return this._disableOptimizedSrcset;\n }\n /**\n * Sets the image to \"fill mode\", which eliminates the height/width requirement and adds\n * styles such that the image fills its containing element.\n */\n set fill(value) {\n this._fill = inputToBoolean(value);\n }\n get fill() {\n return this._fill;\n }\n /** @nodoc */\n ngOnInit() {\n if (ngDevMode) {\n assertNonEmptyInput(this, 'ngSrc', this.ngSrc);\n assertValidNgSrcset(this, this.ngSrcset);\n assertNoConflictingSrc(this);\n if (this.ngSrcset) {\n assertNoConflictingSrcset(this);\n }\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n if (this.fill) {\n assertEmptyWidthAndHeight(this);\n assertNonZeroRenderedHeight(this, this.imgElement, this.renderer);\n }\n else {\n assertNonEmptyWidthAndHeight(this);\n // Only check for distorted images when not in fill mode, where\n // images may be intentionally stretched, cropped or letterboxed.\n assertNoImageDistortion(this, this.imgElement, this.renderer);\n }\n assertValidLoadingInput(this);\n if (!this.ngSrcset) {\n assertNoComplexSizes(this);\n }\n assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);\n assertNoNgSrcsetWithoutLoader(this, this.imageLoader);\n assertNoLoaderParamsWithoutLoader(this, this.imageLoader);\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);\n }\n else {\n // Monitor whether an image is an LCP element only in case\n // the `priority` attribute is missing. Otherwise, an image\n // has the necessary settings and no extra checks are required.\n if (this.lcpObserver !== null) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc);\n });\n }\n }\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n if (this.fill) {\n if (!this.sizes) {\n this.sizes = '100vw';\n }\n this.renderer.setStyle(this.imgElement, 'position', 'absolute');\n this.renderer.setStyle(this.imgElement, 'width', '100%');\n this.renderer.setStyle(this.imgElement, 'height', '100%');\n this.renderer.setStyle(this.imgElement, 'inset', '0px');\n }\n else {\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n }\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `data-ng-img` attribute flags an image as using the directive, to allow\n // for analysis of the directive's performance.\n this.setHostAttribute('ng-img', 'true');\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n const rewrittenSrc = this.getRewrittenSrc();\n this.setHostAttribute('src', rewrittenSrc);\n let rewrittenSrcset = undefined;\n if (this.sizes) {\n this.setHostAttribute('sizes', this.sizes);\n }\n if (this.ngSrcset) {\n rewrittenSrcset = this.getRewrittenSrcset();\n }\n else if (this.shouldGenerateAutomaticSrcset()) {\n rewrittenSrcset = this.getAutomaticSrcset();\n }\n if (rewrittenSrcset) {\n this.setHostAttribute('srcset', rewrittenSrcset);\n }\n if (isPlatformServer(this.platformId) && this.priority) {\n this.preloadLinkChecker.createPreloadLinkTag(this.renderer, rewrittenSrc, rewrittenSrcset, this.sizes);\n }\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, [\n 'ngSrc',\n 'ngSrcset',\n 'width',\n 'height',\n 'priority',\n 'fill',\n 'loading',\n 'sizes',\n 'loaderParams',\n 'disableOptimizedSrcset',\n ]);\n }\n }\n callImageLoader(configWithoutCustomParams) {\n let augmentedConfig = configWithoutCustomParams;\n if (this.loaderParams) {\n augmentedConfig.loaderParams = this.loaderParams;\n }\n return this.imageLoader(augmentedConfig);\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.ngSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.callImageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);\n const finalSrcs = this.ngSrcset.split(',').filter(src => src !== '').map(srcStr => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.callImageLoader({ src: this.ngSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n getAutomaticSrcset() {\n if (this.sizes) {\n return this.getResponsiveSrcset();\n }\n else {\n return this.getFixedSrcset();\n }\n }\n getResponsiveSrcset() {\n const { breakpoints } = this.config;\n let filteredBreakpoints = breakpoints;\n if (this.sizes?.trim() === '100vw') {\n // Since this is a full-screen-width image, our srcset only needs to include\n // breakpoints with full viewport widths.\n filteredBreakpoints = breakpoints.filter(bp => bp >= VIEWPORT_BREAKPOINT_CUTOFF);\n }\n const finalSrcs = filteredBreakpoints.map(bp => `${this.callImageLoader({ src: this.ngSrc, width: bp })} ${bp}w`);\n return finalSrcs.join(', ');\n }\n getFixedSrcset() {\n const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map(multiplier => {\n const imgUrl = this.callImageLoader({ src: this.ngSrc, width: this.width * multiplier });\n return `${imgUrl} ${multiplier}x`;\n });\n return finalSrcs.join(', ');\n }\n shouldGenerateAutomaticSrcset() {\n return !this._disableOptimizedSrcset && !this.srcset && this.imageLoader !== noopImageLoader &&\n !(this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT);\n }\n /** @nodoc */\n ngOnDestroy() {\n if (ngDevMode) {\n if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n }\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n}\nNgOptimizedImage.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgOptimizedImage, deps: [{ token: IMAGE_LOADER }, { token: IMAGE_CONFIG }, { token: Renderer2 }, { token: ElementRef }, { token: Injector }, { token: PLATFORM_ID }, { token: PreloadLinkCreator }], target: i0.ɵɵFactoryTarget.Directive });\nNgOptimizedImage.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgOptimizedImage, selector: \"img[ngSrc]\", inputs: { ngSrc: \"ngSrc\", ngSrcset: \"ngSrcset\", sizes: \"sizes\", width: \"width\", height: \"height\", loading: \"loading\", priority: \"priority\", loaderParams: \"loaderParams\", disableOptimizedSrcset: \"disableOptimizedSrcset\", fill: \"fill\", src: \"src\", srcset: \"srcset\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{ selector: 'img[ngSrc]' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [IMAGE_LOADER]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [IMAGE_CONFIG]\n }] }, { type: i0.Renderer2, decorators: [{\n type: Inject,\n args: [Renderer2]\n }] }, { type: i0.ElementRef, decorators: [{\n type: Inject,\n args: [ElementRef]\n }] }, { type: i0.Injector, decorators: [{\n type: Inject,\n args: [Injector]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }, { type: PreloadLinkCreator, decorators: [{\n type: Inject,\n args: [PreloadLinkCreator]\n }] }]; }, propDecorators: { ngSrc: [{\n type: Input\n }], ngSrcset: [{\n type: Input\n }], sizes: [{\n type: Input\n }], width: [{\n type: Input\n }], height: [{\n type: Input\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input\n }], loaderParams: [{\n type: Input\n }], disableOptimizedSrcset: [{\n type: Input\n }], fill: [{\n type: Input\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Convert input value to integer.\n */\nfunction inputToInteger(value) {\n return typeof value === 'string' ? parseInt(value, 10) : value;\n}\n/**\n * Convert input value to boolean.\n */\nfunction inputToBoolean(value) {\n return value != null && `${value}` !== 'false';\n}\n/**\n * Sorts provided config breakpoints and uses defaults.\n */\nfunction processConfig(config) {\n let sortedBreakpoints = {};\n if (config.breakpoints) {\n sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);\n }\n return Object.assign({}, defaultConfig, config, sortedBreakpoints);\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`src\\` and \\`ngSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`ngSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`srcset\\` and \\`ngSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`ngSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('data:')) {\n if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`ngSrc\\` is a Base64-encoded string ` +\n `(${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the 'sizes' only includes responsive values.\n */\nfunction assertNoComplexSizes(dir) {\n let sizes = dir.sizes;\n if (sizes?.match(/((\\)|,)\\s|^)\\d+px/)) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`sizes\\` was set to a string including ` +\n `pixel values. For automatic \\`srcset\\` generation, \\`sizes\\` must only include responsive ` +\n `values, such as \\`sizes=\"50vw\"\\` or \\`sizes=\"(min-width: 768px) 50vw, 100vw\"\\`. ` +\n `To fix this, modify the \\`sizes\\` attribute, or provide your own \\`ngSrcset\\` value directly.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrc\\` was set to a blob URL (${ngSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `ngSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidNgSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'ngSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`ngSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value.split(',').every(num => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n let reason;\n if (inputName === 'width' || inputName === 'height') {\n reason = `Changing \\`${inputName}\\` may result in different attribute value ` +\n `applied to the underlying image element and cause layout shifts on a page.`;\n }\n else {\n reason = `Changing the \\`${inputName}\\` would have no effect on the underlying ` +\n `image element, because the resource loading has already occurred.`;\n }\n return new ɵRuntimeError(2953 /* UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ${reason} ` +\n `To fix this, either switch \\`${inputName}\\` to a static value ` +\n `or wrap the image element in an *ngIf that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach(input => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'ngSrc') {\n // When the `ngSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `ngSrc` is already set. We use\n // `ngSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { ngSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` has an invalid value ` +\n `(\\`${inputValue}\\`). To fix this, provide \\`${inputName}\\` ` +\n `as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const renderedWidth = img.clientWidth;\n const renderedHeight = img.clientHeight;\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = img.naturalWidth;\n const intrinsicHeight = img.naturalHeight;\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nSupplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${suppliedAspectRatio}). ` +\n `\\nTo fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nRendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${renderedAspectRatio}). \\nThis issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.ngSrcset && nonZeroRenderedDimensions) {\n // If `ngSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = (intrinsicWidth - recommendedWidth) >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = (intrinsicHeight - recommendedHeight) >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"ngSrcset\" and \"sizes\" attributes.`));\n }\n }\n });\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.ngSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map(attr => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag or turn on ` +\n `\"fill\" mode with the \\`fill\\` attribute.`);\n }\n}\n/**\n * Verifies that width and height are not set. Used in fill mode, where those attributes don't make\n * sense.\n */\nfunction assertEmptyWidthAndHeight(dir) {\n if (dir.width || dir.height) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the attributes \\`height\\` and/or \\`width\\` are present ` +\n `along with the \\`fill\\` attribute. Because \\`fill\\` mode causes an image to fill its containing ` +\n `element, the size attributes have no effect and should be removed.`);\n }\n}\n/**\n * Verifies that the rendered image has a nonzero height. If the image is in fill mode, provides\n * guidance that this can be caused by the containing element's CSS position property.\n */\nfunction assertNonZeroRenderedHeight(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const renderedHeight = img.clientHeight;\n if (dir.fill && renderedHeight === 0) {\n console.warn(ɵformatRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. ` +\n `This is likely because the containing element does not have the CSS 'position' ` +\n `property set to one of the following: \"relative\", \"fixed\", or \"absolute\". ` +\n `To fix this problem, make sure the container element has the CSS 'position' ` +\n `property defined and the height of the element is not zero.`));\n }\n });\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n/**\n * Warns if NOT using a loader (falling back to the generic loader) and\n * the image appears to be hosted on one of the image CDNs for which\n * we do have a built-in image loader. Suggests switching to the\n * built-in loader.\n *\n * @param ngSrc Value of the ngSrc attribute\n * @param imageLoader ImageLoader provided\n */\nfunction assertNotMissingBuiltInLoader(ngSrc, imageLoader) {\n if (imageLoader === noopImageLoader) {\n let builtInLoaderName = '';\n for (const loader of BUILT_IN_LOADERS) {\n if (loader.testUrl(ngSrc)) {\n builtInLoaderName = loader.name;\n break;\n }\n }\n if (builtInLoaderName) {\n console.warn(ɵformatRuntimeError(2962 /* MISSING_BUILTIN_LOADER */, `NgOptimizedImage: It looks like your images may be hosted on the ` +\n `${builtInLoaderName} CDN, but your app is not using Angular's ` +\n `built-in loader for that CDN. We recommend switching to use ` +\n `the built-in by calling \\`provide${builtInLoaderName}Loader()\\` ` +\n `in your \\`providers\\` and passing it your instance's base URL. ` +\n `If you don't want to use the built-in loader, define a custom ` +\n `loader function using IMAGE_LOADER to silence this warning.`));\n }\n }\n}\n/**\n * Warns if ngSrcset is present and no loader is configured (i.e. the default one is being used).\n */\nfunction assertNoNgSrcsetWithoutLoader(dir, imageLoader) {\n if (dir.ngSrcset && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for all configured sizes. ` +\n `To fix this, provide a loader or remove the \\`ngSrcset\\` attribute from the image.`));\n }\n}\n/**\n * Warns if loaderParams is present and no loader is configured (i.e. the default one is being\n * used).\n */\nfunction assertNoLoaderParamsWithoutLoader(dir, imageLoader) {\n if (dir.loaderParams && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loaderParams\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which means that the loaderParams data will not be consumed and will not affect the URL. ` +\n `To fix this, provide a custom loader or remove the \\`loaderParams\\` attribute from the image.`));\n }\n}\n/**\n * This NgModule exports the `NgOptimizedImage` directive.\n * Import this module to enable the optimized image directive in your application.\n *\n * @publicApi\n * @deprecated In Angular v15, this NgModule is removed in favor of the NgOptimizedImage directive,\n * which is annotated as standalone.\n */\nclass NgOptimizedImageModule {\n}\nNgOptimizedImageModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgOptimizedImageModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nNgOptimizedImageModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgOptimizedImageModule, declarations: [NgOptimizedImage], exports: [NgOptimizedImage] });\nNgOptimizedImageModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgOptimizedImageModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgOptimizedImageModule, decorators: [{\n type: NgModule,\n args: [{\n declarations: [NgOptimizedImage],\n exports: [NgOptimizedImage],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n if (!this._defaultViews) {\n this._defaultViews = [];\n }\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (let i = 0; i < this._defaultViews.length; i++) {\n const defaultView = this._defaultViews[i];\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitch.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgSwitch, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{ selector: '[ngSwitch]' }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgSwitchCase, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{ selector: '[ngSwitchCase]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; }, propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchDefault.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgSwitchDefault, selector: \"[ngSwitchDefault]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{ selector: '[ngSwitchDefault]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; } });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._switchValue = value;\n this._updateView();\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView() {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(this._switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\nNgPlural.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgPlural, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{ selector: '[ngPlural]' }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; }, propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgPluralCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgPluralCase, selector: \"[ngPluralCase]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{ selector: '[ngPluralCase]' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n value = value != null && unit ? `${value}${unit}` : value;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, value);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgStyle.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgStyle, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{ selector: '[ngStyle]' }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }]; }, propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n this._viewRef = this.ngTemplateOutlet ?\n viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, this.ngTemplateOutletContext) :\n null;\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n}\nNgTemplateOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgTemplateOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.4.0\", type: NgTemplateOutlet, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{ selector: '[ngTemplateOutlet]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction invalidPipeArgumentError(type, value) {\n const errorMessage = (typeof ngDevMode === 'undefined' || ngDevMode) ?\n `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'` :\n '';\n return new ɵRuntimeError(2100 /* INVALID_PIPE_ARGUMENT */, errorMessage);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n onDestroy(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n onDestroy(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(_ref) {\n this._ref = _ref;\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe });\nAsyncPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: AsyncPipe, name: \"async\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'async', pure: false }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nLowerCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LowerCasePipe, name: \"lowercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'lowercase' }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.substr(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nTitleCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: TitleCasePipe, name: \"titlecase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'titlecase' }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nUpperCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: UpperCasePipe, name: \"uppercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'uppercase' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken('DATE_PIPE_DEFAULT_TIMEZONE');\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n-common-format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_TIMEZONE`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
\n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n-common-locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nDecimalPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: DecimalPipe, name: \"number\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'number' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nPercentPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PercentPipe, name: \"percent\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'percent' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n * {@a currency-code-deprecation}\n * \n *\n * **Deprecation notice:**\n *\n * The default currency code is currently always `USD` but this is deprecated from v9.\n *\n * **In v11 the default currency code will be taken from the current locale identified by\n * the `LOCALE_ID` token. See the [i18n guide](guide/i18n-common-locale-id) for\n * more information.**\n *\n * If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in\n * your application `NgModule`:\n *\n * ```ts\n * {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'}\n * ```\n *\n *
\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\nCurrencyPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: CurrencyPipe, name: \"currency\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'currency' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }]; } });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n * b\n * c\n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nSlicePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: SlicePipe, name: \"slice\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'slice', pure: false }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * * The `providers` options configure the NgModule's injector to provide\n * localization dependencies to members.\n * * The `exports` options make the declared directives and pipes available for import\n * by other NgModules.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: CommonModule, declarations: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\nCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: CommonModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n declarations: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('13.4.0');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n (document.body.createShadowRoot || document.body.attachShadow)) {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\n// Exported for testing purposes in backport only. Not to be accessed except in unit tests.\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_CONFIG, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgOptimizedImageModule, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, registerLocaleData, BrowserPlatformLocation as ɵBrowserPlatformLocation, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v13.4.0\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, ɵparseCookieValue, XhrFactory as XhrFactory$1 } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, Inject, PLATFORM_ID, NgModule } from '@angular/core';\nimport { of, Observable } from 'rxjs';\nimport { concatMap, filter, map } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach(line => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else {\n this.lazyInit = () => {\n this.headers = new Map();\n Object.keys(headers).forEach(name => {\n let values = headers[name];\n const key = name.toLowerCase();\n if (typeof values === 'string') {\n values = [values];\n }\n if (values.length > 0) {\n this.headers.set(key, values);\n this.maybeSetNormalizedName(name, key);\n }\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or overide for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach(update => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach(key => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit =\n (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter(value => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys())\n .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1 ?\n [codec.decodeKey(param), ''] :\n [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\n/**\n * Encode input string with standard encodeURIComponent and then un-encode specific characters.\n */\nconst STANDARD_ENCODING_REGEX = /%(\\d[a-f0-9])/gi;\nconst STANDARD_ENCODING_REPLACEMENTS = {\n '40': '@',\n '3A': ':',\n '24': '$',\n '2C': ',',\n '3B': ';',\n '2B': '+',\n '3D': '=',\n '3F': '?',\n '2F': '/',\n};\nfunction standardEncoding(v) {\n return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => STANDARD_ENCODING_REPLACEMENTS[t] ?? s);\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach(key => {\n const value = options.fromObject[key];\n this.map.set(key, Array.isArray(value) ? value : [value]);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach(param => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach(_value => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return this.keys()\n .map(key => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter(param => param !== '')\n .join('&');\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach(update => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = (third !== undefined) ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n if (!this.headers) {\n this.headers = new HttpHeaders();\n }\n // If no context have been passed in, construct a new HttpContext instance.\n if (!this.context) {\n this.context = new HttpContext();\n }\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||\n isUrlSearchParams(this.body) || typeof this.body === 'string') {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' || typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' || typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = (update.body !== undefined) ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;\n const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = update.context ?? this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers =\n Object.keys(update.setHeaders)\n .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams)\n .reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n });\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200 /* Ok */, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: (update.body !== undefined) ? update.body : this.body,\n headers: update.headers || this.headers,\n status: (update.status !== undefined) ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n *\n * @usageNotes\n * Sample HTTP requests for the [Tour of Heroes](/tutorial/toh-pt0) application.\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n}\nHttpClient.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpClient.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: HttpClient });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpHandler }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * `HttpHandler` which applies an `HttpInterceptor` to an `HttpRequest`.\n *\n *\n */\nclass HttpInterceptorHandler {\n constructor(next, interceptor) {\n this.next = next;\n this.interceptor = interceptor;\n }\n handle(req) {\n return this.interceptor.intercept(req, this.next);\n }\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken('HTTP_INTERCEPTORS');\nclass NoopInterceptor {\n intercept(req, next) {\n return next.handle(req);\n }\n}\nNoopInterceptor.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NoopInterceptor, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNoopInterceptor.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NoopInterceptor });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.4.0\", ngImport: i0, type: NoopInterceptor, decorators: [{\n type: Injectable\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n/**\n * When a pending